From c35713f87071fcdba99938e85397f7e96015bae0 Mon Sep 17 00:00:00 2001 From: Erik Date: Mon, 9 Apr 2012 11:46:50 -0400 Subject: [PATCH] Reorganized the repo. Now have Wordpress and Static site. STarted static site cleanup. --- Static HTML/css/application.css | 573 + Static HTML/css/base.css | 5356 ++++++++ Static HTML/index.html | 145 + 404.php => Wordpress/404.php | 94 +- .../BrowserDetect.js | 252 +- README => Wordpress/README | 8 +- application.js => Wordpress/application.js | 52 +- archive.php => Wordpress/archive.php | 142 +- author.php => Wordpress/author.php | 176 +- category.php => Wordpress/category.php | 128 +- {colors => Wordpress/colors}/dark.css | 1244 +- comments.php => Wordpress/comments.php | 154 +- .../content-aside.php | 80 +- .../content-featured.php | 94 +- .../content-gallery.php | 184 +- .../content-image.php | 128 +- .../content-intro.php | 42 +- .../content-link.php | 82 +- .../content-page.php | 46 +- .../content-quote.php | 138 +- .../content-single.php | 142 +- .../content-status.php | 84 +- content.php => Wordpress/content.php | 154 +- .../editor-style-rtl.css | 46 +- .../editor-style.css | 620 +- footer.php => Wordpress/footer.php | 54 +- functions.php => Wordpress/functions.php | 1192 +- header.php => Wordpress/header.php | 240 +- image.php => Wordpress/image.php | 206 +- {images => Wordpress/images}/Thumbs.db | Bin .../comment-arrow-bypostauthor-dark-rtl.png | Bin .../comment-arrow-bypostauthor-dark.png | Bin .../comment-arrow-bypostauthor-rtl.png | Bin .../images}/comment-arrow-bypostauthor.png | Bin .../images}/comment-arrow-dark-rtl.png | Bin .../images}/comment-arrow-dark.png | Bin .../images}/comment-arrow-rtl.png | Bin .../images}/comment-arrow.png | Bin .../images}/comment-bubble-dark-rtl.png | Bin .../images}/comment-bubble-dark.png | Bin .../images}/comment-bubble-rtl.png | Bin .../images}/comment-bubble.png | Bin {images => Wordpress/images}/search.png | Bin {images => Wordpress/images}/wordpress.png | Bin .../inc}/images/content-sidebar.png | Bin {inc => Wordpress/inc}/images/content.png | Bin {inc => Wordpress/inc}/images/dark.png | Bin {inc => Wordpress/inc}/images/light.png | Bin .../inc}/images/sidebar-content.png | Bin {inc => Wordpress/inc}/theme-options.css | 70 +- {inc => Wordpress/inc}/theme-options.js | 102 +- {inc => Wordpress/inc}/theme-options.php | 896 +- {inc => Wordpress/inc}/widgets.php | 326 +- index.php => Wordpress/index.php | 102 +- .../images/ui-bg_flat_0_aaaaaa_40x100.png | Bin .../images/ui-bg_glass_55_fbf9ee_1x400.png | Bin .../images/ui-bg_glass_65_ffffff_1x400.png | Bin .../images/ui-bg_glass_75_dadada_1x400.png | Bin .../images/ui-bg_glass_75_e6e6e6_1x400.png | Bin .../images/ui-bg_glass_75_ffffff_1x400.png | Bin .../ui-bg_highlight-soft_75_cccccc_1x100.png | Bin .../ui-bg_inset-soft_95_fef1ec_1x100.png | Bin .../jqui}/images/ui-icons_222222_256x240.png | Bin .../jqui}/images/ui-icons_2e83ff_256x240.png | Bin .../jqui}/images/ui-icons_454545_256x240.png | Bin .../jqui}/images/ui-icons_888888_256x240.png | Bin .../jqui}/images/ui-icons_cd0a0a_256x240.png | Bin .../jqui}/images/ui-icons_f6cf3b_256x240.png | Bin .../jqui}/jquery-ui-1.8.16.custom.css | 2640 ++-- .../jqui}/jquery.ui.1.8.16.ie.css | 12 +- {js => Wordpress/js}/html5.js | 4 +- {js => Wordpress/js}/jquery-1.6.2.min.js | 34 +- .../js}/jquery-ui-1.8.16.custom.min.js | 1580 +-- {js => Wordpress/js}/showcase.js | 32 +- .../languages}/twentyeleven.pot | 1314 +- license.txt => Wordpress/license.txt | 562 +- mainpage.php => Wordpress/mainpage.php | 38 +- page.php => Wordpress/page.php | 60 +- rtl.css => Wordpress/rtl.css | 1166 +- screenshot.png => Wordpress/screenshot.png | Bin search.php => Wordpress/search.php | 112 +- searchform.php => Wordpress/searchform.php | 28 +- showcase.php => Wordpress/showcase.php | 442 +- .../sidebar-footer.php | 82 +- .../sidebar-page.php | 54 +- sidebar.php => Wordpress/sidebar.php | 70 +- single.php => Wordpress/single.php | 62 +- style.css => Wordpress/style.css | 1088 +- tag.php => Wordpress/tag.php | 130 +- .../twentyeleven.css | 10710 ++++++++-------- 90 files changed, 19823 insertions(+), 13749 deletions(-) create mode 100644 Static HTML/css/application.css create mode 100644 Static HTML/css/base.css create mode 100644 Static HTML/index.html rename 404.php => Wordpress/404.php (95%) rename BrowserDetect.js => Wordpress/BrowserDetect.js (94%) rename README => Wordpress/README (79%) rename application.js => Wordpress/application.js (96%) rename archive.php => Wordpress/archive.php (96%) rename author.php => Wordpress/author.php (96%) rename category.php => Wordpress/category.php (96%) rename {colors => Wordpress/colors}/dark.css (95%) rename comments.php => Wordpress/comments.php (97%) rename content-aside.php => Wordpress/content-aside.php (97%) rename content-featured.php => Wordpress/content-featured.php (97%) rename content-gallery.php => Wordpress/content-gallery.php (97%) rename content-image.php => Wordpress/content-image.php (97%) rename content-intro.php => Wordpress/content-intro.php (97%) rename content-link.php => Wordpress/content-link.php (97%) rename content-page.php => Wordpress/content-page.php (97%) rename content-quote.php => Wordpress/content-quote.php (97%) rename content-single.php => Wordpress/content-single.php (97%) rename content-status.php => Wordpress/content-status.php (97%) rename content.php => Wordpress/content.php (97%) rename editor-style-rtl.css => Wordpress/editor-style-rtl.css (92%) rename editor-style.css => Wordpress/editor-style.css (94%) rename footer.php => Wordpress/footer.php (90%) rename functions.php => Wordpress/functions.php (97%) rename header.php => Wordpress/header.php (97%) rename image.php => Wordpress/image.php (97%) rename {images => Wordpress/images}/Thumbs.db (100%) rename {images => Wordpress/images}/comment-arrow-bypostauthor-dark-rtl.png (100%) rename {images => Wordpress/images}/comment-arrow-bypostauthor-dark.png (100%) rename {images => Wordpress/images}/comment-arrow-bypostauthor-rtl.png (100%) rename {images => Wordpress/images}/comment-arrow-bypostauthor.png (100%) rename {images => Wordpress/images}/comment-arrow-dark-rtl.png (100%) rename {images => Wordpress/images}/comment-arrow-dark.png (100%) rename {images => Wordpress/images}/comment-arrow-rtl.png (100%) rename {images => Wordpress/images}/comment-arrow.png (100%) rename {images => Wordpress/images}/comment-bubble-dark-rtl.png (100%) rename {images => Wordpress/images}/comment-bubble-dark.png (100%) rename {images => Wordpress/images}/comment-bubble-rtl.png (100%) rename {images => Wordpress/images}/comment-bubble.png (100%) rename {images => Wordpress/images}/search.png (100%) rename {images => Wordpress/images}/wordpress.png (100%) rename {inc => Wordpress/inc}/images/content-sidebar.png (100%) rename {inc => Wordpress/inc}/images/content.png (100%) rename {inc => Wordpress/inc}/images/dark.png (100%) rename {inc => Wordpress/inc}/images/light.png (100%) rename {inc => Wordpress/inc}/images/sidebar-content.png (100%) rename {inc => Wordpress/inc}/theme-options.css (94%) rename {inc => Wordpress/inc}/theme-options.js (95%) rename {inc => Wordpress/inc}/theme-options.php (97%) rename {inc => Wordpress/inc}/widgets.php (97%) rename index.php => Wordpress/index.php (95%) rename {jqui => Wordpress/jqui}/images/ui-bg_flat_0_aaaaaa_40x100.png (100%) rename {jqui => Wordpress/jqui}/images/ui-bg_glass_55_fbf9ee_1x400.png (100%) rename {jqui => Wordpress/jqui}/images/ui-bg_glass_65_ffffff_1x400.png (100%) rename {jqui => Wordpress/jqui}/images/ui-bg_glass_75_dadada_1x400.png (100%) rename {jqui => Wordpress/jqui}/images/ui-bg_glass_75_e6e6e6_1x400.png (100%) rename {jqui => Wordpress/jqui}/images/ui-bg_glass_75_ffffff_1x400.png (100%) rename {jqui => Wordpress/jqui}/images/ui-bg_highlight-soft_75_cccccc_1x100.png (100%) rename {jqui => Wordpress/jqui}/images/ui-bg_inset-soft_95_fef1ec_1x100.png (100%) rename {jqui => Wordpress/jqui}/images/ui-icons_222222_256x240.png (100%) rename {jqui => Wordpress/jqui}/images/ui-icons_2e83ff_256x240.png (100%) rename {jqui => Wordpress/jqui}/images/ui-icons_454545_256x240.png (100%) rename {jqui => Wordpress/jqui}/images/ui-icons_888888_256x240.png (100%) rename {jqui => Wordpress/jqui}/images/ui-icons_cd0a0a_256x240.png (100%) rename {jqui => Wordpress/jqui}/images/ui-icons_f6cf3b_256x240.png (100%) rename {jqui => Wordpress/jqui}/jquery-ui-1.8.16.custom.css (97%) rename {jqui => Wordpress/jqui}/jquery.ui.1.8.16.ie.css (98%) rename {js => Wordpress/js}/html5.js (98%) rename {js => Wordpress/js}/jquery-1.6.2.min.js (99%) rename {js => Wordpress/js}/jquery-ui-1.8.16.custom.min.js (99%) rename {js => Wordpress/js}/showcase.js (94%) rename {languages => Wordpress/languages}/twentyeleven.pot (96%) rename license.txt => Wordpress/license.txt (98%) rename mainpage.php => Wordpress/mainpage.php (92%) rename page.php => Wordpress/page.php (92%) rename rtl.css => Wordpress/rtl.css (94%) rename screenshot.png => Wordpress/screenshot.png (100%) rename search.php => Wordpress/search.php (95%) rename searchform.php => Wordpress/searchform.php (97%) rename showcase.php => Wordpress/showcase.php (96%) rename sidebar-footer.php => Wordpress/sidebar-footer.php (94%) rename sidebar-page.php => Wordpress/sidebar-page.php (91%) rename sidebar.php => Wordpress/sidebar.php (94%) rename single.php => Wordpress/single.php (94%) rename style.css => Wordpress/style.css (94%) rename tag.php => Wordpress/tag.php (96%) rename twentyeleven.css => Wordpress/twentyeleven.css (95%) diff --git a/Static HTML/css/application.css b/Static HTML/css/application.css new file mode 100644 index 0000000..7a418d8 --- /dev/null +++ b/Static HTML/css/application.css @@ -0,0 +1,573 @@ +/* +Theme Name: HuskyPress +Theme URI: uconn.edu +Description: Wordpress theme in the style of UConn.edu. Built off of the wordpress theme "TwentyEleven." +Author: Dave Hicking and Erik Reynolds +Author URI: http://lib.uconn.edu +Template: huskypress +Version: 1.0 +*/ +@import url("base.css"); + +/*Home Page */ +.downtime-alert { + position: absolute; + top: 0; + left: 0; + width: 100%; + height: 2em; + background: #ff4040; + z-index: 99999; + text-align: center; + color: #fff; + font-weight: bold; + padding-top: 0.5em; + +} + +#page { margin-top: 1em; } +#hero { + background: #3182c3; /* Old browsers */ + background: -moz-linear-gradient(top, #3182c3 0%, #003093 100%); /* FF3.6+ */ + background: -webkit-gradient(linear, left top, left bottom, color-stop(0%,#3182c3), color-stop(100%,#003093)); /* Chrome,Safari4+ */ + background: -webkit-linear-gradient(top, #3182c3 0%,#003093 100%); /* Chrome10+,Safari5.1+ */ + background: -o-linear-gradient(top, #3182c3 0%,#003093 100%); /* Opera 11.10+ */ + background: -ms-linear-gradient(top, #3182c3 0%,#003093 100%); /* IE10+ */ + background: linear-gradient(top, #3182c3 0%,#003093 100%); /* W3C */ + -ms-filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#3182c3', endColorstr='#003093', GradientType=0 ); /* IE6-9 */ + border: #3182c3; +} + +.top { + min-height:260px; +} + +.top.herohelp { + min-height: 310px; +} + +.bottom { + min-height:150px; + background: initial; + color: black; +} + +.second { + padding: 1em 2em 1em 2em; + background: white; + min-height: 200px; +} + +.second-help { min-height: 400px; } + +#hero, .second { + color: white; + /*font-family: 'Myriad Pro', 'Helvetica Neue', Arial, sans-serif; */ + /*font-family: 'Myriad Pro', Lucida Grande, Arial, sans-serif;*/ + font-family: 'Myriad Pro', Tahoma, Geneva, sans-serif; +} + +#hero .top { + padding: 3em 2em 2em 2em; +} + +#hero h2, .second h2 { + font-size: 2.5em; + margin-top: 1%; + line-height: 1.5em; +} + +#hero h3, .second h3 { + font-size: 1.6em; + line-height: 1.5em; + margin-right: 1em; + margin-top: 1em; +} + +#hero h4, .second h4 { + font-size: 1.4em; + line-height: 1.5em; + margin-right: 1em; + margin-top: 1em; +} + +#hero .left, .second .left { + width: 50%; + margin-left: 0em; + padding-right: 2em; +} + +#hero .right, .second .right { + width: 40%; + margin-right: 1em; +} + +.second .left { + border-right: 1px solid #cdcdcd; + padding-right: 2em; +} + +.second p { margin-top: 5px; } + +p.help { +font-size: 1.5em; +} + +#hero .top a, #hero .top a:visited, #hero .top a:hover { + color: #ffffff; +} + +.heroButton { + width: 100%; + padding: 10px; + border: #CCC solid 2px; + border-radius: 15px; + box-shadow: rgba(0, 0, 0, 0.2) 0px 1px 2px; +} + +.heroButton:first { margin-top: 1em; } + +#other_clients { + margin-top: 0px; + +} + +.divider { height: 1em; width 100%; display: block; } + +.left { float:left; } +.right { float:right; } +.clear { clear: both; } + +p { +margin-bottom: 0em; +} + +#catchphrase { + margin-top: 5em; + font-size: 1.6em; + font-style: italic; +} + +.ui-accordion-header { +font-size: 1.4em; +} + +.ui-accordion-content ul { +font-family: 'Myriad Pro', Tahoma, Geneva, sans-serif; +font-size: 1.3em; +-webkit-column-count: 2; + +} + + +/*End Home Page */ + +html { +margin-top: none; +} + +#page { +background: none; +min-width: 480px; +} + +h1, h2 { +font-family: 'Myriad Pro', Tahoma, Geneva, sans-serif; +} + +h2 { + font-size: 1.8em; +} + +body, input, textarea { +font: 15px Helvetica, sans-serif; +line-height: 1.625em; +} + +.headline { +font-family: 'Myriad Pro', Tahoma, Geneva, sans-serif; +font-size: 1.3em; +} + +input[type=text] { + padding: 0px; + height: 25px; +} + +body { +background: #CCCCCC; +} + +#branding { +border-top: none; +background-image: url(http://web2.uconn.edu/webtools/global/4.0/head-foot/images/hd-blue.png); +background-repeat: repeat-x; +box-shadow: rgba(0, 0, 0, 0.4) 0px 1px 2px; +border-radius: 7px 7px 0px 0px; +} + +#branding .with-image #searchform { +max-width: 200px; +} + +#branding .only-search + #access div { +padding-right:0px; +} + +.cufon-active h1 { /* for Cufon.replace('h1') */ + font-size: 2em; +} + +.entry-title a { +font-size: 26px; +} + +#uc-website-title { +margin-left: 15px; +} + +#uc-website-title a{ +color:white; +position: relative; +top: -25px; +} + +#branding img { +width:auto; +margin-left: 10px +} + +#branding .only-search #searchform { +top: 0em; +right: 1em; +color: white; +} + +#searchform li { +float: left; +list-style: none; +font-size: .7em; +} + +#searchform #sa { +margin:0; +} + +#access { +background: #E2E2E2; +margin: auto; +} + +#access a { +font: bold 1em Helvetica, sans-serif; +color: black; +padding: 1em 17px .8em 17px; +} + +#access ul ul { +top: 3.0em; +z-index: 1000; +} + +#access div { +margin: 0 1.6em; +} + +#main { +clear: none; +padding: 0; +} + +ul, ol { +margin: 1em 0 1.625em 2.5em; +} + +#primary { +background: white; +padding: 0; +box-shadow: rgba(0, 0, 0, 0.4) 0px 1px 2px; +} + +.page-title.author { +font-size: inherit; +} + +.singular .entry-header .entry-meta { +left: inherit; +} + +.singular.page .hentry { + padding: 0 0 0; +} + +.singular .hentry { +padding: 3em 0 0; +} + +.singular #content, +.left-sidebar.singular #content { + margin: 1em; +} + +.singular .entry-header, .singular .entry-content, .singular footer.entry-meta, .singular #comments-title { +width: 85%; +} + +#content nav{ +padding: 0 2em 0 0; +} + +#nav-single .nav-previous, #nav-single .nav-next { +float: left; +} + +#secondary { +padding-top: 1.8em; +background: white; +} + +#page { +margin: 1em auto; +max-width: 950px; +} + +#colophon { +box-shadow: rgba(0, 0, 0, 0.4) 0px 1px 2px; +border-radius: 0px 0px 7px 7px; +background: #003093; /* Old browsers */ +background: -moz-linear-gradient(top, #003093 0%, #00165f 100%); /* FF3.6+ */ +background: -webkit-gradient(linear, left top, left bottom, color-stop(0%,#003093), color-stop(100%,#00165f)); /* Chrome,Safari4+ */ +background: -webkit-linear-gradient(top, #003093 0%,#00165f 100%); /* Chrome10+,Safari5.1+ */ +background: -o-linear-gradient(top, #003093 0%,#00165f 100%); /* Opera 11.10+ */ +background: -ms-linear-gradient(top, #003093 0%,#00165f 100%); /* IE10+ */ +background: linear-gradient(top, #003093 0%,#00165f 100%); /* W3C */ +filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#003093', endColorstr='#00165f',GradientType=0 ); /* IE6-9 */ +} + +#colophon a { +color: white; +} + +#content { + margin: 0 15% 0 10%; + width: 75%; +} + +.widget-area { +text-align: center; +} + +.widget-area ul { + list-style-type: none; +} + +#secondary { + width: 15%; + margin-right: 1.8em; +} + +#supplementary { +padding: 1.5em 7.6%; +} + +#tabs-1 div { text-align: center; margin-top: 2em; } + +div.step { + margin-top: 1.5em; +} + +div.step p { margin-bottom: 0.5em; } + +div.step img { margin: 0.5em auto; } + +div.featurebox { + float: left; + width: 96%; + border: 1px solid #f4f4f4; + height: 150px; + margin: 2%; +} + +.featurebox div { padding: 1em; } +.featurebox h2 { + display: block; + text-align: center; + padding: 0.5em; + background-color: #3f3f4d; +} + +.featurebox h2 a, .featurebox h2 a:visited { color: #ffffff; } +/* =Responsive Structure for narrow screens +* to keep min width and sidebar +-------------------------------------------- */ +@media (max-width: 850px){ + +.second { +min-height: 250px; +} + +} + +@media (max-width: 800px) { + # +/* keep the sidebar - for right sidebar */ + .right-sidebar #main #content { + margin: 0 29% 0 1%; + width: 70%; + } + .right-sidebar #main #secondary { + float: right; + margin: 0 1% 0 1%; + width: 24%; + } +/* keep the sidebar - for left sidebar */ + .left-sidebar #main #content { + margin: 0 1% 0 29%; + width: 60%; + } + .left-sidebar #main #secondary { + float: right; + margin: 0 -1% 0 2%; + width: 24%; + } +/* correction for 'showcase' template */ + .page-template-showcase-php #main #primary.showcase { + float: right; + margin: 0 2% 0 2%; + width: 96%; + } + .page-template-showcase-php #main #primary.showcase #content { + margin: 0 6% 0 6%; + width: 88%; + } + .page-template-showcase-php section.recent-posts { + float: right; + margin-right: 0pt; + margin-left: 31%; + width: 69%; + } + .page-template-showcase-php #main .widget-area { + float: left; + margin-right: -22.15%; + margin-left: 0pt; + width: 22.15%; + } + + #main #content { + width:60%; + } +/* correction for singular posts/pages without sidebar */ + .singular #main #content { + margin: 0 8% 0 8%; + width: 84%; + } +/* keep floating footer widgets side-by-side at this size */ + #colophon #supplementary .widget-area { + float: left; + margin-right: 1%; + width: 32%; + } + +.second { +min-height: 300px; +} + +} + +@media (max-width: 750px) { + +#main #secondary { +margin: auto; +} + +.entry-header .comments-link a { +display:none; +} + +#main #secondary ul { +list-style: none; +} + +#main #secondary .widget { +margin: auto; +} + +} + +@media (max-width: 680px) { + +#page { +margin: 0; +} +#branding { +border-radius: 0px; +} + +#hero .right { +margin-left: 0em; +margin-right: 0em; +} + +#hero .left, +#hero .right, +{ +width: 100% +} + +#hero .left, .second .left{ +width: 100%; +margin-left: 0; +padding-right: 0; +border-right: 0px; +padding-bottom: 1em; +} + +#hero .right, .second .right { +width: 100%; +} + +.top { +padding: 30px 30px 30px 30px; +} + +.second { +padding: 30px 30px 30px 30px; +} + +#view_client { +width: 90%; +box-shadow:rgba(0, 0, 0, 0) 0px 1px 2px; +} + +#other_clients a img { + box-shadow: rgba(0, 0, 0, 0) 0px 1px 2px; + width: 90%; + } +.heroButton { + box-shadow: rgba(0, 0, 0, 0) 0px 1px 2px; + width: 90%; +} +.right{ +float: none; +} + +.bottom.right{ +padding-top:10px; +} + +#branding #searchform { +display:none; +} + + + + +#supplementary { +padding: none; +} + +#colophon { +border-radius: 0px; +} + +} \ No newline at end of file diff --git a/Static HTML/css/base.css b/Static HTML/css/base.css new file mode 100644 index 0000000..db24941 --- /dev/null +++ b/Static HTML/css/base.css @@ -0,0 +1,5356 @@ +/* +Theme Name: HuskyPress +Theme URI: +Author: the WordPress team +Author URI: http://uconn.edu +Description: Adapted from the Wordpress TwentyEleven theme. +Version: 1.0 +License: GNU General Public License +License URI: license.txt +Tags: dark, light, white, black, gray, one-column, two-columns, left-sidebar, right-sidebar, fixed-width, flexible-width, custom-background, custom-colors, custom-header, custom-menu, editor-style, featured-image-header, featured-images, full-width-template, microformats, post-formats, rtl-language-support, sticky-post, theme-options, translation-ready +*/ + +/* =Reset default browser CSS. Based on work by Eric Meyer: http://meyerweb.com/eric/tools/css/reset/index.html +-------------------------------------------------------------- */ + +html, body, div, span, applet, object, iframe, +h1, h2, h3, h4, h5, h6, p, blockquote, pre, +a, abbr, acronym, address, big, cite, code, +del, dfn, em, font, ins, kbd, q, s, samp, +small, strike, strong, sub, sup, tt, var, +dl, dt, dd, ol, ul, li, +fieldset, form, label, legend, +table, caption, tbody, tfoot, thead, tr, th, td { + border: 0; + font-family: inherit; + font-size: 100%; + font-style: inherit; + font-weight: inherit; + margin: 0; + outline: 0; + padding: 0; + vertical-align: baseline; +} +:focus {/* remember to define focus styles! */ + outline: 0; +} +body { + background: #fff; + line-height: 1; +} +ol, ul { + list-style: none; +} +table {/* tables still need 'cellspacing="0"' in the markup */ + border-collapse: separate; + border-spacing: 0; +} +caption, th, td { + font-weight: normal; + text-align: left; +} +blockquote:before, blockquote:after, +q:before, q:after { + content: ""; +} +blockquote, q { + quotes: "" ""; +} +a img { + border: 0; +} +article, aside, details, figcaption, figure, +footer, header, hgroup, menu, nav, section { + display: block; +} + + +/* =Structure +----------------------------------------------- */ + +body { + padding: 0 2em; +} +#page { + margin: 2em auto; + max-width: 1000px; +} +#branding hgroup { + margin: 0 7.6%; +} +#access div { + margin: 0 7.6%; +} +#primary { + float: left; + margin: 0 -26.4% 0 0; + width: 100%; +} +#content { + margin: 0 34% 0 7.6%; + width: 58.4%; +} +#secondary { + float: right; + margin-right: 7.6%; + width: 18.8%; +} + +/* Singular */ +.singular #primary { + margin: 0; +} +.singular #content, +.left-sidebar.singular #content { + margin: 0 7.6%; + position: relative; + width: auto; +} +.singular .entry-header, +.singular .entry-content, +.singular footer.entry-meta, +.singular #comments-title { + margin: 0 auto; + width: 68.9%; +} + +/* Attachments */ +.singular .image-attachment .entry-content { + margin: 0 auto; + width: auto; +} +.singular .image-attachment .entry-description { + margin: 0 auto; + width: 68.9%; +} + +/* Showcase */ +.page-template-showcase-php #primary, +.left-sidebar.page-template-showcase-php #primary { + margin: 0; +} +.page-template-showcase-php #content, +.left-sidebar.page-template-showcase-php #content { + margin: 0 7.6%; + width: auto; +} +.page-template-showcase-php section.recent-posts { + float: right; + margin: 0 0 0 31%; + width: 69%; +} +.page-template-showcase-php #main .widget-area { + float: left; + margin: 0 -22.15% 0 0; + width: 22.15%; +} + +/* error404 */ +.error404 #primary { + float: none; + margin: 0; +} +.error404 #primary #content { + margin: 0 7.6%; + width: auto; +} + +/* Alignment */ +.alignleft { + display: inline; + float: left; + margin-right: 1.625em; +} +.alignright { + display: inline; + float: right; + margin-left: 1.625em; +} +.aligncenter { + clear: both; + display: block; + margin-left: auto; + margin-right: auto; +} + +/* Right Content */ +.left-sidebar #primary { + float: right; + margin: 0 0 0 -26.4%; + width: 100%; +} +.left-sidebar #content { + margin: 0 7.6% 0 34%; + width: 58.4%; +} +.left-sidebar #secondary { + float: left; + margin-left: 7.6%; + margin-right: 0; + width: 18.8%; +} + +/* One column */ +.one-column #page { + max-width: 690px; +} +.one-column #content { + margin: 0 7.6%; + width: auto; +} +.one-column #nav-below { + border-bottom: 1px solid #ddd; + margin-bottom: 1.625em; +} +.one-column #secondary { + float: none; + margin: 0 7.6%; + width: auto; +} +/* Simplify the showcase template */ +.one-column .page-template-showcase-php section.recent-posts { + float: none; + margin: 0; + width: 100%; +} +.one-column .page-template-showcase-php #main .widget-area { + float: none; + margin: 0; + width: auto; +} +.one-column .page-template-showcase-php .other-recent-posts { + border-bottom: 1px solid #ddd; +} +/* Simplify the showcase template when small feature */ +.one-column section.featured-post .attachment-small-feature { + border: none; + display: block; + height: auto; + max-width: 60%; + position: static; +} +.one-column article.feature-image.small { + margin: 0 0 1.625em; + padding: 0; +} +.one-column article.feature-image.small .entry-title { + font-size: 20px; + line-height: 1.3em; +} +.one-column article.feature-image.small .entry-summary { + height: 150px; + overflow: hidden; + padding: 0; + text-overflow: ellipsis; +} +.one-column article.feature-image.small .entry-summary a { + left: -9%; +} +/* Remove the margin on singular articles */ +.one-column.singular .entry-header, +.one-column.singular .entry-content, +.one-column.singular footer.entry-meta, +.one-column.singular #comments-title { + width: 100%; +} +/* Simplify the pullquotes and pull styles */ +.one-column.singular blockquote.pull { + margin: 0 0 1.625em; +} +.one-column.singular .pull.alignleft { + margin: 0 1.625em 0 0; +} +.one-column.singular .pull.alignright { + margin: 0 0 0 1.625em; +} +.one-column.singular .entry-meta .edit-link a { + position: absolute; + left: 0; + top: 40px; +} +.one-column.singular #author-info { + margin: 2.2em -8.8% 0; + padding: 20px 8.8%; +} +/* Make sure we have room for our comment avatars */ +.one-column .commentlist > li.comment { + margin-left: 102px; + width: auto; +} +/* Make sure the logo and search form don't collide */ +.one-column #branding #searchform { + right: 40px; + top: 4em; +} +/* Talking avatars take up too much room at this size */ +.one-column .commentlist > li.comment { + margin-left: 0; +} +.one-column .commentlist > li.comment .comment-meta, +.one-column .commentlist > li.comment .comment-content { + margin-right: 85px; +} +.one-column .commentlist .avatar { + background: transparent; + display: block; + padding: 0; + top: 1.625em; + left: auto; + right: 1.625em; +} +.one-column .commentlist .children .avatar { + background: none; + padding: 0; + position: absolute; + top: 2.2em; + left: 2.2em; +} +.one-column #respond { + width: auto; +} + + +/* =Global +----------------------------------------------- */ + +body, input, textarea { + color: #373737; + font: 15px "Helvetica Neue", Helvetica, Arial, sans-serif; + font-weight: 300; + line-height: 1.625; +} +body { + background: #e2e2e2; +} +#page { + background: #fff; +} + +/* Headings */ +h1,h2,h3,h4,h5,h6 { + clear: both; +} +hr { + background-color: #ccc; + border: 0; + height: 1px; + margin-bottom: 1.625em; +} + +/* Text elements */ +p { + margin-bottom: 1.625em; +} +ul, ol { + margin: 0 0 1.625em 2.5em; +} +ul { + list-style: square; +} +ol { + list-style-type: decimal; +} +ol ol { + list-style: upper-alpha; +} +ol ol ol { + list-style: lower-roman; +} +ol ol ol ol { + list-style: lower-alpha; +} +ul ul, ol ol, ul ol, ol ul { + margin-bottom: 0; +} +dl { + margin: 0 1.625em; +} +dt { + font-weight: bold; +} +dd { + margin-bottom: 1.625em; +} +strong { + font-weight: bold; +} +cite, em, i { + font-style: italic; +} +blockquote { + font-family: Georgia, "Bitstream Charter", serif; + font-style: italic; + font-weight: normal; + margin: 0 3em; +} +blockquote em, blockquote i, blockquote cite { + font-style: normal; +} +blockquote cite { + color: #666; + font: 12px "Helvetica Neue", Helvetica, Arial, sans-serif; + font-weight: 300; + letter-spacing: 0.05em; + text-transform: uppercase; +} +pre { + background: #f4f4f4; + font: 13px "Courier 10 Pitch", Courier, monospace; + line-height: 1.5; + margin-bottom: 1.625em; + overflow: auto; + padding: 0.75em 1.625em; +} +code, kbd { + font: 13px Monaco, Consolas, "Andale Mono", "DejaVu Sans Mono", monospace; +} +abbr, acronym, dfn { + border-bottom: 1px dotted #666; + cursor: help; +} +address { + display: block; + margin: 0 0 1.625em; +} +ins { + background: #fff9c0; + text-decoration: none; +} +sup, +sub { + font-size: 10px; + height: 0; + line-height: 1; + position: relative; + vertical-align: baseline; +} +sup { + bottom: 1ex; +} +sub { + top: .5ex; +} + +/* Forms */ +input[type=text], +input[type=password], +textarea { + background: #fafafa; + -moz-box-shadow: inset 0 1px 1px rgba(0,0,0,0.1); + -webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,0.1); + box-shadow: inset 0 1px 1px rgba(0,0,0,0.1); + border: 1px solid #ddd; + color: #888; +} +input[type=text]:focus, +textarea:focus { + color: #373737; +} +textarea { + padding-left: 3px; + width: 98%; +} +input[type=text] { + padding: 3px; +} +input#s { + background: url(images/search.png) no-repeat 5px 6px; + -moz-border-radius: 2px; + border-radius: 2px; + font-size: 14px; + height: 22px; + line-height: 1.2em; + padding: 4px 10px 4px 28px; +} +input#searchsubmit { + display: none; +} + +/* Links */ +a { + color: #1982d1; + text-decoration: none; +} +a:focus, +a:active, +a:hover { + text-decoration: underline; +} + +/* Assistive text */ +.assistive-text { + position: absolute !important; + clip: rect(1px 1px 1px 1px); /* IE6, IE7 */ + clip: rect(1px, 1px, 1px, 1px); +} +#access a.assistive-text:active, +#access a.assistive-text:focus { + background: #eee; + border-bottom: 1px solid #ddd; + color: #1982d1; + clip: auto !important; + font-size: 12px; + position: absolute; + text-decoration: underline; + top: 0; + left: 7.6%; +} + + +/* =Header +----------------------------------------------- */ + +#branding { + border-top: 2px solid #bbb; + + position: relative; + z-index: 9999; +} +#site-title { + margin-right: 270px; + padding: 3.65625em 0 0; +} +#site-title a { + color: #111; + font-size: 30px; + font-weight: bold; + line-height: 36px; + text-decoration: none; +} +#site-title a:hover, +#site-title a:focus, +#site-title a:active { + color: #1982d1; +} +#site-description { + color: #7a7a7a; + font-size: 14px; + margin: 0 270px 3.65625em 0; +} +#branding img { + height: auto; + margin-bottom: -7px; + width: 100%; +} + + +/* =Menu +-------------------------------------------------------------- */ + +#access { + background: #222; /* Show a solid color for older browsers */ + background: -moz-linear-gradient(#252525, #0a0a0a); + background: -o-linear-gradient(#252525, #0a0a0a); + background: -webkit-gradient(linear, 0% 0%, 0% 100%, from(#252525), to(#0a0a0a)); /* older webkit syntax */ + background: -webkit-linear-gradient(#252525, #0a0a0a); + -webkit-box-shadow: rgba(0, 0, 0, 0.4) 0px 1px 2px; + -moz-box-shadow: rgba(0, 0, 0, 0.4) 0px 1px 2px; + box-shadow: rgba(0, 0, 0, 0.4) 0px 1px 2px; + clear: both; + display: block; + float: left; + margin: 0 auto 6px; + width: 100%; +} +#access ul { + font-size: 13px; + list-style: none; + margin: 0 0 0 -0.8125em; + padding-left: 0; +} +#access li { + float: left; + position: relative; +} +#access a { + color: #eee; + display: block; + line-height: 3.333em; + padding: 0 1.2125em; + text-decoration: none; +} +#access ul ul { + -moz-box-shadow: 0 3px 3px rgba(0,0,0,0.2); + -webkit-box-shadow: 0 3px 3px rgba(0,0,0,0.2); + box-shadow: 0 3px 3px rgba(0,0,0,0.2); + display: none; + float: left; + margin: 0; + position: absolute; + top: 3.333em; + left: 0; + width: 188px; + z-index: 99999; +} +#access ul ul ul { + left: 100%; + top: 0; +} +#access ul ul a { + background: #f9f9f9; + border-bottom: 1px dotted #ddd; + color: #444; + font-size: 13px; + font-weight: normal; + height: auto; + line-height: 1.4em; + padding: 10px 10px; + width: 168px; +} +#access li:hover > a, +#access ul ul :hover > a, +#access a:focus { + background: #efefef; +} +#access li:hover > a, +#access a:focus { + background: #f9f9f9; /* Show a solid color for older browsers */ + background: -moz-linear-gradient(#f9f9f9, #e5e5e5); + background: -o-linear-gradient(#f9f9f9, #e5e5e5); + background: -webkit-gradient(linear, 0% 0%, 0% 100%, from(#f9f9f9), to(#e5e5e5)); /* Older webkit syntax */ + background: -webkit-linear-gradient(#f9f9f9, #e5e5e5); + color: #373737; +} +#access ul li:hover > ul { + display: block; +} +#access .current-menu-item > a, +#access .current-menu-ancestor > a, +#access .current_page_item > a, +#access .current_page_ancestor > a { + font-weight: bold; +} + +/* Search Form */ +#branding #searchform { + position: absolute; + top: 3.8em; + right: 7.6%; + text-align: right; +} +#branding #searchform div { + margin: 0; +} +#branding #s { + float: right; + -webkit-transition-duration: 400ms; + -webkit-transition-property: width, background; + -webkit-transition-timing-function: ease; + -moz-transition-duration: 400ms; + -moz-transition-property: width, background; + -moz-transition-timing-function: ease; + -o-transition-duration: 400ms; + -o-transition-property: width, background; + -o-transition-timing-function: ease; + width: 72px; +} +#branding #s:focus { + background-color: #f9f9f9; + width: 196px; +} +#branding #searchsubmit { + display: none; +} +#branding .only-search #searchform { + top: 5px; + z-index: 1; +} +#branding .only-search #s { + background-color: #666; + border-color: #000; + color: #222; +} +#branding .only-search #s, +#branding .only-search #s:focus { + width: 85%; +} +#branding .only-search #s:focus { + background-color: #bbb; +} +#branding .with-image #searchform { + top: auto; + bottom: -27px; + max-width: 195px; +} +#branding .only-search + #access div { + padding-right: 205px; +} + + +/* =Content +----------------------------------------------- */ + +#main { + clear: both; + padding: 1.625em 0 0; +} +.page-title { + color: #666; + font-size: 10px; + font-weight: 500; + letter-spacing: 0.1em; + line-height: 2.6em; + margin: 0 0 2.6em; + text-transform: uppercase; +} +.page-title a { + font-size: 12px; + font-weight: bold; + letter-spacing: 0; + text-transform: none; +} +.hentry, +.no-results { + border-bottom: 1px solid #ddd; + margin: 0 0 1.625em; + padding: 0 0 1.625em; + position: relative; +} +.hentry:last-child, +.no-results { + border-bottom: none; +} +.blog .sticky .entry-header .entry-meta { + clip: rect(1px 1px 1px 1px); /* IE6, IE7 */ + clip: rect(1px, 1px, 1px, 1px); + position: absolute !important; +} +.entry-title, +.entry-header .entry-meta { + padding-right: 76px; +} +.entry-title { + clear: both; + color: #222; + font-size: 26px; + font-weight: bold; + line-height: 1.5em; + padding-bottom: .3em; + padding-top: 15px; +} +.entry-title, +.entry-title a { + color: #222; + text-decoration: none; +} +.entry-title a:hover, +.entry-title a:focus, +.entry-title a:active { + color: #1982d1; +} +.entry-meta { + color: #666; + clear: both; + font-size: 12px; + line-height: 18px; +} +.entry-meta a { + font-weight: bold; +} +.single-author .entry-meta .by-author { + display: none; +} +.entry-content, +.entry-summary { + padding: 1.625em 0 0; +} +.entry-content h1, +.entry-content h2, +.comment-content h1, +.comment-content h2 { + color: #000; + font-weight: bold; +} +.entry-content h3, +.comment-content h3 { + font-size: 10px; + letter-spacing: 0.1em; + line-height: 2.6em; + text-transform: uppercase; +} +.entry-content table, +.comment-content table { + border-bottom: 1px solid #ddd; + margin: 0 0 1.625em; + width: 100%; +} +.entry-content th, +.comment-content th { + color: #666; + font-size: 10px; + font-weight: 500; + letter-spacing: 0.1em; + line-height: 2.6em; + text-transform: uppercase; +} +.entry-content td, +.comment-content td { + border-top: 1px solid #ddd; + padding: 6px 10px 6px 0; +} +.entry-content #s { + width: 75%; +} +.comment-content ul, +.comment-content ol { + margin-bottom: 1.625em; +} +.comment-content ul ul, +.comment-content ol ol, +.comment-content ul ol, +.comment-content ol ul { + margin-bottom: 0; +} +dl.gallery-item { + margin: 0; +} +.page-link { + clear: both; + display: block; + margin: 0 0 1.625em; +} +.page-link a { + background: #eee; + color: #373737; + margin: 0; + padding: 2px 3px; + text-decoration: none; +} +.page-link a:hover { + background: #888; + color: #fff; + font-weight: bold; +} +.page-link span { + margin-right: 6px; +} +.entry-meta .edit-link a, +.commentlist .edit-link a { + background: #eee; + -moz-border-radius: 3px; + border-radius: 3px; + color: #666; + float: right; + font-size: 12px; + line-height: 1.5em; + font-weight: 300; + text-decoration: none; + padding: 0 8px; +} +.entry-meta .edit-link a:hover, +.commentlist .edit-link a:hover { + background: #888; + color: #fff; +} +.entry-content .edit-link { + clear: both; + display: block; +} + +/* Images */ +.entry-content img, +.comment-content img, +.widget img { + max-width: 97.5%; /* Fluid images for posts, comments, and widgets */ +} +img[class*="align"], +img[class*="wp-image-"], +img[class*="attachment-"] { + height: auto; /* Make sure images with WordPress-added height and width attributes are scaled correctly */ +} +img.size-full, +img.size-large { + max-width: 97.5%; + width: auto; /* Prevent stretching of full-size and large-size images with height and width attributes in IE8 */ + height: auto; /* Make sure images with WordPress-added height and width attributes are scaled correctly */ +} +.entry-content img.wp-smiley { + border: none; + margin-bottom: 0; + margin-top: 0; + padding: 0; +} +img.alignleft, +img.alignright, +img.aligncenter { + margin-bottom: 1.625em; +} +p img, +.wp-caption { + margin-top: 0.4em; +} +.wp-caption { + background: #eee; + margin-bottom: 1.625em; + max-width: 96%; + padding: 9px; +} +.wp-caption img { + display: block; + margin: 0 auto; + max-width: 98%; +} +.wp-caption .wp-caption-text, +.gallery-caption { + color: #666; + font-family: Georgia, serif; + font-size: 12px; +} +.wp-caption .wp-caption-text { + margin-bottom: 0.6em; + padding: 10px 0 5px 40px; + position: relative; +} +.wp-caption .wp-caption-text:before { + color: #666; + content: '\2014'; + font-size: 14px; + font-style: normal; + font-weight: bold; + margin-right: 5px; + position: absolute; + left: 10px; + top: 7px; +} +#content .gallery { + margin: 0 auto 1.625em; +} +#content .gallery a img { + border: none; +} +img#wpstats { + display: block; + margin: 0 auto 1.625em; +} +#content .gallery-columns-4 .gallery-item { + width: 23%; + padding-right: 2%; +} +#content .gallery-columns-4 .gallery-item img { + width: 100%; + height: auto; +} + +/* Image borders */ +img[class*="align"], +img[class*="wp-image-"], +#content .gallery .gallery-icon img {/* Add fancy borders to all WordPress-added images but not things like badges and icons and the like */ + border: 1px solid #ddd; + padding: 6px; +} +.wp-caption img { + border-color: #eee; +} +a:focus img[class*="align"], +a:hover img[class*="align"], +a:active img[class*="align"], +a:focus img[class*="wp-image-"], +a:hover img[class*="wp-image-"], +a:active img[class*="wp-image-"], +#content .gallery .gallery-icon a:focus img, +#content .gallery .gallery-icon a:hover img, +#content .gallery .gallery-icon a:active img {/* Add some useful style to those fancy borders for linked images ... */ + background: #eee; + border-color: #bbb; +} +.wp-caption a:focus img, +.wp-caption a:active img, +.wp-caption a:hover img {/* ... including captioned images! */ + background: #fff; + border-color: #ddd; +} + +/* Make sure embeds and iframes fit their containers */ +embed, +iframe, +object { + max-width: 100%; +} + +/* Password Protected Posts */ +.post-password-required .entry-header .comments-link { + margin: 1.625em 0 0; +} +.post-password-required input[type=password] { + margin: 0.8125em 0; +} +.post-password-required input[type=password]:focus { + background: #f7f7f7; +} + +/* Author Info */ +#author-info { + font-size: 12px; + overflow: hidden; +} +.singular #author-info { + background: #f9f9f9; + border-top: 1px solid #ddd; + border-bottom: 1px solid #ddd; + margin: 2.2em -35.6% 0 -35.4%; + padding: 20px 35.4%; +} +.archive #author-info { + border-bottom: 1px solid #ddd; + margin: 0 0 2.2em; + padding: 0 0 2.2em; +} +#author-avatar { + float: left; + margin-right: -78px; +} +#author-avatar img { + background: #fff; + -moz-border-radius: 3px; + border-radius: 3px; + -webkit-box-shadow: 0 1px 2px #bbb; + -moz-box-shadow: 0 1px 2px #bbb; + box-shadow: 0 1px 2px #bbb; + padding: 3px; +} +#author-description { + float: left; + margin-left: 108px; +} +#author-description h2 { + color: #000; + font-size: 15px; + font-weight: bold; + margin: 5px 0 10px; +} + +/* Comments link */ +.entry-header .comments-link a { + background: #eee url(images/comment-bubble.png) no-repeat; + color: #666; + font-size: 13px; + font-weight: normal; + line-height: 35px; + overflow: hidden; + padding: 0 0 0; + position: absolute; + top: 1.5em; + right: 0; + text-align: center; + text-decoration: none; + width: 43px; + height: 36px; +} +.entry-header .comments-link a:hover, +.entry-header .comments-link a:focus, +.entry-header .comments-link a:active { + background-color: #1982d1; + color: #fff; + color: rgba(255,255,255,0.8); +} +.entry-header .comments-link .leave-reply { + visibility: hidden; +} + +/* +Post Formats Headings +To hide the headings, display: none the ".entry-header .entry-format" selector, +and remove the padding rules below. +*/ +.entry-header .entry-format { + color: #666; + font-size: 10px; + font-weight: 500; + letter-spacing: 0.1em; + line-height: 2.6em; + position: absolute; + text-transform: uppercase; + top: -5px; +} +.entry-header hgroup .entry-title { + padding-top: 15px; +} +article.format-aside .entry-content, +article.format-link .entry-content, +article.format-status .entry-content { + padding: 20px 0 0; +} +article.format-status .entry-content { + min-height: 65px; +} +.recent-posts .entry-header .entry-format { + display: none; +} +.recent-posts .entry-header hgroup .entry-title { + padding-top: 0; +} + +/* Singular content styles for Posts and Pages */ +.singular .hentry { + border-bottom: none; + padding: 4.875em 0 0; + position: relative; +} +.singular.page .hentry { + padding: 3.5em 0 0; +} +.singular .entry-title { + color: #000; + font-size: 36px; + font-weight: bold; + line-height: 48px; +} +.singular .entry-title, +.singular .entry-header .entry-meta { + padding-right: 0; +} +.singular .entry-header .entry-meta { + position: absolute; + top: 0; + left: 0; +} +blockquote.pull { + font-size: 21px; + font-weight: bold; + line-height: 1.6125em; + margin: 0 0 1.625em; + text-align: center; +} +.singular blockquote.pull { + margin: 0 -22.25% 1.625em; +} +.pull.alignleft { + margin: 0 1.625em 0 0; + text-align: right; + width: 33%; +} +.singular .pull.alignleft { + margin: 0 1.625em 0 -22.25%; +} +.pull.alignright { + margin: 0 0 0 1.625em; + text-align: left; + width: 33%; +} +.singular .pull.alignright { + margin: 0 -22.25% 0 1.625em; +} +.singular blockquote.pull.alignleft, +.singular blockquote.pull.alignright { + width: 33%; +} +.singular .entry-meta .edit-link a { + bottom: auto; + left: 50px; + position: absolute; + right: auto; + top: 80px; +} + + +/* =Aside +----------------------------------------------- */ + +.format-aside .entry-title, +.format-aside .entry-header .comments-link { + display: none; +} +.singular .format-aside .entry-title { + display: block; +} +.format-aside .entry-content { + padding: 0; +} +.singular .format-aside .entry-content { + padding: 1.625em 0 0; +} + + +/* =Link +----------------------------------------------- */ + +.format-link .entry-title, +.format-link .entry-header .comments-link { + display: none; +} +.singular .format-link .entry-title { + display: block; +} +.format-link .entry-content { + padding: 0; +} +.singular .format-link .entry-content { + padding: 1.625em 0 0; +} + + +/* =Gallery +----------------------------------------------- */ + +.format-gallery .gallery-thumb { + float: left; + display: block; + margin: .375em 1.625em 0 0; +} + + +/* =Status +----------------------------------------------- */ + +.format-status .entry-title, +.format-status .entry-header .comments-link { + display: none; +} +.singular .format-status .entry-title { + display: block; +} +.format-status .entry-content { + padding: 0; +} +.singular .format-status .entry-content { + padding: 1.625em 0 0; +} +.format-status img.avatar { + -moz-border-radius: 3px; + border-radius: 3px; + -webkit-box-shadow: 0 1px 2px #ccc; + -moz-box-shadow: 0 1px 2px #ccc; + box-shadow: 0 1px 2px #ccc; + float: left; + margin: 4px 10px 2px 0; + padding: 0; +} + + +/* =Quote +----------------------------------------------- */ + +.format-quote blockquote { + color: #555; + font-size: 17px; + margin: 0; +} + + +/* =Image +----------------------------------------------- */ + +.indexed.format-image .entry-header { + min-height: 61px; /* Prevent the comment icon from colliding with the image when there is no title */ +} +.indexed.format-image .entry-content { + padding-top: 0.5em; +} +.indexed.format-image p, +.indexed.format-image p img { + margin-bottom: 0; +} +.indexed.format-image footer.entry-meta { + background: #ddd; + margin-top: -7px; + padding: 20px 30px; + overflow: hidden; +} +.indexed.format-image div.entry-meta { + display: inline-block; + float: left; + width: 35%; +} +.indexed.format-image div.entry-meta + div.entry-meta { + float: none; + width: 65%; +} +.indexed.format-image .entry-meta span.cat-links, +.indexed.format-image .entry-meta span.tag-links, +.indexed.format-image .entry-meta span.comments-link { + display: block; +} +.indexed.format-image footer.entry-meta a { + color: #444; +} +.indexed.format-image footer.entry-meta a:hover { + color: #fff; +} +#content .indexed.format-image img { + border: none; + max-width: 100%; + padding: 0; +} +.indexed.format-image .wp-caption { + background: #111; + margin-bottom: 0; + max-width: 96%; + padding: 11px; +} +.indexed.format-image .wp-caption .wp-caption-text { + color: #ddd; +} +.indexed.format-image .wp-caption .wp-caption-text:before { + color: #444; +} +.indexed.format-image a:hover img { + opacity: 0.8; +} + + +/* =error404 +----------------------------------------------- */ + +.error404 #main #searchform { + background: #f9f9f9; + border: 1px solid #ddd; + border-width: 1px 0; + margin: 0 -8.9% 1.625em; + overflow: hidden; + padding: 1.625em 8.9%; +} +.error404 #main #s { + width: 95%; +} +.error404 #main .widget { + clear: none; + float: left; + margin-right: 3.7%; + width: 30.85%; +} +.error404 #main .widget_archive { + margin-right: 0; +} +.error404 #main .widget_tag_cloud { + float: none; + margin-right: 0; + width: 100%; +} +.error404 .widgettitle { + font-size: 10px; + letter-spacing: 0.1em; + line-height: 2.6em; + text-transform: uppercase; +} + + +/* =Showcase +----------------------------------------------- */ + +h1.showcase-heading { + color: #666; + font-size: 10px; + font-weight: 500; + letter-spacing: 0.1em; + line-height: 2.6em; + text-transform: uppercase; +} + +/* Intro */ +article.intro { + background: #f9f9f9; + border-bottom: none; + margin: -1.855em -8.9% 1.625em; + padding: 0 8.9%; +} +article.intro .entry-title { + display: none; +} +article.intro .entry-content { + color: #111; + font-size: 16px; + padding: 1.625em 0 0.625em; +} +article.intro .edit-link a { + background: #aaa; + -moz-border-radius: 3px; + border-radius: 3px; + color: #fff; + font-size: 12px; + padding: 0 8px; + position: absolute; + top: 30px; + right: 20px; + text-decoration: none; +} +article.intro .edit-link a:hover, +article.intro .edit-link a:focus, +article.intro .edit-link a:active { + background: #777; +} + +/* Featured post */ +section.featured-post { + float: left; + margin: -1.625em -8.9% 1.625em; + padding: 1.625em 8.9% 0; + position: relative; + width: 100%; +} +section.featured-post .hentry { + border: none; + color: #666; + margin: 0; +} +section.featured-post .entry-meta { + clip: rect(1px 1px 1px 1px); /* IE6, IE7 */ + clip: rect(1px, 1px, 1px, 1px); + position: absolute !important; +} + +/* Small featured post */ +section.featured-post .attachment-small-feature { + float: right; + height: auto; + margin: 0 -8.9% 1.625em 0; + max-width: 59%; + position: relative; + right: -15px; +} +section.featured-post.small { + padding-top: 0; +} +section.featured-post .attachment-small-feature:hover, +section.featured-post .attachment-small-feature:focus, +section.featured-post .attachment-small-feature:active { + opacity: .8; +} +article.feature-image.small { + float: left; + margin: 0 0 1.625em; + width: 45%; +} +article.feature-image.small .entry-title { + line-height: 1.2em; +} +article.feature-image.small .entry-summary { + color: #555; + font-size: 13px; +} +article.feature-image.small .entry-summary p a { + background: #222; + color: #eee; + display: block; + left: -23.8%; + padding: 9px 26px 9px 85px; + position: relative; + text-decoration: none; + top: 20px; + width: 180px; + z-index: 1; +} +article.feature-image.small .entry-summary p a:hover { + background: #1982d1; + color: #eee; + color: rgba(255,255,255,0.8); +} + +/* Large featured post */ +section.feature-image.large { + border: none; + max-height: 288px; + padding: 0; + width: 100%; +} +section.feature-image.large .showcase-heading { + display: none; +} +section.feature-image.large .hentry { + border-bottom: none; + left: 9%; + margin: 1.625em 9% 0 0; + position: absolute; + top: 0; +} +article.feature-image.large .entry-title a { + background: #222; + background: rgba(0,0,0,0.8); + -moz-border-radius: 3px; + border-radius: 3px; + color: #fff; + display: inline-block; + font-weight: 300; + padding: .2em 20px; +} +section.feature-image.large:hover .entry-title a, +section.feature-image.large .entry-title:hover a { + background: #eee; + background: rgba(255,255,255,0.8); + color: #222; +} +article.feature-image.large .entry-summary { + display: none; +} +section.feature-image.large img { + display: block; + height: auto; + max-width: 117.9%; + padding: 0 0 6px; +} + +/* Featured Slider */ +.featured-posts { + border-bottom: 1px solid #ddd; + display: block; + height: 328px; + margin: 1.625em -8.9% 20px; + max-width: 1000px; + padding: 0; + position: relative; + overflow: hidden; +} +.featured-posts .showcase-heading { + padding-left: 8.9%; +} +.featured-posts section.featured-post { + background: #fff; + height: 288px; + left: 0; + margin: 0; + position: absolute; + top: 30px; + width: auto; +} +.featured-posts section.featured-post.large { + max-width: 100%; + overflow: hidden; +} +.featured-posts section.featured-post { + -webkit-transition-duration: 200ms; + -webkit-transition-property: opacity, visibility; + -webkit-transition-timing-function: ease; + -moz-transition-duration: 200ms; + -moz-transition-property: opacity, visibility; + -moz-transition-timing-function: ease; +} +.featured-posts section.featured-post { + opacity: 0; + visibility: hidden; +} +.featured-posts #featured-post-1 { + opacity: 1; + visibility: visible; +} +.featured-post .feature-text:after, +.featured-post .feature-image.small:after { + content: ' '; + background: -moz-linear-gradient(top, rgba(255,255,255,0) 0%, rgba(255,255,255,1) 100%); /* FF3.6+ */ + background: -webkit-gradient(linear, left top, left bottom, color-stop(0%,rgba(255,255,255,0)), color-stop(100%,rgba(255,255,255,1))); /* Chrome,Safari4+ */ + background: -webkit-linear-gradient(top, rgba(255,255,255,0) 0%,rgba(255,255,255,1) 100%); /* Chrome10+,Safari5.1+ */ + background: -o-linear-gradient(top, rgba(255,255,255,0) 0%,rgba(255,255,255,1) 100%); /* Opera11.10+ */ + background: -ms-linear-gradient(top, rgba(255,255,255,0) 0%,rgba(255,255,255,1) 100%); /* IE10+ */ + filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#00ffffff', endColorstr='#ffffff',GradientType=0 ); /* IE6-9 */ + background: linear-gradient(top, rgba(255,255,255,0) 0%,rgba(255,255,255,1) 100%); /* W3C */ + width: 100%; + height: 45px; + position: absolute; + top: 230px; +} +.featured-post .feature-image.small:after { + top: 253px; +} +#content .feature-slider { + top: 5px; + right: 8.9%; + overflow: visible; + position: absolute; +} +.feature-slider ul { + list-style-type: none; + margin: 0; +} +.feature-slider li { + float: left; + margin: 0 6px; +} +.feature-slider a { + background: #3c3c3c; + background: rgba(60,60,60,0.9); + -moz-border-radius: 12px; + border-radius: 12px; + -webkit-box-shadow: inset 1px 1px 5px rgba(0,0,0,0.5), inset 0 0 2px rgba(255,255,255,0.5); + -moz-box-shadow: inset 1px 1px 5px rgba(0,0,0,0.5), inset 0 0 2px rgba(255,255,255,0.5); + box-shadow: inset 1px 1px 5px rgba(0,0,0,0.5), inset 0 0 2px rgba(255,255,255,0.5); + display: block; + width: 14px; + height: 14px; +} +.feature-slider a.active { + background: #1982d1; + -webkit-box-shadow: inset 1px 1px 5px rgba(0,0,0,0.4), inset 0 0 2px rgba(255,255,255,0.8); + -moz-box-shadow: inset 1px 1px 5px rgba(0,0,0,0.4), inset 0 0 2px rgba(255,255,255,0.8); + box-shadow: inset 1px 1px 5px rgba(0,0,0,0.4), inset 0 0 2px rgba(255,255,255,0.8); + cursor: default; + opacity: 0.5; +} + +/* Recent Posts */ +section.recent-posts { + padding: 0 0 1.625em; +} +section.recent-posts .hentry { + border: none; + margin: 0; +} +section.recent-posts .other-recent-posts { + border-bottom: 1px solid #ddd; + list-style: none; + margin: 0; +} +section.recent-posts .other-recent-posts li { + padding: 0.3125em 0; + position: relative; +} +section.recent-posts .other-recent-posts .entry-title { + border-top: 1px solid #ddd; + font-size: 17px; +} +section.recent-posts .other-recent-posts a[rel="bookmark"] { + color: #373737; + float: left; + max-width: 84%; +} +section.recent-posts .other-recent-posts a[rel="bookmark"]:after { + content: '-'; + color: transparent; + font-size: 11px; +} +section.recent-posts .other-recent-posts a[rel="bookmark"]:hover { +} +section.recent-posts .other-recent-posts .comments-link a, +section.recent-posts .other-recent-posts .comments-link > span { + border-bottom: 2px solid #999; + bottom: -2px; + color: #444; + display: block; + font-size: 10px; + font-weight: 500; + line-height: 2.76333em; + padding: 0.3125em 0 0.3125em 1em; + position: absolute; + right: 0; + text-align: right; + text-transform: uppercase; + z-index: 1; +} +section.recent-posts .other-recent-posts .comments-link > span { + border-color: #bbb; + color: #888; +} +section.recent-posts .other-recent-posts .comments-link a:hover { + color: #1982d1; + border-color: #1982d1; +} +section.recent-posts .other-recent-posts li:after { + clear: both; + content: '.'; + display: block; + height: 0; + visibility: hidden; +} + + +/* =Attachments +----------------------------------------------- */ + +.image-attachment div.attachment { + background: #f9f9f9; + border: 1px solid #ddd; + border-width: 1px 0; + margin: 0 -8.9% 1.625em; + overflow: hidden; + padding: 1.625em 1.625em 0; + text-align: center; +} +.image-attachment div.attachment img { + display: block; + height: auto; + margin: 0 auto 1.625em; + max-width: 100%; +} +.image-attachment div.attachment a img { + border-color: #f9f9f9; +} +.image-attachment div.attachment a:focus img, +.image-attachment div.attachment a:hover img, +.image-attachment div.attachment a:active img { + border-color: #ddd; + background: #fff; +} +.image-attachment .entry-caption p { + font-size: 10px; + letter-spacing: 0.1em; + line-height: 2.6em; + margin: 0 0 2.6em; + text-transform: uppercase; +} + + +/* =Navigation +-------------------------------------------------------------- */ + +#content nav { + clear: both; + overflow: hidden; + padding: 0 0 1.625em; +} +#content nav a { + font-size: 12px; + font-weight: bold; + line-height: 2.2em; +} +#nav-above { + padding: 0 0 1.625em; +} +#nav-above { + display: none; +} +.paged #nav-above { + display: block; +} +.nav-previous { + float: left; + width: 50%; +} +.nav-next { + float: right; + text-align: right; + width: 50%; +} +#content nav .meta-nav { + font-weight: normal; +} + +/* Singular navigation */ +#nav-single { + float: right; + position: relative; + top: -0.3em; + text-align: right; + z-index: 1; +} +#nav-single .nav-previous, +#nav-single .nav-next { + float: none; + width: auto; +} +#nav-single .nav-next { + padding-left: .5em; +} + + +/* =Widgets +----------------------------------------------- */ + +.widget-area { + font-size: 12px; +} +.widget { + clear: both; + margin: 0 0 2.2em; +} +.widget-title { + color: #666; + font-size: 10px; + font-weight: 500; + letter-spacing: 0.1em; + line-height: 2.6em; + text-transform: uppercase; +} +.widget ul { + font-size: 15px; + margin: 0; +} +.widget ul ul { + margin-left: 1.5em; +} +.widget ul li { + color: #777; + font-size: 13px; +} +.widget a { + font-weight: bold; + text-decoration: none; +} +.widget a:hover, +.widget a:focus, +.widget a:active { + text-decoration: underline; +} + +/* Search Widget */ +.widget_search form { + margin: 0 0 1.625em; +} +.widget_search #s { + width: 77%; +} +.widget_search #searchsubmit { + background: #ddd; + border: 1px solid #ccc; + -webkit-box-shadow: inset 0px -1px 1px rgba(0, 0, 0, 0.09); + -moz-box-shadow: inset 0px -1px 1px rgba(0, 0, 0, 0.09); + box-shadow: inset 0px -1px 1px rgba(0, 0, 0, 0.09); + color: #888; + font-size: 13px; + line-height: 25px; + position: relative; + top: -2px; +} +.widget_search #searchsubmit:active { + background: #1982d1; + border-color: #0861a5; + -webkit-box-shadow: inset 0px 1px 1px rgba(0, 0, 0, 0.1); + -moz-box-shadow: inset 0px 1px 1px rgba(0, 0, 0, 0.1); + box-shadow: inset 0px 1px 1px rgba(0, 0, 0, 0.1); + color: #bfddf3; +} + +/* Ephemera Widget */ +section.ephemera ol, +.widget_twentyeleven_ephemera ol { + list-style: square; + margin: 5px 0 0; +} +.widget_twentyeleven_ephemera .widget-entry-title { + font-size: 15px; + font-weight: bold; + padding: 0; +} +.widget_twentyeleven_ephemera .comments-link a, +.widget_twentyeleven_ephemera .comments-link > span { + color: #666; + display: block; + font-size: 10px; + font-weight: 500; + line-height: 2.76333em; + text-transform: uppercase; +} +section.ephemera .entry-title .comments-link a:hover, +.widget_twentyeleven_ephemera .entry-title .comments-link a:hover { +} +section.ephemera .entry-title a span { + color: #29628d; +} + +/* Twitter */ +.widget_twitter li { + list-style-type: none; + margin-bottom: 14px; +} +.widget_twitter .timesince { + display: block; + font-size: 11px; + margin-right: -10px; + text-align: right; +} + +/* Widget Image */ +.widget_image img { + height: auto; + max-width: 100%; +} + +/* Calendar Widget */ + +.widget_calendar #wp-calendar { + color: #555; + width: 95%; + text-align: center; +} +.widget_calendar #wp-calendar caption, +.widget_calendar #wp-calendar td, +.widget_calendar #wp-calendar th { + text-align: center; +} +.widget_calendar #wp-calendar caption { + font-size: 11px; + font-weight: 500; + padding: 5px 0 3px 0; + text-transform: uppercase; +} +.widget_calendar #wp-calendar th { + background: #f4f4f4; + border-top: 1px solid #ccc; + border-bottom: 1px solid #ccc; + font-weight: bold; +} +.widget_calendar #wp-calendar tfoot td { + background: #f4f4f4; + border-top: 1px solid #ccc; + border-bottom: 1px solid #ccc; +} + + +/* =Comments +----------------------------------------------- */ + +#comments-title { + color: #666; + font-size: 10px; + font-weight: 500; + line-height: 2.6em; + padding: 0 0 2.6em; + text-transform: uppercase; +} +.nopassword, +.nocomments { + color: #aaa; + font-size: 24px; + font-weight: 100; + margin: 26px 0; + text-align: center; +} +.commentlist { + list-style: none; + margin: 0 auto; + width: 68.9%; +} +.content .commentlist, +.page-template-sidebar-page-php .commentlist { + width: 100%; /* reset the width for the one-column and sidebar page layout */ +} +.commentlist > li.comment { + background: #f6f6f6; + border: 1px solid #ddd; + -moz-border-radius: 3px; + border-radius: 3px; + margin: 0 0 1.625em; + padding: 1.625em; + position: relative; +} +.commentlist .pingback { + margin: 0 0 1.625em; + padding: 0 1.625em; +} +.commentlist .children { + list-style: none; + margin: 0; +} +.commentlist .children li.comment { + background: #fff; + border-left: 1px solid #ddd; + -moz-border-radius: 0 3px 3px 0; + border-radius: 0 3px 3px 0; + margin: 1.625em 0 0; + padding: 1.625em; + position: relative; +} +.commentlist .children li.comment .fn { + display: block; +} +.comment-meta .fn { + font-style: normal; +} +.comment-meta { + color: #666; + font-size: 12px; + line-height: 2.2em; +} +.commentlist .children li.comment .comment-meta { + line-height: 1.625em; + margin-left: 50px; +} +.commentlist .children li.comment .comment-content { + margin: 1.625em 0 0; +} +.comment-meta a { + font-weight: bold; +} +.comment-meta a:focus, +.comment-meta a:active, +.comment-meta a:hover { +} +.commentlist .avatar { + -moz-border-radius: 3px; + border-radius: 3px; + -webkit-box-shadow: 0 1px 2px #ccc; + -moz-box-shadow: 0 1px 2px #ccc; + box-shadow: 0 1px 2px #ccc; + left: -102px; + padding: 0; + position: absolute; + top: 0; +} +.commentlist > li:before { + content: url(images/comment-arrow.png); + left: -21px; + position: absolute; +} +.commentlist > li.pingback:before { + content: ''; +} +.commentlist .children .avatar { + background: none; + -webkit-box-shadow: none; + -moz-box-shadow: none; + box-shadow: none; + left: 2.2em; + padding: 0; + top: 2.2em; +} +a.comment-reply-link { + background: #eee; + -moz-border-radius: 3px; + border-radius: 3px; + color: #666; + display: inline-block; + font-size: 12px; + padding: 0 8px; + text-decoration: none; +} +a.comment-reply-link:hover, +a.comment-reply-link:focus, +a.comment-reply-link:active { + background: #888; + color: #fff; +} +a.comment-reply-link > span { + display: inline-block; + position: relative; + top: -1px; +} + +/* Post author highlighting */ +.commentlist > li.bypostauthor { + background: #ddd; + border-color: #d3d3d3; +} +.commentlist > li.bypostauthor .comment-meta { + color: #575757; +} +.commentlist > li.bypostauthor .comment-meta a:focus, +.commentlist > li.bypostauthor .comment-meta a:active, +.commentlist > li.bypostauthor .comment-meta a:hover { +} +.commentlist > li.bypostauthor:before { + content: url(images/comment-arrow-bypostauthor.png); +} + +/* Post Author threaded comments */ +.commentlist .children > li.bypostauthor { + background: #ddd; + border-color: #d3d3d3; +} + +/* sidebar-page.php comments */ +/* Make sure we have room for our comment avatars */ +.page-template-sidebar-page-php .commentlist > li.comment, +.page-template-sidebar-page-php.commentlist .pingback { + margin-left: 102px; + width: auto; +} +/* And a full-width comment form */ +.page-template-sidebar-page-php #respond { + width: auto; +} + +/* Comment Form */ +#respond { + background: #ddd; + border: 1px solid #d3d3d3; + -moz-border-radius: 3px; + border-radius: 3px; + margin: 0 auto 1.625em; + padding: 1.625em; + position: relative; + width: 68.9%; +} +#respond input[type="text"], +#respond textarea { + background: #fff; + border: 4px solid #eee; + -moz-border-radius: 5px; + border-radius: 5px; + -webkit-box-shadow: inset 0 1px 3px rgba(204,204,204,0.95); + -moz-box-shadow: inset 0 1px 3px rgba(204,204,204,0.95); + box-shadow: inset 0 1px 3px rgba(204,204,204,0.95); + position: relative; + padding: 10px; + text-indent: 80px; +} +#respond .comment-form-author, +#respond .comment-form-email, +#respond .comment-form-url, +#respond .comment-form-comment { + position: relative; +} +#respond .comment-form-author label, +#respond .comment-form-email label, +#respond .comment-form-url label, +#respond .comment-form-comment label { + background: #eee; + -webkit-box-shadow: 1px 2px 2px rgba(204,204,204,0.8); + -moz-box-shadow: 1px 2px 2px rgba(204,204,204,0.8); + box-shadow: 1px 2px 2px rgba(204,204,204,0.8); + color: #555; + display: inline-block; + font-size: 13px; + left: 4px; + min-width: 60px; + padding: 4px 10px; + position: relative; + top: 40px; + z-index: 1; +} +#respond input[type="text"]:focus, +#respond textarea:focus { + text-indent: 0; + z-index: 1; +} +#respond textarea { + resize: vertical; + width: 95%; +} +#respond .comment-form-author .required, +#respond .comment-form-email .required { + color: #bd3500; + font-size: 22px; + font-weight: bold; + left: 75%; + position: absolute; + top: 45px; + z-index: 1; +} +#respond .comment-notes, +#respond .logged-in-as { + font-size: 13px; +} +#respond p { + margin: 10px 0; +} +#respond .form-submit { + float: right; + margin: -20px 0 10px; +} +#respond input#submit { + background: #222; + border: none; + -moz-border-radius: 3px; + border-radius: 3px; + -webkit-box-shadow: 0px 1px 2px rgba(0,0,0,0.3); + -moz-box-shadow: 0px 1px 2px rgba(0,0,0,0.3); + box-shadow: 0px 1px 2px rgba(0,0,0,0.3); + color: #eee; + cursor: pointer; + font-size: 15px; + margin: 20px 0; + padding: 5px 42px 5px 22px; + position: relative; + left: 30px; + text-shadow: 0 -1px 0 rgba(0,0,0,0.3); +} +#respond input#submit:active { + background: #1982d1; + color: #bfddf3; +} +#respond #cancel-comment-reply-link { + color: #666; + margin-left: 10px; + text-decoration: none; +} +#respond .logged-in-as a:hover, +#respond #cancel-comment-reply-link:hover { + text-decoration: underline; +} +.commentlist #respond { + margin: 1.625em 0 0; + width: auto; +} +#reply-title { + color: #373737; + font-size: 24px; + font-weight: bold; + line-height: 30px; +} +#cancel-comment-reply-link { + color: #888; + display: block; + font-size: 10px; + font-weight: normal; + line-height: 2.2em; + letter-spacing: 0.05em; + position: absolute; + right: 1.625em; + text-decoration: none; + text-transform: uppercase; + top: 1.1em; +} +#cancel-comment-reply-link:focus, +#cancel-comment-reply-link:active, +#cancel-comment-reply-link:hover { + color: #ff4b33; +} +#respond label { + line-height: 2.2em; +} +#respond input[type=text] { + display: block; + height: 24px; + width: 75%; +} +#respond p { + font-size: 12px; +} +p.comment-form-comment { + margin: 0; +} +.form-allowed-tags { + display: none; +} + + +/* =Footer +----------------------------------------------- */ + +#colophon { + clear: both; +} +#supplementary { + border-top: 1px solid #ddd; + padding: 1.625em 7.6%; + overflow: hidden; +} + +/* Two Footer Widget Areas */ +#supplementary.two .widget-area { + float: left; + margin-right: 3.7%; + width: 48.1%; +} +#supplementary.two .widget-area + .widget-area { + margin-right: 0; +} + +/* Three Footer Widget Areas */ +#supplementary.three .widget-area { + float: left; + margin-right: 3.7%; + width: 30.85%; +} +#supplementary.three .widget-area + .widget-area + .widget-area { + margin-right: 0; +} + +/* Site Generator Line */ +#site-generator { + background: #f9f9f9; + border-top: 1px solid #ddd; + color: #666; + font-size: 12px; + line-height: 2.2em; + padding: 2.2em 0.5em; + text-align: center; +} +#site-generator a { + color: #555; + font-weight: bold; +} +#site-generator .sep { + background: url(images/wordpress.png) center left no-repeat; + color: transparent; + display: inline-block; + height: 16px; + line-height: 16px; + margin: 0 7px; + width: 16px; +} + + +/* =Responsive Structure +----------------------------------------------- */ + +@media (max-width: 800px) { + /* Simplify the basic layout */ + #main #content { + margin: 0 7.6%; + width: auto; + } + #nav-below { + border-bottom: 1px solid #ddd; + margin-bottom: 1.625em; + } + #main #secondary { + float: none; + margin: 0 7.6%; + width: auto; + } + /* Simplify the showcase template */ + .page-template-showcase-php .featured-posts { + min-height: 280px; + } + .featured-posts section.featured-post { + height: auto; + } + .page-template-showcase-php section.recent-posts { + float: none; + margin: 0; + width: 100%; + } + .page-template-showcase-php #main .widget-area { + float: none; + margin: 0; + width: auto; + } + .page-template-showcase-php .other-recent-posts { + border-bottom: 1px solid #ddd; + } + /* Simplify the showcase template when small feature */ + section.featured-post .attachment-small-feature, + .one-column section.featured-post .attachment-small-feature { + border: none; + display: block; + float: left; + height: auto; + margin: 0.625em auto 1.025em; + max-width: 30%; + position: static; + } + article.feature-image.small { + float: right; + margin: 0 0 1.625em; + width: 64%; + } + .one-column article.feature-image.small .entry-summary { + height: auto; + } + article.feature-image.small .entry-summary p a { + left: 0; + padding-left: 20px; + padding-right: 20px; + width: auto; + } + /* Remove the margin on singular articles */ + .singular .entry-header, + .singular .entry-content, + .singular footer.entry-meta, + .singular #comments-title { + width: 100%; + } + /* Simplify the pullquotes and pull styles */ + .singular blockquote.pull { + margin: 0 0 1.625em; + } + .singular .pull.alignleft { + margin: 0 1.625em 0 0; + } + .singular .pull.alignright { + margin: 0 0 0 1.625em; + } + .singular .entry-meta .edit-link a { + left: 0; + position: absolute; + top: 40px; + } + .singular #author-info { + margin: 2.2em -8.8% 0; + padding: 20px 8.8%; + } + /* Make sure we have room for our comment avatars */ + .commentlist { + width: 100%; + } + .commentlist > li.comment, + .commentlist .pingback { + margin-left: 102px; + width: auto; + } + /* And a full-width comment form */ + #respond { + width: auto; + } + /* No need to float footer widgets at this size */ + #colophon #supplementary .widget-area { + float: none; + margin-right: 0; + width: auto; + } + /* No need to float 404 widgets at this size */ + .error404 #main .widget { + float: none; + margin-right: 0; + width: auto; + } + +} +@media (max-width: 650px) { + /* @media (max-width: 650px) Reduce font-sizes for better readability on smaller devices */ + body, input, textarea { + font-size: 13px; + } + #site-title a { + font-size: 24px; + } + #site-description { + font-size: 12px; + } + #access ul { + font-size: 12px; + } + article.intro .entry-content { + font-size: 12px; + } + .entry-title { + font-size: 21px; + } + .featured-post .entry-title { + font-size: 14px; + } + .singular .entry-title { + font-size: 28px; + } + .entry-meta { + font-size: 12px; + } + blockquote { + margin: 0; + } + blockquote.pull { + font-size: 17px; + } + /* Reposition the site title and description slightly */ + #site-title { + padding: 5.30625em 0 0; + } + #site-title, + #site-description { + margin-right: 0; + } + /* Make sure the logo and search form don't collide */ + #branding #searchform { + top: 1.625em !important; + } + /* Floated content doesn't work well at this size */ + .alignleft, + .alignright { + float: none; + margin-left: 0; + margin-right: 0; + } + /* Make sure the post-post navigation doesn't collide with anything */ + #nav-single { + display: block; + position: static; + } + .singular .hentry { + padding: 1.625em 0 0; + } + .singular.page .hentry { + padding: 1.625em 0 0; + } + /* Talking avatars take up too much room at this size */ + .commentlist > li.comment, + .commentlist > li.pingback { + margin-left: 0 !important; + } + .commentlist .avatar { + background: transparent; + display: block; + padding: 0; + position: static; + } + .commentlist .children .avatar { + background: none; + left: 2.2em; + padding: 0; + position: absolute; + top: 2.2em; + } + /* Use the available space in the smaller comment form */ + #respond input[type="text"] { + width: 95%; + } + #respond .comment-form-author .required, + #respond .comment-form-email .required { + left: 95%; + } + #content .gallery-columns-3 .gallery-item { + width: 31%; + padding-right: 2%; + } + #content .gallery-columns-3 .gallery-item img { + width: 100%; + height: auto; + } + +} +@media (max-width: 450px) { + #content .gallery-columns-2 .gallery-item { + width: 45%; + padding-right: 4%; + } + #content .gallery-columns-2 .gallery-item img { + width: 100%; + height: auto; + } + +} +@media only screen and (min-device-width: 320px) and (max-device-width: 480px) { + body { + padding: 0; + } + #page { + margin-top: 0; + } + #branding { + border-top: none; + } + +} + + +/* =Print +----------------------------------------------- */ + +@media print { + body { + background: none !important; + font-size: 10pt; + } + footer.entry-meta a[rel=bookmark]:link:after, + footer.entry-meta a[rel=bookmark]:visited:after { + content: " [" attr(href) "] "; /* Show URLs */ + } + #page { + clear: both !important; + display: block !important; + float: none !important; + max-width: 100%; + position: relative !important; + } + #branding { + border-top: none !important; + padding: 0; + } + #branding hgroup { + margin: 0; + } + #site-title a { + font-size: 21pt; + } + #site-description { + font-size: 10pt; + } + #branding #searchform { + display: none; + } + #branding img { + display: none; + } + #access { + display: none; + } + #main { + border-top: none; + box-shadow: none; + } + #primary { + float: left; + margin: 0; + width: 100%; + } + #content { + margin: 0; + width: auto; + } + .singular #content { + margin: 0; + width: 100%; + } + .singular .entry-header .entry-meta { + position: static; + } + .entry-meta .edit-link a { + display: none; + } + #content nav { + display: none; + } + .singular .entry-header, + .singular .entry-content, + .singular footer.entry-meta, + .singular #comments-title { + margin: 0; + width: 100%; + } + .singular .hentry { + padding: 0; + } + .entry-title, + .singular .entry-title { + font-size: 21pt; + } + .entry-meta { + font-size: 10pt; + } + .entry-header .comments-link { + display: none; + } + .page-link { + display: none; + } + .singular #author-info { + background: none; + border-bottom: none; + border-top: none; + margin: 2.2em 0 0; + padding: 0; + } + #respond { + display: none; + } + .widget-area { + display: none; + } + #colophon { + display: none; + } + + /* Comments */ + .commentlist > li.comment { + background: none; + border: 1px solid #ddd; + -moz-border-radius: 3px 3px 3px 3px; + border-radius: 3px 3px 3px 3px; + margin: 0 auto 1.625em; + padding: 1.625em; + position: relative; + width: auto; + } + .commentlist .avatar { + height: 39px; + left: 2.2em; + top: 2.2em; + width: 39px; + } + .commentlist li.comment .comment-meta { + line-height: 1.625em; + margin-left: 50px; + } + .commentlist li.comment .fn { + display: block; + } + .commentlist li.comment .comment-content { + margin: 1.625em 0 0; + } + .commentlist .comment-edit-link { + display: none; + } + .commentlist > li::before, + .commentlist > li.bypostauthor::before { + content: ''; + } + .commentlist .reply { + display: none; + } + + /* Post author highlighting */ + .commentlist > li.bypostauthor { + color: #444; + } + .commentlist > li.bypostauthor .comment-meta { + color: #666; + } + .commentlist > li.bypostauthor:before { + content: none; + } + + /* Post Author threaded comments */ + .commentlist .children > li.bypostauthor { + background: #fff; + border-color: #ddd; + } + .commentlist .children > li.bypostauthor > article, + .commentlist .children > li.bypostauthor > article .comment-meta { + color: #666; + } + +} + + +/* =IE7 +----------------------------------------------- */ + +#ie7 article.intro { + margin-left: -7.6%; + margin-right: -7.6%; + padding-left: -7.6%; + padding-right: -7.6%; + max-width: 1000px; +} +#ie7 section.featured-post { + margin-left: -7.6%; + margin-right: -7.6%; + max-width: 850px; +} +#ie7 section.recent-posts { + margin-right: 7.6%; +} +/* +Theme Name: HuskyPress +Theme URI: http://wordpress.org/extend/themes/twentyeleven +Author: the WordPress team +Author URI: http://uconn.edu +Description: +Version: 1.3 +License: GNU General Public License +License URI: license.txt +Tags: dark, light, white, black, gray, one-column, two-columns, left-sidebar, right-sidebar, fixed-width, flexible-width, custom-background, custom-colors, custom-header, custom-menu, editor-style, featured-image-header, featured-images, full-width-template, microformats, post-formats, rtl-language-support, sticky-post, theme-options, translation-ready +*/ + +/* =Reset default browser CSS. Based on work by Eric Meyer: http://meyerweb.com/eric/tools/css/reset/index.html +-------------------------------------------------------------- */ + +html, body, div, span, applet, object, iframe, +h1, h2, h3, h4, h5, h6, p, blockquote, pre, +a, abbr, acronym, address, big, cite, code, +del, dfn, em, font, ins, kbd, q, s, samp, +small, strike, strong, sub, sup, tt, var, +dl, dt, dd, ol, ul, li, +fieldset, form, label, legend, +table, caption, tbody, tfoot, thead, tr, th, td { + border: 0; + font-family: inherit; + font-size: 100%; + font-style: inherit; + font-weight: inherit; + margin: 0; + outline: 0; + padding: 0; + vertical-align: baseline; +} +:focus {/* remember to define focus styles! */ + outline: 0; +} +body { + background: #fff; + line-height: 1; +} +ol, ul { + list-style: none; +} +table {/* tables still need 'cellspacing="0"' in the markup */ + border-collapse: separate; + border-spacing: 0; +} +caption, th, td { + font-weight: normal; + text-align: left; +} +blockquote:before, blockquote:after, +q:before, q:after { + content: ""; +} +blockquote, q { + quotes: "" ""; +} +a img { + border: 0; +} +article, aside, details, figcaption, figure, +footer, header, hgroup, menu, nav, section { + display: block; +} + + +/* =Structure +----------------------------------------------- */ + +body { + padding: 0 2em; +} +#page { + margin: 2em auto; + max-width: 1000px; +} +#branding hgroup { + margin: 0 7.6%; +} +#access div { + margin: 0 7.6%; +} +#primary { + float: left; + margin: 0 -26.4% 0 0; + width: 100%; +} +#content { + margin: 0 34% 0 7.6%; + width: 58.4%; +} +#secondary { + float: right; + margin-right: 7.6%; + width: 18.8%; +} + +/* Singular */ +.singular #primary { + margin: 0; +} +.singular #content, +.left-sidebar.singular #content { + margin: 0 7.6%; + position: relative; + width: auto; +} +.singular .entry-header, +.singular .entry-content, +.singular footer.entry-meta, +.singular #comments-title { + margin: 0 auto; + width: 68.9%; +} + +/* Attachments */ +.singular .image-attachment .entry-content { + margin: 0 auto; + width: auto; +} +.singular .image-attachment .entry-description { + margin: 0 auto; + width: 68.9%; +} + +/* Showcase */ +.page-template-showcase-php #primary, +.left-sidebar.page-template-showcase-php #primary { + margin: 0; +} +.page-template-showcase-php #content, +.left-sidebar.page-template-showcase-php #content { + margin: 0 7.6%; + width: auto; +} +.page-template-showcase-php section.recent-posts { + float: right; + margin: 0 0 0 31%; + width: 69%; +} +.page-template-showcase-php #main .widget-area { + float: left; + margin: 0 -22.15% 0 0; + width: 22.15%; +} + +/* error404 */ +.error404 #primary { + float: none; + margin: 0; +} +.error404 #primary #content { + margin: 0 7.6%; + width: auto; +} + +/* Alignment */ +.alignleft { + display: inline; + float: left; + margin-right: 1.625em; +} +.alignright { + display: inline; + float: right; + margin-left: 1.625em; +} +.aligncenter { + clear: both; + display: block; + margin-left: auto; + margin-right: auto; +} + +/* Right Content */ +.left-sidebar #primary { + float: right; + margin: 0 0 0 -26.4%; + width: 100%; +} +.left-sidebar #content { + margin: 0 7.6% 0 34%; + width: 58.4%; +} +.left-sidebar #secondary { + float: left; + margin-left: 7.6%; + margin-right: 0; + width: 18.8%; +} + +/* One column */ +.one-column #page { + max-width: 690px; +} +.one-column #content { + margin: 0 7.6%; + width: auto; +} +.one-column #nav-below { + border-bottom: 1px solid #ddd; + margin-bottom: 1.625em; +} +.one-column #secondary { + float: none; + margin: 0 7.6%; + width: auto; +} +/* Simplify the showcase template */ +.one-column .page-template-showcase-php section.recent-posts { + float: none; + margin: 0; + width: 100%; +} +.one-column .page-template-showcase-php #main .widget-area { + float: none; + margin: 0; + width: auto; +} +.one-column .page-template-showcase-php .other-recent-posts { + border-bottom: 1px solid #ddd; +} +/* Simplify the showcase template when small feature */ +.one-column section.featured-post .attachment-small-feature { + border: none; + display: block; + height: auto; + max-width: 60%; + position: static; +} +.one-column article.feature-image.small { + margin: 0 0 1.625em; + padding: 0; +} +.one-column article.feature-image.small .entry-title { + font-size: 20px; + line-height: 1.3em; +} +.one-column article.feature-image.small .entry-summary { + height: 150px; + overflow: hidden; + padding: 0; + text-overflow: ellipsis; +} +.one-column article.feature-image.small .entry-summary a { + left: -9%; +} +/* Remove the margin on singular articles */ +.one-column.singular .entry-header, +.one-column.singular .entry-content, +.one-column.singular footer.entry-meta, +.one-column.singular #comments-title { + width: 100%; +} +/* Simplify the pullquotes and pull styles */ +.one-column.singular blockquote.pull { + margin: 0 0 1.625em; +} +.one-column.singular .pull.alignleft { + margin: 0 1.625em 0 0; +} +.one-column.singular .pull.alignright { + margin: 0 0 0 1.625em; +} +.one-column.singular .entry-meta .edit-link a { + position: absolute; + left: 0; + top: 40px; +} +.one-column.singular #author-info { + margin: 2.2em -8.8% 0; + padding: 20px 8.8%; +} +/* Make sure we have room for our comment avatars */ +.one-column .commentlist > li.comment { + margin-left: 102px; + width: auto; +} +/* Make sure the logo and search form don't collide */ +.one-column #branding #searchform { + right: 40px; + top: 4em; +} +/* Talking avatars take up too much room at this size */ +.one-column .commentlist > li.comment { + margin-left: 0; +} +.one-column .commentlist > li.comment .comment-meta, +.one-column .commentlist > li.comment .comment-content { + margin-right: 85px; +} +.one-column .commentlist .avatar { + background: transparent; + display: block; + padding: 0; + top: 1.625em; + left: auto; + right: 1.625em; +} +.one-column .commentlist .children .avatar { + background: none; + padding: 0; + position: absolute; + top: 2.2em; + left: 2.2em; +} +.one-column #respond { + width: auto; +} + + +/* =Global +----------------------------------------------- */ + +body, input, textarea { + color: #373737; + font: 15px "Helvetica Neue", Helvetica, Arial, sans-serif; + font-weight: 300; + line-height: 1.625; +} +body { + background: #e2e2e2; +} +#page { + background: #fff; +} + +/* Headings */ +h1,h2,h3,h4,h5,h6 { + clear: both; +} +hr { + background-color: #ccc; + border: 0; + height: 1px; + margin-bottom: 1.625em; +} + +/* Text elements */ +p { + margin-bottom: 1.625em; +} +ul, ol { + margin: 0 0 1.625em 2.5em; +} +ul { + list-style: square; +} +ol { + list-style-type: decimal; +} +ol ol { + list-style: upper-alpha; +} +ol ol ol { + list-style: lower-roman; +} +ol ol ol ol { + list-style: lower-alpha; +} +ul ul, ol ol, ul ol, ol ul { + margin-bottom: 0; +} +dl { + margin: 0 1.625em; +} +dt { + font-weight: bold; +} +dd { + margin-bottom: 1.625em; +} +strong { + font-weight: bold; +} +cite, em, i { + font-style: italic; +} +blockquote { + font-family: Georgia, "Bitstream Charter", serif; + font-style: italic; + font-weight: normal; + margin: 0 3em; +} +blockquote em, blockquote i, blockquote cite { + font-style: normal; +} +blockquote cite { + color: #666; + font: 12px "Helvetica Neue", Helvetica, Arial, sans-serif; + font-weight: 300; + letter-spacing: 0.05em; + text-transform: uppercase; +} +pre { + background: #f4f4f4; + font: 13px "Courier 10 Pitch", Courier, monospace; + line-height: 1.5; + margin-bottom: 1.625em; + overflow: auto; + padding: 0.75em 1.625em; +} +code, kbd { + font: 13px Monaco, Consolas, "Andale Mono", "DejaVu Sans Mono", monospace; +} +abbr, acronym, dfn { + border-bottom: 1px dotted #666; + cursor: help; +} +address { + display: block; + margin: 0 0 1.625em; +} +ins { + background: #fff9c0; + text-decoration: none; +} +sup, +sub { + font-size: 10px; + height: 0; + line-height: 1; + position: relative; + vertical-align: baseline; +} +sup { + bottom: 1ex; +} +sub { + top: .5ex; +} + +/* Forms */ +input[type=text], +input[type=password], +textarea { + background: #fafafa; + -moz-box-shadow: inset 0 1px 1px rgba(0,0,0,0.1); + -webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,0.1); + box-shadow: inset 0 1px 1px rgba(0,0,0,0.1); + border: 1px solid #ddd; + color: #888; +} +input[type=text]:focus, +textarea:focus { + color: #373737; +} +textarea { + padding-left: 3px; + width: 98%; +} +input[type=text] { + padding: 3px; +} +input#s { + background: url(images/search.png) no-repeat 5px 6px; + -moz-border-radius: 2px; + border-radius: 2px; + font-size: 14px; + height: 22px; + line-height: 1.2em; + padding: 4px 10px 4px 28px; +} +input#searchsubmit { + display: none; +} + +/* Links */ +a { + color: #1982d1; + text-decoration: none; +} +a:focus, +a:active, +a:hover { + text-decoration: underline; +} + +/* Assistive text */ +.assistive-text { + position: absolute !important; + clip: rect(1px 1px 1px 1px); /* IE6, IE7 */ + clip: rect(1px, 1px, 1px, 1px); +} +#access a.assistive-text:active, +#access a.assistive-text:focus { + background: #eee; + border-bottom: 1px solid #ddd; + color: #1982d1; + clip: auto !important; + font-size: 12px; + position: absolute; + text-decoration: underline; + top: 0; + left: 7.6%; +} + + +/* =Header +----------------------------------------------- */ + +#branding { + border-top: 2px solid #bbb; + padding-bottom: 10px; + position: relative; + z-index: 9999; +} +#site-title { + margin-right: 270px; + padding: 3.65625em 0 0; +} +#site-title a { + color: #111; + font-size: 30px; + font-weight: bold; + line-height: 36px; + text-decoration: none; +} +#site-title a:hover, +#site-title a:focus, +#site-title a:active { + color: #1982d1; +} +#site-description { + color: #7a7a7a; + font-size: 14px; + margin: 0 270px 3.65625em 0; +} +#branding img { + height: auto; + margin-bottom: -7px; + width: 100%; +} + + +/* =Menu +-------------------------------------------------------------- */ + +#access { + background: #222; /* Show a solid color for older browsers */ + background: -moz-linear-gradient(#252525, #0a0a0a); + background: -o-linear-gradient(#252525, #0a0a0a); + background: -webkit-gradient(linear, 0% 0%, 0% 100%, from(#252525), to(#0a0a0a)); /* older webkit syntax */ + background: -webkit-linear-gradient(#252525, #0a0a0a); + -webkit-box-shadow: rgba(0, 0, 0, 0.4) 0px 1px 2px; + -moz-box-shadow: rgba(0, 0, 0, 0.4) 0px 1px 2px; + box-shadow: rgba(0, 0, 0, 0.4) 0px 1px 2px; + clear: both; + display: block; + float: left; + margin: 0 auto 6px; + width: 100%; +} +#access ul { + font-size: 13px; + list-style: none; + margin: 0 0 0 -0.8125em; + padding-left: 0; +} +#access li { + float: left; + position: relative; +} +#access a { + color: #eee; + display: block; + line-height: 3.333em; + padding: 0 1.2125em; + text-decoration: none; +} +#access ul ul { + -moz-box-shadow: 0 3px 3px rgba(0,0,0,0.2); + -webkit-box-shadow: 0 3px 3px rgba(0,0,0,0.2); + box-shadow: 0 3px 3px rgba(0,0,0,0.2); + display: none; + float: left; + margin: 0; + position: absolute; + top: 3.333em; + left: 0; + width: 188px; + z-index: 99999; +} +#access ul ul ul { + left: 100%; + top: 0; +} +#access ul ul a { + background: #f9f9f9; + border-bottom: 1px dotted #ddd; + color: #444; + font-size: 13px; + font-weight: normal; + height: auto; + line-height: 1.4em; + padding: 10px 10px; + width: 168px; +} +#access li:hover > a, +#access ul ul :hover > a, +#access a:focus { + background: #efefef; +} +#access li:hover > a, +#access a:focus { + background: #f9f9f9; /* Show a solid color for older browsers */ + background: -moz-linear-gradient(#f9f9f9, #e5e5e5); + background: -o-linear-gradient(#f9f9f9, #e5e5e5); + background: -webkit-gradient(linear, 0% 0%, 0% 100%, from(#f9f9f9), to(#e5e5e5)); /* Older webkit syntax */ + background: -webkit-linear-gradient(#f9f9f9, #e5e5e5); + color: #373737; +} +#access ul li:hover > ul { + display: block; +} +#access .current-menu-item > a, +#access .current-menu-ancestor > a, +#access .current_page_item > a, +#access .current_page_ancestor > a { + font-weight: bold; +} + +/* Search Form */ +#branding #searchform { + position: absolute; + top: 3.8em; + right: 7.6%; + text-align: right; +} +#branding #searchform div { + margin: 0; +} +#branding #s { + float: right; + -webkit-transition-duration: 400ms; + -webkit-transition-property: width, background; + -webkit-transition-timing-function: ease; + -moz-transition-duration: 400ms; + -moz-transition-property: width, background; + -moz-transition-timing-function: ease; + -o-transition-duration: 400ms; + -o-transition-property: width, background; + -o-transition-timing-function: ease; + width: 72px; +} +#branding #s:focus { + background-color: #f9f9f9; + width: 196px; +} +#branding #searchsubmit { + display: none; +} +#branding .only-search #searchform { + top: 5px; + z-index: 1; +} +#branding .only-search #s { + background-color: #666; + border-color: #000; + color: #222; +} +#branding .only-search #s, +#branding .only-search #s:focus { + width: 85%; +} +#branding .only-search #s:focus { + background-color: #bbb; +} +#branding .with-image #searchform { + top: auto; + bottom: -27px; + max-width: 195px; +} +#branding .only-search + #access div { + padding-right: 205px; +} + + +/* =Content +----------------------------------------------- */ + +#main { + clear: both; + padding: 1.625em 0 0; +} +.page-title { + color: #666; + font-size: 10px; + font-weight: 500; + letter-spacing: 0.1em; + line-height: 2.6em; + margin: 0 0 2.6em; + text-transform: uppercase; +} +.page-title a { + font-size: 12px; + font-weight: bold; + letter-spacing: 0; + text-transform: none; +} +.hentry, +.no-results { + border-bottom: 1px solid #ddd; + margin: 0 0 1.625em; + padding: 0 0 1.625em; + position: relative; +} +.hentry:last-child, +.no-results { + border-bottom: none; +} +.blog .sticky .entry-header .entry-meta { + clip: rect(1px 1px 1px 1px); /* IE6, IE7 */ + clip: rect(1px, 1px, 1px, 1px); + position: absolute !important; +} +.entry-title, +.entry-header .entry-meta { + padding-right: 76px; +} +.entry-title { + clear: both; + color: #222; + font-size: 26px; + font-weight: bold; + line-height: 1.5em; + padding-bottom: .3em; + padding-top: 15px; +} +.entry-title, +.entry-title a { + color: #222; + text-decoration: none; +} +.entry-title a:hover, +.entry-title a:focus, +.entry-title a:active { + color: #1982d1; +} +.entry-meta { + color: #666; + clear: both; + font-size: 12px; + line-height: 18px; +} +.entry-meta a { + font-weight: bold; +} +.single-author .entry-meta .by-author { + display: none; +} +.entry-content, +.entry-summary { + padding: 1.625em 0 0; +} +.entry-content h1, +.entry-content h2, +.comment-content h1, +.comment-content h2 { + color: #000; + font-weight: bold; +} +.entry-content h3, +.comment-content h3 { + font-size: 10px; + letter-spacing: 0.1em; + line-height: 2.6em; + text-transform: uppercase; +} +.entry-content table, +.comment-content table { + border-bottom: 1px solid #ddd; + margin: 0 0 1.625em; + width: 100%; +} +.entry-content th, +.comment-content th { + color: #666; + font-size: 10px; + font-weight: 500; + letter-spacing: 0.1em; + line-height: 2.6em; + text-transform: uppercase; +} +.entry-content td, +.comment-content td { + border-top: 1px solid #ddd; + padding: 6px 10px 6px 0; +} +.entry-content #s { + width: 75%; +} +.comment-content ul, +.comment-content ol { + margin-bottom: 1.625em; +} +.comment-content ul ul, +.comment-content ol ol, +.comment-content ul ol, +.comment-content ol ul { + margin-bottom: 0; +} +dl.gallery-item { + margin: 0; +} +.page-link { + clear: both; + display: block; + margin: 0 0 1.625em; +} +.page-link a { + background: #eee; + color: #373737; + margin: 0; + padding: 2px 3px; + text-decoration: none; +} +.page-link a:hover { + background: #888; + color: #fff; + font-weight: bold; +} +.page-link span { + margin-right: 6px; +} +.entry-meta .edit-link a, +.commentlist .edit-link a { + background: #eee; + -moz-border-radius: 3px; + border-radius: 3px; + color: #666; + float: right; + font-size: 12px; + line-height: 1.5em; + font-weight: 300; + text-decoration: none; + padding: 0 8px; +} +.entry-meta .edit-link a:hover, +.commentlist .edit-link a:hover { + background: #888; + color: #fff; +} +.entry-content .edit-link { + clear: both; + display: block; +} + +/* Images */ +.entry-content img, +.comment-content img, +.widget img { + max-width: 97.5%; /* Fluid images for posts, comments, and widgets */ +} +img[class*="align"], +img[class*="wp-image-"], +img[class*="attachment-"] { + height: auto; /* Make sure images with WordPress-added height and width attributes are scaled correctly */ +} +img.size-full, +img.size-large { + max-width: 97.5%; + width: auto; /* Prevent stretching of full-size and large-size images with height and width attributes in IE8 */ + height: auto; /* Make sure images with WordPress-added height and width attributes are scaled correctly */ +} +.entry-content img.wp-smiley { + border: none; + margin-bottom: 0; + margin-top: 0; + padding: 0; +} +img.alignleft, +img.alignright, +img.aligncenter { + margin-bottom: 1.625em; +} +p img, +.wp-caption { + margin-top: 0.4em; +} +.wp-caption { + background: #eee; + margin-bottom: 1.625em; + max-width: 96%; + padding: 9px; +} +.wp-caption img { + display: block; + margin: 0 auto; + max-width: 98%; +} +.wp-caption .wp-caption-text, +.gallery-caption { + color: #666; + font-family: Georgia, serif; + font-size: 12px; +} +.wp-caption .wp-caption-text { + margin-bottom: 0.6em; + padding: 10px 0 5px 40px; + position: relative; +} +.wp-caption .wp-caption-text:before { + color: #666; + content: '\2014'; + font-size: 14px; + font-style: normal; + font-weight: bold; + margin-right: 5px; + position: absolute; + left: 10px; + top: 7px; +} +#content .gallery { + margin: 0 auto 1.625em; +} +#content .gallery a img { + border: none; +} +img#wpstats { + display: block; + margin: 0 auto 1.625em; +} +#content .gallery-columns-4 .gallery-item { + width: 23%; + padding-right: 2%; +} +#content .gallery-columns-4 .gallery-item img { + width: 100%; + height: auto; +} + +/* Image borders */ +img[class*="align"], +img[class*="wp-image-"], +#content .gallery .gallery-icon img {/* Add fancy borders to all WordPress-added images but not things like badges and icons and the like */ + border: 1px solid #ddd; + padding: 6px; +} +.wp-caption img { + border-color: #eee; +} +a:focus img[class*="align"], +a:hover img[class*="align"], +a:active img[class*="align"], +a:focus img[class*="wp-image-"], +a:hover img[class*="wp-image-"], +a:active img[class*="wp-image-"], +#content .gallery .gallery-icon a:focus img, +#content .gallery .gallery-icon a:hover img, +#content .gallery .gallery-icon a:active img {/* Add some useful style to those fancy borders for linked images ... */ + background: #eee; + border-color: #bbb; +} +.wp-caption a:focus img, +.wp-caption a:active img, +.wp-caption a:hover img {/* ... including captioned images! */ + background: #fff; + border-color: #ddd; +} + +/* Make sure embeds and iframes fit their containers */ +embed, +iframe, +object { + max-width: 100%; +} + +/* Password Protected Posts */ +.post-password-required .entry-header .comments-link { + margin: 1.625em 0 0; +} +.post-password-required input[type=password] { + margin: 0.8125em 0; +} +.post-password-required input[type=password]:focus { + background: #f7f7f7; +} + +/* Author Info */ +#author-info { + font-size: 12px; + overflow: hidden; +} +.singular #author-info { + background: #f9f9f9; + border-top: 1px solid #ddd; + border-bottom: 1px solid #ddd; + margin: 2.2em -35.6% 0 -35.4%; + padding: 20px 35.4%; +} +.archive #author-info { + border-bottom: 1px solid #ddd; + margin: 0 0 2.2em; + padding: 0 0 2.2em; +} +#author-avatar { + float: left; + margin-right: -78px; +} +#author-avatar img { + background: #fff; + -moz-border-radius: 3px; + border-radius: 3px; + -webkit-box-shadow: 0 1px 2px #bbb; + -moz-box-shadow: 0 1px 2px #bbb; + box-shadow: 0 1px 2px #bbb; + padding: 3px; +} +#author-description { + float: left; + margin-left: 108px; +} +#author-description h2 { + color: #000; + font-size: 15px; + font-weight: bold; + margin: 5px 0 10px; +} + +/* Comments link */ +.entry-header .comments-link a { + background: #eee url(images/comment-bubble.png) no-repeat; + color: #666; + font-size: 13px; + font-weight: normal; + line-height: 35px; + overflow: hidden; + padding: 0 0 0; + position: absolute; + top: 1.5em; + right: 0; + text-align: center; + text-decoration: none; + width: 43px; + height: 36px; +} +.entry-header .comments-link a:hover, +.entry-header .comments-link a:focus, +.entry-header .comments-link a:active { + background-color: #1982d1; + color: #fff; + color: rgba(255,255,255,0.8); +} +.entry-header .comments-link .leave-reply { + visibility: hidden; +} + +/* +Post Formats Headings +To hide the headings, display: none the ".entry-header .entry-format" selector, +and remove the padding rules below. +*/ +.entry-header .entry-format { + color: #666; + font-size: 10px; + font-weight: 500; + letter-spacing: 0.1em; + line-height: 2.6em; + position: absolute; + text-transform: uppercase; + top: -5px; +} +.entry-header hgroup .entry-title { + padding-top: 15px; +} +article.format-aside .entry-content, +article.format-link .entry-content, +article.format-status .entry-content { + padding: 20px 0 0; +} +article.format-status .entry-content { + min-height: 65px; +} +.recent-posts .entry-header .entry-format { + display: none; +} +.recent-posts .entry-header hgroup .entry-title { + padding-top: 0; +} + +/* Singular content styles for Posts and Pages */ +.singular .hentry { + border-bottom: none; + padding: 4.875em 0 0; + position: relative; +} +.singular.page .hentry { + padding: 3.5em 0 0; +} +.singular .entry-title { + color: #000; + font-size: 36px; + font-weight: bold; + line-height: 48px; +} +.singular .entry-title, +.singular .entry-header .entry-meta { + padding-right: 0; +} +.singular .entry-header .entry-meta { + position: absolute; + top: 0; + left: 0; +} +blockquote.pull { + font-size: 21px; + font-weight: bold; + line-height: 1.6125em; + margin: 0 0 1.625em; + text-align: center; +} +.singular blockquote.pull { + margin: 0 -22.25% 1.625em; +} +.pull.alignleft { + margin: 0 1.625em 0 0; + text-align: right; + width: 33%; +} +.singular .pull.alignleft { + margin: 0 1.625em 0 -22.25%; +} +.pull.alignright { + margin: 0 0 0 1.625em; + text-align: left; + width: 33%; +} +.singular .pull.alignright { + margin: 0 -22.25% 0 1.625em; +} +.singular blockquote.pull.alignleft, +.singular blockquote.pull.alignright { + width: 33%; +} +.singular .entry-meta .edit-link a { + bottom: auto; + left: 50px; + position: absolute; + right: auto; + top: 80px; +} + + +/* =Aside +----------------------------------------------- */ + +.format-aside .entry-title, +.format-aside .entry-header .comments-link { + display: none; +} +.singular .format-aside .entry-title { + display: block; +} +.format-aside .entry-content { + padding: 0; +} +.singular .format-aside .entry-content { + padding: 1.625em 0 0; +} + + +/* =Link +----------------------------------------------- */ + +.format-link .entry-title, +.format-link .entry-header .comments-link { + display: none; +} +.singular .format-link .entry-title { + display: block; +} +.format-link .entry-content { + padding: 0; +} +.singular .format-link .entry-content { + padding: 1.625em 0 0; +} + + +/* =Gallery +----------------------------------------------- */ + +.format-gallery .gallery-thumb { + float: left; + display: block; + margin: .375em 1.625em 0 0; +} + + +/* =Status +----------------------------------------------- */ + +.format-status .entry-title, +.format-status .entry-header .comments-link { + display: none; +} +.singular .format-status .entry-title { + display: block; +} +.format-status .entry-content { + padding: 0; +} +.singular .format-status .entry-content { + padding: 1.625em 0 0; +} +.format-status img.avatar { + -moz-border-radius: 3px; + border-radius: 3px; + -webkit-box-shadow: 0 1px 2px #ccc; + -moz-box-shadow: 0 1px 2px #ccc; + box-shadow: 0 1px 2px #ccc; + float: left; + margin: 4px 10px 2px 0; + padding: 0; +} + + +/* =Quote +----------------------------------------------- */ + +.format-quote blockquote { + color: #555; + font-size: 17px; + margin: 0; +} + + +/* =Image +----------------------------------------------- */ + +.indexed.format-image .entry-header { + min-height: 61px; /* Prevent the comment icon from colliding with the image when there is no title */ +} +.indexed.format-image .entry-content { + padding-top: 0.5em; +} +.indexed.format-image p, +.indexed.format-image p img { + margin-bottom: 0; +} +.indexed.format-image footer.entry-meta { + background: #ddd; + margin-top: -7px; + padding: 20px 30px; + overflow: hidden; +} +.indexed.format-image div.entry-meta { + display: inline-block; + float: left; + width: 35%; +} +.indexed.format-image div.entry-meta + div.entry-meta { + float: none; + width: 65%; +} +.indexed.format-image .entry-meta span.cat-links, +.indexed.format-image .entry-meta span.tag-links, +.indexed.format-image .entry-meta span.comments-link { + display: block; +} +.indexed.format-image footer.entry-meta a { + color: #444; +} +.indexed.format-image footer.entry-meta a:hover { + color: #fff; +} +#content .indexed.format-image img { + border: none; + max-width: 100%; + padding: 0; +} +.indexed.format-image .wp-caption { + background: #111; + margin-bottom: 0; + max-width: 96%; + padding: 11px; +} +.indexed.format-image .wp-caption .wp-caption-text { + color: #ddd; +} +.indexed.format-image .wp-caption .wp-caption-text:before { + color: #444; +} +.indexed.format-image a:hover img { + opacity: 0.8; +} + + +/* =error404 +----------------------------------------------- */ + +.error404 #main #searchform { + background: #f9f9f9; + border: 1px solid #ddd; + border-width: 1px 0; + margin: 0 -8.9% 1.625em; + overflow: hidden; + padding: 1.625em 8.9%; +} +.error404 #main #s { + width: 95%; +} +.error404 #main .widget { + clear: none; + float: left; + margin-right: 3.7%; + width: 30.85%; +} +.error404 #main .widget_archive { + margin-right: 0; +} +.error404 #main .widget_tag_cloud { + float: none; + margin-right: 0; + width: 100%; +} +.error404 .widgettitle { + font-size: 10px; + letter-spacing: 0.1em; + line-height: 2.6em; + text-transform: uppercase; +} + + +/* =Showcase +----------------------------------------------- */ + +h1.showcase-heading { + color: #666; + font-size: 10px; + font-weight: 500; + letter-spacing: 0.1em; + line-height: 2.6em; + text-transform: uppercase; +} + +/* Intro */ +article.intro { + background: #f9f9f9; + border-bottom: none; + margin: -1.855em -8.9% 1.625em; + padding: 0 8.9%; +} +article.intro .entry-title { + display: none; +} +article.intro .entry-content { + color: #111; + font-size: 16px; + padding: 1.625em 0 0.625em; +} +article.intro .edit-link a { + background: #aaa; + -moz-border-radius: 3px; + border-radius: 3px; + color: #fff; + font-size: 12px; + padding: 0 8px; + position: absolute; + top: 30px; + right: 20px; + text-decoration: none; +} +article.intro .edit-link a:hover, +article.intro .edit-link a:focus, +article.intro .edit-link a:active { + background: #777; +} + +/* Featured post */ +section.featured-post { + float: left; + margin: -1.625em -8.9% 1.625em; + padding: 1.625em 8.9% 0; + position: relative; + width: 100%; +} +section.featured-post .hentry { + border: none; + color: #666; + margin: 0; +} +section.featured-post .entry-meta { + clip: rect(1px 1px 1px 1px); /* IE6, IE7 */ + clip: rect(1px, 1px, 1px, 1px); + position: absolute !important; +} + +/* Small featured post */ +section.featured-post .attachment-small-feature { + float: right; + height: auto; + margin: 0 -8.9% 1.625em 0; + max-width: 59%; + position: relative; + right: -15px; +} +section.featured-post.small { + padding-top: 0; +} +section.featured-post .attachment-small-feature:hover, +section.featured-post .attachment-small-feature:focus, +section.featured-post .attachment-small-feature:active { + opacity: .8; +} +article.feature-image.small { + float: left; + margin: 0 0 1.625em; + width: 45%; +} +article.feature-image.small .entry-title { + line-height: 1.2em; +} +article.feature-image.small .entry-summary { + color: #555; + font-size: 13px; +} +article.feature-image.small .entry-summary p a { + background: #222; + color: #eee; + display: block; + left: -23.8%; + padding: 9px 26px 9px 85px; + position: relative; + text-decoration: none; + top: 20px; + width: 180px; + z-index: 1; +} +article.feature-image.small .entry-summary p a:hover { + background: #1982d1; + color: #eee; + color: rgba(255,255,255,0.8); +} + +/* Large featured post */ +section.feature-image.large { + border: none; + max-height: 288px; + padding: 0; + width: 100%; +} +section.feature-image.large .showcase-heading { + display: none; +} +section.feature-image.large .hentry { + border-bottom: none; + left: 9%; + margin: 1.625em 9% 0 0; + position: absolute; + top: 0; +} +article.feature-image.large .entry-title a { + background: #222; + background: rgba(0,0,0,0.8); + -moz-border-radius: 3px; + border-radius: 3px; + color: #fff; + display: inline-block; + font-weight: 300; + padding: .2em 20px; +} +section.feature-image.large:hover .entry-title a, +section.feature-image.large .entry-title:hover a { + background: #eee; + background: rgba(255,255,255,0.8); + color: #222; +} +article.feature-image.large .entry-summary { + display: none; +} +section.feature-image.large img { + display: block; + height: auto; + max-width: 117.9%; + padding: 0 0 6px; +} + +/* Featured Slider */ +.featured-posts { + border-bottom: 1px solid #ddd; + display: block; + height: 328px; + margin: 1.625em -8.9% 20px; + max-width: 1000px; + padding: 0; + position: relative; + overflow: hidden; +} +.featured-posts .showcase-heading { + padding-left: 8.9%; +} +.featured-posts section.featured-post { + background: #fff; + height: 288px; + left: 0; + margin: 0; + position: absolute; + top: 30px; + width: auto; +} +.featured-posts section.featured-post.large { + max-width: 100%; + overflow: hidden; +} +.featured-posts section.featured-post { + -webkit-transition-duration: 200ms; + -webkit-transition-property: opacity, visibility; + -webkit-transition-timing-function: ease; + -moz-transition-duration: 200ms; + -moz-transition-property: opacity, visibility; + -moz-transition-timing-function: ease; +} +.featured-posts section.featured-post { + opacity: 0; + visibility: hidden; +} +.featured-posts #featured-post-1 { + opacity: 1; + visibility: visible; +} +.featured-post .feature-text:after, +.featured-post .feature-image.small:after { + content: ' '; + background: -moz-linear-gradient(top, rgba(255,255,255,0) 0%, rgba(255,255,255,1) 100%); /* FF3.6+ */ + background: -webkit-gradient(linear, left top, left bottom, color-stop(0%,rgba(255,255,255,0)), color-stop(100%,rgba(255,255,255,1))); /* Chrome,Safari4+ */ + background: -webkit-linear-gradient(top, rgba(255,255,255,0) 0%,rgba(255,255,255,1) 100%); /* Chrome10+,Safari5.1+ */ + background: -o-linear-gradient(top, rgba(255,255,255,0) 0%,rgba(255,255,255,1) 100%); /* Opera11.10+ */ + background: -ms-linear-gradient(top, rgba(255,255,255,0) 0%,rgba(255,255,255,1) 100%); /* IE10+ */ + filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#00ffffff', endColorstr='#ffffff',GradientType=0 ); /* IE6-9 */ + background: linear-gradient(top, rgba(255,255,255,0) 0%,rgba(255,255,255,1) 100%); /* W3C */ + width: 100%; + height: 45px; + position: absolute; + top: 230px; +} +.featured-post .feature-image.small:after { + top: 253px; +} +#content .feature-slider { + top: 5px; + right: 8.9%; + overflow: visible; + position: absolute; +} +.feature-slider ul { + list-style-type: none; + margin: 0; +} +.feature-slider li { + float: left; + margin: 0 6px; +} +.feature-slider a { + background: #3c3c3c; + background: rgba(60,60,60,0.9); + -moz-border-radius: 12px; + border-radius: 12px; + -webkit-box-shadow: inset 1px 1px 5px rgba(0,0,0,0.5), inset 0 0 2px rgba(255,255,255,0.5); + -moz-box-shadow: inset 1px 1px 5px rgba(0,0,0,0.5), inset 0 0 2px rgba(255,255,255,0.5); + box-shadow: inset 1px 1px 5px rgba(0,0,0,0.5), inset 0 0 2px rgba(255,255,255,0.5); + display: block; + width: 14px; + height: 14px; +} +.feature-slider a.active { + background: #1982d1; + -webkit-box-shadow: inset 1px 1px 5px rgba(0,0,0,0.4), inset 0 0 2px rgba(255,255,255,0.8); + -moz-box-shadow: inset 1px 1px 5px rgba(0,0,0,0.4), inset 0 0 2px rgba(255,255,255,0.8); + box-shadow: inset 1px 1px 5px rgba(0,0,0,0.4), inset 0 0 2px rgba(255,255,255,0.8); + cursor: default; + opacity: 0.5; +} + +/* Recent Posts */ +section.recent-posts { + padding: 0 0 1.625em; +} +section.recent-posts .hentry { + border: none; + margin: 0; +} +section.recent-posts .other-recent-posts { + border-bottom: 1px solid #ddd; + list-style: none; + margin: 0; +} +section.recent-posts .other-recent-posts li { + padding: 0.3125em 0; + position: relative; +} +section.recent-posts .other-recent-posts .entry-title { + border-top: 1px solid #ddd; + font-size: 17px; +} +section.recent-posts .other-recent-posts a[rel="bookmark"] { + color: #373737; + float: left; + max-width: 84%; +} +section.recent-posts .other-recent-posts a[rel="bookmark"]:after { + content: '-'; + color: transparent; + font-size: 11px; +} +section.recent-posts .other-recent-posts a[rel="bookmark"]:hover { +} +section.recent-posts .other-recent-posts .comments-link a, +section.recent-posts .other-recent-posts .comments-link > span { + border-bottom: 2px solid #999; + bottom: -2px; + color: #444; + display: block; + font-size: 10px; + font-weight: 500; + line-height: 2.76333em; + padding: 0.3125em 0 0.3125em 1em; + position: absolute; + right: 0; + text-align: right; + text-transform: uppercase; + z-index: 1; +} +section.recent-posts .other-recent-posts .comments-link > span { + border-color: #bbb; + color: #888; +} +section.recent-posts .other-recent-posts .comments-link a:hover { + color: #1982d1; + border-color: #1982d1; +} +section.recent-posts .other-recent-posts li:after { + clear: both; + content: '.'; + display: block; + height: 0; + visibility: hidden; +} + + +/* =Attachments +----------------------------------------------- */ + +.image-attachment div.attachment { + background: #f9f9f9; + border: 1px solid #ddd; + border-width: 1px 0; + margin: 0 -8.9% 1.625em; + overflow: hidden; + padding: 1.625em 1.625em 0; + text-align: center; +} +.image-attachment div.attachment img { + display: block; + height: auto; + margin: 0 auto 1.625em; + max-width: 100%; +} +.image-attachment div.attachment a img { + border-color: #f9f9f9; +} +.image-attachment div.attachment a:focus img, +.image-attachment div.attachment a:hover img, +.image-attachment div.attachment a:active img { + border-color: #ddd; + background: #fff; +} +.image-attachment .entry-caption p { + font-size: 10px; + letter-spacing: 0.1em; + line-height: 2.6em; + margin: 0 0 2.6em; + text-transform: uppercase; +} + + +/* =Navigation +-------------------------------------------------------------- */ + +#content nav { + clear: both; + overflow: hidden; + padding: 0 0 1.625em; +} +#content nav a { + font-size: 12px; + font-weight: bold; + line-height: 2.2em; +} +#nav-above { + padding: 0 0 1.625em; +} +#nav-above { + display: none; +} +.paged #nav-above { + display: block; +} +.nav-previous { + float: left; + width: 50%; +} +.nav-next { + float: right; + text-align: right; + width: 50%; +} +#content nav .meta-nav { + font-weight: normal; +} + +/* Singular navigation */ +#nav-single { + float: right; + position: relative; + top: -0.3em; + text-align: right; + z-index: 1; +} +#nav-single .nav-previous, +#nav-single .nav-next { + float: none; + width: auto; +} +#nav-single .nav-next { + padding-left: .5em; +} + + +/* =Widgets +----------------------------------------------- */ + +.widget-area { + font-size: 12px; +} +.widget { + clear: both; + margin: 0 0 2.2em; +} +.widget-title { + color: #666; + font-size: 10px; + font-weight: 500; + letter-spacing: 0.1em; + line-height: 2.6em; + text-transform: uppercase; +} +.widget ul { + font-size: 15px; + margin: 0; +} +.widget ul ul { + margin-left: 1.5em; +} +.widget ul li { + color: #777; + font-size: 13px; +} +.widget a { + font-weight: bold; + text-decoration: none; +} +.widget a:hover, +.widget a:focus, +.widget a:active { + text-decoration: underline; +} + +/* Search Widget */ +.widget_search form { + margin: 0 0 1.625em; +} +.widget_search #s { + width: 77%; +} +.widget_search #searchsubmit { + background: #ddd; + border: 1px solid #ccc; + -webkit-box-shadow: inset 0px -1px 1px rgba(0, 0, 0, 0.09); + -moz-box-shadow: inset 0px -1px 1px rgba(0, 0, 0, 0.09); + box-shadow: inset 0px -1px 1px rgba(0, 0, 0, 0.09); + color: #888; + font-size: 13px; + line-height: 25px; + position: relative; + top: -2px; +} +.widget_search #searchsubmit:active { + background: #1982d1; + border-color: #0861a5; + -webkit-box-shadow: inset 0px 1px 1px rgba(0, 0, 0, 0.1); + -moz-box-shadow: inset 0px 1px 1px rgba(0, 0, 0, 0.1); + box-shadow: inset 0px 1px 1px rgba(0, 0, 0, 0.1); + color: #bfddf3; +} + +/* Ephemera Widget */ +section.ephemera ol, +.widget_twentyeleven_ephemera ol { + list-style: square; + margin: 5px 0 0; +} +.widget_twentyeleven_ephemera .widget-entry-title { + font-size: 15px; + font-weight: bold; + padding: 0; +} +.widget_twentyeleven_ephemera .comments-link a, +.widget_twentyeleven_ephemera .comments-link > span { + color: #666; + display: block; + font-size: 10px; + font-weight: 500; + line-height: 2.76333em; + text-transform: uppercase; +} +section.ephemera .entry-title .comments-link a:hover, +.widget_twentyeleven_ephemera .entry-title .comments-link a:hover { +} +section.ephemera .entry-title a span { + color: #29628d; +} + +/* Twitter */ +.widget_twitter li { + list-style-type: none; + margin-bottom: 14px; +} +.widget_twitter .timesince { + display: block; + font-size: 11px; + margin-right: -10px; + text-align: right; +} + +/* Widget Image */ +.widget_image img { + height: auto; + max-width: 100%; +} + +/* Calendar Widget */ + +.widget_calendar #wp-calendar { + color: #555; + width: 95%; + text-align: center; +} +.widget_calendar #wp-calendar caption, +.widget_calendar #wp-calendar td, +.widget_calendar #wp-calendar th { + text-align: center; +} +.widget_calendar #wp-calendar caption { + font-size: 11px; + font-weight: 500; + padding: 5px 0 3px 0; + text-transform: uppercase; +} +.widget_calendar #wp-calendar th { + background: #f4f4f4; + border-top: 1px solid #ccc; + border-bottom: 1px solid #ccc; + font-weight: bold; +} +.widget_calendar #wp-calendar tfoot td { + background: #f4f4f4; + border-top: 1px solid #ccc; + border-bottom: 1px solid #ccc; +} + + +/* =Comments +----------------------------------------------- */ + +#comments-title { + color: #666; + font-size: 10px; + font-weight: 500; + line-height: 2.6em; + padding: 0 0 2.6em; + text-transform: uppercase; +} +.nopassword, +.nocomments { + color: #aaa; + font-size: 24px; + font-weight: 100; + margin: 26px 0; + text-align: center; +} +.commentlist { + list-style: none; + margin: 0 auto; + width: 68.9%; +} +.content .commentlist, +.page-template-sidebar-page-php .commentlist { + width: 100%; /* reset the width for the one-column and sidebar page layout */ +} +.commentlist > li.comment { + background: #f6f6f6; + border: 1px solid #ddd; + -moz-border-radius: 3px; + border-radius: 3px; + margin: 0 0 1.625em; + padding: 1.625em; + position: relative; +} +.commentlist .pingback { + margin: 0 0 1.625em; + padding: 0 1.625em; +} +.commentlist .children { + list-style: none; + margin: 0; +} +.commentlist .children li.comment { + background: #fff; + border-left: 1px solid #ddd; + -moz-border-radius: 0 3px 3px 0; + border-radius: 0 3px 3px 0; + margin: 1.625em 0 0; + padding: 1.625em; + position: relative; +} +.commentlist .children li.comment .fn { + display: block; +} +.comment-meta .fn { + font-style: normal; +} +.comment-meta { + color: #666; + font-size: 12px; + line-height: 2.2em; +} +.commentlist .children li.comment .comment-meta { + line-height: 1.625em; + margin-left: 50px; +} +.commentlist .children li.comment .comment-content { + margin: 1.625em 0 0; +} +.comment-meta a { + font-weight: bold; +} +.comment-meta a:focus, +.comment-meta a:active, +.comment-meta a:hover { +} +.commentlist .avatar { + -moz-border-radius: 3px; + border-radius: 3px; + -webkit-box-shadow: 0 1px 2px #ccc; + -moz-box-shadow: 0 1px 2px #ccc; + box-shadow: 0 1px 2px #ccc; + left: -102px; + padding: 0; + position: absolute; + top: 0; +} +.commentlist > li:before { + content: url(images/comment-arrow.png); + left: -21px; + position: absolute; +} +.commentlist > li.pingback:before { + content: ''; +} +.commentlist .children .avatar { + background: none; + -webkit-box-shadow: none; + -moz-box-shadow: none; + box-shadow: none; + left: 2.2em; + padding: 0; + top: 2.2em; +} +a.comment-reply-link { + background: #eee; + -moz-border-radius: 3px; + border-radius: 3px; + color: #666; + display: inline-block; + font-size: 12px; + padding: 0 8px; + text-decoration: none; +} +a.comment-reply-link:hover, +a.comment-reply-link:focus, +a.comment-reply-link:active { + background: #888; + color: #fff; +} +a.comment-reply-link > span { + display: inline-block; + position: relative; + top: -1px; +} + +/* Post author highlighting */ +.commentlist > li.bypostauthor { + background: #ddd; + border-color: #d3d3d3; +} +.commentlist > li.bypostauthor .comment-meta { + color: #575757; +} +.commentlist > li.bypostauthor .comment-meta a:focus, +.commentlist > li.bypostauthor .comment-meta a:active, +.commentlist > li.bypostauthor .comment-meta a:hover { +} +.commentlist > li.bypostauthor:before { + content: url(images/comment-arrow-bypostauthor.png); +} + +/* Post Author threaded comments */ +.commentlist .children > li.bypostauthor { + background: #ddd; + border-color: #d3d3d3; +} + +/* sidebar-page.php comments */ +/* Make sure we have room for our comment avatars */ +.page-template-sidebar-page-php .commentlist > li.comment, +.page-template-sidebar-page-php.commentlist .pingback { + margin-left: 102px; + width: auto; +} +/* And a full-width comment form */ +.page-template-sidebar-page-php #respond { + width: auto; +} + +/* Comment Form */ +#respond { + background: #ddd; + border: 1px solid #d3d3d3; + -moz-border-radius: 3px; + border-radius: 3px; + margin: 0 auto 1.625em; + padding: 1.625em; + position: relative; + width: 68.9%; +} +#respond input[type="text"], +#respond textarea { + background: #fff; + border: 4px solid #eee; + -moz-border-radius: 5px; + border-radius: 5px; + -webkit-box-shadow: inset 0 1px 3px rgba(204,204,204,0.95); + -moz-box-shadow: inset 0 1px 3px rgba(204,204,204,0.95); + box-shadow: inset 0 1px 3px rgba(204,204,204,0.95); + position: relative; + padding: 10px; + text-indent: 80px; +} +#respond .comment-form-author, +#respond .comment-form-email, +#respond .comment-form-url, +#respond .comment-form-comment { + position: relative; +} +#respond .comment-form-author label, +#respond .comment-form-email label, +#respond .comment-form-url label, +#respond .comment-form-comment label { + background: #eee; + -webkit-box-shadow: 1px 2px 2px rgba(204,204,204,0.8); + -moz-box-shadow: 1px 2px 2px rgba(204,204,204,0.8); + box-shadow: 1px 2px 2px rgba(204,204,204,0.8); + color: #555; + display: inline-block; + font-size: 13px; + left: 4px; + min-width: 60px; + padding: 4px 10px; + position: relative; + top: 40px; + z-index: 1; +} +#respond input[type="text"]:focus, +#respond textarea:focus { + text-indent: 0; + z-index: 1; +} +#respond textarea { + resize: vertical; + width: 95%; +} +#respond .comment-form-author .required, +#respond .comment-form-email .required { + color: #bd3500; + font-size: 22px; + font-weight: bold; + left: 75%; + position: absolute; + top: 45px; + z-index: 1; +} +#respond .comment-notes, +#respond .logged-in-as { + font-size: 13px; +} +#respond p { + margin: 10px 0; +} +#respond .form-submit { + float: right; + margin: -20px 0 10px; +} +#respond input#submit { + background: #222; + border: none; + -moz-border-radius: 3px; + border-radius: 3px; + -webkit-box-shadow: 0px 1px 2px rgba(0,0,0,0.3); + -moz-box-shadow: 0px 1px 2px rgba(0,0,0,0.3); + box-shadow: 0px 1px 2px rgba(0,0,0,0.3); + color: #eee; + cursor: pointer; + font-size: 15px; + margin: 20px 0; + padding: 5px 42px 5px 22px; + position: relative; + left: 30px; + text-shadow: 0 -1px 0 rgba(0,0,0,0.3); +} +#respond input#submit:active { + background: #1982d1; + color: #bfddf3; +} +#respond #cancel-comment-reply-link { + color: #666; + margin-left: 10px; + text-decoration: none; +} +#respond .logged-in-as a:hover, +#respond #cancel-comment-reply-link:hover { + text-decoration: underline; +} +.commentlist #respond { + margin: 1.625em 0 0; + width: auto; +} +#reply-title { + color: #373737; + font-size: 24px; + font-weight: bold; + line-height: 30px; +} +#cancel-comment-reply-link { + color: #888; + display: block; + font-size: 10px; + font-weight: normal; + line-height: 2.2em; + letter-spacing: 0.05em; + position: absolute; + right: 1.625em; + text-decoration: none; + text-transform: uppercase; + top: 1.1em; +} +#cancel-comment-reply-link:focus, +#cancel-comment-reply-link:active, +#cancel-comment-reply-link:hover { + color: #ff4b33; +} +#respond label { + line-height: 2.2em; +} +#respond input[type=text] { + display: block; + height: 24px; + width: 75%; +} +#respond p { + font-size: 12px; +} +p.comment-form-comment { + margin: 0; +} +.form-allowed-tags { + display: none; +} + + +/* =Footer +----------------------------------------------- */ + +#colophon { + clear: both; +} +#supplementary { + border-top: 1px solid #ddd; + padding: 1.625em 7.6%; + overflow: hidden; +} + +/* Two Footer Widget Areas */ +#supplementary.two .widget-area { + float: left; + margin-right: 3.7%; + width: 48.1%; +} +#supplementary.two .widget-area + .widget-area { + margin-right: 0; +} + +/* Three Footer Widget Areas */ +#supplementary.three .widget-area { + float: left; + margin-right: 3.7%; + width: 30.85%; +} +#supplementary.three .widget-area + .widget-area + .widget-area { + margin-right: 0; +} + +/* Site Generator Line */ +#site-generator { + background: #f9f9f9; + border-top: 1px solid #ddd; + color: #666; + font-size: 12px; + line-height: 2.2em; + padding: 2.2em 0.5em; + text-align: center; +} +#site-generator a { + color: #555; + font-weight: bold; +} +#site-generator .sep { + background: url(images/wordpress.png) center left no-repeat; + color: transparent; + display: inline-block; + height: 16px; + line-height: 16px; + margin: 0 7px; + width: 16px; +} + + +/* =Responsive Structure +----------------------------------------------- */ + +@media (max-width: 800px) { + /* Simplify the basic layout */ + #main #content { + margin: 0 7.6%; + width: auto; + } + #nav-below { + border-bottom: 1px solid #ddd; + margin-bottom: 1.625em; + } + #main #secondary { + float: none; + margin: 0 7.6%; + width: auto; + } + /* Simplify the showcase template */ + .page-template-showcase-php .featured-posts { + min-height: 280px; + } + .featured-posts section.featured-post { + height: auto; + } + .page-template-showcase-php section.recent-posts { + float: none; + margin: 0; + width: 100%; + } + .page-template-showcase-php #main .widget-area { + float: none; + margin: 0; + width: auto; + } + .page-template-showcase-php .other-recent-posts { + border-bottom: 1px solid #ddd; + } + /* Simplify the showcase template when small feature */ + section.featured-post .attachment-small-feature, + .one-column section.featured-post .attachment-small-feature { + border: none; + display: block; + float: left; + height: auto; + margin: 0.625em auto 1.025em; + max-width: 30%; + position: static; + } + article.feature-image.small { + float: right; + margin: 0 0 1.625em; + width: 64%; + } + .one-column article.feature-image.small .entry-summary { + height: auto; + } + article.feature-image.small .entry-summary p a { + left: 0; + padding-left: 20px; + padding-right: 20px; + width: auto; + } + /* Remove the margin on singular articles */ + .singular .entry-header, + .singular .entry-content, + .singular footer.entry-meta, + .singular #comments-title { + width: 100%; + } + /* Simplify the pullquotes and pull styles */ + .singular blockquote.pull { + margin: 0 0 1.625em; + } + .singular .pull.alignleft { + margin: 0 1.625em 0 0; + } + .singular .pull.alignright { + margin: 0 0 0 1.625em; + } + .singular .entry-meta .edit-link a { + left: 0; + position: absolute; + top: 40px; + } + .singular #author-info { + margin: 2.2em -8.8% 0; + padding: 20px 8.8%; + } + /* Make sure we have room for our comment avatars */ + .commentlist { + width: 100%; + } + .commentlist > li.comment, + .commentlist .pingback { + margin-left: 102px; + width: auto; + } + /* And a full-width comment form */ + #respond { + width: auto; + } + /* No need to float footer widgets at this size */ + #colophon #supplementary .widget-area { + float: none; + margin-right: 0; + width: auto; + } + /* No need to float 404 widgets at this size */ + .error404 #main .widget { + float: none; + margin-right: 0; + width: auto; + } + +} +@media (max-width: 650px) { + /* @media (max-width: 650px) Reduce font-sizes for better readability on smaller devices */ + body, input, textarea { + font-size: 13px; + } + #site-title a { + font-size: 24px; + } + #site-description { + font-size: 12px; + } + #access ul { + font-size: 12px; + } + article.intro .entry-content { + font-size: 12px; + } + .entry-title { + font-size: 21px; + } + .featured-post .entry-title { + font-size: 14px; + } + .singular .entry-title { + font-size: 28px; + } + .entry-meta { + font-size: 12px; + } + blockquote { + margin: 0; + } + blockquote.pull { + font-size: 17px; + } + /* Reposition the site title and description slightly */ + #site-title { + padding: 5.30625em 0 0; + } + #site-title, + #site-description { + margin-right: 0; + } + /* Make sure the logo and search form don't collide */ + #branding #searchform { + top: 1.625em !important; + } + /* Floated content doesn't work well at this size */ + .alignleft, + .alignright { + float: none; + margin-left: 0; + margin-right: 0; + } + /* Make sure the post-post navigation doesn't collide with anything */ + #nav-single { + display: block; + position: static; + } + .singular .hentry { + padding: 1.625em 0 0; + } + .singular.page .hentry { + padding: 1.625em 0 0; + } + /* Talking avatars take up too much room at this size */ + .commentlist > li.comment, + .commentlist > li.pingback { + margin-left: 0 !important; + } + .commentlist .avatar { + background: transparent; + display: block; + padding: 0; + position: static; + } + .commentlist .children .avatar { + background: none; + left: 2.2em; + padding: 0; + position: absolute; + top: 2.2em; + } + /* Use the available space in the smaller comment form */ + #respond input[type="text"] { + width: 95%; + } + #respond .comment-form-author .required, + #respond .comment-form-email .required { + left: 95%; + } + #content .gallery-columns-3 .gallery-item { + width: 31%; + padding-right: 2%; + } + #content .gallery-columns-3 .gallery-item img { + width: 100%; + height: auto; + } + +} +@media (max-width: 450px) { + #content .gallery-columns-2 .gallery-item { + width: 45%; + padding-right: 4%; + } + #content .gallery-columns-2 .gallery-item img { + width: 100%; + height: auto; + } + +} +@media only screen and (min-device-width: 320px) and (max-device-width: 480px) { + body { + padding: 0; + } + #page { + margin-top: 0; + } + #branding { + border-top: none; + } + +} + + +/* =Print +----------------------------------------------- */ + +@media print { + body { + background: none !important; + font-size: 10pt; + } + footer.entry-meta a[rel=bookmark]:link:after, + footer.entry-meta a[rel=bookmark]:visited:after { + content: " [" attr(href) "] "; /* Show URLs */ + } + #page { + clear: both !important; + display: block !important; + float: none !important; + max-width: 100%; + position: relative !important; + } + #branding { + border-top: none !important; + padding: 0; + } + #branding hgroup { + margin: 0; + } + #site-title a { + font-size: 21pt; + } + #site-description { + font-size: 10pt; + } + #branding #searchform { + display: none; + } + #branding img { + display: none; + } + #access { + display: none; + } + #main { + border-top: none; + box-shadow: none; + } + #primary { + float: left; + margin: 0; + width: 100%; + } + #content { + margin: 0; + width: auto; + } + .singular #content { + margin: 0; + width: 100%; + } + .singular .entry-header .entry-meta { + position: static; + } + .entry-meta .edit-link a { + display: none; + } + #content nav { + display: none; + } + .singular .entry-header, + .singular .entry-content, + .singular footer.entry-meta, + .singular #comments-title { + margin: 0; + width: 100%; + } + .singular .hentry { + padding: 0; + } + .entry-title, + .singular .entry-title { + font-size: 21pt; + } + .entry-meta { + font-size: 10pt; + } + .entry-header .comments-link { + display: none; + } + .page-link { + display: none; + } + .singular #author-info { + background: none; + border-bottom: none; + border-top: none; + margin: 2.2em 0 0; + padding: 0; + } + #respond { + display: none; + } + .widget-area { + display: none; + } + #colophon { + display: none; + } + + /* Comments */ + .commentlist > li.comment { + background: none; + border: 1px solid #ddd; + -moz-border-radius: 3px 3px 3px 3px; + border-radius: 3px 3px 3px 3px; + margin: 0 auto 1.625em; + padding: 1.625em; + position: relative; + width: auto; + } + .commentlist .avatar { + height: 39px; + left: 2.2em; + top: 2.2em; + width: 39px; + } + .commentlist li.comment .comment-meta { + line-height: 1.625em; + margin-left: 50px; + } + .commentlist li.comment .fn { + display: block; + } + .commentlist li.comment .comment-content { + margin: 1.625em 0 0; + } + .commentlist .comment-edit-link { + display: none; + } + .commentlist > li::before, + .commentlist > li.bypostauthor::before { + content: ''; + } + .commentlist .reply { + display: none; + } + + /* Post author highlighting */ + .commentlist > li.bypostauthor { + color: #444; + } + .commentlist > li.bypostauthor .comment-meta { + color: #666; + } + .commentlist > li.bypostauthor:before { + content: none; + } + + /* Post Author threaded comments */ + .commentlist .children > li.bypostauthor { + background: #fff; + border-color: #ddd; + } + .commentlist .children > li.bypostauthor > article, + .commentlist .children > li.bypostauthor > article .comment-meta { + color: #666; + } + +} + + +/* =IE7 +----------------------------------------------- */ + +#ie7 article.intro { + margin-left: -7.6%; + margin-right: -7.6%; + padding-left: -7.6%; + padding-right: -7.6%; + max-width: 1000px; +} +#ie7 section.featured-post { + margin-left: -7.6%; + margin-right: -7.6%; + max-width: 850px; +} +#ie7 section.recent-posts { + margin-right: 7.6%; +} \ No newline at end of file diff --git a/Static HTML/index.html b/Static HTML/index.html new file mode 100644 index 0000000..3820a00 --- /dev/null +++ b/Static HTML/index.html @@ -0,0 +1,145 @@ + + + + UConn HuskyPress + + + + + + + + + + + + + + + +
+ + + + + + +
+
+
+
+

UConn vPC

+

Your computer lab. Anywhere. Anytime.

+

Access vPC from your iPad or Android device.

+

+ +
+

You can have content over here too!

+
+
+
+ +
+
+

What is UConn vPC?

+

UConn vPC is a virtual computer lab that allows you to use UConn Software and Resources from anywhere in the world (including your PC, Mac or iPad)!

+

UConn vPC is a collaboration between the School of Business, the School of Engineering, and the University Libraries.

+
+ +
+

How do I use it?

+

Visit our Help Center.

+

View available software.

+ +
+ +

Need more help?

+

Visit HuskyTech.

+
+
+
+ + + + + + +
+ + \ No newline at end of file diff --git a/404.php b/Wordpress/404.php similarity index 95% rename from 404.php rename to Wordpress/404.php index 4d2a4d5..0f2fab9 100644 --- a/404.php +++ b/Wordpress/404.php @@ -1,48 +1,48 @@ - - -
-
- -
-
-

-
- -
-

- - - - 10 ), array( 'widget_id' => '404' ) ); ?> - -
-

-
    - 'count', 'order' => 'DESC', 'show_count' => 1, 'title_li' => '', 'number' => 10 ) ); ?> -
-
- - ' . sprintf( __( 'Try looking in the monthly archives. %1$s', 'twentyeleven' ), convert_smilies( ':)' ) ) . '

'; - the_widget( 'WP_Widget_Archives', array('count' => 0 , 'dropdown' => 1 ), array( 'after_title' => ''.$archive_content ) ); - ?> - - - -
-
- -
-
- + + +
+
+ +
+
+

+
+ +
+

+ + + + 10 ), array( 'widget_id' => '404' ) ); ?> + +
+

+
    + 'count', 'order' => 'DESC', 'show_count' => 1, 'title_li' => '', 'number' => 10 ) ); ?> +
+
+ + ' . sprintf( __( 'Try looking in the monthly archives. %1$s', 'twentyeleven' ), convert_smilies( ':)' ) ) . '

'; + the_widget( 'WP_Widget_Archives', array('count' => 0 , 'dropdown' => 1 ), array( 'after_title' => ''.$archive_content ) ); + ?> + + + +
+
+ +
+
+ \ No newline at end of file diff --git a/BrowserDetect.js b/Wordpress/BrowserDetect.js similarity index 94% rename from BrowserDetect.js rename to Wordpress/BrowserDetect.js index b493a8c..64e448d 100644 --- a/BrowserDetect.js +++ b/Wordpress/BrowserDetect.js @@ -1,127 +1,127 @@ -var BrowserDetect = { - init: function () { - this.browser = this.searchString(this.dataBrowser) || "An unknown browser"; - this.version = this.searchVersion(navigator.userAgent) - || this.searchVersion(navigator.appVersion) - || "an unknown version"; - this.OS = this.searchString(this.dataOS) || "an unknown OS"; - }, - searchString: function (data) { - for (var i=0;i - -
-
- - - - - - - - - - - - - - - - - - -
-
-

-
- -
-

- -
-
- - - -
-
- - + + +
+
+ + + + + + + + + + + + + + + + + + +
+
+

+
+ +
+

+ +
+
+ + + +
+
+ + \ No newline at end of file diff --git a/author.php b/Wordpress/author.php similarity index 96% rename from author.php rename to Wordpress/author.php index 33d5429..69e4340 100644 --- a/author.php +++ b/Wordpress/author.php @@ -1,89 +1,89 @@ - - -
-
- - - - - - - - - - - - -
-
- -
-
-

- -
-
- - - - - - - - - - - - - -
-
-

-
- -
-

- -
-
- - - -
-
- - + + +
+
+ + + + + + + + + + + + +
+
+ +
+
+

+ +
+
+ + + + + + + + + + + + + +
+
+

+
+ +
+

+ +
+
+ + + +
+
+ + \ No newline at end of file diff --git a/category.php b/Wordpress/category.php similarity index 96% rename from category.php rename to Wordpress/category.php index e140117..113910c 100644 --- a/category.php +++ b/Wordpress/category.php @@ -1,64 +1,64 @@ - - -
-
- - - - - - - - - - - - - - - - - -
-
-

-
- -
-

- -
-
- - - -
-
- - - + + +
+
+ + + + + + + + + + + + + + + + + +
+
+

+
+ +
+

+ +
+
+ + + +
+
+ + + diff --git a/colors/dark.css b/Wordpress/colors/dark.css similarity index 95% rename from colors/dark.css rename to Wordpress/colors/dark.css index b9dacce..1446b74 100644 --- a/colors/dark.css +++ b/Wordpress/colors/dark.css @@ -1,623 +1,623 @@ -/* - A dark color scheme for Twenty Eleven -*/ - -/* =Global ------------------------------------------------ */ - -body { - background: #1d1d1d; - color: #bbb; -} -#page { - background: #0f0f0f; -} - -/* Headings */ -hr { - background-color: #333; -} - -/* Text elements */ -blockquote cite { - color: #999; -} -pre { - background: #0b0b0b; -} -code, kbd { - font: 13px Monaco, Consolas, "Andale Mono", "DejaVu Sans Mono", monospace; -} -abbr, acronym, dfn { - border-bottom: 1px dotted #999; -} -ins { - background: #00063f; -} -input[type=text], -.post-password-required input[type=password], -textarea { - border: 1px solid #222; -} -input[type=text]:focus, -textarea:focus { -} -input#s { - background-color: #ddd; -} - -/* Links */ -a { -} - - -/* =Header ------------------------------------------------ */ - -#branding { - border-top: 2px solid #0a0a0a; -} -#site-title a { - color: #eee; -} -#site-title a:hover, -#site-title a:focus, -#site-title a:active { -} -#site-description { - color: #858585; -} -#branding #s { - background-color: #ddd; -} - - -/* =Menu ------------------------------------------------ */ - -#access { - background: #333; /* Show a solid color for older browsers */ - background: -moz-linear-gradient(#383838, #272727); - background: -webkit-gradient(linear, 0% 0%, 0% 100%, from(#383838), to(#272727)); /* older webkit syntax */ - background: -webkit-linear-gradient(#383838, #272727); - border-bottom: 1px solid #222; -} - -/* =Content ------------------------------------------------ */ - -.page-title { - color: #ccc; -} -.hentry { - border-color: #222; -} -.entry-title { - color: #ddd; -} -.entry-title, -.entry-title a { - color: #ddd; -} -.entry-title a:hover, -.entry-title a:focus, -.entry-title a:active { -} -.entry-meta { - color: #999; -} -.entry-content h1, -.entry-content h2, -.comment-content h1, -.comment-content h2 { - color: #fff; -} -.entry-content table, -.comment-content table { - border-color: #222; -} -.entry-content th, -.comment-content th { - color: #999; -} -.entry-content td, -.comment-content td { - border-color: #222; -} -.page-link { -} -.page-link a { - background: #242424; - color: #bbb; -} -.page-link a:hover { - background: #999; - color: #000; -} -.entry-meta .edit-link a { - background: #242424; - color: #bbb; -} -.entry-meta .edit-link a:hover, -.entry-meta .edit-link a:focus, -.entry-meta .edit-link a:active { - background: #999; - color: #000; -} - -/* Images */ -.wp-caption { - background: #2c2c2c; -} -.wp-caption .wp-caption-text { - color: #999; -} -.wp-caption .wp-caption-text:before { - color: #999; -} - -/* Image borders */ -img[class*="wp-image-"], -#content .gallery .gallery-icon img { - border-color: #2c2c2c; -} -.wp-caption img { - border-color: #2c2c2c; -} -a:focus img[class*="wp-image-"], -a:hover img[class*="wp-image-"], -a:active img[class*="wp-image-"] { - background: #2c2c2c; - border-color: #444; -} -.wp-caption a:focus img, -.wp-caption a:active img, -.wp-caption a:hover img { - background: #0f0f0f; - border-color: #2c2c2c; -} - -/* Password Protected Posts */ -.post-password-required input[type=password] { - background: #ddd; -} -.post-password-required input[type=password]:focus { - background: #fff; -} - -/* Author Info */ -.singular #author-info { - background: #060606; - border-color: #222; -} -.archive #author-info { - border-color: #222; -} -#author-avatar img { - background: #000; - -webkit-box-shadow: 0 1px 2px #444; - -moz-box-shadow: 0 1px 2px #444; - box-shadow: 0 1px 2px #444; -} -#author-description h2 { - color: #fff; -} - -/* Comments link */ -.entry-header .comments-link a { - background: #282828 url(../images/comment-bubble-dark.png) no-repeat; - border-color: #222; - color: #888; -} - -.rtl .entry-header .comments-link a { - background-image: url(../images/comment-bubble-dark-rtl.png); -} -/* Singular content styles for Posts and Pages */ -.singular .entry-title { - color: #fff; -} - - -/* =Status ------------------------------------------------ */ - -.format-status img.avatar { - -webkit-box-shadow: 0 1px 2px #333; - -moz-box-shadow: 0 1px 2px #333; - box-shadow: 0 1px 2px #333; -} - - -/* =Quote ------------------------------------------------ */ - -.format-quote blockquote { - color: #aaa; -} - - -/* =Image ------------------------------------------------ */ - -.indexed.format-image .wp-caption { - background: #242424; -} -.indexed.format-image .entry-meta .edit-link a { - color: #ddd; -} -.indexed.format-image .entry-meta .edit-link a:hover { - color: #fff; -} - - -/* =error404 ------------------------------------------------ */ -.error404 #main #searchform { - background: #060606; - border-color: #222; -} - - -/* =Showcase ------------------------------------------------ */ - -h1.showcase-heading { - color: #ccc; -} - -/* Intro */ -article.intro { - background: #060606; -} -article.intro .entry-content { - color: #eee; -} -article.intro .edit-link a { - background: #555; - color: #000; -} -article.intro .edit-link a:hover { - background: #888; -} - -/* Featured post */ -section.featured-post .hentry { - color: #999; -} - -/* Small featured post */ -section.featured-post .attachment-small-feature { - border-color: #444; -} -section.featured-post .attachment-small-feature:hover { - border-color: #777; -} -article.feature-image.small .entry-summary { - color: #aaa; -} -article.feature-image.small .entry-summary p a { - background: #ddd; - color: #111; -} -article.feature-image.small .entry-summary p a:hover { - color: #40220c; -} - -/* Large featured post */ -article.feature-image.large .entry-title a { - background: #ddd; - background: rgba(0,0,0,0.8); - color: #fff; -} -section.feature-image.large:hover .entry-title a, -section.feature-image.large .entry-title:hover a { - background: #111; - background: rgba(255,255,255,0.8); - color: #000; -} -section.feature-image.large img { - border-bottom: 1px solid #222; -} - -/* Featured Slider */ -.featured-posts { - border-color: #222; -} -.featured-posts section.featured-post { - background: #000; -} -.featured-post .feature-text:after, -.featured-post .feature-image.small:after { - background: -moz-linear-gradient(top, rgba(0,0,0,0) 0%, rgba(0,0,0,1) 100%); /* FF3.6+ */ - background: -webkit-gradient(linear, left top, left bottom, color-stop(0%,rgba(0,0,0,0)), color-stop(100%,rgba(0,0,0,1))); /* Chrome,Safari4+ */ - background: -webkit-linear-gradient(top, rgba(0,0,0,0) 0%,rgba(0,0,0,1) 100%); /* Chrome10+,Safari5.1+ */ - background: -o-linear-gradient(top, rgba(0,0,0,0) 0%,rgba(0,0,0,1) 100%); /* Opera11.10+ */ - background: -ms-linear-gradient(top, rgba(0,0,0,0) 0%,rgba(0,0,0,1) 100%); /* IE10+ */ - filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#00000000', endColorstr='#000000',GradientType=0 ); /* IE6-9 */ - background: linear-gradient(top, rgba(0,0,0,0) 0%,rgba(0,0,0,1) 100%); /* W3C */ -} -.feature-slider a { - background: #c3c3c3; - background: rgba(60,60,60,0.9); - -webkit-box-shadow: inset 1px 1px 5px rgba(0,0,0,0.5), inset 0 0 2px rgba(255,255,255,0.5); - -moz-box-shadow: inset 1px 1px 5px rgba(0,0,0,0.5), inset 0 0 2px rgba(255,255,255,0.5); - box-shadow: inset 1px 1px 5px rgba(0,0,0,0.5), inset 0 0 2px rgba(255,255,255,0.5); -} -.feature-slider a.active { - background: #000; - background: rgba(255,255,255,0.8); - -webkit-box-shadow: inset 1px 1px 5px rgba(0,0,0,0.4), inset 0 0 2px rgba(255,255,255,0.8); - -moz-box-shadow: inset 1px 1px 5px rgba(0,0,0,0.4), inset 0 0 2px rgba(255,255,255,0.8); - box-shadow: inset 1px 1px 5px rgba(0,0,0,0.4), inset 0 0 2px rgba(255,255,255,0.8); -} - -/* Recent Posts */ -section.recent-posts .other-recent-posts { - border-color: #222; -} -section.recent-posts .other-recent-posts .entry-title { - border-color: #222; -} -section.recent-posts .other-recent-posts a[rel="bookmark"] { - color: #ccc; -} -section.recent-posts .other-recent-posts a[rel="bookmark"]:hover { -} -section.recent-posts .other-recent-posts .comments-link a, -section.recent-posts .other-recent-posts .comments-link > span { - border-color: #959595; - color: #bbb; -} -section.recent-posts .other-recent-posts .comments-link > span { - border-color: #444; - color: #777; -} -section.recent-posts .other-recent-posts .comments-link a:hover { -} - - -/* =Attachments ------------------------------------------------ */ - -.image-attachment div.attachment { - background: #060606; - border-color: #222; -} -.image-attachment div.attachment a img { - border-color: #060606; -} -.image-attachment div.attachment a:focus img, -.image-attachment div.attachment a:hover img, -.image-attachment div.attachment a:active img { - border-color: #2c2c2c; - background: #0f0f0f; -} - - -/* =Widgets ------------------------------------------------ */ - -.widget-title { - color: #ccc; -} -.widget ul li { - color: #888; -} - -/* Search Widget */ -.widget_search #searchsubmit { - background: #222; - border-color: #333; - -webkit-box-shadow: inset 0px -1px 1px rgba(0, 0, 0, 0.09); - -moz-box-shadow: inset 0px -1px 1px rgba(0, 0, 0, 0.09); - box-shadow: inset 0px -1px 1px rgba(0, 0, 0, 0.09); - color: #777; -} -.widget_search #searchsubmit:active { - -webkit-box-shadow: inset 0px 1px 1px rgba(0, 0, 0, 0.1); - -moz-box-shadow: inset 0px 1px 1px rgba(0, 0, 0, 0.1); - box-shadow: inset 0px 1px 1px rgba(0, 0, 0, 0.1); - color: #40220c; -} - -/* Calendar Widget */ -.widget_calendar #wp-calendar { - color: #aaa; -} -.widget_calendar #wp-calendar th { - background: #0b0b0b; - border-color: #333; -} -.widget_calendar #wp-calendar tfoot td { - background: #0b0b0b; - border-color: #333; -} - - -/* =Comments ------------------------------------------------ */ - -#comments-title { - color: #bbb; -} -.nocomments { - color: #555; -} -.commentlist > li.comment { - background: #090909; - border-color: #222; -} -.commentlist .children li.comment { - background: #000; - border-color: #222; -} -.rtl .commentlist .children li.comment { - border-color: #222; -} -.comment-meta { - color: #999; -} -.commentlist .avatar { - -webkit-box-shadow: 0 1px 2px #222; - -moz-box-shadow: 0 1px 2px #222; - box-shadow: 0 1px 2px #222; -} -a.comment-reply-link { - background: #242424; - color: #bbb; -} -li.bypostauthor a.comment-reply-link { - background: #111; -} -a.comment-reply-link:hover, -a.comment-reply-link:focus, -a.comment-reply-link:active, -li.bypostauthor a.comment-reply-link:hover, -li.bypostauthor a.comment-reply-link:focus, -li.bypostauthor a.comment-reply-link:active { - background: #999; - color: #000; -} -.commentlist > li:before { - content: url(../images/comment-arrow-dark.png); -} -.rtl .commentlist > li:before { - content: url(../images/comment-arrow-dark-rtl.png); -} - -/* Post author highlighting */ -.commentlist > li.bypostauthor { - background: #222; - border-color: #2c2c2c; -} -.commentlist > li.bypostauthor:before { - content: url(../images/comment-arrow-bypostauthor-dark.png); -} -.rtl .commentlist > li.bypostauthor:before { - content: url(../images/comment-arrow-bypostauthor-dark-rtl.png); -} - -/* Post Author threaded comments */ -.commentlist .children > li.bypostauthor { - background: #222; - border-color: #2c2c2c; -} -.commentlist > li.bypostauthor .comment-meta { - color: #a8a8a8; -} - -/* Comment Form */ -#respond { - background: #222; - border-color: #2c2c2c; -} -#respond input[type="text"], -#respond textarea { - background: #000; - border: 4px solid #111; - -webkit-box-shadow: inset 0 1px 3px rgba(51,51,51,0.95); - -moz-box-shadow: inset 0 1px 3px rgba(51,51,51,0.95); - box-shadow: inset 0 1px 3px rgba(51,51,51,0.95); - color: #bbb; -} -#respond .comment-form-author label, -#respond .comment-form-email label, -#respond .comment-form-url label, -#respond .comment-form-comment label { - background: #111; - -webkit-box-shadow: 1px 2px 2px rgba(51,51,51,0.8); - -moz-box-shadow: 1px 2px 2px rgba(51,51,51,0.8); - box-shadow: 1px 1px 2px rgba(51,51,51,0.8); - color: #aaa; -} -.rtl #respond .comment-form-author label, -.rtl #respond .comment-form-email label, -.rtl #respond .comment-form-url label, -.rtl #respond .comment-form-comment label { - -webkit-box-shadow: -1px 2px 2px rgba(51,51,51,0.8); - -moz-box-shadow: -1px 2px 2px rgba(51,51,51,0.8); - box-shadow: -1px 1px 2px rgba(51,51,51,0.8); -} -#respond .comment-form-author .required, -#respond .comment-form-email .required { - color: #42caff; -} -#respond input#submit { - background: #ddd; - -webkit-box-shadow: 0px 1px 2px rgba(0,0,0,0.3); - -moz-box-shadow: 0px 1px 2px rgba(0,0,0,0.3); - box-shadow: 0px 1px 2px rgba(0,0,0,0.3); - color: #111; - text-shadow: 0 -1px 0 rgba(0,0,0,0.3); -} -#respond input#submit:active { - color: #40220c; -} -#respond #cancel-comment-reply-link { - color: #999; -} -#reply-title { - color: #ccc; -} -#cancel-comment-reply-link { - color: #777; -} -#cancel-comment-reply-link:focus, -#cancel-comment-reply-link:active, -#cancel-comment-reply-link:hover { - color: #00b4cc; -} - - -/* =Footer ------------------------------------------------ */ - -#supplementary { - border-color: #222; -} - -/* Site Generator Line */ -#site-generator { - background: #060606; - border-color: #000; -} - - -/* =Print ------------------------------------------------ */ - -@media print { - body { - color: #333; - background: none !important; - } - #page { - background: none !important; - } - - /* Comments */ - .commentlist > li.comment { - } - - /* Post author highlighting */ - .commentlist > li.bypostauthor { - color: #333; - } - .commentlist > li.bypostauthor .comment-meta { - color: #959595; - } - .commentlist > li:before { - content: none !important; - } - - /* Post Author threaded comments */ - .commentlist .children > li.bypostauthor { - background: #fff; - border-color: #ddd; - } - .commentlist .children > li.bypostauthor > article, - .commentlist .children > li.bypostauthor > article .comment-meta { - color: #959595; - } +/* + A dark color scheme for Twenty Eleven +*/ + +/* =Global +----------------------------------------------- */ + +body { + background: #1d1d1d; + color: #bbb; +} +#page { + background: #0f0f0f; +} + +/* Headings */ +hr { + background-color: #333; +} + +/* Text elements */ +blockquote cite { + color: #999; +} +pre { + background: #0b0b0b; +} +code, kbd { + font: 13px Monaco, Consolas, "Andale Mono", "DejaVu Sans Mono", monospace; +} +abbr, acronym, dfn { + border-bottom: 1px dotted #999; +} +ins { + background: #00063f; +} +input[type=text], +.post-password-required input[type=password], +textarea { + border: 1px solid #222; +} +input[type=text]:focus, +textarea:focus { +} +input#s { + background-color: #ddd; +} + +/* Links */ +a { +} + + +/* =Header +----------------------------------------------- */ + +#branding { + border-top: 2px solid #0a0a0a; +} +#site-title a { + color: #eee; +} +#site-title a:hover, +#site-title a:focus, +#site-title a:active { +} +#site-description { + color: #858585; +} +#branding #s { + background-color: #ddd; +} + + +/* =Menu +----------------------------------------------- */ + +#access { + background: #333; /* Show a solid color for older browsers */ + background: -moz-linear-gradient(#383838, #272727); + background: -webkit-gradient(linear, 0% 0%, 0% 100%, from(#383838), to(#272727)); /* older webkit syntax */ + background: -webkit-linear-gradient(#383838, #272727); + border-bottom: 1px solid #222; +} + +/* =Content +----------------------------------------------- */ + +.page-title { + color: #ccc; +} +.hentry { + border-color: #222; +} +.entry-title { + color: #ddd; +} +.entry-title, +.entry-title a { + color: #ddd; +} +.entry-title a:hover, +.entry-title a:focus, +.entry-title a:active { +} +.entry-meta { + color: #999; +} +.entry-content h1, +.entry-content h2, +.comment-content h1, +.comment-content h2 { + color: #fff; +} +.entry-content table, +.comment-content table { + border-color: #222; +} +.entry-content th, +.comment-content th { + color: #999; +} +.entry-content td, +.comment-content td { + border-color: #222; +} +.page-link { +} +.page-link a { + background: #242424; + color: #bbb; +} +.page-link a:hover { + background: #999; + color: #000; +} +.entry-meta .edit-link a { + background: #242424; + color: #bbb; +} +.entry-meta .edit-link a:hover, +.entry-meta .edit-link a:focus, +.entry-meta .edit-link a:active { + background: #999; + color: #000; +} + +/* Images */ +.wp-caption { + background: #2c2c2c; +} +.wp-caption .wp-caption-text { + color: #999; +} +.wp-caption .wp-caption-text:before { + color: #999; +} + +/* Image borders */ +img[class*="wp-image-"], +#content .gallery .gallery-icon img { + border-color: #2c2c2c; +} +.wp-caption img { + border-color: #2c2c2c; +} +a:focus img[class*="wp-image-"], +a:hover img[class*="wp-image-"], +a:active img[class*="wp-image-"] { + background: #2c2c2c; + border-color: #444; +} +.wp-caption a:focus img, +.wp-caption a:active img, +.wp-caption a:hover img { + background: #0f0f0f; + border-color: #2c2c2c; +} + +/* Password Protected Posts */ +.post-password-required input[type=password] { + background: #ddd; +} +.post-password-required input[type=password]:focus { + background: #fff; +} + +/* Author Info */ +.singular #author-info { + background: #060606; + border-color: #222; +} +.archive #author-info { + border-color: #222; +} +#author-avatar img { + background: #000; + -webkit-box-shadow: 0 1px 2px #444; + -moz-box-shadow: 0 1px 2px #444; + box-shadow: 0 1px 2px #444; +} +#author-description h2 { + color: #fff; +} + +/* Comments link */ +.entry-header .comments-link a { + background: #282828 url(../images/comment-bubble-dark.png) no-repeat; + border-color: #222; + color: #888; +} + +.rtl .entry-header .comments-link a { + background-image: url(../images/comment-bubble-dark-rtl.png); +} +/* Singular content styles for Posts and Pages */ +.singular .entry-title { + color: #fff; +} + + +/* =Status +----------------------------------------------- */ + +.format-status img.avatar { + -webkit-box-shadow: 0 1px 2px #333; + -moz-box-shadow: 0 1px 2px #333; + box-shadow: 0 1px 2px #333; +} + + +/* =Quote +----------------------------------------------- */ + +.format-quote blockquote { + color: #aaa; +} + + +/* =Image +----------------------------------------------- */ + +.indexed.format-image .wp-caption { + background: #242424; +} +.indexed.format-image .entry-meta .edit-link a { + color: #ddd; +} +.indexed.format-image .entry-meta .edit-link a:hover { + color: #fff; +} + + +/* =error404 +----------------------------------------------- */ +.error404 #main #searchform { + background: #060606; + border-color: #222; +} + + +/* =Showcase +----------------------------------------------- */ + +h1.showcase-heading { + color: #ccc; +} + +/* Intro */ +article.intro { + background: #060606; +} +article.intro .entry-content { + color: #eee; +} +article.intro .edit-link a { + background: #555; + color: #000; +} +article.intro .edit-link a:hover { + background: #888; +} + +/* Featured post */ +section.featured-post .hentry { + color: #999; +} + +/* Small featured post */ +section.featured-post .attachment-small-feature { + border-color: #444; +} +section.featured-post .attachment-small-feature:hover { + border-color: #777; +} +article.feature-image.small .entry-summary { + color: #aaa; +} +article.feature-image.small .entry-summary p a { + background: #ddd; + color: #111; +} +article.feature-image.small .entry-summary p a:hover { + color: #40220c; +} + +/* Large featured post */ +article.feature-image.large .entry-title a { + background: #ddd; + background: rgba(0,0,0,0.8); + color: #fff; +} +section.feature-image.large:hover .entry-title a, +section.feature-image.large .entry-title:hover a { + background: #111; + background: rgba(255,255,255,0.8); + color: #000; +} +section.feature-image.large img { + border-bottom: 1px solid #222; +} + +/* Featured Slider */ +.featured-posts { + border-color: #222; +} +.featured-posts section.featured-post { + background: #000; +} +.featured-post .feature-text:after, +.featured-post .feature-image.small:after { + background: -moz-linear-gradient(top, rgba(0,0,0,0) 0%, rgba(0,0,0,1) 100%); /* FF3.6+ */ + background: -webkit-gradient(linear, left top, left bottom, color-stop(0%,rgba(0,0,0,0)), color-stop(100%,rgba(0,0,0,1))); /* Chrome,Safari4+ */ + background: -webkit-linear-gradient(top, rgba(0,0,0,0) 0%,rgba(0,0,0,1) 100%); /* Chrome10+,Safari5.1+ */ + background: -o-linear-gradient(top, rgba(0,0,0,0) 0%,rgba(0,0,0,1) 100%); /* Opera11.10+ */ + background: -ms-linear-gradient(top, rgba(0,0,0,0) 0%,rgba(0,0,0,1) 100%); /* IE10+ */ + filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#00000000', endColorstr='#000000',GradientType=0 ); /* IE6-9 */ + background: linear-gradient(top, rgba(0,0,0,0) 0%,rgba(0,0,0,1) 100%); /* W3C */ +} +.feature-slider a { + background: #c3c3c3; + background: rgba(60,60,60,0.9); + -webkit-box-shadow: inset 1px 1px 5px rgba(0,0,0,0.5), inset 0 0 2px rgba(255,255,255,0.5); + -moz-box-shadow: inset 1px 1px 5px rgba(0,0,0,0.5), inset 0 0 2px rgba(255,255,255,0.5); + box-shadow: inset 1px 1px 5px rgba(0,0,0,0.5), inset 0 0 2px rgba(255,255,255,0.5); +} +.feature-slider a.active { + background: #000; + background: rgba(255,255,255,0.8); + -webkit-box-shadow: inset 1px 1px 5px rgba(0,0,0,0.4), inset 0 0 2px rgba(255,255,255,0.8); + -moz-box-shadow: inset 1px 1px 5px rgba(0,0,0,0.4), inset 0 0 2px rgba(255,255,255,0.8); + box-shadow: inset 1px 1px 5px rgba(0,0,0,0.4), inset 0 0 2px rgba(255,255,255,0.8); +} + +/* Recent Posts */ +section.recent-posts .other-recent-posts { + border-color: #222; +} +section.recent-posts .other-recent-posts .entry-title { + border-color: #222; +} +section.recent-posts .other-recent-posts a[rel="bookmark"] { + color: #ccc; +} +section.recent-posts .other-recent-posts a[rel="bookmark"]:hover { +} +section.recent-posts .other-recent-posts .comments-link a, +section.recent-posts .other-recent-posts .comments-link > span { + border-color: #959595; + color: #bbb; +} +section.recent-posts .other-recent-posts .comments-link > span { + border-color: #444; + color: #777; +} +section.recent-posts .other-recent-posts .comments-link a:hover { +} + + +/* =Attachments +----------------------------------------------- */ + +.image-attachment div.attachment { + background: #060606; + border-color: #222; +} +.image-attachment div.attachment a img { + border-color: #060606; +} +.image-attachment div.attachment a:focus img, +.image-attachment div.attachment a:hover img, +.image-attachment div.attachment a:active img { + border-color: #2c2c2c; + background: #0f0f0f; +} + + +/* =Widgets +----------------------------------------------- */ + +.widget-title { + color: #ccc; +} +.widget ul li { + color: #888; +} + +/* Search Widget */ +.widget_search #searchsubmit { + background: #222; + border-color: #333; + -webkit-box-shadow: inset 0px -1px 1px rgba(0, 0, 0, 0.09); + -moz-box-shadow: inset 0px -1px 1px rgba(0, 0, 0, 0.09); + box-shadow: inset 0px -1px 1px rgba(0, 0, 0, 0.09); + color: #777; +} +.widget_search #searchsubmit:active { + -webkit-box-shadow: inset 0px 1px 1px rgba(0, 0, 0, 0.1); + -moz-box-shadow: inset 0px 1px 1px rgba(0, 0, 0, 0.1); + box-shadow: inset 0px 1px 1px rgba(0, 0, 0, 0.1); + color: #40220c; +} + +/* Calendar Widget */ +.widget_calendar #wp-calendar { + color: #aaa; +} +.widget_calendar #wp-calendar th { + background: #0b0b0b; + border-color: #333; +} +.widget_calendar #wp-calendar tfoot td { + background: #0b0b0b; + border-color: #333; +} + + +/* =Comments +----------------------------------------------- */ + +#comments-title { + color: #bbb; +} +.nocomments { + color: #555; +} +.commentlist > li.comment { + background: #090909; + border-color: #222; +} +.commentlist .children li.comment { + background: #000; + border-color: #222; +} +.rtl .commentlist .children li.comment { + border-color: #222; +} +.comment-meta { + color: #999; +} +.commentlist .avatar { + -webkit-box-shadow: 0 1px 2px #222; + -moz-box-shadow: 0 1px 2px #222; + box-shadow: 0 1px 2px #222; +} +a.comment-reply-link { + background: #242424; + color: #bbb; +} +li.bypostauthor a.comment-reply-link { + background: #111; +} +a.comment-reply-link:hover, +a.comment-reply-link:focus, +a.comment-reply-link:active, +li.bypostauthor a.comment-reply-link:hover, +li.bypostauthor a.comment-reply-link:focus, +li.bypostauthor a.comment-reply-link:active { + background: #999; + color: #000; +} +.commentlist > li:before { + content: url(../images/comment-arrow-dark.png); +} +.rtl .commentlist > li:before { + content: url(../images/comment-arrow-dark-rtl.png); +} + +/* Post author highlighting */ +.commentlist > li.bypostauthor { + background: #222; + border-color: #2c2c2c; +} +.commentlist > li.bypostauthor:before { + content: url(../images/comment-arrow-bypostauthor-dark.png); +} +.rtl .commentlist > li.bypostauthor:before { + content: url(../images/comment-arrow-bypostauthor-dark-rtl.png); +} + +/* Post Author threaded comments */ +.commentlist .children > li.bypostauthor { + background: #222; + border-color: #2c2c2c; +} +.commentlist > li.bypostauthor .comment-meta { + color: #a8a8a8; +} + +/* Comment Form */ +#respond { + background: #222; + border-color: #2c2c2c; +} +#respond input[type="text"], +#respond textarea { + background: #000; + border: 4px solid #111; + -webkit-box-shadow: inset 0 1px 3px rgba(51,51,51,0.95); + -moz-box-shadow: inset 0 1px 3px rgba(51,51,51,0.95); + box-shadow: inset 0 1px 3px rgba(51,51,51,0.95); + color: #bbb; +} +#respond .comment-form-author label, +#respond .comment-form-email label, +#respond .comment-form-url label, +#respond .comment-form-comment label { + background: #111; + -webkit-box-shadow: 1px 2px 2px rgba(51,51,51,0.8); + -moz-box-shadow: 1px 2px 2px rgba(51,51,51,0.8); + box-shadow: 1px 1px 2px rgba(51,51,51,0.8); + color: #aaa; +} +.rtl #respond .comment-form-author label, +.rtl #respond .comment-form-email label, +.rtl #respond .comment-form-url label, +.rtl #respond .comment-form-comment label { + -webkit-box-shadow: -1px 2px 2px rgba(51,51,51,0.8); + -moz-box-shadow: -1px 2px 2px rgba(51,51,51,0.8); + box-shadow: -1px 1px 2px rgba(51,51,51,0.8); +} +#respond .comment-form-author .required, +#respond .comment-form-email .required { + color: #42caff; +} +#respond input#submit { + background: #ddd; + -webkit-box-shadow: 0px 1px 2px rgba(0,0,0,0.3); + -moz-box-shadow: 0px 1px 2px rgba(0,0,0,0.3); + box-shadow: 0px 1px 2px rgba(0,0,0,0.3); + color: #111; + text-shadow: 0 -1px 0 rgba(0,0,0,0.3); +} +#respond input#submit:active { + color: #40220c; +} +#respond #cancel-comment-reply-link { + color: #999; +} +#reply-title { + color: #ccc; +} +#cancel-comment-reply-link { + color: #777; +} +#cancel-comment-reply-link:focus, +#cancel-comment-reply-link:active, +#cancel-comment-reply-link:hover { + color: #00b4cc; +} + + +/* =Footer +----------------------------------------------- */ + +#supplementary { + border-color: #222; +} + +/* Site Generator Line */ +#site-generator { + background: #060606; + border-color: #000; +} + + +/* =Print +----------------------------------------------- */ + +@media print { + body { + color: #333; + background: none !important; + } + #page { + background: none !important; + } + + /* Comments */ + .commentlist > li.comment { + } + + /* Post author highlighting */ + .commentlist > li.bypostauthor { + color: #333; + } + .commentlist > li.bypostauthor .comment-meta { + color: #959595; + } + .commentlist > li:before { + content: none !important; + } + + /* Post Author threaded comments */ + .commentlist .children > li.bypostauthor { + background: #fff; + border-color: #ddd; + } + .commentlist .children > li.bypostauthor > article, + .commentlist .children > li.bypostauthor > article .comment-meta { + color: #959595; + } } \ No newline at end of file diff --git a/comments.php b/Wordpress/comments.php similarity index 97% rename from comments.php rename to Wordpress/comments.php index b1bab1c..8c1875e 100644 --- a/comments.php +++ b/Wordpress/comments.php @@ -1,77 +1,77 @@ - -
- -

-
- - - - - -

- ' . get_the_title() . '' ); - ?> -

- - 1 && get_option( 'page_comments' ) ) : // are there comments to navigate through ?> - - - -
    - 'twentyeleven_comment' ) ); - ?> -
- - 1 && get_option( 'page_comments' ) ) : // are there comments to navigate through ?> - - - - -

- - - - - + +
+ +

+
+ + + + + +

+ ' . get_the_title() . '' ); + ?> +

+ + 1 && get_option( 'page_comments' ) ) : // are there comments to navigate through ?> + + + +
    + 'twentyeleven_comment' ) ); + ?> +
+ + 1 && get_option( 'page_comments' ) ) : // are there comments to navigate through ?> + + + + +

+ + + + + diff --git a/content-aside.php b/Wordpress/content-aside.php similarity index 97% rename from content-aside.php rename to Wordpress/content-aside.php index ca0988d..21a777a 100644 --- a/content-aside.php +++ b/Wordpress/content-aside.php @@ -1,40 +1,40 @@ - - -
> -
-
-

-

-
-
- - -
- -
- -
- →', 'twentyeleven' ) ); ?> - '' ) ); ?> -
- - -
- - - | - ' . __( 'Leave a reply', 'twentyeleven' ) . '', __( '1 Reply', 'twentyeleven' ), __( '% Replies', 'twentyeleven' ) ); ?> - - ', '' ); ?> -
-
+ + +
> +
+
+

+

+
+
+ + +
+ +
+ +
+ →', 'twentyeleven' ) ); ?> + '' ) ); ?> +
+ + +
+ + + | + ' . __( 'Leave a reply', 'twentyeleven' ) . '', __( '1 Reply', 'twentyeleven' ), __( '% Replies', 'twentyeleven' ) ); ?> + + ', '' ); ?> +
+
diff --git a/content-featured.php b/Wordpress/content-featured.php similarity index 97% rename from content-featured.php rename to Wordpress/content-featured.php index 06ee415..485e5a4 100644 --- a/content-featured.php +++ b/Wordpress/content-featured.php @@ -1,47 +1,47 @@ - -
> -
-

- - -
- -
- - '' ) ); ?> -
- -
- permalink.', 'twentyeleven' ); - } else { - $utility_text = __( 'This entry was posted in %1$s. Bookmark the permalink.', 'twentyeleven' ); - } - printf( - $utility_text, - /* translators: used between list items, there is a space after the comma */ - get_the_category_list( __( ', ', 'twentyeleven' ) ), - $tag_list, - esc_url( get_permalink() ), - the_title_attribute( 'echo=0' ) - ); - ?> - - ', '' ); ?> -
-
+ +
> +
+

+ + +
+ +
+ + '' ) ); ?> +
+ +
+ permalink.', 'twentyeleven' ); + } else { + $utility_text = __( 'This entry was posted in %1$s. Bookmark the permalink.', 'twentyeleven' ); + } + printf( + $utility_text, + /* translators: used between list items, there is a space after the comma */ + get_the_category_list( __( ', ', 'twentyeleven' ) ), + $tag_list, + esc_url( get_permalink() ), + the_title_attribute( 'echo=0' ) + ); + ?> + + ', '' ); ?> +
+
diff --git a/content-gallery.php b/Wordpress/content-gallery.php similarity index 97% rename from content-gallery.php rename to Wordpress/content-gallery.php index 3797cd2..000a07d 100644 --- a/content-gallery.php +++ b/Wordpress/content-gallery.php @@ -1,92 +1,92 @@ - - -
> -
-
-

-

-
- - -
- - -
- -
- -
- - →', 'twentyeleven' ) ); ?> - - - $post->ID, 'post_type' => 'attachment', 'post_mime_type' => 'image', 'orderby' => 'menu_order', 'order' => 'ASC', 'numberposts' => 999 ) ); - if ( $images ) : - $total_images = count( $images ); - $image = array_shift( $images ); - $image_img_tag = wp_get_attachment_image( $image->ID, 'thumbnail' ); - ?> - - - -

%2$s photo.', 'This gallery contains %2$s photos.', $total_images, 'twentyeleven' ), - 'href="' . esc_url( get_permalink() ) . '" title="' . sprintf( esc_attr__( 'Permalink to %s', 'twentyeleven' ), the_title_attribute( 'echo=0' ) ) . '" rel="bookmark"', - number_format_i18n( $total_images ) - ); ?>

- - - - '' ) ); ?> -
- - -
- - - - Posted in %2$s', 'twentyeleven' ), 'entry-utility-prep entry-utility-prep-cat-links', $categories_list ); - $show_sep = true; ?> - - - - | - - - Tagged %2$s', 'twentyeleven' ), 'entry-utility-prep entry-utility-prep-tag-links', $tags_list ); - $show_sep = true; ?> - - - - - - | - - ' . __( 'Leave a reply', 'twentyeleven' ) . '', __( '1 Reply', 'twentyeleven' ), __( '% Replies', 'twentyeleven' ) ); ?> - - - ', '' ); ?> -
-
+ + +
> +
+
+

+

+
+ + +
+ + +
+ +
+ +
+ + →', 'twentyeleven' ) ); ?> + + + $post->ID, 'post_type' => 'attachment', 'post_mime_type' => 'image', 'orderby' => 'menu_order', 'order' => 'ASC', 'numberposts' => 999 ) ); + if ( $images ) : + $total_images = count( $images ); + $image = array_shift( $images ); + $image_img_tag = wp_get_attachment_image( $image->ID, 'thumbnail' ); + ?> + + + +

%2$s photo.', 'This gallery contains %2$s photos.', $total_images, 'twentyeleven' ), + 'href="' . esc_url( get_permalink() ) . '" title="' . sprintf( esc_attr__( 'Permalink to %s', 'twentyeleven' ), the_title_attribute( 'echo=0' ) ) . '" rel="bookmark"', + number_format_i18n( $total_images ) + ); ?>

+ + + + '' ) ); ?> +
+ + +
+ + + + Posted in %2$s', 'twentyeleven' ), 'entry-utility-prep entry-utility-prep-cat-links', $categories_list ); + $show_sep = true; ?> + + + + | + + + Tagged %2$s', 'twentyeleven' ), 'entry-utility-prep entry-utility-prep-tag-links', $tags_list ); + $show_sep = true; ?> + + + + + + | + + ' . __( 'Leave a reply', 'twentyeleven' ) . '', __( '1 Reply', 'twentyeleven' ), __( '% Replies', 'twentyeleven' ) ); ?> + + + ', '' ); ?> +
+
diff --git a/content-image.php b/Wordpress/content-image.php similarity index 97% rename from content-image.php rename to Wordpress/content-image.php index 9bdc43f..e644eb6 100644 --- a/content-image.php +++ b/Wordpress/content-image.php @@ -1,64 +1,64 @@ - -
> -
-
-

-

-
-
- -
- →', 'twentyeleven' ) ); ?> - '' ) ); ?> -
- -
- - - - ', '' ); ?> -
-
+ +
> +
+
+

+

+
+
+ +
+ →', 'twentyeleven' ) ); ?> + '' ) ); ?> +
+ +
+ + + + ', '' ); ?> +
+
diff --git a/content-intro.php b/Wordpress/content-intro.php similarity index 97% rename from content-intro.php rename to Wordpress/content-intro.php index 16906ff..91c1164 100644 --- a/content-intro.php +++ b/Wordpress/content-intro.php @@ -1,21 +1,21 @@ - - -
> -
-

-
- -
- - '' ) ); ?> - ', '' ); ?> -
-
+ + +
> +
+

+
+ +
+ + '' ) ); ?> + ', '' ); ?> +
+
diff --git a/content-link.php b/Wordpress/content-link.php similarity index 97% rename from content-link.php rename to Wordpress/content-link.php index bdecedc..890dd09 100644 --- a/content-link.php +++ b/Wordpress/content-link.php @@ -1,41 +1,41 @@ - - -
> -
-
-

-

-
- -
- - -
- -
- -
- →', 'twentyeleven' ) ); ?> - '' ) ); ?> -
- - -
- - - | - ' . __( 'Leave a reply', 'twentyeleven' ) . '', __( '1 Reply', 'twentyeleven' ), __( '% Replies', 'twentyeleven' ) ); ?> - - ', '' ); ?> -
-
+ + +
> +
+
+

+

+
+ +
+ + +
+ +
+ +
+ →', 'twentyeleven' ) ); ?> + '' ) ); ?> +
+ + +
+ + + | + ' . __( 'Leave a reply', 'twentyeleven' ) . '', __( '1 Reply', 'twentyeleven' ), __( '% Replies', 'twentyeleven' ) ); ?> + + ', '' ); ?> +
+
diff --git a/content-page.php b/Wordpress/content-page.php similarity index 97% rename from content-page.php rename to Wordpress/content-page.php index 1d1728a..b38c167 100644 --- a/content-page.php +++ b/Wordpress/content-page.php @@ -1,23 +1,23 @@ - - -
> -
-

-
- -
- - '' ) ); ?> -
-
- ', '' ); ?> -
-
+ + +
> +
+

+
+ +
+ + '' ) ); ?> +
+
+ ', '' ); ?> +
+
diff --git a/content-quote.php b/Wordpress/content-quote.php similarity index 97% rename from content-quote.php rename to Wordpress/content-quote.php index 8f65897..536ac45 100644 --- a/content-quote.php +++ b/Wordpress/content-quote.php @@ -1,69 +1,69 @@ - - -
> -
-
-

-

-
- - - -
- - -
- -
- -
- →', 'twentyeleven' ) ); ?> - '' ) ); ?> -
- - -
- - - - Posted in %2$s', 'twentyeleven' ), 'entry-utility-prep entry-utility-prep-cat-links', $categories_list ); - $show_sep = true; ?> - - - - | - - - Tagged %2$s', 'twentyeleven' ), 'entry-utility-prep entry-utility-prep-tag-links', $tags_list ); - $show_sep = true; ?> - - - - - - | - - ' . __( 'Leave a reply', 'twentyeleven' ) . '', __( '1 Reply', 'twentyeleven' ), __( '% Replies', 'twentyeleven' ) ); ?> - - - ', '' ); ?> -
-
+ + +
> +
+
+

+

+
+ + + +
+ + +
+ +
+ +
+ →', 'twentyeleven' ) ); ?> + '' ) ); ?> +
+ + +
+ + + + Posted in %2$s', 'twentyeleven' ), 'entry-utility-prep entry-utility-prep-cat-links', $categories_list ); + $show_sep = true; ?> + + + + | + + + Tagged %2$s', 'twentyeleven' ), 'entry-utility-prep entry-utility-prep-tag-links', $tags_list ); + $show_sep = true; ?> + + + + + + | + + ' . __( 'Leave a reply', 'twentyeleven' ) . '', __( '1 Reply', 'twentyeleven' ), __( '% Replies', 'twentyeleven' ) ); ?> + + + ', '' ); ?> +
+
diff --git a/content-single.php b/Wordpress/content-single.php similarity index 97% rename from content-single.php rename to Wordpress/content-single.php index fcecd9f..6d2f10a 100644 --- a/content-single.php +++ b/Wordpress/content-single.php @@ -1,71 +1,71 @@ - - -
> -
-

- - - - -
- -
- - '' ) ); ?> -
- -
- %5$s. Bookmark the permalink.', 'twentyeleven' ); - } elseif ( '' != $categories_list ) { - $utility_text = __( 'This entry was posted in %1$s by %5$s. Bookmark the permalink.', 'twentyeleven' ); - } else { - $utility_text = __( 'This entry was posted by %5$s. Bookmark the permalink.', 'twentyeleven' ); - } - - printf( - $utility_text, - $categories_list, - $tag_list, - esc_url( get_permalink() ), - the_title_attribute( 'echo=0' ), - get_the_author(), - esc_url( get_author_posts_url( get_the_author_meta( 'ID' ) ) ) - ); - ?> - ', '' ); ?> - - - - -
-
+ + +
> +
+

+ + + + +
+ +
+ + '' ) ); ?> +
+ +
+ %5$s. Bookmark the permalink.', 'twentyeleven' ); + } elseif ( '' != $categories_list ) { + $utility_text = __( 'This entry was posted in %1$s by %5$s. Bookmark the permalink.', 'twentyeleven' ); + } else { + $utility_text = __( 'This entry was posted by %5$s. Bookmark the permalink.', 'twentyeleven' ); + } + + printf( + $utility_text, + $categories_list, + $tag_list, + esc_url( get_permalink() ), + the_title_attribute( 'echo=0' ), + get_the_author(), + esc_url( get_author_posts_url( get_the_author_meta( 'ID' ) ) ) + ); + ?> + ', '' ); ?> + + + + +
+
diff --git a/content-status.php b/Wordpress/content-status.php similarity index 97% rename from content-status.php rename to Wordpress/content-status.php index 2319dca..d2465e3 100644 --- a/content-status.php +++ b/Wordpress/content-status.php @@ -1,42 +1,42 @@ - - -
> -
-
-

-

-
- -
- - -
- -
- -
-
- - →', 'twentyeleven' ) ); ?> - '' ) ); ?> -
- - -
- - - | - ' . __( 'Leave a reply', 'twentyeleven' ) . '', __( '1 Reply', 'twentyeleven' ), __( '% Replies', 'twentyeleven' ) ); ?> - - ', '' ); ?> -
-
+ + +
> +
+
+

+

+
+ +
+ + +
+ +
+ +
+
+ + →', 'twentyeleven' ) ); ?> + '' ) ); ?> +
+ + +
+ + + | + ' . __( 'Leave a reply', 'twentyeleven' ) . '', __( '1 Reply', 'twentyeleven' ), __( '% Replies', 'twentyeleven' ) ); ?> + + ', '' ); ?> +
+
diff --git a/content.php b/Wordpress/content.php similarity index 97% rename from content.php rename to Wordpress/content.php index aac00d9..4efa531 100644 --- a/content.php +++ b/Wordpress/content.php @@ -1,77 +1,77 @@ - - -
> -
- -
-

-

-
- -

- - - - - - -
- - -
- -
- -
- →', 'twentyeleven' ) ); ?> - '' ) ); ?> -
- - -
- - - - - Posted in %2$s', 'twentyeleven' ), 'entry-utility-prep entry-utility-prep-cat-links', $categories_list ); - $show_sep = true; ?> - - - - | - - - Tagged %2$s', 'twentyeleven' ), 'entry-utility-prep entry-utility-prep-tag-links', $tags_list ); - $show_sep = true; ?> - - - - - - - | - - ' . __( 'Leave a reply', 'twentyeleven' ) . '', __( '1 Reply', 'twentyeleven' ), __( '% Replies', 'twentyeleven' ) ); ?> - - - ', '' ); ?> -
-
+ + +
> +
+ +
+

+

+
+ +

+ + + + + + +
+ + +
+ +
+ +
+ →', 'twentyeleven' ) ); ?> + '' ) ); ?> +
+ + +
+ + + + + Posted in %2$s', 'twentyeleven' ), 'entry-utility-prep entry-utility-prep-cat-links', $categories_list ); + $show_sep = true; ?> + + + + | + + + Tagged %2$s', 'twentyeleven' ), 'entry-utility-prep entry-utility-prep-tag-links', $tags_list ); + $show_sep = true; ?> + + + + + + + | + + ' . __( 'Leave a reply', 'twentyeleven' ) . '', __( '1 Reply', 'twentyeleven' ), __( '% Replies', 'twentyeleven' ) ); ?> + + + ', '' ); ?> +
+
diff --git a/editor-style-rtl.css b/Wordpress/editor-style-rtl.css similarity index 92% rename from editor-style-rtl.css rename to Wordpress/editor-style-rtl.css index c087731..fb76443 100644 --- a/editor-style-rtl.css +++ b/Wordpress/editor-style-rtl.css @@ -1,24 +1,24 @@ -/* -Theme Name: HuskyPress -*/ -/* -Used to style the TinyMCE editor. -*/ -html .mceContentBody { - direction: rtl; - unicode-bidi: embed; - float: right; - width: 584px; -} -* { - font-family: Arial, Tahoma, sans-serif; -} -ul, ol { - margin: 0 2.5em 1.625em 0; -} -blockquote { - font-style: normal; -} -table { - text-align: right; +/* +Theme Name: HuskyPress +*/ +/* +Used to style the TinyMCE editor. +*/ +html .mceContentBody { + direction: rtl; + unicode-bidi: embed; + float: right; + width: 584px; +} +* { + font-family: Arial, Tahoma, sans-serif; +} +ul, ol { + margin: 0 2.5em 1.625em 0; +} +blockquote { + font-style: normal; +} +table { + text-align: right; } \ No newline at end of file diff --git a/editor-style.css b/Wordpress/editor-style.css similarity index 94% rename from editor-style.css rename to Wordpress/editor-style.css index d7c20f2..6ecf0e9 100644 --- a/editor-style.css +++ b/Wordpress/editor-style.css @@ -1,311 +1,311 @@ -/* -Theme Name: HuskyPress -Description: Used to style the TinyMCE editor. -*/ - -html .mceContentBody { - max-width: 584px; -} -* { - color: inherit; - font: 15px "Helvetica Neue", Helvetica, Arial, sans-serif; - font-style: inherit; - font-weight: inherit; - line-height: 1.625; -} -body { - color: #333; - font: 15px "Helvetica Neue", Helvetica, Arial, "Nimbus Sans L", sans-serif; - font-weight: 300; - line-height: 1.625; -} - -/* Headings */ -h1,h2,h3,h4,h5,h6 { - clear: both; -} -h1, -h2 { - color: #000; - font-size: 15px; - font-weight: bold; - margin: 0 0 .8125em; -} -h3 { - font-size: 10px; - letter-spacing: 0.1em; - line-height: 2.6em; - text-transform: uppercase; -} -h4, h5, h6 { - font-size: 14px; - margin: 0; -} -hr { - background-color: #ccc; - border: 0; - height: 1px; - margin-bottom: 1.625em; -} - -/* Text elements */ -p, ul, ol, dl { - font-weight: 300; -} -p { - margin-bottom: 1.625em; -} -ul, ol { - margin: 0 0 1.625em 2.5em; - padding: 0; -} -ul { - list-style: square; -} -ol { - list-style-type: decimal; -} -ol ol { - list-style: upper-alpha; -} -ol ol ol { - list-style: lower-roman; -} -ol ol ol ol { - list-style: lower-alpha; -} -ul ul, ol ol, ul ol, ol ul { - margin-bottom: 0; -} -dl { - margin: 0 1.625em; -} -dt { - font-size: 15px; - font-weight: bold; -} -dd { - margin: 0 0 1.625em; -} -strong { - font-weight: bold; -} -cite, em, i { - font-style: italic; -} -cite { - border: none; -} -big { - font-size: 131.25%; -} -.mceContentBody blockquote, -.mceContentBody blockquote p { - font-family: Georgia, "Bitstream Charter", serif !important; - font-style: italic !important; - font-weight: normal; - margin: 0 3em; -} -.mceContentBody blockquote em, -.mceContentBody blockquote i, -.mceContentBody blockquote cite { - font-style: normal; -} -.mceContentBody blockquote cite { - color: #666; - font: 12px "Helvetica Neue", Helvetica, Arial, sans-serif; - font-weight: 300; - letter-spacing: 0.05em; - text-transform: uppercase; -} -pre { - background: #f4f4f4; - font: 13px "Courier 10 Pitch", Courier, monospace; - line-height: 1.5; - margin-bottom: 1.625em; - padding: 0.75em 1.625em; -} -code, kbd, code var { - font: 13px Monaco, Consolas, "Andale Mono", "DejaVu Sans Mono", monospace; -} -abbr, acronym, dfn { - border-bottom: 1px dotted #666; - cursor: help; -} -address { - display: block; - margin: 0 0 1.625em; -} -del { - color: #333; -} -ins { - background: #fff9c0; - border: none; - color: #333; - text-decoration: none; -} -sup, -sub { - font-size: 10px; - height: 0; - line-height: 1; - position: relative; - vertical-align: baseline; -} -sup { - bottom: 1ex; -} -sub { - top: .5ex; -} -input[type=text], -textarea { - background: #fafafa; - -moz-box-shadow: inset 0 1px 1px rgba(0,0,0,0.1); - -webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,0.1); - box-shadow: inset 0 1px 1px rgba(0,0,0,0.1); - border: 1px solid #ddd; - color: #888; -} -input[type=text]:focus, -textarea:focus { - color: #333; -} -textarea { - padding-left: 3px; - width: 98%; -} -input[type=text] { - padding: 3px; -} - -/* Links */ -a, -a em, -a strong { - color: #1b8be0; - text-decoration: none; -} -a:focus, -a:active, -a:hover { - text-decoration: underline; -} - -/* Alignment */ -.alignleft { - display: inline; - float: left; - margin-right: 1.625em; -} -.alignright { - display: inline; - float: right; - margin-left: 1.625em; -} -.aligncenter { - clear: both; - display: block; - margin-left: auto; - margin-right: auto; -} - -/* Tables */ -table { - border: none !important; - border-bottom: 1px solid #ddd !important; - border-collapse: collapse; - border-spacing: 0; - text-align: left; - margin: 0 0 1.625em; - width: 100%; -} -tr th { - border: none !important; - color: #666; - font-size: 10px; - font-weight: 500; - letter-spacing: 0.1em; - line-height: 2.6em; - text-transform: uppercase; -} -td { - border: none !important; - border-top: 1px solid #ddd !important; - padding: 6px 10px 6px 0; -} - -/* Images */ -img[class*="wp-image-"] { - height: auto; - max-width: 97.5%; -} -img.size-full { - width: auto; /* Prevent stretching of full-size images in IE8 */ -} -img.wp-smiley { - border: none; - margin-bottom: 0; - margin-top: 0; - padding: 0; -} -p img, -.wp-caption { - margin-top: 0.4em; -} -img { - border: 1px solid #ddd; - padding: 6px; -} -img.alignleft, -img.alignright, -img.aligncenter { - margin-bottom: 1.625em; -} -.wp-caption { - background: #eee; - border: none; - margin-bottom: 1.625em; - max-width: 96%; - padding: 9px; -} -.wp-caption img { - display: block; - margin: 5px auto 0 !important; - max-width: 98%; - border-color: #eee; -} -.wp-caption .wp-caption-text, -.wp-caption-dd { - color: #666; - font-family: Georgia, serif !important; - font-size: 12px; - margin: 0 0 0.6em 0 !important; - padding: 0 0 5px 40px; - position: relative; - text-align: left; -} -.wp-caption .wp-caption-text:before { - color: #666; - content: '\2014'; - font-size: 14px; - font-style: normal; - font-weight: bold; - margin-right: 5px; - position: absolute; - left: 10px; - top: 7px; -} -a:focus img[class*="wp-image-"], -a:hover img[class*="wp-image-"], -a:active img[class*="wp-image-"] { - background: #eee; - border-color: #bbb; -} -.wp-caption a:focus img, -.wp-caption a:active img, -.wp-caption a:hover img { - background: #fff; - border-color: #ddd; +/* +Theme Name: HuskyPress +Description: Used to style the TinyMCE editor. +*/ + +html .mceContentBody { + max-width: 584px; +} +* { + color: inherit; + font: 15px "Helvetica Neue", Helvetica, Arial, sans-serif; + font-style: inherit; + font-weight: inherit; + line-height: 1.625; +} +body { + color: #333; + font: 15px "Helvetica Neue", Helvetica, Arial, "Nimbus Sans L", sans-serif; + font-weight: 300; + line-height: 1.625; +} + +/* Headings */ +h1,h2,h3,h4,h5,h6 { + clear: both; +} +h1, +h2 { + color: #000; + font-size: 15px; + font-weight: bold; + margin: 0 0 .8125em; +} +h3 { + font-size: 10px; + letter-spacing: 0.1em; + line-height: 2.6em; + text-transform: uppercase; +} +h4, h5, h6 { + font-size: 14px; + margin: 0; +} +hr { + background-color: #ccc; + border: 0; + height: 1px; + margin-bottom: 1.625em; +} + +/* Text elements */ +p, ul, ol, dl { + font-weight: 300; +} +p { + margin-bottom: 1.625em; +} +ul, ol { + margin: 0 0 1.625em 2.5em; + padding: 0; +} +ul { + list-style: square; +} +ol { + list-style-type: decimal; +} +ol ol { + list-style: upper-alpha; +} +ol ol ol { + list-style: lower-roman; +} +ol ol ol ol { + list-style: lower-alpha; +} +ul ul, ol ol, ul ol, ol ul { + margin-bottom: 0; +} +dl { + margin: 0 1.625em; +} +dt { + font-size: 15px; + font-weight: bold; +} +dd { + margin: 0 0 1.625em; +} +strong { + font-weight: bold; +} +cite, em, i { + font-style: italic; +} +cite { + border: none; +} +big { + font-size: 131.25%; +} +.mceContentBody blockquote, +.mceContentBody blockquote p { + font-family: Georgia, "Bitstream Charter", serif !important; + font-style: italic !important; + font-weight: normal; + margin: 0 3em; +} +.mceContentBody blockquote em, +.mceContentBody blockquote i, +.mceContentBody blockquote cite { + font-style: normal; +} +.mceContentBody blockquote cite { + color: #666; + font: 12px "Helvetica Neue", Helvetica, Arial, sans-serif; + font-weight: 300; + letter-spacing: 0.05em; + text-transform: uppercase; +} +pre { + background: #f4f4f4; + font: 13px "Courier 10 Pitch", Courier, monospace; + line-height: 1.5; + margin-bottom: 1.625em; + padding: 0.75em 1.625em; +} +code, kbd, code var { + font: 13px Monaco, Consolas, "Andale Mono", "DejaVu Sans Mono", monospace; +} +abbr, acronym, dfn { + border-bottom: 1px dotted #666; + cursor: help; +} +address { + display: block; + margin: 0 0 1.625em; +} +del { + color: #333; +} +ins { + background: #fff9c0; + border: none; + color: #333; + text-decoration: none; +} +sup, +sub { + font-size: 10px; + height: 0; + line-height: 1; + position: relative; + vertical-align: baseline; +} +sup { + bottom: 1ex; +} +sub { + top: .5ex; +} +input[type=text], +textarea { + background: #fafafa; + -moz-box-shadow: inset 0 1px 1px rgba(0,0,0,0.1); + -webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,0.1); + box-shadow: inset 0 1px 1px rgba(0,0,0,0.1); + border: 1px solid #ddd; + color: #888; +} +input[type=text]:focus, +textarea:focus { + color: #333; +} +textarea { + padding-left: 3px; + width: 98%; +} +input[type=text] { + padding: 3px; +} + +/* Links */ +a, +a em, +a strong { + color: #1b8be0; + text-decoration: none; +} +a:focus, +a:active, +a:hover { + text-decoration: underline; +} + +/* Alignment */ +.alignleft { + display: inline; + float: left; + margin-right: 1.625em; +} +.alignright { + display: inline; + float: right; + margin-left: 1.625em; +} +.aligncenter { + clear: both; + display: block; + margin-left: auto; + margin-right: auto; +} + +/* Tables */ +table { + border: none !important; + border-bottom: 1px solid #ddd !important; + border-collapse: collapse; + border-spacing: 0; + text-align: left; + margin: 0 0 1.625em; + width: 100%; +} +tr th { + border: none !important; + color: #666; + font-size: 10px; + font-weight: 500; + letter-spacing: 0.1em; + line-height: 2.6em; + text-transform: uppercase; +} +td { + border: none !important; + border-top: 1px solid #ddd !important; + padding: 6px 10px 6px 0; +} + +/* Images */ +img[class*="wp-image-"] { + height: auto; + max-width: 97.5%; +} +img.size-full { + width: auto; /* Prevent stretching of full-size images in IE8 */ +} +img.wp-smiley { + border: none; + margin-bottom: 0; + margin-top: 0; + padding: 0; +} +p img, +.wp-caption { + margin-top: 0.4em; +} +img { + border: 1px solid #ddd; + padding: 6px; +} +img.alignleft, +img.alignright, +img.aligncenter { + margin-bottom: 1.625em; +} +.wp-caption { + background: #eee; + border: none; + margin-bottom: 1.625em; + max-width: 96%; + padding: 9px; +} +.wp-caption img { + display: block; + margin: 5px auto 0 !important; + max-width: 98%; + border-color: #eee; +} +.wp-caption .wp-caption-text, +.wp-caption-dd { + color: #666; + font-family: Georgia, serif !important; + font-size: 12px; + margin: 0 0 0.6em 0 !important; + padding: 0 0 5px 40px; + position: relative; + text-align: left; +} +.wp-caption .wp-caption-text:before { + color: #666; + content: '\2014'; + font-size: 14px; + font-style: normal; + font-weight: bold; + margin-right: 5px; + position: absolute; + left: 10px; + top: 7px; +} +a:focus img[class*="wp-image-"], +a:hover img[class*="wp-image-"], +a:active img[class*="wp-image-"] { + background: #eee; + border-color: #bbb; +} +.wp-caption a:focus img, +.wp-caption a:active img, +.wp-caption a:hover img { + background: #fff; + border-color: #ddd; } \ No newline at end of file diff --git a/footer.php b/Wordpress/footer.php similarity index 90% rename from footer.php rename to Wordpress/footer.php index 023b91e..d48bade 100644 --- a/footer.php +++ b/Wordpress/footer.php @@ -1,28 +1,28 @@ - - - - -
- - - - -
- - + + + + +
+ + + + +
+ + \ No newline at end of file diff --git a/functions.php b/Wordpress/functions.php similarity index 97% rename from functions.php rename to Wordpress/functions.php index f4ab201..28c1077 100644 --- a/functions.php +++ b/Wordpress/functions.php @@ -1,596 +1,596 @@ - - * add_action( 'after_setup_theme', 'my_child_theme_setup' ); - * function my_child_theme_setup() { - * // We are providing our own filter for excerpt_length (or using the unfiltered value) - * remove_filter( 'excerpt_length', 'twentyeleven_excerpt_length' ); - * ... - * } - * - * - * For more information on hooks, actions, and filters, see http://codex.wordpress.org/Plugin_API. - * - * @package UConn - * @subpackage HuskyPress - * @since HuskyPress 1.0 - */ - -/** - * Set the content width based on the theme's design and stylesheet. - */ -if ( ! isset( $content_width ) ) - $content_width = 584; - -/** - * Tell WordPress to run twentyeleven_setup() when the 'after_setup_theme' hook is run. - */ -add_action( 'after_setup_theme', 'twentyeleven_setup' ); - -if ( ! function_exists( 'twentyeleven_setup' ) ): -/** - * Sets up theme defaults and registers support for various WordPress features. - * - * Note that this function is hooked into the after_setup_theme hook, which runs - * before the init hook. The init hook is too late for some features, such as indicating - * support post thumbnails. - * - * To override twentyeleven_setup() in a child theme, add your own twentyeleven_setup to your child theme's - * functions.php file. - * - * @uses load_theme_textdomain() For translation/localization support. - * @uses add_editor_style() To style the visual editor. - * @uses add_theme_support() To add support for post thumbnails, automatic feed links, and Post Formats. - * @uses register_nav_menus() To add support for navigation menus. - * @uses add_custom_background() To add support for a custom background. - * @uses add_custom_image_header() To add support for a custom header. - * @uses register_default_headers() To register the default custom header images provided with the theme. - * @uses set_post_thumbnail_size() To set a custom post thumbnail size. - * - * @since Twenty Eleven 1.0 - */ -function twentyeleven_setup() { - - /* Make Twenty Eleven available for translation. - * Translations can be added to the /languages/ directory. - * If you're building a theme based on Twenty Eleven, use a find and replace - * to change 'twentyeleven' to the name of your theme in all the template files. - */ - load_theme_textdomain( 'twentyeleven', get_template_directory() . '/languages' ); - - $locale = get_locale(); - $locale_file = get_template_directory() . "/languages/$locale.php"; - if ( is_readable( $locale_file ) ) - require_once( $locale_file ); - - // This theme styles the visual editor with editor-style.css to match the theme style. - add_editor_style(); - - // Load up our theme options page and related code. - require( get_template_directory() . '/inc/theme-options.php' ); - - // Grab Twenty Eleven's Ephemera widget. - require( get_template_directory() . '/inc/widgets.php' ); - - // Add default posts and comments RSS feed links to . - add_theme_support( 'automatic-feed-links' ); - - // This theme uses wp_nav_menu() in one location. - register_nav_menu( 'primary', __( 'Primary Menu', 'twentyeleven' ) ); - - // Add support for a variety of post formats - add_theme_support( 'post-formats', array( 'aside', 'link', 'gallery', 'status', 'quote', 'image' ) ); - - // Add support for custom backgrounds - add_custom_background(); - - // This theme uses Featured Images (also known as post thumbnails) for per-post/per-page Custom Header images - add_theme_support( 'post-thumbnails' ); - - // The next four constants set how Twenty Eleven supports custom headers. - - // The default header text color - define( 'HEADER_TEXTCOLOR', '000' ); - - // By leaving empty, we allow for random image rotation. - define( 'HEADER_IMAGE', '' ); - - // The height and width of your custom header. - // Add a filter to twentyeleven_header_image_width and twentyeleven_header_image_height to change these values. - define( 'HEADER_IMAGE_WIDTH', apply_filters( 'twentyeleven_header_image_width', 1000 ) ); - define( 'HEADER_IMAGE_HEIGHT', apply_filters( 'twentyeleven_header_image_height', 288 ) ); - - // We'll be using post thumbnails for custom header images on posts and pages. - // We want them to be the size of the header image that we just defined - // Larger images will be auto-cropped to fit, smaller ones will be ignored. See header.php. - set_post_thumbnail_size( HEADER_IMAGE_WIDTH, HEADER_IMAGE_HEIGHT, true ); - - // Add Twenty Eleven's custom image sizes - add_image_size( 'large-feature', HEADER_IMAGE_WIDTH, HEADER_IMAGE_HEIGHT, true ); // Used for large feature (header) images - add_image_size( 'small-feature', 500, 300 ); // Used for featured posts if a large-feature doesn't exist - - // Turn on random header image rotation by default. - add_theme_support( 'custom-header', array( 'random-default' => true ) ); - - // Add a way for the custom header to be styled in the admin panel that controls - // custom headers. See twentyeleven_admin_header_style(), below. - add_custom_image_header( 'twentyeleven_header_style', 'twentyeleven_admin_header_style', 'twentyeleven_admin_header_image' ); - - // ... and thus ends the changeable header business. - - // Default custom headers packaged with the theme. %s is a placeholder for the theme template directory URI. - register_default_headers( array( - 'wheel' => array( - 'url' => '%s/images/headers/wheel.jpg', - 'thumbnail_url' => '%s/images/headers/wheel-thumbnail.jpg', - /* translators: header image description */ - 'description' => __( 'Wheel', 'twentyeleven' ) - ), - 'shore' => array( - 'url' => '%s/images/headers/shore.jpg', - 'thumbnail_url' => '%s/images/headers/shore-thumbnail.jpg', - /* translators: header image description */ - 'description' => __( 'Shore', 'twentyeleven' ) - ), - 'trolley' => array( - 'url' => '%s/images/headers/trolley.jpg', - 'thumbnail_url' => '%s/images/headers/trolley-thumbnail.jpg', - /* translators: header image description */ - 'description' => __( 'Trolley', 'twentyeleven' ) - ), - 'pine-cone' => array( - 'url' => '%s/images/headers/pine-cone.jpg', - 'thumbnail_url' => '%s/images/headers/pine-cone-thumbnail.jpg', - /* translators: header image description */ - 'description' => __( 'Pine Cone', 'twentyeleven' ) - ), - 'chessboard' => array( - 'url' => '%s/images/headers/chessboard.jpg', - 'thumbnail_url' => '%s/images/headers/chessboard-thumbnail.jpg', - /* translators: header image description */ - 'description' => __( 'Chessboard', 'twentyeleven' ) - ), - 'lanterns' => array( - 'url' => '%s/images/headers/lanterns.jpg', - 'thumbnail_url' => '%s/images/headers/lanterns-thumbnail.jpg', - /* translators: header image description */ - 'description' => __( 'Lanterns', 'twentyeleven' ) - ), - 'willow' => array( - 'url' => '%s/images/headers/willow.jpg', - 'thumbnail_url' => '%s/images/headers/willow-thumbnail.jpg', - /* translators: header image description */ - 'description' => __( 'Willow', 'twentyeleven' ) - ), - 'hanoi' => array( - 'url' => '%s/images/headers/hanoi.jpg', - 'thumbnail_url' => '%s/images/headers/hanoi-thumbnail.jpg', - /* translators: header image description */ - 'description' => __( 'Hanoi Plant', 'twentyeleven' ) - ) - ) ); -} -endif; // twentyeleven_setup - -if ( ! function_exists( 'twentyeleven_header_style' ) ) : -/** - * Styles the header image and text displayed on the blog - * - * @since Twenty Eleven 1.0 - */ -function twentyeleven_header_style() { - - // If no custom options for text are set, let's bail - // get_header_textcolor() options: HEADER_TEXTCOLOR is default, hide text (returns 'blank') or any hex value - if ( HEADER_TEXTCOLOR == get_header_textcolor() ) - return; - // If we get this far, we have custom styles. Let's do this. - ?> - - Header admin panel. - * - * Referenced via add_custom_image_header() in twentyeleven_setup(). - * - * @since Twenty Eleven 1.0 - */ -function twentyeleven_admin_header_style() { -?> - - Header admin panel. - * - * Referenced via add_custom_image_header() in twentyeleven_setup(). - * - * @since Twenty Eleven 1.0 - */ -function twentyeleven_admin_header_image() { ?> - -' . __( 'Continue reading ', 'twentyeleven' ) . ''; -} - -/** - * Replaces "[...]" (appended to automatically generated excerpts) with an ellipsis and twentyeleven_continue_reading_link(). - * - * To override this in a child theme, remove the filter and add your own - * function tied to the excerpt_more filter hook. - */ -function twentyeleven_auto_excerpt_more( $more ) { - return ' …' . twentyeleven_continue_reading_link(); -} -add_filter( 'excerpt_more', 'twentyeleven_auto_excerpt_more' ); - -/** - * Adds a pretty "Continue Reading" link to custom post excerpts. - * - * To override this link in a child theme, remove the filter and add your own - * function tied to the get_the_excerpt filter hook. - */ -function twentyeleven_custom_excerpt_more( $output ) { - if ( has_excerpt() && ! is_attachment() ) { - $output .= twentyeleven_continue_reading_link(); - } - return $output; -} -add_filter( 'get_the_excerpt', 'twentyeleven_custom_excerpt_more' ); - -/** - * Get our wp_nav_menu() fallback, wp_page_menu(), to show a home link. - */ -function twentyeleven_page_menu_args( $args ) { - $args['show_home'] = true; - return $args; -} -add_filter( 'wp_page_menu_args', 'twentyeleven_page_menu_args' ); - -/** - * Register our sidebars and widgetized areas. Also register the default Epherma widget. - * - * @since Twenty Eleven 1.0 - */ -function twentyeleven_widgets_init() { - - register_widget( 'Twenty_Eleven_Ephemera_Widget' ); - - register_sidebar( array( - 'name' => __( 'Main Sidebar', 'twentyeleven' ), - 'id' => 'sidebar-1', - 'before_widget' => '", - 'before_title' => '

', - 'after_title' => '

', - ) ); - - register_sidebar( array( - 'name' => __( 'Showcase Sidebar', 'twentyeleven' ), - 'id' => 'sidebar-2', - 'description' => __( 'The sidebar for the optional Showcase Template', 'twentyeleven' ), - 'before_widget' => '", - 'before_title' => '

', - 'after_title' => '

', - ) ); - - register_sidebar( array( - 'name' => __( 'Footer Area One', 'twentyeleven' ), - 'id' => 'sidebar-3', - 'description' => __( 'An optional widget area for your site footer', 'twentyeleven' ), - 'before_widget' => '", - 'before_title' => '

', - 'after_title' => '

', - ) ); - - register_sidebar( array( - 'name' => __( 'Footer Area Two', 'twentyeleven' ), - 'id' => 'sidebar-4', - 'description' => __( 'An optional widget area for your site footer', 'twentyeleven' ), - 'before_widget' => '", - 'before_title' => '

', - 'after_title' => '

', - ) ); - - register_sidebar( array( - 'name' => __( 'Footer Area Three', 'twentyeleven' ), - 'id' => 'sidebar-5', - 'description' => __( 'An optional widget area for your site footer', 'twentyeleven' ), - 'before_widget' => '", - 'before_title' => '

', - 'after_title' => '

', - ) ); -} -add_action( 'widgets_init', 'twentyeleven_widgets_init' ); - -if ( ! function_exists( 'twentyeleven_content_nav' ) ) : -/** - * Display navigation to next/previous pages when applicable - */ -function twentyeleven_content_nav( $nav_id ) { - global $wp_query; - - if ( $wp_query->max_num_pages > 1 ) : ?> - - ]*?href=[\'"](.+?)[\'"]/is', get_the_content(), $matches ) ) - return false; - - return esc_url_raw( $matches[1] ); -} - -/** - * Count the number of footer sidebars to enable dynamic classes for the footer - */ -function twentyeleven_footer_sidebar_class() { - $count = 0; - - if ( is_active_sidebar( 'sidebar-3' ) ) - $count++; - - if ( is_active_sidebar( 'sidebar-4' ) ) - $count++; - - if ( is_active_sidebar( 'sidebar-5' ) ) - $count++; - - $class = ''; - - switch ( $count ) { - case '1': - $class = 'one'; - break; - case '2': - $class = 'two'; - break; - case '3': - $class = 'three'; - break; - } - - if ( $class ) - echo 'class="' . $class . '"'; -} - -if ( ! function_exists( 'twentyeleven_comment' ) ) : -/** - * Template for comments and pingbacks. - * - * To override this walker in a child theme without modifying the comments template - * simply create your own twentyeleven_comment(), and that function will be used instead. - * - * Used as a callback by wp_list_comments() for displaying the comments. - * - * @since Twenty Eleven 1.0 - */ -function twentyeleven_comment( $comment, $args, $depth ) { - $GLOBALS['comment'] = $comment; - switch ( $comment->comment_type ) : - case 'pingback' : - case 'trackback' : - ?> -
  • -

    ', '' ); ?>

    - -
  • id="li-comment-"> -
    -
    -
    - comment_parent ) - $avatar_size = 39; - - echo get_avatar( $comment, $avatar_size ); - - /* translators: 1: comment author, 2: date and time */ - printf( __( '%1$s on %2$s said:', 'twentyeleven' ), - sprintf( '%s', get_comment_author_link() ), - sprintf( '', - esc_url( get_comment_link( $comment->comment_ID ) ), - get_comment_time( 'c' ), - /* translators: 1: date, 2: time */ - sprintf( __( '%1$s at %2$s', 'twentyeleven' ), get_comment_date(), get_comment_time() ) - ) - ); - ?> - - ', '' ); ?> -
    - - comment_approved == '0' ) : ?> - -
    - - -
    - -
    - -
    - __( 'Reply ', 'twentyeleven' ), 'depth' => $depth, 'max_depth' => $args['max_depth'] ) ) ); ?> -
    -
    - - Posted on by ', 'twentyeleven' ), - esc_url( get_permalink() ), - esc_attr( get_the_time() ), - esc_attr( get_the_date( 'c' ) ), - esc_html( get_the_date() ), - esc_url( get_author_posts_url( get_the_author_meta( 'ID' ) ) ), - esc_attr( sprintf( __( 'View all posts by %s', 'twentyeleven' ), get_the_author() ) ), - get_the_author() - ); -} -endif; - -/** - * Adds two classes to the array of body classes. - * The first is if the site has only had one author with published posts. - * The second is if a singular post being displayed - * - * @since Twenty Eleven 1.0 - */ -function twentyeleven_body_classes( $classes ) { - - if ( function_exists( 'is_multi_author' ) && ! is_multi_author() ) - $classes[] = 'single-author'; - - if ( is_singular() && ! is_home() && ! is_page_template( 'showcase.php' ) && ! is_page_template( 'sidebar-page.php' ) ) - $classes[] = 'singular'; - - return $classes; -} -add_filter( 'body_class', 'twentyeleven_body_classes' ); - -define( 'HEADER_IMAGE_WIDTH', apply_filters( 'twentyeleven_header_image_width', 950 ) ); - define( 'HEADER_IMAGE_HEIGHT', apply_filters( 'twentyeleven_header_image_height', 90 ) ); + + * add_action( 'after_setup_theme', 'my_child_theme_setup' ); + * function my_child_theme_setup() { + * // We are providing our own filter for excerpt_length (or using the unfiltered value) + * remove_filter( 'excerpt_length', 'twentyeleven_excerpt_length' ); + * ... + * } + * + * + * For more information on hooks, actions, and filters, see http://codex.wordpress.org/Plugin_API. + * + * @package UConn + * @subpackage HuskyPress + * @since HuskyPress 1.0 + */ + +/** + * Set the content width based on the theme's design and stylesheet. + */ +if ( ! isset( $content_width ) ) + $content_width = 584; + +/** + * Tell WordPress to run twentyeleven_setup() when the 'after_setup_theme' hook is run. + */ +add_action( 'after_setup_theme', 'twentyeleven_setup' ); + +if ( ! function_exists( 'twentyeleven_setup' ) ): +/** + * Sets up theme defaults and registers support for various WordPress features. + * + * Note that this function is hooked into the after_setup_theme hook, which runs + * before the init hook. The init hook is too late for some features, such as indicating + * support post thumbnails. + * + * To override twentyeleven_setup() in a child theme, add your own twentyeleven_setup to your child theme's + * functions.php file. + * + * @uses load_theme_textdomain() For translation/localization support. + * @uses add_editor_style() To style the visual editor. + * @uses add_theme_support() To add support for post thumbnails, automatic feed links, and Post Formats. + * @uses register_nav_menus() To add support for navigation menus. + * @uses add_custom_background() To add support for a custom background. + * @uses add_custom_image_header() To add support for a custom header. + * @uses register_default_headers() To register the default custom header images provided with the theme. + * @uses set_post_thumbnail_size() To set a custom post thumbnail size. + * + * @since Twenty Eleven 1.0 + */ +function twentyeleven_setup() { + + /* Make Twenty Eleven available for translation. + * Translations can be added to the /languages/ directory. + * If you're building a theme based on Twenty Eleven, use a find and replace + * to change 'twentyeleven' to the name of your theme in all the template files. + */ + load_theme_textdomain( 'twentyeleven', get_template_directory() . '/languages' ); + + $locale = get_locale(); + $locale_file = get_template_directory() . "/languages/$locale.php"; + if ( is_readable( $locale_file ) ) + require_once( $locale_file ); + + // This theme styles the visual editor with editor-style.css to match the theme style. + add_editor_style(); + + // Load up our theme options page and related code. + require( get_template_directory() . '/inc/theme-options.php' ); + + // Grab Twenty Eleven's Ephemera widget. + require( get_template_directory() . '/inc/widgets.php' ); + + // Add default posts and comments RSS feed links to . + add_theme_support( 'automatic-feed-links' ); + + // This theme uses wp_nav_menu() in one location. + register_nav_menu( 'primary', __( 'Primary Menu', 'twentyeleven' ) ); + + // Add support for a variety of post formats + add_theme_support( 'post-formats', array( 'aside', 'link', 'gallery', 'status', 'quote', 'image' ) ); + + // Add support for custom backgrounds + add_custom_background(); + + // This theme uses Featured Images (also known as post thumbnails) for per-post/per-page Custom Header images + add_theme_support( 'post-thumbnails' ); + + // The next four constants set how Twenty Eleven supports custom headers. + + // The default header text color + define( 'HEADER_TEXTCOLOR', '000' ); + + // By leaving empty, we allow for random image rotation. + define( 'HEADER_IMAGE', '' ); + + // The height and width of your custom header. + // Add a filter to twentyeleven_header_image_width and twentyeleven_header_image_height to change these values. + define( 'HEADER_IMAGE_WIDTH', apply_filters( 'twentyeleven_header_image_width', 1000 ) ); + define( 'HEADER_IMAGE_HEIGHT', apply_filters( 'twentyeleven_header_image_height', 288 ) ); + + // We'll be using post thumbnails for custom header images on posts and pages. + // We want them to be the size of the header image that we just defined + // Larger images will be auto-cropped to fit, smaller ones will be ignored. See header.php. + set_post_thumbnail_size( HEADER_IMAGE_WIDTH, HEADER_IMAGE_HEIGHT, true ); + + // Add Twenty Eleven's custom image sizes + add_image_size( 'large-feature', HEADER_IMAGE_WIDTH, HEADER_IMAGE_HEIGHT, true ); // Used for large feature (header) images + add_image_size( 'small-feature', 500, 300 ); // Used for featured posts if a large-feature doesn't exist + + // Turn on random header image rotation by default. + add_theme_support( 'custom-header', array( 'random-default' => true ) ); + + // Add a way for the custom header to be styled in the admin panel that controls + // custom headers. See twentyeleven_admin_header_style(), below. + add_custom_image_header( 'twentyeleven_header_style', 'twentyeleven_admin_header_style', 'twentyeleven_admin_header_image' ); + + // ... and thus ends the changeable header business. + + // Default custom headers packaged with the theme. %s is a placeholder for the theme template directory URI. + register_default_headers( array( + 'wheel' => array( + 'url' => '%s/images/headers/wheel.jpg', + 'thumbnail_url' => '%s/images/headers/wheel-thumbnail.jpg', + /* translators: header image description */ + 'description' => __( 'Wheel', 'twentyeleven' ) + ), + 'shore' => array( + 'url' => '%s/images/headers/shore.jpg', + 'thumbnail_url' => '%s/images/headers/shore-thumbnail.jpg', + /* translators: header image description */ + 'description' => __( 'Shore', 'twentyeleven' ) + ), + 'trolley' => array( + 'url' => '%s/images/headers/trolley.jpg', + 'thumbnail_url' => '%s/images/headers/trolley-thumbnail.jpg', + /* translators: header image description */ + 'description' => __( 'Trolley', 'twentyeleven' ) + ), + 'pine-cone' => array( + 'url' => '%s/images/headers/pine-cone.jpg', + 'thumbnail_url' => '%s/images/headers/pine-cone-thumbnail.jpg', + /* translators: header image description */ + 'description' => __( 'Pine Cone', 'twentyeleven' ) + ), + 'chessboard' => array( + 'url' => '%s/images/headers/chessboard.jpg', + 'thumbnail_url' => '%s/images/headers/chessboard-thumbnail.jpg', + /* translators: header image description */ + 'description' => __( 'Chessboard', 'twentyeleven' ) + ), + 'lanterns' => array( + 'url' => '%s/images/headers/lanterns.jpg', + 'thumbnail_url' => '%s/images/headers/lanterns-thumbnail.jpg', + /* translators: header image description */ + 'description' => __( 'Lanterns', 'twentyeleven' ) + ), + 'willow' => array( + 'url' => '%s/images/headers/willow.jpg', + 'thumbnail_url' => '%s/images/headers/willow-thumbnail.jpg', + /* translators: header image description */ + 'description' => __( 'Willow', 'twentyeleven' ) + ), + 'hanoi' => array( + 'url' => '%s/images/headers/hanoi.jpg', + 'thumbnail_url' => '%s/images/headers/hanoi-thumbnail.jpg', + /* translators: header image description */ + 'description' => __( 'Hanoi Plant', 'twentyeleven' ) + ) + ) ); +} +endif; // twentyeleven_setup + +if ( ! function_exists( 'twentyeleven_header_style' ) ) : +/** + * Styles the header image and text displayed on the blog + * + * @since Twenty Eleven 1.0 + */ +function twentyeleven_header_style() { + + // If no custom options for text are set, let's bail + // get_header_textcolor() options: HEADER_TEXTCOLOR is default, hide text (returns 'blank') or any hex value + if ( HEADER_TEXTCOLOR == get_header_textcolor() ) + return; + // If we get this far, we have custom styles. Let's do this. + ?> + + Header admin panel. + * + * Referenced via add_custom_image_header() in twentyeleven_setup(). + * + * @since Twenty Eleven 1.0 + */ +function twentyeleven_admin_header_style() { +?> + + Header admin panel. + * + * Referenced via add_custom_image_header() in twentyeleven_setup(). + * + * @since Twenty Eleven 1.0 + */ +function twentyeleven_admin_header_image() { ?> + +' . __( 'Continue reading ', 'twentyeleven' ) . ''; +} + +/** + * Replaces "[...]" (appended to automatically generated excerpts) with an ellipsis and twentyeleven_continue_reading_link(). + * + * To override this in a child theme, remove the filter and add your own + * function tied to the excerpt_more filter hook. + */ +function twentyeleven_auto_excerpt_more( $more ) { + return ' …' . twentyeleven_continue_reading_link(); +} +add_filter( 'excerpt_more', 'twentyeleven_auto_excerpt_more' ); + +/** + * Adds a pretty "Continue Reading" link to custom post excerpts. + * + * To override this link in a child theme, remove the filter and add your own + * function tied to the get_the_excerpt filter hook. + */ +function twentyeleven_custom_excerpt_more( $output ) { + if ( has_excerpt() && ! is_attachment() ) { + $output .= twentyeleven_continue_reading_link(); + } + return $output; +} +add_filter( 'get_the_excerpt', 'twentyeleven_custom_excerpt_more' ); + +/** + * Get our wp_nav_menu() fallback, wp_page_menu(), to show a home link. + */ +function twentyeleven_page_menu_args( $args ) { + $args['show_home'] = true; + return $args; +} +add_filter( 'wp_page_menu_args', 'twentyeleven_page_menu_args' ); + +/** + * Register our sidebars and widgetized areas. Also register the default Epherma widget. + * + * @since Twenty Eleven 1.0 + */ +function twentyeleven_widgets_init() { + + register_widget( 'Twenty_Eleven_Ephemera_Widget' ); + + register_sidebar( array( + 'name' => __( 'Main Sidebar', 'twentyeleven' ), + 'id' => 'sidebar-1', + 'before_widget' => '", + 'before_title' => '

    ', + 'after_title' => '

    ', + ) ); + + register_sidebar( array( + 'name' => __( 'Showcase Sidebar', 'twentyeleven' ), + 'id' => 'sidebar-2', + 'description' => __( 'The sidebar for the optional Showcase Template', 'twentyeleven' ), + 'before_widget' => '", + 'before_title' => '

    ', + 'after_title' => '

    ', + ) ); + + register_sidebar( array( + 'name' => __( 'Footer Area One', 'twentyeleven' ), + 'id' => 'sidebar-3', + 'description' => __( 'An optional widget area for your site footer', 'twentyeleven' ), + 'before_widget' => '", + 'before_title' => '

    ', + 'after_title' => '

    ', + ) ); + + register_sidebar( array( + 'name' => __( 'Footer Area Two', 'twentyeleven' ), + 'id' => 'sidebar-4', + 'description' => __( 'An optional widget area for your site footer', 'twentyeleven' ), + 'before_widget' => '", + 'before_title' => '

    ', + 'after_title' => '

    ', + ) ); + + register_sidebar( array( + 'name' => __( 'Footer Area Three', 'twentyeleven' ), + 'id' => 'sidebar-5', + 'description' => __( 'An optional widget area for your site footer', 'twentyeleven' ), + 'before_widget' => '", + 'before_title' => '

    ', + 'after_title' => '

    ', + ) ); +} +add_action( 'widgets_init', 'twentyeleven_widgets_init' ); + +if ( ! function_exists( 'twentyeleven_content_nav' ) ) : +/** + * Display navigation to next/previous pages when applicable + */ +function twentyeleven_content_nav( $nav_id ) { + global $wp_query; + + if ( $wp_query->max_num_pages > 1 ) : ?> + + ]*?href=[\'"](.+?)[\'"]/is', get_the_content(), $matches ) ) + return false; + + return esc_url_raw( $matches[1] ); +} + +/** + * Count the number of footer sidebars to enable dynamic classes for the footer + */ +function twentyeleven_footer_sidebar_class() { + $count = 0; + + if ( is_active_sidebar( 'sidebar-3' ) ) + $count++; + + if ( is_active_sidebar( 'sidebar-4' ) ) + $count++; + + if ( is_active_sidebar( 'sidebar-5' ) ) + $count++; + + $class = ''; + + switch ( $count ) { + case '1': + $class = 'one'; + break; + case '2': + $class = 'two'; + break; + case '3': + $class = 'three'; + break; + } + + if ( $class ) + echo 'class="' . $class . '"'; +} + +if ( ! function_exists( 'twentyeleven_comment' ) ) : +/** + * Template for comments and pingbacks. + * + * To override this walker in a child theme without modifying the comments template + * simply create your own twentyeleven_comment(), and that function will be used instead. + * + * Used as a callback by wp_list_comments() for displaying the comments. + * + * @since Twenty Eleven 1.0 + */ +function twentyeleven_comment( $comment, $args, $depth ) { + $GLOBALS['comment'] = $comment; + switch ( $comment->comment_type ) : + case 'pingback' : + case 'trackback' : + ?> +
  • +

    ', '' ); ?>

    + +
  • id="li-comment-"> +
    +
    +
    + comment_parent ) + $avatar_size = 39; + + echo get_avatar( $comment, $avatar_size ); + + /* translators: 1: comment author, 2: date and time */ + printf( __( '%1$s on %2$s said:', 'twentyeleven' ), + sprintf( '%s', get_comment_author_link() ), + sprintf( '', + esc_url( get_comment_link( $comment->comment_ID ) ), + get_comment_time( 'c' ), + /* translators: 1: date, 2: time */ + sprintf( __( '%1$s at %2$s', 'twentyeleven' ), get_comment_date(), get_comment_time() ) + ) + ); + ?> + + ', '' ); ?> +
    + + comment_approved == '0' ) : ?> + +
    + + +
    + +
    + +
    + __( 'Reply ', 'twentyeleven' ), 'depth' => $depth, 'max_depth' => $args['max_depth'] ) ) ); ?> +
    +
    + + Posted on by ', 'twentyeleven' ), + esc_url( get_permalink() ), + esc_attr( get_the_time() ), + esc_attr( get_the_date( 'c' ) ), + esc_html( get_the_date() ), + esc_url( get_author_posts_url( get_the_author_meta( 'ID' ) ) ), + esc_attr( sprintf( __( 'View all posts by %s', 'twentyeleven' ), get_the_author() ) ), + get_the_author() + ); +} +endif; + +/** + * Adds two classes to the array of body classes. + * The first is if the site has only had one author with published posts. + * The second is if a singular post being displayed + * + * @since Twenty Eleven 1.0 + */ +function twentyeleven_body_classes( $classes ) { + + if ( function_exists( 'is_multi_author' ) && ! is_multi_author() ) + $classes[] = 'single-author'; + + if ( is_singular() && ! is_home() && ! is_page_template( 'showcase.php' ) && ! is_page_template( 'sidebar-page.php' ) ) + $classes[] = 'singular'; + + return $classes; +} +add_filter( 'body_class', 'twentyeleven_body_classes' ); + +define( 'HEADER_IMAGE_WIDTH', apply_filters( 'twentyeleven_header_image_width', 950 ) ); + define( 'HEADER_IMAGE_HEIGHT', apply_filters( 'twentyeleven_header_image_height', 90 ) ); diff --git a/header.php b/Wordpress/header.php similarity index 97% rename from header.php rename to Wordpress/header.php index 0632f39..102cff9 100644 --- a/header.php +++ b/Wordpress/header.php @@ -1,121 +1,121 @@ - section and everything up till
    - * - * @package UConn - * @subpackage HuskyPress - * @since HuskyPress 1.0 - */ -?> - - - - -> - - - - - - - - -<?php - /* - * Print the <title> tag based on what is being viewed. - */ - global $page, $paged; - - wp_title( '|', true, 'right' ); - - // Add the blog name. - bloginfo( 'name' ); - - // Add the blog description for the home/front page. - $site_description = get_bloginfo( 'description', 'display' ); - if ( $site_description && ( is_home() || is_front_page() ) ) - echo " | $site_description"; - - // Add a page number if necessary: - if ( $paged >= 2 || $page >= 2 ) - echo ' | ' . sprintf( __( 'Page %s', 'twentyeleven' ), max( $paged, $page ) ); - - ?> - - - - - - - * tag of your theme, or you will break many plugins, which - * generally use this hook to add elements to such - * as styles, scripts, and meta tags. - */ - wp_head(); -?> - - - - - -> -
    - - - + section and everything up till
    + * + * @package UConn + * @subpackage HuskyPress + * @since HuskyPress 1.0 + */ +?> + + + + +> + + + + + + + + +<?php + /* + * Print the <title> tag based on what is being viewed. + */ + global $page, $paged; + + wp_title( '|', true, 'right' ); + + // Add the blog name. + bloginfo( 'name' ); + + // Add the blog description for the home/front page. + $site_description = get_bloginfo( 'description', 'display' ); + if ( $site_description && ( is_home() || is_front_page() ) ) + echo " | $site_description"; + + // Add a page number if necessary: + if ( $paged >= 2 || $page >= 2 ) + echo ' | ' . sprintf( __( 'Page %s', 'twentyeleven' ), max( $paged, $page ) ); + + ?> + + + + + + + * tag of your theme, or you will break many plugins, which + * generally use this hook to add elements to such + * as styles, scripts, and meta tags. + */ + wp_head(); +?> + + + + + +> +
    + + +
    \ No newline at end of file diff --git a/image.php b/Wordpress/image.php similarity index 97% rename from image.php rename to Wordpress/image.php index c81a738..a8aa0e1 100644 --- a/image.php +++ b/Wordpress/image.php @@ -1,104 +1,104 @@ - - -
    -
    - - - - - -
    > -
    -

    - - - -
    - -
    - -
    -
    - $post->post_parent, 'post_status' => 'inherit', 'post_type' => 'attachment', 'post_mime_type' => 'image', 'order' => 'ASC', 'orderby' => 'menu_order ID' ) ) ); - foreach ( $attachments as $k => $attachment ) { - if ( $attachment->ID == $post->ID ) - break; - } - $k++; - // If there is more than 1 attachment in a gallery - if ( count( $attachments ) > 1 ) { - if ( isset( $attachments[ $k ] ) ) - // get the URL of the next image attachment - $next_attachment_url = get_attachment_link( $attachments[ $k ]->ID ); - else - // or get the URL of the first image attachment - $next_attachment_url = get_attachment_link( $attachments[ 0 ]->ID ); - } else { - // or, if there's only 1 image, get the URL of the image - $next_attachment_url = wp_get_attachment_url(); - } -?> - ID, array( $attachment_size, 1024 ) ); // filterable image width with 1024px limit for image height. - ?> - - post_excerpt ) ) : ?> -
    - -
    - -
    - -
    - -
    - - '' ) ); ?> -
    - -
    - -
    - - - - - -
    -
    - + + +
    +
    + + + + + +
    > +
    +

    + + + +
    + +
    + +
    +
    + $post->post_parent, 'post_status' => 'inherit', 'post_type' => 'attachment', 'post_mime_type' => 'image', 'order' => 'ASC', 'orderby' => 'menu_order ID' ) ) ); + foreach ( $attachments as $k => $attachment ) { + if ( $attachment->ID == $post->ID ) + break; + } + $k++; + // If there is more than 1 attachment in a gallery + if ( count( $attachments ) > 1 ) { + if ( isset( $attachments[ $k ] ) ) + // get the URL of the next image attachment + $next_attachment_url = get_attachment_link( $attachments[ $k ]->ID ); + else + // or get the URL of the first image attachment + $next_attachment_url = get_attachment_link( $attachments[ 0 ]->ID ); + } else { + // or, if there's only 1 image, get the URL of the image + $next_attachment_url = wp_get_attachment_url(); + } +?> + ID, array( $attachment_size, 1024 ) ); // filterable image width with 1024px limit for image height. + ?> + + post_excerpt ) ) : ?> +
    + +
    + +
    + +
    + +
    + + '' ) ); ?> +
    + +
    + +
    + + + + + +
    +
    + \ No newline at end of file diff --git a/images/Thumbs.db b/Wordpress/images/Thumbs.db similarity index 100% rename from images/Thumbs.db rename to Wordpress/images/Thumbs.db diff --git a/images/comment-arrow-bypostauthor-dark-rtl.png b/Wordpress/images/comment-arrow-bypostauthor-dark-rtl.png similarity index 100% rename from images/comment-arrow-bypostauthor-dark-rtl.png rename to Wordpress/images/comment-arrow-bypostauthor-dark-rtl.png diff --git a/images/comment-arrow-bypostauthor-dark.png b/Wordpress/images/comment-arrow-bypostauthor-dark.png similarity index 100% rename from images/comment-arrow-bypostauthor-dark.png rename to Wordpress/images/comment-arrow-bypostauthor-dark.png diff --git a/images/comment-arrow-bypostauthor-rtl.png b/Wordpress/images/comment-arrow-bypostauthor-rtl.png similarity index 100% rename from images/comment-arrow-bypostauthor-rtl.png rename to Wordpress/images/comment-arrow-bypostauthor-rtl.png diff --git a/images/comment-arrow-bypostauthor.png b/Wordpress/images/comment-arrow-bypostauthor.png similarity index 100% rename from images/comment-arrow-bypostauthor.png rename to Wordpress/images/comment-arrow-bypostauthor.png diff --git a/images/comment-arrow-dark-rtl.png b/Wordpress/images/comment-arrow-dark-rtl.png similarity index 100% rename from images/comment-arrow-dark-rtl.png rename to Wordpress/images/comment-arrow-dark-rtl.png diff --git a/images/comment-arrow-dark.png b/Wordpress/images/comment-arrow-dark.png similarity index 100% rename from images/comment-arrow-dark.png rename to Wordpress/images/comment-arrow-dark.png diff --git a/images/comment-arrow-rtl.png b/Wordpress/images/comment-arrow-rtl.png similarity index 100% rename from images/comment-arrow-rtl.png rename to Wordpress/images/comment-arrow-rtl.png diff --git a/images/comment-arrow.png b/Wordpress/images/comment-arrow.png similarity index 100% rename from images/comment-arrow.png rename to Wordpress/images/comment-arrow.png diff --git a/images/comment-bubble-dark-rtl.png b/Wordpress/images/comment-bubble-dark-rtl.png similarity index 100% rename from images/comment-bubble-dark-rtl.png rename to Wordpress/images/comment-bubble-dark-rtl.png diff --git a/images/comment-bubble-dark.png b/Wordpress/images/comment-bubble-dark.png similarity index 100% rename from images/comment-bubble-dark.png rename to Wordpress/images/comment-bubble-dark.png diff --git a/images/comment-bubble-rtl.png b/Wordpress/images/comment-bubble-rtl.png similarity index 100% rename from images/comment-bubble-rtl.png rename to Wordpress/images/comment-bubble-rtl.png diff --git a/images/comment-bubble.png b/Wordpress/images/comment-bubble.png similarity index 100% rename from images/comment-bubble.png rename to Wordpress/images/comment-bubble.png diff --git a/images/search.png b/Wordpress/images/search.png similarity index 100% rename from images/search.png rename to Wordpress/images/search.png diff --git a/images/wordpress.png b/Wordpress/images/wordpress.png similarity index 100% rename from images/wordpress.png rename to Wordpress/images/wordpress.png diff --git a/inc/images/content-sidebar.png b/Wordpress/inc/images/content-sidebar.png similarity index 100% rename from inc/images/content-sidebar.png rename to Wordpress/inc/images/content-sidebar.png diff --git a/inc/images/content.png b/Wordpress/inc/images/content.png similarity index 100% rename from inc/images/content.png rename to Wordpress/inc/images/content.png diff --git a/inc/images/dark.png b/Wordpress/inc/images/dark.png similarity index 100% rename from inc/images/dark.png rename to Wordpress/inc/images/dark.png diff --git a/inc/images/light.png b/Wordpress/inc/images/light.png similarity index 100% rename from inc/images/light.png rename to Wordpress/inc/images/light.png diff --git a/inc/images/sidebar-content.png b/Wordpress/inc/images/sidebar-content.png similarity index 100% rename from inc/images/sidebar-content.png rename to Wordpress/inc/images/sidebar-content.png diff --git a/inc/theme-options.css b/Wordpress/inc/theme-options.css similarity index 94% rename from inc/theme-options.css rename to Wordpress/inc/theme-options.css index 464ab8c..63295c6 100644 --- a/inc/theme-options.css +++ b/Wordpress/inc/theme-options.css @@ -1,35 +1,35 @@ -#wpcontent select option { - padding-right: 5px; -} -.image-radio-option td { - padding-top: 15px; -} -.image-radio-option label { - display: block; - float: left; - margin: 0 30px 20px 2px; - position: relative; -} -.image-radio-option input { - margin: 0 0 10px; -} -.image-radio-option span { - display: block; - width: 136px; -} -.image-radio-option img { - margin: 0 0 0 -2px; -} -#link-color-example { - -moz-border-radius: 4px; - -webkit-border-radius: 4px; - border-radius: 4px; - border: 1px solid #dfdfdf; - margin: 0 7px 0 3px; - padding: 4px 14px; -} - -body.rtl .image-radio-option label { - float: right; - margin: 0 2px 20px 30px; -} +#wpcontent select option { + padding-right: 5px; +} +.image-radio-option td { + padding-top: 15px; +} +.image-radio-option label { + display: block; + float: left; + margin: 0 30px 20px 2px; + position: relative; +} +.image-radio-option input { + margin: 0 0 10px; +} +.image-radio-option span { + display: block; + width: 136px; +} +.image-radio-option img { + margin: 0 0 0 -2px; +} +#link-color-example { + -moz-border-radius: 4px; + -webkit-border-radius: 4px; + border-radius: 4px; + border: 1px solid #dfdfdf; + margin: 0 7px 0 3px; + padding: 4px 14px; +} + +body.rtl .image-radio-option label { + float: right; + margin: 0 2px 20px 30px; +} diff --git a/inc/theme-options.js b/Wordpress/inc/theme-options.js similarity index 95% rename from inc/theme-options.js rename to Wordpress/inc/theme-options.js index 4cfaec1..08357bb 100644 --- a/inc/theme-options.js +++ b/Wordpress/inc/theme-options.js @@ -1,52 +1,52 @@ -var farbtastic; - -(function($){ - var pickColor = function(a) { - farbtastic.setColor(a); - $('#link-color').val(a); - $('#link-color-example').css('background-color', a); - }; - - $(document).ready( function() { - $('#default-color').wrapInner(''); - - farbtastic = $.farbtastic('#colorPickerDiv', pickColor); - - pickColor( $('#link-color').val() ); - - $('.pickcolor').click( function(e) { - $('#colorPickerDiv').show(); - e.preventDefault(); - }); - - $('#link-color').keyup( function() { - var a = $('#link-color').val(), - b = a; - - a = a.replace(/[^a-fA-F0-9]/, ''); - if ( '#' + a !== b ) - $('#link-color').val(a); - if ( a.length === 3 || a.length === 6 ) - pickColor( '#' + a ); - }); - - $(document).mousedown( function() { - $('#colorPickerDiv').hide(); - }); - - $('#default-color a').click( function(e) { - pickColor( '#' + this.innerHTML.replace(/[^a-fA-F0-9]/, '') ); - e.preventDefault(); - }); - - $('.image-radio-option.color-scheme input:radio').change( function() { - var currentDefault = $('#default-color a'), - newDefault = $(this).next().val(); - - if ( $('#link-color').val() == currentDefault.text() ) - pickColor( newDefault ); - - currentDefault.text( newDefault ); - }); - }); +var farbtastic; + +(function($){ + var pickColor = function(a) { + farbtastic.setColor(a); + $('#link-color').val(a); + $('#link-color-example').css('background-color', a); + }; + + $(document).ready( function() { + $('#default-color').wrapInner(''); + + farbtastic = $.farbtastic('#colorPickerDiv', pickColor); + + pickColor( $('#link-color').val() ); + + $('.pickcolor').click( function(e) { + $('#colorPickerDiv').show(); + e.preventDefault(); + }); + + $('#link-color').keyup( function() { + var a = $('#link-color').val(), + b = a; + + a = a.replace(/[^a-fA-F0-9]/, ''); + if ( '#' + a !== b ) + $('#link-color').val(a); + if ( a.length === 3 || a.length === 6 ) + pickColor( '#' + a ); + }); + + $(document).mousedown( function() { + $('#colorPickerDiv').hide(); + }); + + $('#default-color a').click( function(e) { + pickColor( '#' + this.innerHTML.replace(/[^a-fA-F0-9]/, '') ); + e.preventDefault(); + }); + + $('.image-radio-option.color-scheme input:radio').change( function() { + var currentDefault = $('#default-color a'), + newDefault = $(this).next().val(); + + if ( $('#link-color').val() == currentDefault.text() ) + pickColor( newDefault ); + + currentDefault.text( newDefault ); + }); + }); })(jQuery); \ No newline at end of file diff --git a/inc/theme-options.php b/Wordpress/inc/theme-options.php similarity index 97% rename from inc/theme-options.php rename to Wordpress/inc/theme-options.php index f1d6c4b..d729474 100644 --- a/inc/theme-options.php +++ b/Wordpress/inc/theme-options.php @@ -1,449 +1,449 @@ -' . __( 'Some themes provide customization options that are grouped together on a Theme Options screen. If you change themes, options may change or disappear, as they are theme-specific. Your current theme, Twenty Eleven, provides the following Theme Options:', 'twentyeleven' ) . '

    ' . - '
      ' . - '
    1. ' . __( 'Color Scheme: You can choose a color palette of "Light" (light background with dark text) or "Dark" (dark background with light text) for your site.', 'twentyeleven' ) . '
    2. ' . - '
    3. ' . __( 'Link Color: You can choose the color used for text links on your site. You can enter the HTML color or hex code, or you can choose visually by clicking the "Select a Color" button to pick from a color wheel.', 'twentyeleven' ) . '
    4. ' . - '
    5. ' . __( 'Default Layout: You can choose if you want your site’s default layout to have a sidebar on the left, the right, or not at all.', 'twentyeleven' ) . '
    6. ' . - '
    ' . - '

    ' . __( 'Remember to click "Save Changes" to save any changes you have made to the theme options.', 'twentyeleven' ) . '

    '; - - $sidebar = '

    ' . __( 'For more information:', 'twentyeleven' ) . '

    ' . - '

    ' . __( 'Documentation on Theme Options', 'twentyeleven' ) . '

    ' . - '

    ' . __( 'Support Forums', 'twentyeleven' ) . '

    '; - - $screen = get_current_screen(); - - if ( method_exists( $screen, 'add_help_tab' ) ) { - // WordPress 3.3 - $screen->add_help_tab( array( - 'title' => __( 'Overview', 'twentyeleven' ), - 'id' => 'theme-options-help', - 'content' => $help, - ) - ); - - $screen->set_help_sidebar( $sidebar ); - } else { - // WordPress 3.2 - add_contextual_help( $screen, $help . $sidebar ); - } -} - -/** - * Returns an array of color schemes registered for Twenty Eleven. - * - * @since Twenty Eleven 1.0 - */ -function twentyeleven_color_schemes() { - $color_scheme_options = array( - 'light' => array( - 'value' => 'light', - 'label' => __( 'Light', 'twentyeleven' ), - 'thumbnail' => get_template_directory_uri() . '/inc/images/light.png', - 'default_link_color' => '#1b8be0', - ), - 'dark' => array( - 'value' => 'dark', - 'label' => __( 'Dark', 'twentyeleven' ), - 'thumbnail' => get_template_directory_uri() . '/inc/images/dark.png', - 'default_link_color' => '#e4741f', - ), - ); - - return apply_filters( 'twentyeleven_color_schemes', $color_scheme_options ); -} - -/** - * Returns an array of layout options registered for Twenty Eleven. - * - * @since Twenty Eleven 1.0 - */ -function twentyeleven_layouts() { - $layout_options = array( - 'content-sidebar' => array( - 'value' => 'content-sidebar', - 'label' => __( 'Content on left', 'twentyeleven' ), - 'thumbnail' => get_template_directory_uri() . '/inc/images/content-sidebar.png', - ), - 'sidebar-content' => array( - 'value' => 'sidebar-content', - 'label' => __( 'Content on right', 'twentyeleven' ), - 'thumbnail' => get_template_directory_uri() . '/inc/images/sidebar-content.png', - ), - 'content' => array( - 'value' => 'content', - 'label' => __( 'One-column, no sidebar', 'twentyeleven' ), - 'thumbnail' => get_template_directory_uri() . '/inc/images/content.png', - ), - ); - - return apply_filters( 'twentyeleven_layouts', $layout_options ); -} - -/** - * Returns the default options for Twenty Eleven. - * - * @since Twenty Eleven 1.0 - */ -function twentyeleven_get_default_theme_options() { - $default_theme_options = array( - 'color_scheme' => 'light', - 'link_color' => twentyeleven_get_default_link_color( 'light' ), - 'theme_layout' => 'content-sidebar', - ); - - if ( is_rtl() ) - $default_theme_options['theme_layout'] = 'sidebar-content'; - - return apply_filters( 'twentyeleven_default_theme_options', $default_theme_options ); -} - -/** - * Returns the default link color for Twenty Eleven, based on color scheme. - * - * @since Twenty Eleven 1.0 - * - * @param $string $color_scheme Color scheme. Defaults to the active color scheme. - * @return $string Color. -*/ -function twentyeleven_get_default_link_color( $color_scheme = null ) { - if ( null === $color_scheme ) { - $options = twentyeleven_get_theme_options(); - $color_scheme = $options['color_scheme']; - } - - $color_schemes = twentyeleven_color_schemes(); - if ( ! isset( $color_schemes[ $color_scheme ] ) ) - return false; - - return $color_schemes[ $color_scheme ]['default_link_color']; -} - -/** - * Returns the options array for Twenty Eleven. - * - * @since Twenty Eleven 1.0 - */ -function twentyeleven_get_theme_options() { - return get_option( 'twentyeleven_theme_options', twentyeleven_get_default_theme_options() ); -} - -/** - * Renders the Color Scheme setting field. - * - * @since Twenty Eleven 1.3 - */ -function twentyeleven_settings_field_color_scheme() { - $options = twentyeleven_get_theme_options(); - - foreach ( twentyeleven_color_schemes() as $scheme ) { - ?> -
    - -
    - - - - - -
    - ' . twentyeleven_get_default_link_color( $options['color_scheme'] ) . '' ); ?> - -
    - -
    - -
    - -

    - - -
    - -
    -
    - - -' . __( 'Some themes provide customization options that are grouped together on a Theme Options screen. If you change themes, options may change or disappear, as they are theme-specific. Your current theme, Twenty Eleven, provides the following Theme Options:', 'twentyeleven' ) . '

    ' . + '
      ' . + '
    1. ' . __( 'Color Scheme: You can choose a color palette of "Light" (light background with dark text) or "Dark" (dark background with light text) for your site.', 'twentyeleven' ) . '
    2. ' . + '
    3. ' . __( 'Link Color: You can choose the color used for text links on your site. You can enter the HTML color or hex code, or you can choose visually by clicking the "Select a Color" button to pick from a color wheel.', 'twentyeleven' ) . '
    4. ' . + '
    5. ' . __( 'Default Layout: You can choose if you want your site’s default layout to have a sidebar on the left, the right, or not at all.', 'twentyeleven' ) . '
    6. ' . + '
    ' . + '

    ' . __( 'Remember to click "Save Changes" to save any changes you have made to the theme options.', 'twentyeleven' ) . '

    '; + + $sidebar = '

    ' . __( 'For more information:', 'twentyeleven' ) . '

    ' . + '

    ' . __( 'Documentation on Theme Options', 'twentyeleven' ) . '

    ' . + '

    ' . __( 'Support Forums', 'twentyeleven' ) . '

    '; + + $screen = get_current_screen(); + + if ( method_exists( $screen, 'add_help_tab' ) ) { + // WordPress 3.3 + $screen->add_help_tab( array( + 'title' => __( 'Overview', 'twentyeleven' ), + 'id' => 'theme-options-help', + 'content' => $help, + ) + ); + + $screen->set_help_sidebar( $sidebar ); + } else { + // WordPress 3.2 + add_contextual_help( $screen, $help . $sidebar ); + } +} + +/** + * Returns an array of color schemes registered for Twenty Eleven. + * + * @since Twenty Eleven 1.0 + */ +function twentyeleven_color_schemes() { + $color_scheme_options = array( + 'light' => array( + 'value' => 'light', + 'label' => __( 'Light', 'twentyeleven' ), + 'thumbnail' => get_template_directory_uri() . '/inc/images/light.png', + 'default_link_color' => '#1b8be0', + ), + 'dark' => array( + 'value' => 'dark', + 'label' => __( 'Dark', 'twentyeleven' ), + 'thumbnail' => get_template_directory_uri() . '/inc/images/dark.png', + 'default_link_color' => '#e4741f', + ), + ); + + return apply_filters( 'twentyeleven_color_schemes', $color_scheme_options ); +} + +/** + * Returns an array of layout options registered for Twenty Eleven. + * + * @since Twenty Eleven 1.0 + */ +function twentyeleven_layouts() { + $layout_options = array( + 'content-sidebar' => array( + 'value' => 'content-sidebar', + 'label' => __( 'Content on left', 'twentyeleven' ), + 'thumbnail' => get_template_directory_uri() . '/inc/images/content-sidebar.png', + ), + 'sidebar-content' => array( + 'value' => 'sidebar-content', + 'label' => __( 'Content on right', 'twentyeleven' ), + 'thumbnail' => get_template_directory_uri() . '/inc/images/sidebar-content.png', + ), + 'content' => array( + 'value' => 'content', + 'label' => __( 'One-column, no sidebar', 'twentyeleven' ), + 'thumbnail' => get_template_directory_uri() . '/inc/images/content.png', + ), + ); + + return apply_filters( 'twentyeleven_layouts', $layout_options ); +} + +/** + * Returns the default options for Twenty Eleven. + * + * @since Twenty Eleven 1.0 + */ +function twentyeleven_get_default_theme_options() { + $default_theme_options = array( + 'color_scheme' => 'light', + 'link_color' => twentyeleven_get_default_link_color( 'light' ), + 'theme_layout' => 'content-sidebar', + ); + + if ( is_rtl() ) + $default_theme_options['theme_layout'] = 'sidebar-content'; + + return apply_filters( 'twentyeleven_default_theme_options', $default_theme_options ); +} + +/** + * Returns the default link color for Twenty Eleven, based on color scheme. + * + * @since Twenty Eleven 1.0 + * + * @param $string $color_scheme Color scheme. Defaults to the active color scheme. + * @return $string Color. +*/ +function twentyeleven_get_default_link_color( $color_scheme = null ) { + if ( null === $color_scheme ) { + $options = twentyeleven_get_theme_options(); + $color_scheme = $options['color_scheme']; + } + + $color_schemes = twentyeleven_color_schemes(); + if ( ! isset( $color_schemes[ $color_scheme ] ) ) + return false; + + return $color_schemes[ $color_scheme ]['default_link_color']; +} + +/** + * Returns the options array for Twenty Eleven. + * + * @since Twenty Eleven 1.0 + */ +function twentyeleven_get_theme_options() { + return get_option( 'twentyeleven_theme_options', twentyeleven_get_default_theme_options() ); +} + +/** + * Renders the Color Scheme setting field. + * + * @since Twenty Eleven 1.3 + */ +function twentyeleven_settings_field_color_scheme() { + $options = twentyeleven_get_theme_options(); + + foreach ( twentyeleven_color_schemes() as $scheme ) { + ?> +
    + +
    + + + + + +
    + ' . twentyeleven_get_default_link_color( $options['color_scheme'] ) . '' ); ?> + +
    + +
    + +
    + +

    + + +
    + +
    +
    + + + 'widget_twentyeleven_ephemera', 'description' => __( 'Use this widget to list your recent Aside, Status, Quote, and Link posts', 'twentyeleven' ) ); - $this->WP_Widget( 'widget_twentyeleven_ephemera', __( 'Twenty Eleven Ephemera', 'twentyeleven' ), $widget_ops ); - $this->alt_option_name = 'widget_twentyeleven_ephemera'; - - add_action( 'save_post', array(&$this, 'flush_widget_cache' ) ); - add_action( 'deleted_post', array(&$this, 'flush_widget_cache' ) ); - add_action( 'switch_theme', array(&$this, 'flush_widget_cache' ) ); - } - - /** - * Outputs the HTML for this widget. - * - * @param array An array of standard parameters for widgets in this theme - * @param array An array of settings for this widget instance - * @return void Echoes it's output - **/ - function widget( $args, $instance ) { - $cache = wp_cache_get( 'widget_twentyeleven_ephemera', 'widget' ); - - if ( !is_array( $cache ) ) - $cache = array(); - - if ( ! isset( $args['widget_id'] ) ) - $args['widget_id'] = null; - - if ( isset( $cache[$args['widget_id']] ) ) { - echo $cache[$args['widget_id']]; - return; - } - - ob_start(); - extract( $args, EXTR_SKIP ); - - $title = apply_filters( 'widget_title', empty( $instance['title'] ) ? __( 'Ephemera', 'twentyeleven' ) : $instance['title'], $instance, $this->id_base); - - if ( ! isset( $instance['number'] ) ) - $instance['number'] = '10'; - - if ( ! $number = absint( $instance['number'] ) ) - $number = 10; - - $ephemera_args = array( - 'order' => 'DESC', - 'posts_per_page' => $number, - 'no_found_rows' => true, - 'post_status' => 'publish', - 'post__not_in' => get_option( 'sticky_posts' ), - 'tax_query' => array( - array( - 'taxonomy' => 'post_format', - 'terms' => array( 'post-format-aside', 'post-format-link', 'post-format-status', 'post-format-quote' ), - 'field' => 'slug', - 'operator' => 'IN', - ), - ), - ); - $ephemera = new WP_Query( $ephemera_args ); - - if ( $ephemera->have_posts() ) : - echo $before_widget; - echo $before_title; - echo $title; // Can set this with a widget option, or omit altogether - echo $after_title; - ?> -
      - have_posts() ) : $ephemera->the_post(); ?> - - - -
    1. - - - comments →', 'twentyeleven' ), __( '1 comment →', 'twentyeleven' ), __( '% comments →', 'twentyeleven' ) ); ?> - -
    2. - - - -
    3. - -   - - comments →', 'twentyeleven' ), __( '1 comment →', 'twentyeleven' ), __( '% comments →', 'twentyeleven' ) ); ?> - -
    4. - - - - -
    - flush_widget_cache(); - - $alloptions = wp_cache_get( 'alloptions', 'options' ); - if ( isset( $alloptions['widget_twentyeleven_ephemera'] ) ) - delete_option( 'widget_twentyeleven_ephemera' ); - - return $instance; - } - - function flush_widget_cache() { - wp_cache_delete( 'widget_twentyeleven_ephemera', 'widget' ); - } - - /** - * Displays the form for this widget on the Widgets page of the WP Admin area. - **/ - function form( $instance ) { - $title = isset( $instance['title']) ? esc_attr( $instance['title'] ) : ''; - $number = isset( $instance['number'] ) ? absint( $instance['number'] ) : 10; -?> -

    -

    - -

    -

    - 'widget_twentyeleven_ephemera', 'description' => __( 'Use this widget to list your recent Aside, Status, Quote, and Link posts', 'twentyeleven' ) ); + $this->WP_Widget( 'widget_twentyeleven_ephemera', __( 'Twenty Eleven Ephemera', 'twentyeleven' ), $widget_ops ); + $this->alt_option_name = 'widget_twentyeleven_ephemera'; + + add_action( 'save_post', array(&$this, 'flush_widget_cache' ) ); + add_action( 'deleted_post', array(&$this, 'flush_widget_cache' ) ); + add_action( 'switch_theme', array(&$this, 'flush_widget_cache' ) ); + } + + /** + * Outputs the HTML for this widget. + * + * @param array An array of standard parameters for widgets in this theme + * @param array An array of settings for this widget instance + * @return void Echoes it's output + **/ + function widget( $args, $instance ) { + $cache = wp_cache_get( 'widget_twentyeleven_ephemera', 'widget' ); + + if ( !is_array( $cache ) ) + $cache = array(); + + if ( ! isset( $args['widget_id'] ) ) + $args['widget_id'] = null; + + if ( isset( $cache[$args['widget_id']] ) ) { + echo $cache[$args['widget_id']]; + return; + } + + ob_start(); + extract( $args, EXTR_SKIP ); + + $title = apply_filters( 'widget_title', empty( $instance['title'] ) ? __( 'Ephemera', 'twentyeleven' ) : $instance['title'], $instance, $this->id_base); + + if ( ! isset( $instance['number'] ) ) + $instance['number'] = '10'; + + if ( ! $number = absint( $instance['number'] ) ) + $number = 10; + + $ephemera_args = array( + 'order' => 'DESC', + 'posts_per_page' => $number, + 'no_found_rows' => true, + 'post_status' => 'publish', + 'post__not_in' => get_option( 'sticky_posts' ), + 'tax_query' => array( + array( + 'taxonomy' => 'post_format', + 'terms' => array( 'post-format-aside', 'post-format-link', 'post-format-status', 'post-format-quote' ), + 'field' => 'slug', + 'operator' => 'IN', + ), + ), + ); + $ephemera = new WP_Query( $ephemera_args ); + + if ( $ephemera->have_posts() ) : + echo $before_widget; + echo $before_title; + echo $title; // Can set this with a widget option, or omit altogether + echo $after_title; + ?> +
      + have_posts() ) : $ephemera->the_post(); ?> + + + +
    1. + + + comments →', 'twentyeleven' ), __( '1 comment →', 'twentyeleven' ), __( '% comments →', 'twentyeleven' ) ); ?> + +
    2. + + + +
    3. + +   + + comments →', 'twentyeleven' ), __( '1 comment →', 'twentyeleven' ), __( '% comments →', 'twentyeleven' ) ); ?> + +
    4. + + + + +
    + flush_widget_cache(); + + $alloptions = wp_cache_get( 'alloptions', 'options' ); + if ( isset( $alloptions['widget_twentyeleven_ephemera'] ) ) + delete_option( 'widget_twentyeleven_ephemera' ); + + return $instance; + } + + function flush_widget_cache() { + wp_cache_delete( 'widget_twentyeleven_ephemera', 'widget' ); + } + + /** + * Displays the form for this widget on the Widgets page of the WP Admin area. + **/ + function form( $instance ) { + $title = isset( $instance['title']) ? esc_attr( $instance['title'] ) : ''; + $number = isset( $instance['number'] ) ? absint( $instance['number'] ) : 10; +?> +

    +

    + +

    +

    + - -
    -
    - - - - - - - - - - - - - - - - -
    -
    -

    -
    - -
    -

    - -
    -
    - - - -
    -
    - - + + +
    +
    + + + + + + + + + + + + + + + + +
    +
    +

    +
    + +
    +

    + +
    +
    + + + +
    +
    + + \ No newline at end of file diff --git a/jqui/images/ui-bg_flat_0_aaaaaa_40x100.png b/Wordpress/jqui/images/ui-bg_flat_0_aaaaaa_40x100.png similarity index 100% rename from jqui/images/ui-bg_flat_0_aaaaaa_40x100.png rename to Wordpress/jqui/images/ui-bg_flat_0_aaaaaa_40x100.png diff --git a/jqui/images/ui-bg_glass_55_fbf9ee_1x400.png b/Wordpress/jqui/images/ui-bg_glass_55_fbf9ee_1x400.png similarity index 100% rename from jqui/images/ui-bg_glass_55_fbf9ee_1x400.png rename to Wordpress/jqui/images/ui-bg_glass_55_fbf9ee_1x400.png diff --git a/jqui/images/ui-bg_glass_65_ffffff_1x400.png b/Wordpress/jqui/images/ui-bg_glass_65_ffffff_1x400.png similarity index 100% rename from jqui/images/ui-bg_glass_65_ffffff_1x400.png rename to Wordpress/jqui/images/ui-bg_glass_65_ffffff_1x400.png diff --git a/jqui/images/ui-bg_glass_75_dadada_1x400.png b/Wordpress/jqui/images/ui-bg_glass_75_dadada_1x400.png similarity index 100% rename from jqui/images/ui-bg_glass_75_dadada_1x400.png rename to Wordpress/jqui/images/ui-bg_glass_75_dadada_1x400.png diff --git a/jqui/images/ui-bg_glass_75_e6e6e6_1x400.png b/Wordpress/jqui/images/ui-bg_glass_75_e6e6e6_1x400.png similarity index 100% rename from jqui/images/ui-bg_glass_75_e6e6e6_1x400.png rename to Wordpress/jqui/images/ui-bg_glass_75_e6e6e6_1x400.png diff --git a/jqui/images/ui-bg_glass_75_ffffff_1x400.png b/Wordpress/jqui/images/ui-bg_glass_75_ffffff_1x400.png similarity index 100% rename from jqui/images/ui-bg_glass_75_ffffff_1x400.png rename to Wordpress/jqui/images/ui-bg_glass_75_ffffff_1x400.png diff --git a/jqui/images/ui-bg_highlight-soft_75_cccccc_1x100.png b/Wordpress/jqui/images/ui-bg_highlight-soft_75_cccccc_1x100.png similarity index 100% rename from jqui/images/ui-bg_highlight-soft_75_cccccc_1x100.png rename to Wordpress/jqui/images/ui-bg_highlight-soft_75_cccccc_1x100.png diff --git a/jqui/images/ui-bg_inset-soft_95_fef1ec_1x100.png b/Wordpress/jqui/images/ui-bg_inset-soft_95_fef1ec_1x100.png similarity index 100% rename from jqui/images/ui-bg_inset-soft_95_fef1ec_1x100.png rename to Wordpress/jqui/images/ui-bg_inset-soft_95_fef1ec_1x100.png diff --git a/jqui/images/ui-icons_222222_256x240.png b/Wordpress/jqui/images/ui-icons_222222_256x240.png similarity index 100% rename from jqui/images/ui-icons_222222_256x240.png rename to Wordpress/jqui/images/ui-icons_222222_256x240.png diff --git a/jqui/images/ui-icons_2e83ff_256x240.png b/Wordpress/jqui/images/ui-icons_2e83ff_256x240.png similarity index 100% rename from jqui/images/ui-icons_2e83ff_256x240.png rename to Wordpress/jqui/images/ui-icons_2e83ff_256x240.png diff --git a/jqui/images/ui-icons_454545_256x240.png b/Wordpress/jqui/images/ui-icons_454545_256x240.png similarity index 100% rename from jqui/images/ui-icons_454545_256x240.png rename to Wordpress/jqui/images/ui-icons_454545_256x240.png diff --git a/jqui/images/ui-icons_888888_256x240.png b/Wordpress/jqui/images/ui-icons_888888_256x240.png similarity index 100% rename from jqui/images/ui-icons_888888_256x240.png rename to Wordpress/jqui/images/ui-icons_888888_256x240.png diff --git a/jqui/images/ui-icons_cd0a0a_256x240.png b/Wordpress/jqui/images/ui-icons_cd0a0a_256x240.png similarity index 100% rename from jqui/images/ui-icons_cd0a0a_256x240.png rename to Wordpress/jqui/images/ui-icons_cd0a0a_256x240.png diff --git a/jqui/images/ui-icons_f6cf3b_256x240.png b/Wordpress/jqui/images/ui-icons_f6cf3b_256x240.png similarity index 100% rename from jqui/images/ui-icons_f6cf3b_256x240.png rename to Wordpress/jqui/images/ui-icons_f6cf3b_256x240.png diff --git a/jqui/jquery-ui-1.8.16.custom.css b/Wordpress/jqui/jquery-ui-1.8.16.custom.css similarity index 97% rename from jqui/jquery-ui-1.8.16.custom.css rename to Wordpress/jqui/jquery-ui-1.8.16.custom.css index 5cf5c6b..fb73407 100644 --- a/jqui/jquery-ui-1.8.16.custom.css +++ b/Wordpress/jqui/jquery-ui-1.8.16.custom.css @@ -1,1320 +1,1320 @@ -/*! - * jQuery UI Bootstrap (0.22) - * http://addyosmani.github.com/jquery-ui-bootstrap - * - * Copyright 2012, Addy Osmani - * Dual licensed under the MIT or GPL Version 2 licenses. - * - * Portions copyright jQuery UI & Twitter Bootstrap - */ - - -/* Layout helpers -----------------------------------*/ -.ui-helper-hidden { display: none; } -.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); } -.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } -.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } -.ui-helper-clearfix { display: inline-block; } -/* required comment for clearfix to work in Opera \*/ -* html .ui-helper-clearfix { height:1%; } -.ui-helper-clearfix { display:block; } -/* end clearfix */ -.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } - - -/* Interaction Cues -----------------------------------*/ -.ui-state-disabled { cursor: default !important; } - - -/* Icons -----------------------------------*/ - -/* states and images */ -.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } - - -/* Misc visuals -----------------------------------*/ - -/* Overlays */ -.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } - - -/* - * jQuery UI CSS Framework 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Theming/API - * - * To view and modify this theme, visit http://jqueryui.com/themeroller/?ctl=themeroller - */ - - -/* Component containers -----------------------------------*/ -.ui-widget { font-family: "Helvetica Neue", Helvetica, Arial, sans-serif; font-size:13px; } -.ui-widget .ui-widget { font-size: 1em; } -.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: "Helvetica Neue", Helvetica, Arial, sans-serif; font-size: 1em; } -.ui-widget-content { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_glass_75_ffffff_1x400.png) 50% 50% repeat-x; color: #404040; } -.ui-widget-content a { color: #404040; } -.ui-widget-header { - font-weight:bold; - border-color: #0064cd #0064cd #003f81; - border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); - border:1px solid #666; - - } -.ui-widget-header a { color: #222222; } - -/* Interaction states -----------------------------------*/ -.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { - - background-color: #e6e6e6; - background-repeat: no-repeat; - background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#ffffff), color-stop(25%, #ffffff), to(#e6e6e6)); - background-image: -webkit-linear-gradient(#ffffff, #ffffff 25%, #e6e6e6); - background-image: -moz-linear-gradient(top, #ffffff, #ffffff 25%, #e6e6e6); - background-image: -ms-linear-gradient(#ffffff, #ffffff 25%, #e6e6e6); - background-image: -o-linear-gradient(#ffffff, #ffffff 25%, #e6e6e6); - background-image: linear-gradient(#ffffff, #ffffff 25%, #e6e6e6); - filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#e6e6e6', GradientType=0); - - text-shadow: 0 1px 1px rgba(255, 255, 255, 0.75); - - color: #333; - font-size: 13px; - line-height: normal; - border: 1px solid #ccc; - border-bottom-color: #bbb; - -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05); - -moz-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05); - box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05); - -webkit-transition: 0.1s linear background-image; - -moz-transition: 0.1s linear background-image; - -ms-transition: 0.1s linear background-image; - -o-transition: 0.1s linear background-image; - transition: 0.1s linear background-image; - overflow: visible; - - } - - -.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555; text-decoration: none; } -.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { - background-position: 0 -15px; - color: #333; - text-decoration: none; - - - } -.ui-state-hover a, .ui-state-hover a:hover { color: #212121; text-decoration: none; } -.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa; font-weight: normal; color: #212121; } -.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121; text-decoration: none; } -.ui-widget :active { outline: none; } - -/* Interaction Cues -----------------------------------*/ - - -.ui-state-highlight p, .ui-state-error p, .ui-state-default p{ - font-size: 13px; - font-weight: normal; - line-height: 18px; - margin:7px 15px; -} -.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight { - - - position: relative; - margin-bottom: 18px; - color: #404040; - background-color: #eedc94; - background-repeat: repeat-x; - background-image: -khtml-gradient(linear, left top, left bottom, from(#fceec1), to(#eedc94)); - background-image: -moz-linear-gradient(top, #fceec1, #eedc94); - background-image: -ms-linear-gradient(top, #fceec1, #eedc94); - background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0%, #fceec1), color-stop(100%, #eedc94)); - background-image: -webkit-linear-gradient(top, #fceec1, #eedc94); - background-image: -o-linear-gradient(top, #fceec1, #eedc94); - background-image: linear-gradient(top, #fceec1, #eedc94); - filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#fceec1', endColorstr='#eedc94', GradientType=0); - text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25); - border-color: #eedc94 #eedc94 #e4c652; - border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); - text-shadow: 0 1px 0 rgba(255, 255, 255, 0.5); - border-width: 1px; - border-style: solid; - -webkit-border-radius: 4px; - -moz-border-radius: 4px; - border-radius: 4px; - -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25); - -moz-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25); - box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25); - - -} -.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; } -.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error { - - - position: relative; - margin-bottom: 18px; - color: #ffffff; - border-width: 1px; - border-style: solid; - -webkit-border-radius: 4px; - -moz-border-radius: 4px; - border-radius: 4px; - -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25); - -moz-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25); - box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25); - background-color: #c43c35; - background-repeat: repeat-x; - background-image: -khtml-gradient(linear, left top, left bottom, from(#ee5f5b), to(#c43c35)); - background-image: -moz-linear-gradient(top, #ee5f5b, #c43c35); - background-image: -ms-linear-gradient(top, #ee5f5b, #c43c35); - background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0%, #ee5f5b), color-stop(100%, #c43c35)); - background-image: -webkit-linear-gradient(top, #ee5f5b, #c43c35); - background-image: -o-linear-gradient(top, #ee5f5b, #c43c35); - background-image: linear-gradient(top, #ee5f5b, #c43c35); - filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ee5f5b', endColorstr='#c43c35', GradientType=0); - text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25); - border-color: #c43c35 #c43c35 #882a25; - border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); - - -} -.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a; } -.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a; } -.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } -.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } -.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } - - - -/* Icons -----------------------------------*/ - -/* states and images */ -.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); } -.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); } -.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); } -.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png); } -.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); } -.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); } -.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png); } -.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_f6cf3b_256x240.png); } - -/* positioning */ -.ui-icon-carat-1-n { background-position: 0 0; } -.ui-icon-carat-1-ne { background-position: -16px 0; } -.ui-icon-carat-1-e { background-position: -32px 0; } -.ui-icon-carat-1-se { background-position: -48px 0; } -.ui-icon-carat-1-s { background-position: -64px 0; } -.ui-icon-carat-1-sw { background-position: -80px 0; } -.ui-icon-carat-1-w { background-position: -96px 0; } -.ui-icon-carat-1-nw { background-position: -112px 0; } -.ui-icon-carat-2-n-s { background-position: -128px 0; } -.ui-icon-carat-2-e-w { background-position: -144px 0; } -.ui-icon-triangle-1-n { background-position: 0 -16px; } -.ui-icon-triangle-1-ne { background-position: -16px -16px; } -.ui-icon-triangle-1-e { background-position: -32px -16px; } -.ui-icon-triangle-1-se { background-position: -48px -16px; } -.ui-icon-triangle-1-s { background-position: -64px -16px; } -.ui-icon-triangle-1-sw { background-position: -80px -16px; } -.ui-icon-triangle-1-w { background-position: -96px -16px; } -.ui-icon-triangle-1-nw { background-position: -112px -16px; } -.ui-icon-triangle-2-n-s { background-position: -128px -16px; } -.ui-icon-triangle-2-e-w { background-position: -144px -16px; } -.ui-icon-arrow-1-n { background-position: 0 -32px; } -.ui-icon-arrow-1-ne { background-position: -16px -32px; } -.ui-icon-arrow-1-e { background-position: -32px -32px; } -.ui-icon-arrow-1-se { background-position: -48px -32px; } -.ui-icon-arrow-1-s { background-position: -64px -32px; } -.ui-icon-arrow-1-sw { background-position: -80px -32px; } -.ui-icon-arrow-1-w { background-position: -96px -32px; } -.ui-icon-arrow-1-nw { background-position: -112px -32px; } -.ui-icon-arrow-2-n-s { background-position: -128px -32px; } -.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } -.ui-icon-arrow-2-e-w { background-position: -160px -32px; } -.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } -.ui-icon-arrowstop-1-n { background-position: -192px -32px; } -.ui-icon-arrowstop-1-e { background-position: -208px -32px; } -.ui-icon-arrowstop-1-s { background-position: -224px -32px; } -.ui-icon-arrowstop-1-w { background-position: -240px -32px; } -.ui-icon-arrowthick-1-n { background-position: 0 -48px; } -.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } -.ui-icon-arrowthick-1-e { background-position: -32px -48px; } -.ui-icon-arrowthick-1-se { background-position: -48px -48px; } -.ui-icon-arrowthick-1-s { background-position: -64px -48px; } -.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } -.ui-icon-arrowthick-1-w { background-position: -96px -48px; } -.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } -.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } -.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } -.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } -.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } -.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } -.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } -.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } -.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } -.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } -.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } -.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } -.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } -.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } -.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } -.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } -.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } -.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } -.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } -.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } -.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } -.ui-icon-arrow-4 { background-position: 0 -80px; } -.ui-icon-arrow-4-diag { background-position: -16px -80px; } -.ui-icon-extlink { background-position: -32px -80px; } -.ui-icon-newwin { background-position: -48px -80px; } -.ui-icon-refresh { background-position: -64px -80px; } -.ui-icon-shuffle { background-position: -80px -80px; } -.ui-icon-transfer-e-w { background-position: -96px -80px; } -.ui-icon-transferthick-e-w { background-position: -112px -80px; } -.ui-icon-folder-collapsed { background-position: 0 -96px; } -.ui-icon-folder-open { background-position: -16px -96px; } -.ui-icon-document { background-position: -32px -96px; } -.ui-icon-document-b { background-position: -48px -96px; } -.ui-icon-note { background-position: -64px -96px; } -.ui-icon-mail-closed { background-position: -80px -96px; } -.ui-icon-mail-open { background-position: -96px -96px; } -.ui-icon-suitcase { background-position: -112px -96px; } -.ui-icon-comment { background-position: -128px -96px; } -.ui-icon-person { background-position: -144px -96px; } -.ui-icon-print { background-position: -160px -96px; } -.ui-icon-trash { background-position: -176px -96px; } -.ui-icon-locked { background-position: -192px -96px; } -.ui-icon-unlocked { background-position: -208px -96px; } -.ui-icon-bookmark { background-position: -224px -96px; } -.ui-icon-tag { background-position: -240px -96px; } -.ui-icon-home { background-position: 0 -112px; } -.ui-icon-flag { background-position: -16px -112px; } -.ui-icon-calendar { background-position: -32px -112px; } -.ui-icon-cart { background-position: -48px -112px; } -.ui-icon-pencil { background-position: -64px -112px; } -.ui-icon-clock { background-position: -80px -112px; } -.ui-icon-disk { background-position: -96px -112px; } -.ui-icon-calculator { background-position: -112px -112px; } -.ui-icon-zoomin { background-position: -128px -112px; } -.ui-icon-zoomout { background-position: -144px -112px; } -.ui-icon-search { background-position: -160px -112px; } -.ui-icon-wrench { background-position: -176px -112px; } -.ui-icon-gear { background-position: -192px -112px; } -.ui-icon-heart { background-position: -208px -112px; } -.ui-icon-star { background-position: -224px -112px; } -.ui-icon-link { background-position: -240px -112px; } -.ui-icon-cancel { background-position: 0 -128px; } -.ui-icon-plus { background-position: -16px -128px; } -.ui-icon-plusthick { background-position: -32px -128px; } -.ui-icon-minus { background-position: -48px -128px; } -.ui-icon-minusthick { background-position: -64px -128px; } -.ui-icon-close { background-position: -80px -128px; } -.ui-icon-closethick { background-position: -96px -128px; } -.ui-icon-key { background-position: -112px -128px; } -.ui-icon-lightbulb { background-position: -128px -128px; } -.ui-icon-scissors { background-position: -144px -128px; } -.ui-icon-clipboard { background-position: -160px -128px; } -.ui-icon-copy { background-position: -176px -128px; } -.ui-icon-contact { background-position: -192px -128px; } -.ui-icon-image { background-position: -208px -128px; } -.ui-icon-video { background-position: -224px -128px; } -.ui-icon-script { background-position: -240px -128px; } -.ui-icon-alert { background-position: 0 -144px; } -.ui-icon-info { background-position: -16px -144px; } -.ui-icon-notice { background-position: -32px -144px; } -.ui-icon-help { background-position: -48px -144px; } -.ui-icon-check { background-position: -64px -144px; } -.ui-icon-bullet { background-position: -80px -144px; } -.ui-icon-radio-off { background-position: -96px -144px; } -.ui-icon-radio-on { background-position: -112px -144px; } -.ui-icon-pin-w { background-position: -128px -144px; } -.ui-icon-pin-s { background-position: -144px -144px; } -.ui-icon-play { background-position: 0 -160px; } -.ui-icon-pause { background-position: -16px -160px; } -.ui-icon-seek-next { background-position: -32px -160px; } -.ui-icon-seek-prev { background-position: -48px -160px; } -.ui-icon-seek-end { background-position: -64px -160px; } -.ui-icon-seek-start { background-position: -80px -160px; } -/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ -.ui-icon-seek-first { background-position: -80px -160px; } -.ui-icon-stop { background-position: -96px -160px; } -.ui-icon-eject { background-position: -112px -160px; } -.ui-icon-volume-off { background-position: -128px -160px; } -.ui-icon-volume-on { background-position: -144px -160px; } -.ui-icon-power { background-position: 0 -176px; } -.ui-icon-signal-diag { background-position: -16px -176px; } -.ui-icon-signal { background-position: -32px -176px; } -.ui-icon-battery-0 { background-position: -48px -176px; } -.ui-icon-battery-1 { background-position: -64px -176px; } -.ui-icon-battery-2 { background-position: -80px -176px; } -.ui-icon-battery-3 { background-position: -96px -176px; } -.ui-icon-circle-plus { background-position: 0 -192px; } -.ui-icon-circle-minus { background-position: -16px -192px; } -.ui-icon-circle-close { background-position: -32px -192px; } -.ui-icon-circle-triangle-e { background-position: -48px -192px; } -.ui-icon-circle-triangle-s { background-position: -64px -192px; } -.ui-icon-circle-triangle-w { background-position: -80px -192px; } -.ui-icon-circle-triangle-n { background-position: -96px -192px; } -.ui-icon-circle-arrow-e { background-position: -112px -192px; } -.ui-icon-circle-arrow-s { background-position: -128px -192px; } -.ui-icon-circle-arrow-w { background-position: -144px -192px; } -.ui-icon-circle-arrow-n { background-position: -160px -192px; } -.ui-icon-circle-zoomin { background-position: -176px -192px; } -.ui-icon-circle-zoomout { background-position: -192px -192px; } -.ui-icon-circle-check { background-position: -208px -192px; } -.ui-icon-circlesmall-plus { background-position: 0 -208px; } -.ui-icon-circlesmall-minus { background-position: -16px -208px; } -.ui-icon-circlesmall-close { background-position: -32px -208px; } -.ui-icon-squaresmall-plus { background-position: -48px -208px; } -.ui-icon-squaresmall-minus { background-position: -64px -208px; } -.ui-icon-squaresmall-close { background-position: -80px -208px; } -.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } -.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } -.ui-icon-grip-solid-vertical { background-position: -32px -224px; } -.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } -.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } -.ui-icon-grip-diagonal-se { background-position: -80px -224px; } - - -/* Misc visuals -----------------------------------*/ - -/* Corner radius */ -.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; -khtml-border-top-left-radius: 4px; border-top-left-radius: 4px; } -.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; -khtml-border-top-right-radius: 4px; border-top-right-radius: 4px; } -.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; -khtml-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; } -.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; -khtml-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; } - - - -/* Overlays */ -.ui-widget-overlay { background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); } -.ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -khtml-border-radius: 8px; -webkit-border-radius: 8px; border-radius: 8px; }/* - * jQuery UI Resizable 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Resizable#theming - */ -.ui-resizable { position: relative;} -.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block; } -.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } -.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; } -.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; } -.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; } -.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; } -.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } -.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } -.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } -.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/* - * jQuery UI Selectable 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Selectable#theming - */ -.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; } -/* - * jQuery UI Accordion 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Accordion#theming - */ -/* IE/Win - Fix animation bug - #4615 */ -.ui-accordion { width: 100%; } -.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; font-weight:bold; } -.ui-accordion .ui-accordion-li-fix { display: inline; } -.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } -.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; } -.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; } -.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } -.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; } -.ui-accordion .ui-accordion-content-active { display: block; } -/* - * jQuery UI Autocomplete 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Autocomplete#theming - */ -.ui-autocomplete { position: absolute; cursor: default; } - -/* workarounds */ -* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */ - -/* - * jQuery UI Menu 1.8.16 - * - * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Menu#theming - */ -.ui-menu { - list-style:none; - padding: 2px; - margin: 0; - display:block; - float: left; -} -.ui-menu .ui-menu { - margin-top: -3px; -} -.ui-menu .ui-menu-item { - margin:0; - padding: 0; - zoom: 1; - float: left; - clear: left; - width: 100%; -} -.ui-menu .ui-menu-item a { - text-decoration:none; - display:block; - padding:.2em .4em; - line-height:1.5; - zoom:1; -} -.ui-menu .ui-menu-item a.ui-state-hover, -.ui-menu .ui-menu-item a.ui-state-active { - font-weight: normal; - background:#0064CD; - color:#fff -} - - -/* - * jQuery UI Button 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Button#theming - */ -.ui-button { - - cursor: pointer; - display: inline-block; - background-color: #e6e6e6; - background-repeat: no-repeat; - background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#ffffff), color-stop(25%, #ffffff), to(#e6e6e6)); - background-image: -webkit-linear-gradient(#ffffff, #ffffff 25%, #e6e6e6); - background-image: -moz-linear-gradient(top, #ffffff, #ffffff 25%, #e6e6e6); - background-image: -ms-linear-gradient(#ffffff, #ffffff 25%, #e6e6e6); - background-image: -o-linear-gradient(#ffffff, #ffffff 25%, #e6e6e6); - background-image: linear-gradient(#ffffff, #ffffff 25%, #e6e6e6); - filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#e6e6e6', GradientType=0); - padding: 5px 14px 6px; - margin: 0; - text-shadow: 0 1px 1px rgba(255, 255, 255, 0.75); - color: #333; - font-size: 13px; - line-height: normal; - border: 1px solid #ccc; - border-bottom-color: #bbb; - - -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05); - -moz-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05); - box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05); - -webkit-transition: 0.1s linear background-image; - -moz-transition: 0.1s linear background-image; - -ms-transition: 0.1s linear background-image; - -o-transition: 0.1s linear background-image; - transition: 0.1s linear background-image; - overflow: visible; - -} /* the overflow property removes extra width in IE */ - -.ui-button-primary { - color: #ffffff; - background-color: #0064cd; - background-repeat: repeat-x; - background-image: -khtml-gradient(linear, left top, left bottom, from(#049cdb), to(#0064cd)); - background-image: -moz-linear-gradient(top, #049cdb, #0064cd); - background-image: -ms-linear-gradient(top, #049cdb, #0064cd); - background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0%, #049cdb), color-stop(100%, #0064cd)); - background-image: -webkit-linear-gradient(top, #049cdb, #0064cd); - background-image: -o-linear-gradient(top, #049cdb, #0064cd); - background-image: linear-gradient(top, #049cdb, #0064cd); - filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#049cdb', endColorstr='#0064cd', GradientType=0); - text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25); - border-color: #0064cd #0064cd #003f81; - border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); - -} - - - -.ui-button-success{ - color:#ffffff; - background-color: #57a957; - background-repeat: repeat-x; - background-image: -khtml-gradient(linear, left top, left bottom, from(#62c462), to(#57a957)); - background-image: -moz-linear-gradient(top, #62c462, #57a957); - background-image: -ms-linear-gradient(top, #62c462, #57a957); - background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0%, #62c462), color-stop(100%, #57a957)); - background-image: -webkit-linear-gradient(top, #62c462, #57a957); - background-image: -o-linear-gradient(top, #62c462, #57a957); - background-image: linear-gradient(top, #62c462, #57a957); - filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#62c462', endColorstr='#57a957', GradientType=0); - text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25); - border-color: #57a957 #57a957 #3d773d; - border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); -} - -.ui-button-error{ - color:#ffffff; - background-color: #c43c35; - background-repeat: repeat-x; - background-image: -khtml-gradient(linear, left top, left bottom, from(#ee5f5b), to(#c43c35)); - background-image: -moz-linear-gradient(top, #ee5f5b, #c43c35); - background-image: -ms-linear-gradient(top, #ee5f5b, #c43c35); - background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0%, #ee5f5b), color-stop(100%, #c43c35)); - background-image: -webkit-linear-gradient(top, #ee5f5b, #c43c35); - background-image: -o-linear-gradient(top, #ee5f5b, #c43c35); - background-image: linear-gradient(top, #ee5f5b, #c43c35); - filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ee5f5b', endColorstr='#c43c35', GradientType=0); - text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25); - border-color: #c43c35 #c43c35 #882a25; - border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); -} - -.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */ -button.ui-button-icon-only { } /* button elements seem to need a little more width */ -.ui-button-icons-only { width: 3.4em; } -button.ui-button-icons-only { width: 3.7em; } - -/*button text element */ - -.ui-button .ui-button-text { display: block; } -.ui-button-text-only .ui-button-text { } -.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; /*tempfix*/ display:none;} -.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; } -.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; } -.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; } -/* no icon support for input elements, provide padding by default */ -/* input.ui-button { padding: .4em 1em; } */ - -/*button icon element(s) */ -.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { top: 50%; margin-top:-3px; margin-bottom:3px; } -.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; } -.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; } -.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } -.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } - -/*button sets*/ - - -.ui-buttonset { margin-right: 7px; } -.ui-buttonset .ui-state-active { - color: #ffffff; - background-color: #0064cd; - background-repeat: repeat-x; - background-image: -khtml-gradient(linear, left top, left bottom, from(#049cdb), to(#0064cd)); - background-image: -moz-linear-gradient(top, #049cdb, #0064cd); - background-image: -ms-linear-gradient(top, #049cdb, #0064cd); - background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0%, #049cdb), color-stop(100%, #0064cd)); - background-image: -webkit-linear-gradient(top, #049cdb, #0064cd); - background-image: -o-linear-gradient(top, #049cdb, #0064cd); - background-image: linear-gradient(top, #049cdb, #0064cd); - filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#049cdb', endColorstr='#0064cd', GradientType=0); - text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25); - border-color: #0064cd #0064cd #003f81; - border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); -} -.ui-buttonset .ui-button { margin-left: 0; margin-right: -.4em; } - -/* workarounds */ -button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */ - - - -/* - * jQuery UI Dialog 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Dialog#theming - */ -.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; } -.ui-dialog .ui-dialog-titlebar { /*padding: .4em 1em;*/ - - position: relative; - padding:5px 15px; - - border:0px 0px 0px 1px solid; - border-color: white; - padding: 5px 15px; - font-size: 18px; - text-decoration:none; - background:none; - -moz-border-radius-bottomright: 0px; - -webkit-border-bottom-right-radius: 0px; - -khtml-border-bottom-right-radius: 0px; - - -moz-border-radius-bottomleft: 0px; - -webkit-border-bottom-left-radius: 0px; - -khtml-border-bottom-left-radius: 0px; - border-bottom-left-radius: 0px; - - border-bottom:1px solid #ccc; - -} -.ui-dialog .ui-dialog-title { - float: left; - color:#404040; - font-weight:bold; - margin-top:5px; - margin-bottom:5px; - padding:5px; - -} -.ui-dialog .ui-dialog-titlebar-close { - position: absolute; - right: .3em; - top: 50%; - width: 19px; - margin: -10px 0 0 0; - padding: 1px; - height: 18px; - font-size: 20px; - font-weight: bold; - line-height: 13.5px; - text-shadow: 0 1px 0 #ffffff; - filter: alpha(opacity=25); - -khtml-opacity: 0.25; - -moz-opacity: 0.25; - opacity: 0.25; -} - -.ui-dialog .ui-dialog-titlebar-close span { - display: block; - margin: 1px; - text-indent: 9999px; -} - -.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; filter: alpha(opacity=90); - -khtml-opacity: 0.90; - -moz-opacity: 0.90; - opacity: 0.90; } - -.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } - -.ui-dialog .ui-dialog-buttonpane { - text-align: left; - border-width: 1px 0 0 0; - background-image: none; - margin: .5em 0 0 0; - background-color: #f5f5f5; - padding: 5px 15px 5px; - border-top: 1px solid #ddd; - -webkit-border-radius: 0 0 6px 6px; - -moz-border-radius: 0 0 6px 6px; - border-radius: 0 0 6px 6px; - -webkit-box-shadow: inset 0 1px 0 #ffffff; - -moz-box-shadow: inset 0 1px 0 #ffffff; - box-shadow: inset 0 1px 0 #ffffff; - zoom: 1; - margin-bottom: 0; - -} -.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; } -.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; } -.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } -.ui-draggable .ui-dialog-titlebar { cursor: move; } - -.ui-dialog-buttonpane .ui-dialog-buttonset .ui-button{ - color: #ffffff; - background-color: #0064cd; - background-repeat: repeat-x; - background-image: -khtml-gradient(linear, left top, left bottom, from(#049cdb), to(#0064cd)); - background-image: -moz-linear-gradient(top, #049cdb, #0064cd); - background-image: -ms-linear-gradient(top, #049cdb, #0064cd); - background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0%, #049cdb), color-stop(100%, #0064cd)); - background-image: -webkit-linear-gradient(top, #049cdb, #0064cd); - background-image: -o-linear-gradient(top, #049cdb, #0064cd); - background-image: linear-gradient(top, #049cdb, #0064cd); - filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#049cdb', endColorstr='#0064cd', GradientType=0); - text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25); - border-color: #0064cd #0064cd #003f81; - border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); -} -/* - * jQuery UI Slider 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Slider#theming - */ -.ui-slider { position: relative; text-align: left; } -.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } -.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; - - color: #ffffff; - background-color: #0064cd; - background-repeat: repeat-x; - background-image: -khtml-gradient(linear, left top, left bottom, from(#049cdb), to(#0064cd)); - background-image: -moz-linear-gradient(top, #049cdb, #0064cd); - background-image: -ms-linear-gradient(top, #049cdb, #0064cd); - background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0%, #049cdb), color-stop(100%, #0064cd)); - background-image: -webkit-linear-gradient(top, #049cdb, #0064cd); - background-image: -o-linear-gradient(top, #049cdb, #0064cd); - background-image: linear-gradient(top, #049cdb, #0064cd); - filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#049cdb', endColorstr='#0064cd', GradientType=0); - text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25); - border-color: #0064cd #0064cd #003f81; - border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); - -} - -.ui-slider-horizontal { height: .8em; } -.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } -.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } -.ui-slider-horizontal .ui-slider-range-min { left: 0; } -.ui-slider-horizontal .ui-slider-range-max { right: 0; } - -.ui-slider-vertical { width: .8em; height: 100px; } -.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } -.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } -.ui-slider-vertical .ui-slider-range-min { bottom: 0; } -.ui-slider-vertical .ui-slider-range-max { top: 0; }/* - * jQuery UI Tabs 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Tabs#theming - */ - .ui-tabs .ui-tabs-nav{ background:none; border-color: #ddd; - border-style: solid; - border-width: 0 0 1px;} -.ui-tabs { position: relative; padding: .2em; zoom: 1; border:0px;} /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ - - -.ui-tabs .ui-tabs-nav li:hover, .ui-tabs .ui-tabs-nav li a:hover{ - background:whiteSmoke; - border-bottom:1px solid #ddd; - padding-bottom:0px; - color:#00438A; -} - - -.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; border-bottom:1px solid #DDD; } -.ui-tabs .ui-tabs-nav li { text-decoration: none; list-style: none; float: left; position: relative; top: 1px; padding: 0px 0px 1px 0px; white-space: nowrap; background:none; border:0px; - -} - -.ui-tabs-nav .ui-state-default{ - -webkit-box-shadow: 0px 0px 0px #ffffff; /* Saf3-4, iOS 4.0.2 - 4.2, Android 2.3+ */ - -moz-box-shadow: 0px 0px 0px #ffffff; /* FF3.5 - 3.6 */ - box-shadow: 0px 0px 0px #ffffff; /* Opera 10.5, IE9, FF4+, Chrome 6+, iOS 5 */ -} -.ui-tabs .ui-tabs-nav li a { - - float: left; - text-decoration: none; - cursor: text; - padding: 0 15px; - margin-right: 2px; - line-height: 34px; - border: 1px solid transparent; - -webkit-border-radius: 4px 4px 0 0; - -moz-border-radius: 4px 4px 0 0; - border-radius: 4px 4px 0 0; - - - } -.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 0px; outline:none;} - -.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { - - background-color: #ffffff; - border: 1px solid #ddd; - border-bottom-color: #ffffff; - cursor: default; - color:gray; - outline:none; -} - - -.ui-tabs .ui-tabs-nav li.ui-tabs-selected:hover{ - background:#ffffff; - outline:none; -} - -.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; color:#0069D6; background:none; font-weight:normal; margin-bottom:-1px;} -/* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ -.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; } -.ui-tabs-panel .ui-button{text-decoration:none;} -.ui-tabs .ui-tabs-hide { display: none !important; } - - -/* IE fix for background inheritance from ui-widget*/ -.ui-tabs .ui-tabs-nav li{ - filter:none; -} - - - -/* - * jQuery UI Datepicker 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Datepicker#theming - */ -.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; } -.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; border:0px; font-weight: bold; width: 100%; padding: 4px 0; background-color: #f5f5f5; color: #808080; } -.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } - -.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { /*top: 1px;*/ } -.ui-datepicker .ui-datepicker-prev { left:2px; } -.ui-datepicker .ui-datepicker-next { right:2px; } - -.ui-datepicker .ui-datepicker-prev-hover { /*left:1px;*/ } -.ui-datepicker .ui-datepicker-next-hover { /*right:1px;*/ } - -.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } -.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } -.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; } -.ui-datepicker select.ui-datepicker-month-year {width: 100%;} -.ui-datepicker select.ui-datepicker-month, -.ui-datepicker select.ui-datepicker-year { width: 49%;} -.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } -.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } -.ui-datepicker td { border: 0; padding: 1px; } -.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } -.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } -.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } -.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } - -/* with multiple calendars */ -.ui-datepicker.ui-datepicker-multi { width:auto; } -.ui-datepicker-multi .ui-datepicker-group { float:left; } -.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } -.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } -.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } -.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } -.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } -.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } -.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } -.ui-datepicker-row-break { clear:both; width:100%; font-size:0em; } - -/* RTL support */ -.ui-datepicker-rtl { direction: rtl; } -.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } -.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } -.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } -.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } -.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } -.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } -.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } -.ui-datepicker-rtl .ui-datepicker-group { float:right; } -.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } -.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } - -/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ -.ui-datepicker-cover { - display: none; /*sorry for IE5*/ - display/**/: block; /*sorry for IE5*/ - position: absolute; /*must have*/ - z-index: -1; /*must have*/ - filter: mask(); /*must have*/ - top: -4px; /*must have*/ - left: -4px; /*must have*/ - width: 200px; /*must have*/ - height: 200px; /*must have*/ -} - -.ui-datepicker th{ - font-weight: bold; - color: gray; -} - -.ui-datepicker-today a:hover{ - background-color: #808080; - color: #ffffff; - -} -.ui-datepicker-today a{ - background-color: #BFBFBF; - cursor: pointer; - padding: 0 4px; - margin-bottom:0px; - -} - - -.ui-datepicker td a{ - margin-bottom:0px; - border:0px; -} - -.ui-datepicker td:hover{ - color:white; -} - -.ui-datepicker td .ui-state-default { - border:0px; - background:none; - margin-bottom:0px; - padding:5px; - color:gray; - text-align: center; - filter:none; -} - - -.ui-datepicker td .ui-state-active{ - background:#BFBFBF; - margin-bottom:0px; - font-size:normal; - text-shadow: 0px; - color:white; - -webkit-border-radius: 4px; - -moz-border-radius: 4px; - border-radius: 4px; -} - -.ui-datepicker td .ui-state-default:hover{ - background:#0064cd; - color:white; - -webkit-border-radius: 4px; - -moz-border-radius: 4px; - border-radius: 4px; -} - - -/* - * jQuery UI Progressbar 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Progressbar#theming - */ -.ui-progressbar { height:2em; text-align: left; } -.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; - -/*this can be removed if ui-widget-header is blue*/ - color: #ffffff; - background-color: #0064cd; - background-repeat: repeat-x; - background-image: -khtml-gradient(linear, left top, left bottom, from(#049cdb), to(#0064cd)); - background-image: -moz-linear-gradient(top, #049cdb, #0064cd); - background-image: -ms-linear-gradient(top, #049cdb, #0064cd); - background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0%, #049cdb), color-stop(100%, #0064cd)); - background-image: -webkit-linear-gradient(top, #049cdb, #0064cd); - background-image: -o-linear-gradient(top, #049cdb, #0064cd); - background-image: linear-gradient(top, #049cdb, #0064cd); - filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#049cdb', endColorstr='#0064cd', GradientType=0); - text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25); - border-color: #0064cd #0064cd #003f81; - border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); - } - - - -/*** Input field styling from Bootstrap **/ - input, textarea { - -webkit-transition: border linear 0.2s, box-shadow linear 0.2s; - -moz-transition: border linear 0.2s, box-shadow linear 0.2s; - -ms-transition: border linear 0.2s, box-shadow linear 0.2s; - -o-transition: border linear 0.2s, box-shadow linear 0.2s; - transition: border linear 0.2s, box-shadow linear 0.2s; - -webkit-box-shadow: inset 0 1px 3px rgba(0, 0, 0, 0.1); - -moz-box-shadow: inset 0 1px 3px rgba(0, 0, 0, 0.1); - box-shadow: inset 0 1px 3px rgba(0, 0, 0, 0.1); -} -input:focus, textarea:focus { - outline: 0; - border-color: rgba(82, 168, 236, 0.8); - -webkit-box-shadow: inset 0 1px 3px rgba(0, 0, 0, 0.1), 0 0 8px rgba(82, 168, 236, 0.6); - -moz-box-shadow: inset 0 1px 3px rgba(0, 0, 0, 0.1), 0 0 8px rgba(82, 168, 236, 0.6); - box-shadow: inset 0 1px 3px rgba(0, 0, 0, 0.1), 0 0 8px rgba(82, 168, 236, 0.6); -} -input[type=file]:focus, input[type=checkbox]:focus, select:focus { - -webkit-box-shadow: none; - -moz-box-shadow: none; - box-shadow: none; - outline: 1px dotted #666; -} - -input[type="text"], -input[type="password"], -.ui-autocomplete-input, -textarea, -.uneditable-input { - display: inline-block; - padding: 4px; - font-size: 13px; - line-height: 18px; - color: #808080; - border: 1px solid #ccc; - -webkit-border-radius: 3px; - -moz-border-radius: 3px; - border-radius: 3px; -} - - - -/**Toolbar**/ - -.ui-toolbar{ - padding: 7px 14px; - margin: 0 0 18px; - background-color: #f5f5f5; - background-repeat: repeat-x; - background-image: -khtml-gradient(linear, left top, left bottom, from(#ffffff), to(#f5f5f5)); - background-image: -moz-linear-gradient(top, #ffffff, #f5f5f5); - background-image: -ms-linear-gradient(top, #ffffff, #f5f5f5); - background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0%, #ffffff), color-stop(100%, #f5f5f5)); - background-image: -webkit-linear-gradient(top, #ffffff, #f5f5f5); - background-image: -o-linear-gradient(top, #ffffff, #f5f5f5); - background-image: linear-gradient(top, #ffffff, #f5f5f5); - filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#f5f5f5', GradientType=0); - border: 1px solid #ddd; - -webkit-border-radius: 3px; - -moz-border-radius: 3px; - border-radius: 3px; - -webkit-box-shadow: inset 0 1px 0 #ffffff; - -moz-box-shadow: inset 0 1px 0 #ffffff; - box-shadow: inset 0 1px 0 #ffffff; -} - - -/***Dialog fixes**/ - -.ui-dialog-buttonset .ui-button:nth-child(2){ - cursor: pointer; - display: inline-block; - background-color: #e6e6e6; - background-repeat: no-repeat; - background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#ffffff), color-stop(25%, #ffffff), to(#e6e6e6)); - background-image: -webkit-linear-gradient(#ffffff, #ffffff 25%, #e6e6e6); - background-image: -moz-linear-gradient(top, #ffffff, #ffffff 25%, #e6e6e6); - background-image: -ms-linear-gradient(#ffffff, #ffffff 25%, #e6e6e6); - background-image: -o-linear-gradient(#ffffff, #ffffff 25%, #e6e6e6); - background-image: linear-gradient(#ffffff, #ffffff 25%, #e6e6e6); - filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#e6e6e6', GradientType=0); - padding: 5px 14px 6px; - text-shadow: 0 1px 1px rgba(255, 255, 255, 0.75); - color: #333; - font-size: 13px; - line-height: normal; - border: 1px solid #ccc; - border-bottom-color: #bbb; - -webkit-border-radius: 4px; - -moz-border-radius: 4px; - border-radius: 4px; - -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05); - -moz-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05); - box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05); - -webkit-transition: 0.1s linear all; - -moz-transition: 0.1s linear all; - -ms-transition: 0.1s linear all; - -o-transition: 0.1s linear all; - transition: 0.1s linear all; - overflow: visible; -} - - - -/***Wijmo Theming**/ - -div.wijmo-wijmenu{ - padding:0 20px; - background-color: #222; - background-color: #222222; - background-repeat: repeat-x; - background-image: -khtml-gradient(linear, left top, left bottom, from(#333333), to(#222222)); - background-image: -moz-linear-gradient(top, #333333, #222222); - background-image: -ms-linear-gradient(top, #333333, #222222); - background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0%, #333333), color-stop(100%, #222222)); - background-image: -webkit-linear-gradient(top, #333333, #222222); - background-image: -o-linear-gradient(top, #333333, #222222); - background-image: linear-gradient(top, #333333, #222222); - filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#333333', endColorstr='#222222', GradientType=0); - -webkit-box-shadow: 0 1px 3px rgba(0, 0, 0, 0.25), inset 0 -1px 0 rgba(0, 0, 0, 0.1); - -moz-box-shadow: 0 1px 3px rgba(0, 0, 0, 0.25), inset 0 -1px 0 rgba(0, 0, 0, 0.1); - box-shadow: 0 1px 3px rgba(0, 0, 0, 0.25), inset 0 -1px 0 rgba(0, 0, 0, 0.1); -} - -.wijmo-wijmenu .ui-state-default{ - box-shadow: none; - color:#BFBFBF; -} - -.wijmo-wijmenu .ui-state-default .wijmo-wijmenu-text{ - color:#BFBFBF; -} - -.wijmo-wijmenu .ui-state-hover{ - background: #444; - background: rgba(255, 255, 255, 0.05); -} - -.wijmo-wijmenu .ui-state-hover .wijmo-wijmenu-text{ - color:#ffffff; -} - -div.wijmo-wijmenu .ui-widget-header h3{ - position: relative; - margin-top:1px; - padding:0; -} - -.wijmo-wijmenu h3 a{ - color: #FFFFFF; - display: block; - float: left; - font-size: 20px; - font-weight: 200; - line-height: 1; - margin-left: -20px; - margin-top:1px; - padding: 8px 20px 12px; -} - -.wijmo-wijmenu h3 a:hover{ - background-color: rgba(255, 255, 255, 0.05); - color: #FFFFFF; - text-decoration: none; -} - -.wijmo-wijmenu .ui-widget-header{ - border:0px; -} - -.wijmo-wijmenu .wijmo-wijmenu-parent .wijmo-wijmenu-child{ - padding: 0.3em 0; -} - -div.wijmo-wijmenu .wijmo-wijmenu-item .wijmo-wijmenu-child{ - background: #333; - border:0; - margin:0; - padding: 6px 0; - width:160px; - -webkit-border-radius: 0 0 6px 6px; - -moz-border-radius: 0 0 6px 6px; - border-radius: 0 0 6px 6px; - -webkit-box-shadow: 0 2px 4px rgba(0, 0, 0, 0.2); - -moz-box-shadow: 0 2px 4px rgba(0, 0, 0, 0.2); - box-shadow: 0 2px 4px rgba(0, 0, 0, 0.2); -} - -div.wijmo-wijmenu .wijmo-wijmenu-item{ - margin:0; - border:0; -} - -.wijmo-wijmenu a.wijmo-wijmenu-link{ - margin:0; - line-height: 19px; - padding: 10px 10px 11px; - border:0; - -webkit-border-radius: 0; - -moz-border-radius: 0; - border-radius:0; -} - -div.wijmo-wijmenu .wijmo-wijmenu-child .wijmo-wijmenu-link{ - display:block; - float:none; - padding: 4px 15px; - width:auto; -} - -div.wijmo-wijmenu .wijmo-wijmenu-child .wijmo-wijmenu-text -{ - float:none; -} - -.wijmo-wijmenu .wijmo-wijmenu-item .wijmo-wijmenu-child .ui-state-hover { - background: #191919; -} - -.wijmo-wijmenu .wijmo-wijmenu-item .wijmo-wijmenu-separator{ - padding: 5px 0; - background-image: none; - background-color: #222; - border-top: 1px solid #444; - border-bottom:0; - border-left:0; - border-right:0; -} - -.wijmo-wijmenu .wijmo-wijmenu-item input { - -moz-transition: none 0s ease 0s; - background-color: rgba(255, 255, 255, 0.3); - border: 1px solid #111111; - border-radius: 4px 4px 4px 4px; - box-shadow: 0 1px 2px rgba(0, 0, 0, 0.1) inset, 0 1px 0 rgba(255, 255, 255, 0.25); - color: rgba(255, 255, 255, 0.75); - font-family: "Helvetica Neue",Helvetica,Arial,sans-serif; - line-height: 1; - margin: 5px 10px 0 10px; - padding: 4px 9px; - width:100px; -} - -.wijmo-wijmenu .wijmo-wijmenu-item input:hover { - background-color: rgba(255, 255, 255, 0.5); - color: #FFFFFF; -} - -.wijmo-wijmenu .wijmo-wijmenu-item input:focus { - background-color: #FFFFFF; - border: 0 none; - box-shadow: 0 0 3px rgba(0, 0, 0, 0.15); - color: #404040; - outline: 0 none; - padding: 5px 10px; - text-shadow: 0 1px 0 #FFFFFF; -} - - -.wijmo-wijmenu .ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { - text-shadow:none; -} - - -.wijmo-wijmenu .ui-state-default{ - box-shadow: none; - color:#BFBFBF; - filter: none; -} - +/*! + * jQuery UI Bootstrap (0.22) + * http://addyosmani.github.com/jquery-ui-bootstrap + * + * Copyright 2012, Addy Osmani + * Dual licensed under the MIT or GPL Version 2 licenses. + * + * Portions copyright jQuery UI & Twitter Bootstrap + */ + + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } +.ui-helper-clearfix { display: inline-block; } +/* required comment for clearfix to work in Opera \*/ +* html .ui-helper-clearfix { height:1%; } +.ui-helper-clearfix { display:block; } +/* end clearfix */ +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } + + +/* + * jQuery UI CSS Framework 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + * + * To view and modify this theme, visit http://jqueryui.com/themeroller/?ctl=themeroller + */ + + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: "Helvetica Neue", Helvetica, Arial, sans-serif; font-size:13px; } +.ui-widget .ui-widget { font-size: 1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: "Helvetica Neue", Helvetica, Arial, sans-serif; font-size: 1em; } +.ui-widget-content { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_glass_75_ffffff_1x400.png) 50% 50% repeat-x; color: #404040; } +.ui-widget-content a { color: #404040; } +.ui-widget-header { + font-weight:bold; + border-color: #0064cd #0064cd #003f81; + border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); + border:1px solid #666; + + } +.ui-widget-header a { color: #222222; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { + + background-color: #e6e6e6; + background-repeat: no-repeat; + background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#ffffff), color-stop(25%, #ffffff), to(#e6e6e6)); + background-image: -webkit-linear-gradient(#ffffff, #ffffff 25%, #e6e6e6); + background-image: -moz-linear-gradient(top, #ffffff, #ffffff 25%, #e6e6e6); + background-image: -ms-linear-gradient(#ffffff, #ffffff 25%, #e6e6e6); + background-image: -o-linear-gradient(#ffffff, #ffffff 25%, #e6e6e6); + background-image: linear-gradient(#ffffff, #ffffff 25%, #e6e6e6); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#e6e6e6', GradientType=0); + + text-shadow: 0 1px 1px rgba(255, 255, 255, 0.75); + + color: #333; + font-size: 13px; + line-height: normal; + border: 1px solid #ccc; + border-bottom-color: #bbb; + -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05); + -moz-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05); + box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05); + -webkit-transition: 0.1s linear background-image; + -moz-transition: 0.1s linear background-image; + -ms-transition: 0.1s linear background-image; + -o-transition: 0.1s linear background-image; + transition: 0.1s linear background-image; + overflow: visible; + + } + + +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555; text-decoration: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { + background-position: 0 -15px; + color: #333; + text-decoration: none; + + + } +.ui-state-hover a, .ui-state-hover a:hover { color: #212121; text-decoration: none; } +.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa; font-weight: normal; color: #212121; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121; text-decoration: none; } +.ui-widget :active { outline: none; } + +/* Interaction Cues +----------------------------------*/ + + +.ui-state-highlight p, .ui-state-error p, .ui-state-default p{ + font-size: 13px; + font-weight: normal; + line-height: 18px; + margin:7px 15px; +} +.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight { + + + position: relative; + margin-bottom: 18px; + color: #404040; + background-color: #eedc94; + background-repeat: repeat-x; + background-image: -khtml-gradient(linear, left top, left bottom, from(#fceec1), to(#eedc94)); + background-image: -moz-linear-gradient(top, #fceec1, #eedc94); + background-image: -ms-linear-gradient(top, #fceec1, #eedc94); + background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0%, #fceec1), color-stop(100%, #eedc94)); + background-image: -webkit-linear-gradient(top, #fceec1, #eedc94); + background-image: -o-linear-gradient(top, #fceec1, #eedc94); + background-image: linear-gradient(top, #fceec1, #eedc94); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#fceec1', endColorstr='#eedc94', GradientType=0); + text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25); + border-color: #eedc94 #eedc94 #e4c652; + border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); + text-shadow: 0 1px 0 rgba(255, 255, 255, 0.5); + border-width: 1px; + border-style: solid; + -webkit-border-radius: 4px; + -moz-border-radius: 4px; + border-radius: 4px; + -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25); + -moz-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25); + box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25); + + +} +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; } +.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error { + + + position: relative; + margin-bottom: 18px; + color: #ffffff; + border-width: 1px; + border-style: solid; + -webkit-border-radius: 4px; + -moz-border-radius: 4px; + border-radius: 4px; + -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25); + -moz-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25); + box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25); + background-color: #c43c35; + background-repeat: repeat-x; + background-image: -khtml-gradient(linear, left top, left bottom, from(#ee5f5b), to(#c43c35)); + background-image: -moz-linear-gradient(top, #ee5f5b, #c43c35); + background-image: -ms-linear-gradient(top, #ee5f5b, #c43c35); + background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0%, #ee5f5b), color-stop(100%, #c43c35)); + background-image: -webkit-linear-gradient(top, #ee5f5b, #c43c35); + background-image: -o-linear-gradient(top, #ee5f5b, #c43c35); + background-image: linear-gradient(top, #ee5f5b, #c43c35); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ee5f5b', endColorstr='#c43c35', GradientType=0); + text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25); + border-color: #c43c35 #c43c35 #882a25; + border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); + + +} +.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } + + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png); } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png); } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_f6cf3b_256x240.png); } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-start { background-position: -80px -160px; } +/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; -khtml-border-top-left-radius: 4px; border-top-left-radius: 4px; } +.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; -khtml-border-top-right-radius: 4px; border-top-right-radius: 4px; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; -khtml-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; -khtml-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; } + + + +/* Overlays */ +.ui-widget-overlay { background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); } +.ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -khtml-border-radius: 8px; -webkit-border-radius: 8px; border-radius: 8px; }/* + * jQuery UI Resizable 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizable#theming + */ +.ui-resizable { position: relative;} +.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block; } +.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } +.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; } +.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; } +.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; } +.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; } +.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } +.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } +.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } +.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/* + * jQuery UI Selectable 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectable#theming + */ +.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; } +/* + * jQuery UI Accordion 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Accordion#theming + */ +/* IE/Win - Fix animation bug - #4615 */ +.ui-accordion { width: 100%; } +.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; font-weight:bold; } +.ui-accordion .ui-accordion-li-fix { display: inline; } +.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } +.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; } +.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; } +.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } +.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; } +.ui-accordion .ui-accordion-content-active { display: block; } +/* + * jQuery UI Autocomplete 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete#theming + */ +.ui-autocomplete { position: absolute; cursor: default; } + +/* workarounds */ +* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */ + +/* + * jQuery UI Menu 1.8.16 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu#theming + */ +.ui-menu { + list-style:none; + padding: 2px; + margin: 0; + display:block; + float: left; +} +.ui-menu .ui-menu { + margin-top: -3px; +} +.ui-menu .ui-menu-item { + margin:0; + padding: 0; + zoom: 1; + float: left; + clear: left; + width: 100%; +} +.ui-menu .ui-menu-item a { + text-decoration:none; + display:block; + padding:.2em .4em; + line-height:1.5; + zoom:1; +} +.ui-menu .ui-menu-item a.ui-state-hover, +.ui-menu .ui-menu-item a.ui-state-active { + font-weight: normal; + background:#0064CD; + color:#fff +} + + +/* + * jQuery UI Button 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Button#theming + */ +.ui-button { + + cursor: pointer; + display: inline-block; + background-color: #e6e6e6; + background-repeat: no-repeat; + background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#ffffff), color-stop(25%, #ffffff), to(#e6e6e6)); + background-image: -webkit-linear-gradient(#ffffff, #ffffff 25%, #e6e6e6); + background-image: -moz-linear-gradient(top, #ffffff, #ffffff 25%, #e6e6e6); + background-image: -ms-linear-gradient(#ffffff, #ffffff 25%, #e6e6e6); + background-image: -o-linear-gradient(#ffffff, #ffffff 25%, #e6e6e6); + background-image: linear-gradient(#ffffff, #ffffff 25%, #e6e6e6); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#e6e6e6', GradientType=0); + padding: 5px 14px 6px; + margin: 0; + text-shadow: 0 1px 1px rgba(255, 255, 255, 0.75); + color: #333; + font-size: 13px; + line-height: normal; + border: 1px solid #ccc; + border-bottom-color: #bbb; + + -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05); + -moz-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05); + box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05); + -webkit-transition: 0.1s linear background-image; + -moz-transition: 0.1s linear background-image; + -ms-transition: 0.1s linear background-image; + -o-transition: 0.1s linear background-image; + transition: 0.1s linear background-image; + overflow: visible; + +} /* the overflow property removes extra width in IE */ + +.ui-button-primary { + color: #ffffff; + background-color: #0064cd; + background-repeat: repeat-x; + background-image: -khtml-gradient(linear, left top, left bottom, from(#049cdb), to(#0064cd)); + background-image: -moz-linear-gradient(top, #049cdb, #0064cd); + background-image: -ms-linear-gradient(top, #049cdb, #0064cd); + background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0%, #049cdb), color-stop(100%, #0064cd)); + background-image: -webkit-linear-gradient(top, #049cdb, #0064cd); + background-image: -o-linear-gradient(top, #049cdb, #0064cd); + background-image: linear-gradient(top, #049cdb, #0064cd); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#049cdb', endColorstr='#0064cd', GradientType=0); + text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25); + border-color: #0064cd #0064cd #003f81; + border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); + +} + + + +.ui-button-success{ + color:#ffffff; + background-color: #57a957; + background-repeat: repeat-x; + background-image: -khtml-gradient(linear, left top, left bottom, from(#62c462), to(#57a957)); + background-image: -moz-linear-gradient(top, #62c462, #57a957); + background-image: -ms-linear-gradient(top, #62c462, #57a957); + background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0%, #62c462), color-stop(100%, #57a957)); + background-image: -webkit-linear-gradient(top, #62c462, #57a957); + background-image: -o-linear-gradient(top, #62c462, #57a957); + background-image: linear-gradient(top, #62c462, #57a957); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#62c462', endColorstr='#57a957', GradientType=0); + text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25); + border-color: #57a957 #57a957 #3d773d; + border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); +} + +.ui-button-error{ + color:#ffffff; + background-color: #c43c35; + background-repeat: repeat-x; + background-image: -khtml-gradient(linear, left top, left bottom, from(#ee5f5b), to(#c43c35)); + background-image: -moz-linear-gradient(top, #ee5f5b, #c43c35); + background-image: -ms-linear-gradient(top, #ee5f5b, #c43c35); + background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0%, #ee5f5b), color-stop(100%, #c43c35)); + background-image: -webkit-linear-gradient(top, #ee5f5b, #c43c35); + background-image: -o-linear-gradient(top, #ee5f5b, #c43c35); + background-image: linear-gradient(top, #ee5f5b, #c43c35); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ee5f5b', endColorstr='#c43c35', GradientType=0); + text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25); + border-color: #c43c35 #c43c35 #882a25; + border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); +} + +.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */ +button.ui-button-icon-only { } /* button elements seem to need a little more width */ +.ui-button-icons-only { width: 3.4em; } +button.ui-button-icons-only { width: 3.7em; } + +/*button text element */ + +.ui-button .ui-button-text { display: block; } +.ui-button-text-only .ui-button-text { } +.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; /*tempfix*/ display:none;} +.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; } +.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; } +.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; } +/* no icon support for input elements, provide padding by default */ +/* input.ui-button { padding: .4em 1em; } */ + +/*button icon element(s) */ +.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { top: 50%; margin-top:-3px; margin-bottom:3px; } +.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; } +.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; } +.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } +.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } + +/*button sets*/ + + +.ui-buttonset { margin-right: 7px; } +.ui-buttonset .ui-state-active { + color: #ffffff; + background-color: #0064cd; + background-repeat: repeat-x; + background-image: -khtml-gradient(linear, left top, left bottom, from(#049cdb), to(#0064cd)); + background-image: -moz-linear-gradient(top, #049cdb, #0064cd); + background-image: -ms-linear-gradient(top, #049cdb, #0064cd); + background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0%, #049cdb), color-stop(100%, #0064cd)); + background-image: -webkit-linear-gradient(top, #049cdb, #0064cd); + background-image: -o-linear-gradient(top, #049cdb, #0064cd); + background-image: linear-gradient(top, #049cdb, #0064cd); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#049cdb', endColorstr='#0064cd', GradientType=0); + text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25); + border-color: #0064cd #0064cd #003f81; + border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); +} +.ui-buttonset .ui-button { margin-left: 0; margin-right: -.4em; } + +/* workarounds */ +button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */ + + + +/* + * jQuery UI Dialog 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog#theming + */ +.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; } +.ui-dialog .ui-dialog-titlebar { /*padding: .4em 1em;*/ + + position: relative; + padding:5px 15px; + + border:0px 0px 0px 1px solid; + border-color: white; + padding: 5px 15px; + font-size: 18px; + text-decoration:none; + background:none; + -moz-border-radius-bottomright: 0px; + -webkit-border-bottom-right-radius: 0px; + -khtml-border-bottom-right-radius: 0px; + + -moz-border-radius-bottomleft: 0px; + -webkit-border-bottom-left-radius: 0px; + -khtml-border-bottom-left-radius: 0px; + border-bottom-left-radius: 0px; + + border-bottom:1px solid #ccc; + +} +.ui-dialog .ui-dialog-title { + float: left; + color:#404040; + font-weight:bold; + margin-top:5px; + margin-bottom:5px; + padding:5px; + +} +.ui-dialog .ui-dialog-titlebar-close { + position: absolute; + right: .3em; + top: 50%; + width: 19px; + margin: -10px 0 0 0; + padding: 1px; + height: 18px; + font-size: 20px; + font-weight: bold; + line-height: 13.5px; + text-shadow: 0 1px 0 #ffffff; + filter: alpha(opacity=25); + -khtml-opacity: 0.25; + -moz-opacity: 0.25; + opacity: 0.25; +} + +.ui-dialog .ui-dialog-titlebar-close span { + display: block; + margin: 1px; + text-indent: 9999px; +} + +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; filter: alpha(opacity=90); + -khtml-opacity: 0.90; + -moz-opacity: 0.90; + opacity: 0.90; } + +.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } + +.ui-dialog .ui-dialog-buttonpane { + text-align: left; + border-width: 1px 0 0 0; + background-image: none; + margin: .5em 0 0 0; + background-color: #f5f5f5; + padding: 5px 15px 5px; + border-top: 1px solid #ddd; + -webkit-border-radius: 0 0 6px 6px; + -moz-border-radius: 0 0 6px 6px; + border-radius: 0 0 6px 6px; + -webkit-box-shadow: inset 0 1px 0 #ffffff; + -moz-box-shadow: inset 0 1px 0 #ffffff; + box-shadow: inset 0 1px 0 #ffffff; + zoom: 1; + margin-bottom: 0; + +} +.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; } +.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } + +.ui-dialog-buttonpane .ui-dialog-buttonset .ui-button{ + color: #ffffff; + background-color: #0064cd; + background-repeat: repeat-x; + background-image: -khtml-gradient(linear, left top, left bottom, from(#049cdb), to(#0064cd)); + background-image: -moz-linear-gradient(top, #049cdb, #0064cd); + background-image: -ms-linear-gradient(top, #049cdb, #0064cd); + background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0%, #049cdb), color-stop(100%, #0064cd)); + background-image: -webkit-linear-gradient(top, #049cdb, #0064cd); + background-image: -o-linear-gradient(top, #049cdb, #0064cd); + background-image: linear-gradient(top, #049cdb, #0064cd); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#049cdb', endColorstr='#0064cd', GradientType=0); + text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25); + border-color: #0064cd #0064cd #003f81; + border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); +} +/* + * jQuery UI Slider 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider#theming + */ +.ui-slider { position: relative; text-align: left; } +.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } +.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; + + color: #ffffff; + background-color: #0064cd; + background-repeat: repeat-x; + background-image: -khtml-gradient(linear, left top, left bottom, from(#049cdb), to(#0064cd)); + background-image: -moz-linear-gradient(top, #049cdb, #0064cd); + background-image: -ms-linear-gradient(top, #049cdb, #0064cd); + background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0%, #049cdb), color-stop(100%, #0064cd)); + background-image: -webkit-linear-gradient(top, #049cdb, #0064cd); + background-image: -o-linear-gradient(top, #049cdb, #0064cd); + background-image: linear-gradient(top, #049cdb, #0064cd); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#049cdb', endColorstr='#0064cd', GradientType=0); + text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25); + border-color: #0064cd #0064cd #003f81; + border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); + +} + +.ui-slider-horizontal { height: .8em; } +.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } +.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } +.ui-slider-horizontal .ui-slider-range-min { left: 0; } +.ui-slider-horizontal .ui-slider-range-max { right: 0; } + +.ui-slider-vertical { width: .8em; height: 100px; } +.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } +.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } +.ui-slider-vertical .ui-slider-range-min { bottom: 0; } +.ui-slider-vertical .ui-slider-range-max { top: 0; }/* + * jQuery UI Tabs 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs#theming + */ + .ui-tabs .ui-tabs-nav{ background:none; border-color: #ddd; + border-style: solid; + border-width: 0 0 1px;} +.ui-tabs { position: relative; padding: .2em; zoom: 1; border:0px;} /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ + + +.ui-tabs .ui-tabs-nav li:hover, .ui-tabs .ui-tabs-nav li a:hover{ + background:whiteSmoke; + border-bottom:1px solid #ddd; + padding-bottom:0px; + color:#00438A; +} + + +.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; border-bottom:1px solid #DDD; } +.ui-tabs .ui-tabs-nav li { text-decoration: none; list-style: none; float: left; position: relative; top: 1px; padding: 0px 0px 1px 0px; white-space: nowrap; background:none; border:0px; + +} + +.ui-tabs-nav .ui-state-default{ + -webkit-box-shadow: 0px 0px 0px #ffffff; /* Saf3-4, iOS 4.0.2 - 4.2, Android 2.3+ */ + -moz-box-shadow: 0px 0px 0px #ffffff; /* FF3.5 - 3.6 */ + box-shadow: 0px 0px 0px #ffffff; /* Opera 10.5, IE9, FF4+, Chrome 6+, iOS 5 */ +} +.ui-tabs .ui-tabs-nav li a { + + float: left; + text-decoration: none; + cursor: text; + padding: 0 15px; + margin-right: 2px; + line-height: 34px; + border: 1px solid transparent; + -webkit-border-radius: 4px 4px 0 0; + -moz-border-radius: 4px 4px 0 0; + border-radius: 4px 4px 0 0; + + + } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 0px; outline:none;} + +.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { + + background-color: #ffffff; + border: 1px solid #ddd; + border-bottom-color: #ffffff; + cursor: default; + color:gray; + outline:none; +} + + +.ui-tabs .ui-tabs-nav li.ui-tabs-selected:hover{ + background:#ffffff; + outline:none; +} + +.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; color:#0069D6; background:none; font-weight:normal; margin-bottom:-1px;} +/* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ +.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; } +.ui-tabs-panel .ui-button{text-decoration:none;} +.ui-tabs .ui-tabs-hide { display: none !important; } + + +/* IE fix for background inheritance from ui-widget*/ +.ui-tabs .ui-tabs-nav li{ + filter:none; +} + + + +/* + * jQuery UI Datepicker 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Datepicker#theming + */ +.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; } +.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; border:0px; font-weight: bold; width: 100%; padding: 4px 0; background-color: #f5f5f5; color: #808080; } +.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } + +.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { /*top: 1px;*/ } +.ui-datepicker .ui-datepicker-prev { left:2px; } +.ui-datepicker .ui-datepicker-next { right:2px; } + +.ui-datepicker .ui-datepicker-prev-hover { /*left:1px;*/ } +.ui-datepicker .ui-datepicker-next-hover { /*right:1px;*/ } + +.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } +.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } +.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; } +.ui-datepicker select.ui-datepicker-month-year {width: 100%;} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { width: 49%;} +.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } +.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } +.ui-datepicker td { border: 0; padding: 1px; } +.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } +.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } +.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { width:auto; } +.ui-datepicker-multi .ui-datepicker-group { float:left; } +.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } +.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } +.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } +.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } +.ui-datepicker-row-break { clear:both; width:100%; font-size:0em; } + +/* RTL support */ +.ui-datepicker-rtl { direction: rtl; } +.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } +.ui-datepicker-rtl .ui-datepicker-group { float:right; } +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } + +/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ +.ui-datepicker-cover { + display: none; /*sorry for IE5*/ + display/**/: block; /*sorry for IE5*/ + position: absolute; /*must have*/ + z-index: -1; /*must have*/ + filter: mask(); /*must have*/ + top: -4px; /*must have*/ + left: -4px; /*must have*/ + width: 200px; /*must have*/ + height: 200px; /*must have*/ +} + +.ui-datepicker th{ + font-weight: bold; + color: gray; +} + +.ui-datepicker-today a:hover{ + background-color: #808080; + color: #ffffff; + +} +.ui-datepicker-today a{ + background-color: #BFBFBF; + cursor: pointer; + padding: 0 4px; + margin-bottom:0px; + +} + + +.ui-datepicker td a{ + margin-bottom:0px; + border:0px; +} + +.ui-datepicker td:hover{ + color:white; +} + +.ui-datepicker td .ui-state-default { + border:0px; + background:none; + margin-bottom:0px; + padding:5px; + color:gray; + text-align: center; + filter:none; +} + + +.ui-datepicker td .ui-state-active{ + background:#BFBFBF; + margin-bottom:0px; + font-size:normal; + text-shadow: 0px; + color:white; + -webkit-border-radius: 4px; + -moz-border-radius: 4px; + border-radius: 4px; +} + +.ui-datepicker td .ui-state-default:hover{ + background:#0064cd; + color:white; + -webkit-border-radius: 4px; + -moz-border-radius: 4px; + border-radius: 4px; +} + + +/* + * jQuery UI Progressbar 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar#theming + */ +.ui-progressbar { height:2em; text-align: left; } +.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; + +/*this can be removed if ui-widget-header is blue*/ + color: #ffffff; + background-color: #0064cd; + background-repeat: repeat-x; + background-image: -khtml-gradient(linear, left top, left bottom, from(#049cdb), to(#0064cd)); + background-image: -moz-linear-gradient(top, #049cdb, #0064cd); + background-image: -ms-linear-gradient(top, #049cdb, #0064cd); + background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0%, #049cdb), color-stop(100%, #0064cd)); + background-image: -webkit-linear-gradient(top, #049cdb, #0064cd); + background-image: -o-linear-gradient(top, #049cdb, #0064cd); + background-image: linear-gradient(top, #049cdb, #0064cd); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#049cdb', endColorstr='#0064cd', GradientType=0); + text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25); + border-color: #0064cd #0064cd #003f81; + border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); + } + + + +/*** Input field styling from Bootstrap **/ + input, textarea { + -webkit-transition: border linear 0.2s, box-shadow linear 0.2s; + -moz-transition: border linear 0.2s, box-shadow linear 0.2s; + -ms-transition: border linear 0.2s, box-shadow linear 0.2s; + -o-transition: border linear 0.2s, box-shadow linear 0.2s; + transition: border linear 0.2s, box-shadow linear 0.2s; + -webkit-box-shadow: inset 0 1px 3px rgba(0, 0, 0, 0.1); + -moz-box-shadow: inset 0 1px 3px rgba(0, 0, 0, 0.1); + box-shadow: inset 0 1px 3px rgba(0, 0, 0, 0.1); +} +input:focus, textarea:focus { + outline: 0; + border-color: rgba(82, 168, 236, 0.8); + -webkit-box-shadow: inset 0 1px 3px rgba(0, 0, 0, 0.1), 0 0 8px rgba(82, 168, 236, 0.6); + -moz-box-shadow: inset 0 1px 3px rgba(0, 0, 0, 0.1), 0 0 8px rgba(82, 168, 236, 0.6); + box-shadow: inset 0 1px 3px rgba(0, 0, 0, 0.1), 0 0 8px rgba(82, 168, 236, 0.6); +} +input[type=file]:focus, input[type=checkbox]:focus, select:focus { + -webkit-box-shadow: none; + -moz-box-shadow: none; + box-shadow: none; + outline: 1px dotted #666; +} + +input[type="text"], +input[type="password"], +.ui-autocomplete-input, +textarea, +.uneditable-input { + display: inline-block; + padding: 4px; + font-size: 13px; + line-height: 18px; + color: #808080; + border: 1px solid #ccc; + -webkit-border-radius: 3px; + -moz-border-radius: 3px; + border-radius: 3px; +} + + + +/**Toolbar**/ + +.ui-toolbar{ + padding: 7px 14px; + margin: 0 0 18px; + background-color: #f5f5f5; + background-repeat: repeat-x; + background-image: -khtml-gradient(linear, left top, left bottom, from(#ffffff), to(#f5f5f5)); + background-image: -moz-linear-gradient(top, #ffffff, #f5f5f5); + background-image: -ms-linear-gradient(top, #ffffff, #f5f5f5); + background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0%, #ffffff), color-stop(100%, #f5f5f5)); + background-image: -webkit-linear-gradient(top, #ffffff, #f5f5f5); + background-image: -o-linear-gradient(top, #ffffff, #f5f5f5); + background-image: linear-gradient(top, #ffffff, #f5f5f5); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#f5f5f5', GradientType=0); + border: 1px solid #ddd; + -webkit-border-radius: 3px; + -moz-border-radius: 3px; + border-radius: 3px; + -webkit-box-shadow: inset 0 1px 0 #ffffff; + -moz-box-shadow: inset 0 1px 0 #ffffff; + box-shadow: inset 0 1px 0 #ffffff; +} + + +/***Dialog fixes**/ + +.ui-dialog-buttonset .ui-button:nth-child(2){ + cursor: pointer; + display: inline-block; + background-color: #e6e6e6; + background-repeat: no-repeat; + background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#ffffff), color-stop(25%, #ffffff), to(#e6e6e6)); + background-image: -webkit-linear-gradient(#ffffff, #ffffff 25%, #e6e6e6); + background-image: -moz-linear-gradient(top, #ffffff, #ffffff 25%, #e6e6e6); + background-image: -ms-linear-gradient(#ffffff, #ffffff 25%, #e6e6e6); + background-image: -o-linear-gradient(#ffffff, #ffffff 25%, #e6e6e6); + background-image: linear-gradient(#ffffff, #ffffff 25%, #e6e6e6); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#e6e6e6', GradientType=0); + padding: 5px 14px 6px; + text-shadow: 0 1px 1px rgba(255, 255, 255, 0.75); + color: #333; + font-size: 13px; + line-height: normal; + border: 1px solid #ccc; + border-bottom-color: #bbb; + -webkit-border-radius: 4px; + -moz-border-radius: 4px; + border-radius: 4px; + -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05); + -moz-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05); + box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05); + -webkit-transition: 0.1s linear all; + -moz-transition: 0.1s linear all; + -ms-transition: 0.1s linear all; + -o-transition: 0.1s linear all; + transition: 0.1s linear all; + overflow: visible; +} + + + +/***Wijmo Theming**/ + +div.wijmo-wijmenu{ + padding:0 20px; + background-color: #222; + background-color: #222222; + background-repeat: repeat-x; + background-image: -khtml-gradient(linear, left top, left bottom, from(#333333), to(#222222)); + background-image: -moz-linear-gradient(top, #333333, #222222); + background-image: -ms-linear-gradient(top, #333333, #222222); + background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0%, #333333), color-stop(100%, #222222)); + background-image: -webkit-linear-gradient(top, #333333, #222222); + background-image: -o-linear-gradient(top, #333333, #222222); + background-image: linear-gradient(top, #333333, #222222); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#333333', endColorstr='#222222', GradientType=0); + -webkit-box-shadow: 0 1px 3px rgba(0, 0, 0, 0.25), inset 0 -1px 0 rgba(0, 0, 0, 0.1); + -moz-box-shadow: 0 1px 3px rgba(0, 0, 0, 0.25), inset 0 -1px 0 rgba(0, 0, 0, 0.1); + box-shadow: 0 1px 3px rgba(0, 0, 0, 0.25), inset 0 -1px 0 rgba(0, 0, 0, 0.1); +} + +.wijmo-wijmenu .ui-state-default{ + box-shadow: none; + color:#BFBFBF; +} + +.wijmo-wijmenu .ui-state-default .wijmo-wijmenu-text{ + color:#BFBFBF; +} + +.wijmo-wijmenu .ui-state-hover{ + background: #444; + background: rgba(255, 255, 255, 0.05); +} + +.wijmo-wijmenu .ui-state-hover .wijmo-wijmenu-text{ + color:#ffffff; +} + +div.wijmo-wijmenu .ui-widget-header h3{ + position: relative; + margin-top:1px; + padding:0; +} + +.wijmo-wijmenu h3 a{ + color: #FFFFFF; + display: block; + float: left; + font-size: 20px; + font-weight: 200; + line-height: 1; + margin-left: -20px; + margin-top:1px; + padding: 8px 20px 12px; +} + +.wijmo-wijmenu h3 a:hover{ + background-color: rgba(255, 255, 255, 0.05); + color: #FFFFFF; + text-decoration: none; +} + +.wijmo-wijmenu .ui-widget-header{ + border:0px; +} + +.wijmo-wijmenu .wijmo-wijmenu-parent .wijmo-wijmenu-child{ + padding: 0.3em 0; +} + +div.wijmo-wijmenu .wijmo-wijmenu-item .wijmo-wijmenu-child{ + background: #333; + border:0; + margin:0; + padding: 6px 0; + width:160px; + -webkit-border-radius: 0 0 6px 6px; + -moz-border-radius: 0 0 6px 6px; + border-radius: 0 0 6px 6px; + -webkit-box-shadow: 0 2px 4px rgba(0, 0, 0, 0.2); + -moz-box-shadow: 0 2px 4px rgba(0, 0, 0, 0.2); + box-shadow: 0 2px 4px rgba(0, 0, 0, 0.2); +} + +div.wijmo-wijmenu .wijmo-wijmenu-item{ + margin:0; + border:0; +} + +.wijmo-wijmenu a.wijmo-wijmenu-link{ + margin:0; + line-height: 19px; + padding: 10px 10px 11px; + border:0; + -webkit-border-radius: 0; + -moz-border-radius: 0; + border-radius:0; +} + +div.wijmo-wijmenu .wijmo-wijmenu-child .wijmo-wijmenu-link{ + display:block; + float:none; + padding: 4px 15px; + width:auto; +} + +div.wijmo-wijmenu .wijmo-wijmenu-child .wijmo-wijmenu-text +{ + float:none; +} + +.wijmo-wijmenu .wijmo-wijmenu-item .wijmo-wijmenu-child .ui-state-hover { + background: #191919; +} + +.wijmo-wijmenu .wijmo-wijmenu-item .wijmo-wijmenu-separator{ + padding: 5px 0; + background-image: none; + background-color: #222; + border-top: 1px solid #444; + border-bottom:0; + border-left:0; + border-right:0; +} + +.wijmo-wijmenu .wijmo-wijmenu-item input { + -moz-transition: none 0s ease 0s; + background-color: rgba(255, 255, 255, 0.3); + border: 1px solid #111111; + border-radius: 4px 4px 4px 4px; + box-shadow: 0 1px 2px rgba(0, 0, 0, 0.1) inset, 0 1px 0 rgba(255, 255, 255, 0.25); + color: rgba(255, 255, 255, 0.75); + font-family: "Helvetica Neue",Helvetica,Arial,sans-serif; + line-height: 1; + margin: 5px 10px 0 10px; + padding: 4px 9px; + width:100px; +} + +.wijmo-wijmenu .wijmo-wijmenu-item input:hover { + background-color: rgba(255, 255, 255, 0.5); + color: #FFFFFF; +} + +.wijmo-wijmenu .wijmo-wijmenu-item input:focus { + background-color: #FFFFFF; + border: 0 none; + box-shadow: 0 0 3px rgba(0, 0, 0, 0.15); + color: #404040; + outline: 0 none; + padding: 5px 10px; + text-shadow: 0 1px 0 #FFFFFF; +} + + +.wijmo-wijmenu .ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { + text-shadow:none; +} + + +.wijmo-wijmenu .ui-state-default{ + box-shadow: none; + color:#BFBFBF; + filter: none; +} + diff --git a/jqui/jquery.ui.1.8.16.ie.css b/Wordpress/jqui/jquery.ui.1.8.16.ie.css similarity index 98% rename from jqui/jquery.ui.1.8.16.ie.css rename to Wordpress/jqui/jquery.ui.1.8.16.ie.css index b24b9fb..9a8e4c7 100644 --- a/jqui/jquery.ui.1.8.16.ie.css +++ b/Wordpress/jqui/jquery.ui.1.8.16.ie.css @@ -1,6 +1,6 @@ - -.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-left, .ui-corner-bottom{ border-radius:0px;} -.ui-state-active,.ui-tabs-selected { border-radius:0px;} -.ui-tabs-selected { border-radius:0px;} -.ui-tabs .ui-tabs-nav li{ filter:none;} -.ui-tabs .ui-tabs-nav li a { border-radius:0px; } + +.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-left, .ui-corner-bottom{ border-radius:0px;} +.ui-state-active,.ui-tabs-selected { border-radius:0px;} +.ui-tabs-selected { border-radius:0px;} +.ui-tabs .ui-tabs-nav li{ filter:none;} +.ui-tabs .ui-tabs-nav li a { border-radius:0px; } diff --git a/js/html5.js b/Wordpress/js/html5.js similarity index 98% rename from js/html5.js rename to Wordpress/js/html5.js index 6dd03a4..23a0297 100644 --- a/js/html5.js +++ b/Wordpress/js/html5.js @@ -1,3 +1,3 @@ -// html5shiv MIT @rem remysharp.com/html5-enabling-script -// iepp v1.6.2 MIT @jon_neal iecss.com/print-protector +// html5shiv MIT @rem remysharp.com/html5-enabling-script +// iepp v1.6.2 MIT @jon_neal iecss.com/print-protector /*@cc_on(function(a,b){function r(a){var b=-1;while(++b";return a.childNodes.length!==1}())){a.iepp=a.iepp||{};var c=a.iepp,d=c.html5elements||"abbr|article|aside|audio|canvas|datalist|details|figcaption|figure|footer|header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",e=d.split("|"),f=e.length,g=new RegExp("(^|\\s)("+d+")","gi"),h=new RegExp("<(/*)("+d+")","gi"),i=/^\s*[\{\}]\s*$/,j=new RegExp("(^|[^\\n]*?\\s)("+d+")([^\\n]*)({[\\n\\w\\W]*?})","gi"),k=b.createDocumentFragment(),l=b.documentElement,m=l.firstChild,n=b.createElement("body"),o=b.createElement("style"),p=/print|all/,q;c.getCSS=function(a,b){if(a+""===undefined)return"";var d=-1,e=a.length,f,g=[];while(++d").appendTo(b),e=d.css("display");d.remove();if(e==="none"||e===""){ch||(ch=c.createElement("iframe"),ch.frameBorder=ch.width=ch.height=0),b.appendChild(ch);if(!ci||!ch.createElement)ci=(ch.contentWindow||ch.contentDocument).document,ci.write((c.compatMode==="CSS1Compat"?"":"")+""),ci.close();d=ci.createElement(a),ci.body.appendChild(d),e=f.css(d,"display"),b.removeChild(ch)}cg[a]=e}return cg[a]}function cr(a,b){var c={};f.each(cm.concat.apply([],cm.slice(0,b)),function(){c[this]=a});return c}function cq(){cn=b}function cp(){setTimeout(cq,0);return cn=f.now()}function cf(){try{return new a.ActiveXObject("Microsoft.XMLHTTP")}catch(b){}}function ce(){try{return new a.XMLHttpRequest}catch(b){}}function b$(a,c){a.dataFilter&&(c=a.dataFilter(c,a.dataType));var d=a.dataTypes,e={},g,h,i=d.length,j,k=d[0],l,m,n,o,p;for(g=1;g0){c!=="border"&&f.each(e,function(){c||(d-=parseFloat(f.css(a,"padding"+this))||0),c==="margin"?d+=parseFloat(f.css(a,c+this))||0:d-=parseFloat(f.css(a,"border"+this+"Width"))||0});return d+"px"}d=bx(a,b,b);if(d<0||d==null)d=a.style[b]||0;d=parseFloat(d)||0,c&&f.each(e,function(){d+=parseFloat(f.css(a,"padding"+this))||0,c!=="padding"&&(d+=parseFloat(f.css(a,"border"+this+"Width"))||0),c==="margin"&&(d+=parseFloat(f.css(a,c+this))||0)});return d+"px"}function bm(a,b){b.src?f.ajax({url:b.src,async:!1,dataType:"script"}):f.globalEval((b.text||b.textContent||b.innerHTML||"").replace(be,"/*$0*/")),b.parentNode&&b.parentNode.removeChild(b)}function bl(a){f.nodeName(a,"input")?bk(a):"getElementsByTagName"in a&&f.grep(a.getElementsByTagName("input"),bk)}function bk(a){if(a.type==="checkbox"||a.type==="radio")a.defaultChecked=a.checked}function bj(a){return"getElementsByTagName"in a?a.getElementsByTagName("*"):"querySelectorAll"in a?a.querySelectorAll("*"):[]}function bi(a,b){var c;if(b.nodeType===1){b.clearAttributes&&b.clearAttributes(),b.mergeAttributes&&b.mergeAttributes(a),c=b.nodeName.toLowerCase();if(c==="object")b.outerHTML=a.outerHTML;else if(c!=="input"||a.type!=="checkbox"&&a.type!=="radio"){if(c==="option")b.selected=a.defaultSelected;else if(c==="input"||c==="textarea")b.defaultValue=a.defaultValue}else a.checked&&(b.defaultChecked=b.checked=a.checked),b.value!==a.value&&(b.value=a.value);b.removeAttribute(f.expando)}}function bh(a,b){if(b.nodeType===1&&!!f.hasData(a)){var c=f.expando,d=f.data(a),e=f.data(b,d);if(d=d[c]){var g=d.events;e=e[c]=f.extend({},d);if(g){delete e.handle,e.events={};for(var h in g)for(var i=0,j=g[h].length;i=0===c})}function V(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function N(a,b){return(a&&a!=="*"?a+".":"")+b.replace(z,"`").replace(A,"&")}function M(a){var b,c,d,e,g,h,i,j,k,l,m,n,o,p=[],q=[],r=f._data(this,"events");if(!(a.liveFired===this||!r||!r.live||a.target.disabled||a.button&&a.type==="click")){a.namespace&&(n=new RegExp("(^|\\.)"+a.namespace.split(".").join("\\.(?:.*\\.)?")+"(\\.|$)")),a.liveFired=this;var s=r.live.slice(0);for(i=0;ic)break;a.currentTarget=e.elem,a.data=e.handleObj.data,a.handleObj=e.handleObj,o=e.handleObj.origHandler.apply(e.elem,arguments);if(o===!1||a.isPropagationStopped()){c=e.level,o===!1&&(b=!1);if(a.isImmediatePropagationStopped())break}}return b}}function K(a,c,d){var e=f.extend({},d[0]);e.type=a,e.originalEvent={},e.liveFired=b,f.event.handle.call(c,e),e.isDefaultPrevented()&&d[0].preventDefault()}function E(){return!0}function D(){return!1}function m(a,c,d){var e=c+"defer",g=c+"queue",h=c+"mark",i=f.data(a,e,b,!0);i&&(d==="queue"||!f.data(a,g,b,!0))&&(d==="mark"||!f.data(a,h,b,!0))&&setTimeout(function(){!f.data(a,g,b,!0)&&!f.data(a,h,b,!0)&&(f.removeData(a,e,!0),i.resolve())},0)}function l(a){for(var b in a)if(b!=="toJSON")return!1;return!0}function k(a,c,d){if(d===b&&a.nodeType===1){var e="data-"+c.replace(j,"$1-$2").toLowerCase();d=a.getAttribute(e);if(typeof d=="string"){try{d=d==="true"?!0:d==="false"?!1:d==="null"?null:f.isNaN(d)?i.test(d)?f.parseJSON(d):d:parseFloat(d)}catch(g){}f.data(a,c,d)}else d=b}return d}var c=a.document,d=a.navigator,e=a.location,f=function(){function J(){if(!e.isReady){try{c.documentElement.doScroll("left")}catch(a){setTimeout(J,1);return}e.ready()}}var e=function(a,b){return new e.fn.init(a,b,h)},f=a.jQuery,g=a.$,h,i=/^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,j=/\S/,k=/^\s+/,l=/\s+$/,m=/\d/,n=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,o=/^[\],:{}\s]*$/,p=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,q=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,r=/(?:^|:|,)(?:\s*\[)+/g,s=/(webkit)[ \/]([\w.]+)/,t=/(opera)(?:.*version)?[ \/]([\w.]+)/,u=/(msie) ([\w.]+)/,v=/(mozilla)(?:.*? rv:([\w.]+))?/,w=/-([a-z])/ig,x=function(a,b){return b.toUpperCase()},y=d.userAgent,z,A,B,C=Object.prototype.toString,D=Object.prototype.hasOwnProperty,E=Array.prototype.push,F=Array.prototype.slice,G=String.prototype.trim,H=Array.prototype.indexOf,I={};e.fn=e.prototype={constructor:e,init:function(a,d,f){var g,h,j,k;if(!a)return this;if(a.nodeType){this.context=this[0]=a,this.length=1;return this}if(a==="body"&&!d&&c.body){this.context=c,this[0]=c.body,this.selector=a,this.length=1;return this}if(typeof a=="string"){a.charAt(0)!=="<"||a.charAt(a.length-1)!==">"||a.length<3?g=i.exec(a):g=[null,a,null];if(g&&(g[1]||!d)){if(g[1]){d=d instanceof e?d[0]:d,k=d?d.ownerDocument||d:c,j=n.exec(a),j?e.isPlainObject(d)?(a=[c.createElement(j[1])],e.fn.attr.call(a,d,!0)):a=[k.createElement(j[1])]:(j=e.buildFragment([g[1]],[k]),a=(j.cacheable?e.clone(j.fragment):j.fragment).childNodes);return e.merge(this,a)}h=c.getElementById(g[2]);if(h&&h.parentNode){if(h.id!==g[2])return f.find(a);this.length=1,this[0]=h}this.context=c,this.selector=a;return this}return!d||d.jquery?(d||f).find(a):this.constructor(d).find(a)}if(e.isFunction(a))return f.ready(a);a.selector!==b&&(this.selector=a.selector,this.context=a.context);return e.makeArray(a,this)},selector:"",jquery:"1.6.2",length:0,size:function(){return this.length},toArray:function(){return F.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this[this.length+a]:this[a]},pushStack:function(a,b,c){var d=this.constructor();e.isArray(a)?E.apply(d,a):e.merge(d,a),d.prevObject=this,d.context=this.context,b==="find"?d.selector=this.selector+(this.selector?" ":"")+c:b&&(d.selector=this.selector+"."+b+"("+c+")");return d},each:function(a,b){return e.each(this,a,b)},ready:function(a){e.bindReady(),A.done(a);return this},eq:function(a){return a===-1?this.slice(a):this.slice(a,+a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(F.apply(this,arguments),"slice",F.call(arguments).join(","))},map:function(a){return this.pushStack(e.map(this,function(b,c){return a.call(b,c,b)}))},end:function(){return this.prevObject||this.constructor(null)},push:E,sort:[].sort,splice:[].splice},e.fn.init.prototype=e.fn,e.extend=e.fn.extend=function(){var a,c,d,f,g,h,i=arguments[0]||{},j=1,k=arguments.length,l=!1;typeof i=="boolean"&&(l=i,i=arguments[1]||{},j=2),typeof i!="object"&&!e.isFunction(i)&&(i={}),k===j&&(i=this,--j);for(;j0)return;A.resolveWith(c,[e]),e.fn.trigger&&e(c).trigger("ready").unbind("ready")}},bindReady:function(){if(!A){A=e._Deferred();if(c.readyState==="complete")return setTimeout(e.ready,1);if(c.addEventListener)c.addEventListener("DOMContentLoaded",B,!1),a.addEventListener("load",e.ready,!1);else if(c.attachEvent){c.attachEvent("onreadystatechange",B),a.attachEvent("onload",e.ready);var b=!1;try{b=a.frameElement==null}catch(d){}c.documentElement.doScroll&&b&&J()}}},isFunction:function(a){return e.type(a)==="function"},isArray:Array.isArray||function(a){return e.type(a)==="array"},isWindow:function(a){return a&&typeof a=="object"&&"setInterval"in a},isNaN:function(a){return a==null||!m.test(a)||isNaN(a)},type:function(a){return a==null?String(a):I[C.call(a)]||"object"},isPlainObject:function(a){if(!a||e.type(a)!=="object"||a.nodeType||e.isWindow(a))return!1;if(a.constructor&&!D.call(a,"constructor")&&!D.call(a.constructor.prototype,"isPrototypeOf"))return!1;var c;for(c in a);return c===b||D.call(a,c)},isEmptyObject:function(a){for(var b in a)return!1;return!0},error:function(a){throw a},parseJSON:function(b){if(typeof b!="string"||!b)return null;b=e.trim(b);if(a.JSON&&a.JSON.parse)return a.JSON.parse(b);if(o.test(b.replace(p,"@").replace(q,"]").replace(r,"")))return(new Function("return "+b))();e.error("Invalid JSON: "+b)},parseXML:function(b,c,d){a.DOMParser?(d=new DOMParser,c=d.parseFromString(b,"text/xml")):(c=new ActiveXObject("Microsoft.XMLDOM"),c.async="false",c.loadXML(b)),d=c.documentElement,(!d||!d.nodeName||d.nodeName==="parsererror")&&e.error("Invalid XML: "+b);return c},noop:function(){},globalEval:function(b){b&&j.test(b)&&(a.execScript||function(b){a.eval.call(a,b)})(b)},camelCase:function(a){return a.replace(w,x)},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,c,d){var f,g=0,h=a.length,i=h===b||e.isFunction(a);if(d){if(i){for(f in a)if(c.apply(a[f],d)===!1)break}else for(;g0&&a[0]&&a[j-1]||j===0||e.isArray(a));if(k)for(;i1?h.call(arguments,0):c,--e||g.resolveWith(g,h.call(b,0))}}var b=arguments,c=0,d=b.length,e=d,g=d<=1&&a&&f.isFunction(a.promise)?a:f.Deferred();if(d>1){for(;c
    a",d=a.getElementsByTagName("*"),e=a.getElementsByTagName("a")[0];if(!d||!d.length||!e)return{};g=c.createElement("select"),h=g.appendChild(c.createElement("option")),i=a.getElementsByTagName("input")[0],k={leadingWhitespace:a.firstChild.nodeType===3,tbody:!a.getElementsByTagName("tbody").length,htmlSerialize:!!a.getElementsByTagName("link").length,style:/top/.test(e.getAttribute("style")),hrefNormalized:e.getAttribute("href")==="/a",opacity:/^0.55$/.test(e.style.opacity),cssFloat:!!e.style.cssFloat,checkOn:i.value==="on",optSelected:h.selected,getSetAttribute:a.className!=="t",submitBubbles:!0,changeBubbles:!0,focusinBubbles:!1,deleteExpando:!0,noCloneEvent:!0,inlineBlockNeedsLayout:!1,shrinkWrapBlocks:!1,reliableMarginRight:!0},i.checked=!0,k.noCloneChecked=i.cloneNode(!0).checked,g.disabled=!0,k.optDisabled=!h.disabled;try{delete a.test}catch(v){k.deleteExpando=!1}!a.addEventListener&&a.attachEvent&&a.fireEvent&&(a.attachEvent("onclick",function(){k.noCloneEvent=!1}),a.cloneNode(!0).fireEvent("onclick")),i=c.createElement("input"),i.value="t",i.setAttribute("type","radio"),k.radioValue=i.value==="t",i.setAttribute("checked","checked"),a.appendChild(i),l=c.createDocumentFragment(),l.appendChild(a.firstChild),k.checkClone=l.cloneNode(!0).cloneNode(!0).lastChild.checked,a.innerHTML="",a.style.width=a.style.paddingLeft="1px",m=c.getElementsByTagName("body")[0],o=c.createElement(m?"div":"body"),p={visibility:"hidden",width:0,height:0,border:0,margin:0},m&&f.extend(p,{position:"absolute",left:-1e3,top:-1e3});for(t in p)o.style[t]=p[t];o.appendChild(a),n=m||b,n.insertBefore(o,n.firstChild),k.appendChecked=i.checked,k.boxModel=a.offsetWidth===2,"zoom"in a.style&&(a.style.display="inline",a.style.zoom=1,k.inlineBlockNeedsLayout=a.offsetWidth===2,a.style.display="",a.innerHTML="
    ",k.shrinkWrapBlocks=a.offsetWidth!==2),a.innerHTML="
    t
    ",q=a.getElementsByTagName("td"),u=q[0].offsetHeight===0,q[0].style.display="",q[1].style.display="none",k.reliableHiddenOffsets=u&&q[0].offsetHeight===0,a.innerHTML="",c.defaultView&&c.defaultView.getComputedStyle&&(j=c.createElement("div"),j.style.width="0",j.style.marginRight="0",a.appendChild(j),k.reliableMarginRight=(parseInt((c.defaultView.getComputedStyle(j,null)||{marginRight:0}).marginRight,10)||0)===0),o.innerHTML="",n.removeChild(o);if(a.attachEvent)for(t in{submit:1,change:1,focusin:1})s="on"+t,u=s in a,u||(a.setAttribute(s,"return;"),u=typeof a[s]=="function"),k[t+"Bubbles"]=u;o=l=g=h=m=j=a=i=null;return k}(),f.boxModel=f.support.boxModel;var i=/^(?:\{.*\}|\[.*\])$/,j=/([a-z])([A-Z])/g;f.extend({cache:{},uuid:0,expando:"jQuery"+(f.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:!0},hasData:function(a){a=a.nodeType?f.cache[a[f.expando]]:a[f.expando];return!!a&&!l(a)},data:function(a,c,d,e){if(!!f.acceptData(a)){var g=f.expando,h=typeof c=="string",i,j=a.nodeType,k=j?f.cache:a,l=j?a[f.expando]:a[f.expando]&&f.expando;if((!l||e&&l&&!k[l][g])&&h&&d===b)return;l||(j?a[f.expando]=l=++f.uuid:l=f.expando),k[l]||(k[l]={},j||(k[l].toJSON=f.noop));if(typeof c=="object"||typeof c=="function")e?k[l][g]=f.extend(k[l][g],c):k[l]=f.extend(k[l],c);i=k[l],e&&(i[g]||(i[g]={}),i=i[g]),d!==b&&(i[f.camelCase(c)]=d);if(c==="events"&&!i[c])return i[g]&&i[g].events;return h?i[f.camelCase(c)]||i[c]:i}},removeData:function(b,c,d){if(!!f.acceptData(b)){var e=f.expando,g=b.nodeType,h=g?f.cache:b,i=g?b[f.expando]:f.expando;if(!h[i])return;if(c){var j=d?h[i][e]:h[i];if(j){delete j[c];if(!l(j))return}}if(d){delete h[i][e];if(!l(h[i]))return}var k=h[i][e];f.support.deleteExpando||h!=a?delete h[i]:h[i]=null,k?(h[i]={},g||(h[i].toJSON=f.noop),h[i][e]=k):g&&(f.support.deleteExpando?delete b[f.expando]:b.removeAttribute?b.removeAttribute(f.expando):b[f.expando]=null)}},_data:function(a,b,c){return f.data(a,b,c,!0)},acceptData:function(a){if(a.nodeName){var b=f.noData[a.nodeName.toLowerCase()];if(b)return b!==!0&&a.getAttribute("classid")===b}return!0}}),f.fn.extend({data:function(a,c){var d=null;if(typeof a=="undefined"){if(this.length){d=f.data(this[0]);if(this[0].nodeType===1){var e=this[0].attributes,g;for(var h=0,i=e.length;h-1)return!0;return!1},val:function(a){var c,d,e=this[0];if(!arguments.length){if(e){c=f.valHooks[e.nodeName.toLowerCase()]||f.valHooks[e.type];if(c&&"get"in c&&(d=c.get(e,"value"))!==b)return d;d=e.value;return typeof d=="string"?d.replace(p,""):d==null?"":d}return b}var g=f.isFunction(a);return this.each(function(d){var e=f(this),h;if(this.nodeType===1){g?h=a.call(this,d,e.val()):h=a,h==null?h="":typeof h=="number"?h+="":f.isArray(h)&&(h=f.map(h,function(a){return a==null?"":a+""})),c=f.valHooks[this.nodeName.toLowerCase()]||f.valHooks[this.type];if(!c||!("set"in c)||c.set(this,h,"value")===b)this.value=h}})}}),f.extend({valHooks:{option:{get:function(a){var b=a.attributes.value;return!b||b.specified?a.value:a.text}},select:{get:function(a){var b,c=a.selectedIndex,d=[],e=a.options,g=a.type==="select-one";if(c<0)return null;for(var h=g?c:0,i=g?c+1:e.length;h=0}),c.length||(a.selectedIndex=-1);return c}}},attrFn:{val:!0,css:!0,html:!0,text:!0,data:!0,width:!0,height:!0,offset:!0},attrFix:{tabindex:"tabIndex"},attr:function(a,c,d,e){var g=a.nodeType;if(!a||g===3||g===8||g===2)return b;if(e&&c in f.attrFn)return f(a)[c](d);if(!("getAttribute"in a))return f.prop(a,c,d);var h,i,j=g!==1||!f.isXMLDoc(a);j&&(c=f.attrFix[c]||c,i=f.attrHooks[c],i||(t.test(c)?i=w:v&&c!=="className"&&(f.nodeName(a,"form")||u.test(c))&&(i=v)));if(d!==b){if(d===null){f.removeAttr(a,c);return b}if(i&&"set"in i&&j&&(h=i.set(a,d,c))!==b)return h;a.setAttribute(c,""+d);return d}if(i&&"get"in i&&j&&(h=i.get(a,c))!==null)return h;h=a.getAttribute(c);return h===null?b:h},removeAttr:function(a,b){var c;a.nodeType===1&&(b=f.attrFix[b]||b,f.support.getSetAttribute?a.removeAttribute(b):(f.attr(a,b,""),a.removeAttributeNode(a.getAttributeNode(b))),t.test(b)&&(c=f.propFix[b]||b)in a&&(a[c]=!1))},attrHooks:{type:{set:function(a,b){if(q.test(a.nodeName)&&a.parentNode)f.error("type property can't be changed");else if(!f.support.radioValue&&b==="radio"&&f.nodeName(a,"input")){var c=a.value;a.setAttribute("type",b),c&&(a.value=c);return b}}},tabIndex:{get:function(a){var c=a.getAttributeNode("tabIndex");return c&&c.specified?parseInt(c.value,10):r.test(a.nodeName)||s.test(a.nodeName)&&a.href?0:b}},value:{get:function(a,b){if(v&&f.nodeName(a,"button"))return v.get(a,b);return b in a?a.value:null},set:function(a,b,c){if(v&&f.nodeName(a,"button"))return v.set(a,b,c);a.value=b}}},propFix:{tabindex:"tabIndex",readonly:"readOnly","for":"htmlFor","class":"className",maxlength:"maxLength",cellspacing:"cellSpacing",cellpadding:"cellPadding",rowspan:"rowSpan",colspan:"colSpan",usemap:"useMap",frameborder:"frameBorder",contenteditable:"contentEditable"},prop:function(a,c,d){var e=a.nodeType;if(!a||e===3||e===8||e===2)return b;var g,h,i=e!==1||!f.isXMLDoc(a);i&&(c=f.propFix[c]||c,h=f.propHooks[c]);return d!==b?h&&"set"in h&&(g=h.set(a,d,c))!==b?g:a[c]=d:h&&"get"in h&&(g=h.get(a,c))!==b?g:a[c]},propHooks:{}}),w={get:function(a,c){return f.prop(a,c)?c.toLowerCase():b},set:function(a,b,c){var d;b===!1?f.removeAttr(a,c):(d=f.propFix[c]||c,d in a&&(a[d]=!0),a.setAttribute(c,c.toLowerCase()));return c}},f.support.getSetAttribute||(f.attrFix=f.propFix,v=f.attrHooks.name=f.attrHooks.title=f.valHooks.button={get:function(a,c){var d;d=a.getAttributeNode(c);return d&&d.nodeValue!==""?d.nodeValue:b},set:function(a,b,c){var d=a.getAttributeNode(c);if(d){d.nodeValue=b;return b}}},f.each(["width","height"],function(a,b){f.attrHooks[b]=f.extend(f.attrHooks[b],{set:function(a,c){if(c===""){a.setAttribute(b,"auto");return c}}})})),f.support.hrefNormalized||f.each(["href","src","width","height"],function(a,c){f.attrHooks[c]=f.extend(f.attrHooks[c],{get:function(a){var d=a.getAttribute(c,2);return d===null?b:d}})}),f.support.style||(f.attrHooks.style={get:function(a){return a.style.cssText.toLowerCase()||b},set:function(a,b){return a.style.cssText=""+b}}),f.support.optSelected||(f.propHooks.selected=f.extend(f.propHooks.selected,{get:function(a){var b=a.parentNode;b&&(b.selectedIndex,b.parentNode&&b.parentNode.selectedIndex)}})),f.support.checkOn||f.each(["radio","checkbox"],function(){f.valHooks[this]={get:function(a){return a.getAttribute("value")===null?"on":a.value}}}),f.each(["radio","checkbox"],function(){f.valHooks[this]=f.extend(f.valHooks[this],{set:function(a,b){if(f.isArray(b))return a.checked=f.inArray(f(a).val(),b)>=0}})});var x=/\.(.*)$/,y=/^(?:textarea|input|select)$/i,z=/\./g,A=/ /g,B=/[^\w\s.|`]/g,C=function(a){return a.replace(B,"\\$&")};f.event={add:function(a,c,d,e){if(a.nodeType!==3&&a.nodeType!==8){if(d===!1)d=D;else if(!d)return;var g,h;d.handler&&(g=d,d=g.handler),d.guid||(d.guid=f.guid++);var i=f._data(a);if(!i)return;var j=i.events,k=i.handle;j||(i.events=j={}),k||(i.handle=k=function(a){return typeof f!="undefined"&&(!a||f.event.triggered!==a.type)?f.event.handle.apply(k.elem,arguments):b}),k.elem=a,c=c.split(" ");var l,m=0,n;while(l=c[m++]){h=g?f.extend({},g):{handler:d,data:e},l.indexOf(".")>-1?(n=l.split("."),l=n.shift(),h.namespace=n.slice(0).sort().join(".")):(n=[],h.namespace=""),h.type=l,h.guid||(h.guid=d.guid);var o=j[l],p=f.event.special[l]||{};if(!o){o=j[l]=[];if(!p.setup||p.setup.call(a,e,n,k)===!1)a.addEventListener?a.addEventListener(l,k,!1):a.attachEvent&&a.attachEvent("on"+l,k)}p.add&&(p.add.call(a,h),h.handler.guid||(h.handler.guid=d.guid)),o.push(h),f.event.global[l]=!0}a=null}},global:{},remove:function(a,c,d,e){if(a.nodeType!==3&&a.nodeType!==8){d===!1&&(d=D);var g,h,i,j,k=0,l,m,n,o,p,q,r,s=f.hasData(a)&&f._data(a),t=s&&s.events;if(!s||!t)return;c&&c.type&&(d=c.handler,c=c.type);if(!c||typeof c=="string"&&c.charAt(0)==="."){c=c||"";for(h in t)f.event.remove(a,h+c);return}c=c.split(" ");while(h=c[k++]){r=h,q=null,l=h.indexOf(".")<0,m=[],l||(m=h.split("."),h=m.shift(),n=new RegExp("(^|\\.)"+f.map(m.slice(0).sort(),C).join("\\.(?:.*\\.)?")+"(\\.|$)")),p=t[h];if(!p)continue;if(!d){for(j=0;j=0&&(h=h.slice(0,-1),j=!0),h.indexOf(".")>=0&&(i=h.split("."),h=i. -shift(),i.sort());if(!!e&&!f.event.customEvent[h]||!!f.event.global[h]){c=typeof c=="object"?c[f.expando]?c:new f.Event(h,c):new f.Event(h),c.type=h,c.exclusive=j,c.namespace=i.join("."),c.namespace_re=new RegExp("(^|\\.)"+i.join("\\.(?:.*\\.)?")+"(\\.|$)");if(g||!e)c.preventDefault(),c.stopPropagation();if(!e){f.each(f.cache,function(){var a=f.expando,b=this[a];b&&b.events&&b.events[h]&&f.event.trigger(c,d,b.handle.elem)});return}if(e.nodeType===3||e.nodeType===8)return;c.result=b,c.target=e,d=d!=null?f.makeArray(d):[],d.unshift(c);var k=e,l=h.indexOf(":")<0?"on"+h:"";do{var m=f._data(k,"handle");c.currentTarget=k,m&&m.apply(k,d),l&&f.acceptData(k)&&k[l]&&k[l].apply(k,d)===!1&&(c.result=!1,c.preventDefault()),k=k.parentNode||k.ownerDocument||k===c.target.ownerDocument&&a}while(k&&!c.isPropagationStopped());if(!c.isDefaultPrevented()){var n,o=f.event.special[h]||{};if((!o._default||o._default.call(e.ownerDocument,c)===!1)&&(h!=="click"||!f.nodeName(e,"a"))&&f.acceptData(e)){try{l&&e[h]&&(n=e[l],n&&(e[l]=null),f.event.triggered=h,e[h]())}catch(p){}n&&(e[l]=n),f.event.triggered=b}}return c.result}},handle:function(c){c=f.event.fix(c||a.event);var d=((f._data(this,"events")||{})[c.type]||[]).slice(0),e=!c.exclusive&&!c.namespace,g=Array.prototype.slice.call(arguments,0);g[0]=c,c.currentTarget=this;for(var h=0,i=d.length;h-1?f.map(a.options,function(a){return a.selected}).join("-"):"":f.nodeName(a,"select")&&(c=a.selectedIndex);return c},J=function(c){var d=c.target,e,g;if(!!y.test(d.nodeName)&&!d.readOnly){e=f._data(d,"_change_data"),g=I(d),(c.type!=="focusout"||d.type!=="radio")&&f._data(d,"_change_data",g);if(e===b||g===e)return;if(e!=null||g)c.type="change",c.liveFired=b,f.event.trigger(c,arguments[1],d)}};f.event.special.change={filters:{focusout:J,beforedeactivate:J,click:function(a){var b=a.target,c=f.nodeName(b,"input")?b.type:"";(c==="radio"||c==="checkbox"||f.nodeName(b,"select"))&&J.call(this,a)},keydown:function(a){var b=a.target,c=f.nodeName(b,"input")?b.type:"";(a.keyCode===13&&!f.nodeName(b,"textarea")||a.keyCode===32&&(c==="checkbox"||c==="radio")||c==="select-multiple")&&J.call(this,a)},beforeactivate:function(a){var b=a.target;f._data(b,"_change_data",I(b))}},setup:function(a,b){if(this.type==="file")return!1;for(var c in H)f.event.add(this,c+".specialChange",H[c]);return y.test(this.nodeName)},teardown:function(a){f.event.remove(this,".specialChange");return y.test(this.nodeName)}},H=f.event.special.change.filters,H.focus=H.beforeactivate}f.support.focusinBubbles||f.each({focus:"focusin",blur:"focusout"},function(a,b){function e(a){var c=f.event.fix(a);c.type=b,c.originalEvent={},f.event.trigger(c,null,c.target),c.isDefaultPrevented()&&a.preventDefault()}var d=0;f.event.special[b]={setup:function(){d++===0&&c.addEventListener(a,e,!0)},teardown:function(){--d===0&&c.removeEventListener(a,e,!0)}}}),f.each(["bind","one"],function(a,c){f.fn[c]=function(a,d,e){var g;if(typeof a=="object"){for(var h in a)this[c](h,d,a[h],e);return this}if(arguments.length===2||d===!1)e=d,d=b;c==="one"?(g=function(a){f(this).unbind(a,g);return e.apply(this,arguments)},g.guid=e.guid||f.guid++):g=e;if(a==="unload"&&c!=="one")this.one(a,d,e);else for(var i=0,j=this.length;i0?this.bind(b,a,c):this.trigger(b)},f.attrFn&&(f.attrFn[b]=!0)}),function(){function u(a,b,c,d,e,f){for(var g=0,h=d.length;g0){j=i;break}}i=i[a]}d[g]=j}}}function t(a,b,c,d,e,f){for(var g=0,h=d.length;g+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,d=0,e=Object.prototype.toString,g=!1,h=!0,i=/\\/g,j=/\W/;[0,0].sort(function(){h=!1;return 0});var k=function(b,d,f,g){f=f||[],d=d||c;var h=d;if(d.nodeType!==1&&d.nodeType!==9)return[];if(!b||typeof b!="string")return f;var i,j,n,o,q,r,s,t,u=!0,w=k.isXML(d),x=[],y=b;do{a.exec(""),i=a.exec(y);if(i){y=i[3],x.push(i[1]);if(i[2]){o=i[3];break}}}while(i);if(x.length>1&&m.exec(b))if(x.length===2&&l.relative[x[0]])j=v(x[0]+x[1],d);else{j=l.relative[x[0]]?[d]:k(x.shift(),d);while(x.length)b=x.shift(),l.relative[b]&&(b+=x.shift()),j=v(b,j)}else{!g&&x.length>1&&d.nodeType===9&&!w&&l.match.ID.test(x[0])&&!l.match.ID.test(x[x.length-1])&&(q=k.find(x.shift(),d,w),d=q.expr?k.filter(q.expr,q.set)[0]:q.set[0]);if(d){q=g?{expr:x.pop(),set:p(g)}:k.find(x.pop(),x.length===1&&(x[0]==="~"||x[0]==="+")&&d.parentNode?d.parentNode:d,w),j=q.expr?k.filter(q.expr,q.set):q.set,x.length>0?n=p(j):u=!1;while(x.length)r=x.pop(),s=r,l.relative[r]?s=x.pop():r="",s==null&&(s=d),l.relative[r](n,s,w)}else n=x=[]}n||(n=j),n||k.error(r||b);if(e.call(n)==="[object Array]")if(!u)f.push.apply(f,n);else if(d&&d.nodeType===1)for(t=0;n[t]!=null;t++)n[t]&&(n[t]===!0||n[t].nodeType===1&&k.contains(d,n[t]))&&f.push(j[t]);else for(t=0;n[t]!=null;t++)n[t]&&n[t].nodeType===1&&f.push(j[t]);else p(n,f);o&&(k(o,h,f,g),k.uniqueSort(f));return f};k.uniqueSort=function(a){if(r){g=h,a.sort(r);if(g)for(var b=1;b0},k.find=function(a,b,c){var d;if(!a)return[];for(var e=0,f=l.order.length;e":function(a,b){var c,d=typeof b=="string",e=0,f=a.length;if(d&&!j.test(b)){b=b.toLowerCase();for(;e=0)?c||d.push(h):c&&(b[g]=!1));return!1},ID:function(a){return a[1].replace(i,"")},TAG:function(a,b){return a[1].replace(i,"").toLowerCase()},CHILD:function(a){if(a[1]==="nth"){a[2]||k.error(a[0]),a[2]=a[2].replace(/^\+|\s*/g,"");var b=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(a[2]==="even"&&"2n"||a[2]==="odd"&&"2n+1"||!/\D/.test(a[2])&&"0n+"+a[2]||a[2]);a[2]=b[1]+(b[2]||1)-0,a[3]=b[3]-0}else a[2]&&k.error(a[0]);a[0]=d++;return a},ATTR:function(a,b,c,d,e,f){var g=a[1]=a[1].replace(i,"");!f&&l.attrMap[g]&&(a[1]=l.attrMap[g]),a[4]=(a[4]||a[5]||"").replace(i,""),a[2]==="~="&&(a[4]=" "+a[4]+" ");return a},PSEUDO:function(b,c,d,e,f){if(b[1]==="not")if((a.exec(b[3])||"").length>1||/^\w/.test(b[3]))b[3]=k(b[3],null,null,c);else{var g=k.filter(b[3],c,d,!0^f);d||e.push.apply(e,g);return!1}else if(l.match.POS.test(b[0])||l.match.CHILD.test(b[0]))return!0;return b},POS:function(a){a.unshift(!0);return a}},filters:{enabled:function(a){return a.disabled===!1&&a.type!=="hidden"},disabled:function(a){return a.disabled===!0},checked:function(a){return a.checked===!0},selected:function(a){a.parentNode&&a.parentNode.selectedIndex;return a.selected===!0},parent:function(a){return!!a.firstChild},empty:function(a){return!a.firstChild},has:function(a,b,c){return!!k(c[3],a).length},header:function(a){return/h\d/i.test(a.nodeName)},text:function(a){var b=a.getAttribute("type"),c=a.type;return a.nodeName.toLowerCase()==="input"&&"text"===c&&(b===c||b===null)},radio:function(a){return a.nodeName.toLowerCase()==="input"&&"radio"===a.type},checkbox:function(a){return a.nodeName.toLowerCase()==="input"&&"checkbox"===a.type},file:function(a){return a.nodeName.toLowerCase()==="input"&&"file"===a.type},password:function(a){return a.nodeName.toLowerCase()==="input"&&"password"===a.type},submit:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"submit"===a.type},image:function(a){return a.nodeName.toLowerCase()==="input"&&"image"===a.type},reset:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"reset"===a.type},button:function(a){var b=a.nodeName.toLowerCase();return b==="input"&&"button"===a.type||b==="button"},input:function(a){return/input|select|textarea|button/i.test(a.nodeName)},focus:function(a){return a===a.ownerDocument.activeElement}},setFilters:{first:function(a,b){return b===0},last:function(a,b,c,d){return b===d.length-1},even:function(a,b){return b%2===0},odd:function(a,b){return b%2===1},lt:function(a,b,c){return bc[3]-0},nth:function(a,b,c){return c[3]-0===b},eq:function(a,b,c){return c[3]-0===b}},filter:{PSEUDO:function(a,b,c,d){var e=b[1],f=l.filters[e];if(f)return f(a,c,b,d);if(e==="contains")return(a.textContent||a.innerText||k.getText([a])||"").indexOf(b[3])>=0;if(e==="not"){var g=b[3];for(var h=0,i=g.length;h=0}},ID:function(a,b){return a.nodeType===1&&a.getAttribute("id")===b},TAG:function(a,b){return b==="*"&&a.nodeType===1||a.nodeName.toLowerCase()===b},CLASS:function(a,b){return(" "+(a.className||a.getAttribute("class"))+" ").indexOf(b)>-1},ATTR:function(a,b){var c=b[1],d=l.attrHandle[c]?l.attrHandle[c](a):a[c]!=null?a[c]:a.getAttribute(c),e=d+"",f=b[2],g=b[4];return d==null?f==="!=":f==="="?e===g:f==="*="?e.indexOf(g)>=0:f==="~="?(" "+e+" ").indexOf(g)>=0:g?f==="!="?e!==g:f==="^="?e.indexOf(g)===0:f==="$="?e.substr(e.length-g.length)===g:f==="|="?e===g||e.substr(0,g.length+1)===g+"-":!1:e&&d!==!1},POS:function(a,b,c,d){var e=b[2],f=l.setFilters[e];if(f)return f(a,c,b,d)}}},m=l.match.POS,n=function(a,b){return"\\"+(b-0+1)};for(var o in l.match)l.match[o]=new RegExp(l.match[o].source+/(?![^\[]*\])(?![^\(]*\))/.source),l.leftMatch[o]=new RegExp(/(^(?:.|\r|\n)*?)/.source+l.match[o].source.replace(/\\(\d+)/g,n));var p=function(a,b){a=Array.prototype.slice.call(a,0);if(b){b.push.apply(b,a);return b}return a};try{Array.prototype.slice.call(c.documentElement.childNodes,0)[0].nodeType}catch(q){p=function(a,b){var c=0,d=b||[];if(e.call(a)==="[object Array]")Array.prototype.push.apply(d,a);else if(typeof a.length=="number")for(var f=a.length;c",e.insertBefore(a,e.firstChild),c.getElementById(d)&&(l.find.ID=function(a,c,d){if(typeof c.getElementById!="undefined"&&!d){var e=c.getElementById(a[1]);return e?e.id===a[1]||typeof e.getAttributeNode!="undefined"&&e.getAttributeNode("id").nodeValue===a[1]?[e]:b:[]}},l.filter.ID=function(a,b){var c=typeof a.getAttributeNode!="undefined"&&a.getAttributeNode("id");return a.nodeType===1&&c&&c.nodeValue===b}),e.removeChild(a),e=a=null}(),function(){var a=c.createElement("div");a.appendChild(c.createComment("")),a.getElementsByTagName("*").length>0&&(l.find.TAG=function(a,b){var c=b.getElementsByTagName(a[1]);if(a[1]==="*"){var d=[];for(var e=0;c[e];e++)c[e].nodeType===1&&d.push(c[e]);c=d}return c}),a.innerHTML="",a.firstChild&&typeof a.firstChild.getAttribute!="undefined"&&a.firstChild.getAttribute("href")!=="#"&&(l.attrHandle.href=function(a){return a.getAttribute("href",2)}),a=null}(),c.querySelectorAll&&function(){var a=k,b=c.createElement("div"),d="__sizzle__";b.innerHTML="

    ";if(!b.querySelectorAll||b.querySelectorAll(".TEST").length!==0){k=function(b,e,f,g){e=e||c;if(!g&&!k.isXML(e)){var h=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b);if(h&&(e.nodeType===1||e.nodeType===9)){if(h[1])return p(e.getElementsByTagName(b),f);if(h[2]&&l.find.CLASS&&e.getElementsByClassName)return p(e.getElementsByClassName(h[2]),f)}if(e.nodeType===9){if(b==="body"&&e.body)return p([e.body],f);if(h&&h[3]){var i=e.getElementById(h[3]);if(!i||!i.parentNode)return p([],f);if(i.id===h[3])return p([i],f)}try{return p(e.querySelectorAll(b),f)}catch(j){}}else if(e.nodeType===1&&e.nodeName.toLowerCase()!=="object"){var m=e,n=e.getAttribute("id"),o=n||d,q=e.parentNode,r=/^\s*[+~]/.test(b);n?o=o.replace(/'/g,"\\$&"):e.setAttribute("id",o),r&&q&&(e=e.parentNode);try{if(!r||q)return p(e.querySelectorAll("[id='"+o+"'] "+b),f)}catch(s){}finally{n||m.removeAttribute("id")}}}return a(b,e,f,g)};for(var e in a)k[e]=a[e];b=null}}(),function(){var a=c.documentElement,b=a.matchesSelector||a.mozMatchesSelector||a.webkitMatchesSelector||a.msMatchesSelector;if(b){var d=!b.call(c.createElement("div"),"div"),e=!1;try{b.call(c.documentElement,"[test!='']:sizzle")}catch(f){e=!0}k.matchesSelector=function(a,c){c=c.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!k.isXML(a))try{if(e||!l.match.PSEUDO.test(c)&&!/!=/.test(c)){var f=b.call(a,c);if(f||!d||a.document&&a.document.nodeType!==11)return f}}catch(g){}return k(c,null,null,[a]).length>0}}}(),function(){var a=c.createElement("div");a.innerHTML="
    ";if(!!a.getElementsByClassName&&a.getElementsByClassName("e").length!==0){a.lastChild.className="e";if(a.getElementsByClassName("e").length===1)return;l.order.splice(1,0,"CLASS"),l.find.CLASS=function(a,b,c){if(typeof b.getElementsByClassName!="undefined"&&!c)return b.getElementsByClassName(a[1])},a=null}}(),c.documentElement.contains?k.contains=function(a,b){return a!==b&&(a.contains?a.contains(b):!0)}:c.documentElement.compareDocumentPosition?k.contains=function(a,b){return!!(a.compareDocumentPosition(b)&16)}:k.contains=function(){return!1},k.isXML=function(a){var b=(a?a.ownerDocument||a:0).documentElement;return b?b.nodeName!=="HTML":!1};var v=function(a,b){var c,d=[],e="",f=b.nodeType?[b]:b;while(c=l.match.PSEUDO.exec(a))e+=c[0],a=a.replace(l.match.PSEUDO,"");a=l.relative[a]?a+"*":a;for(var g=0,h=f.length;g0)for(h=g;h0:this.filter(a).length>0)},closest:function(a,b){var c=[],d,e,g=this[0];if(f.isArray(a)){var h,i,j={},k=1;if(g&&a.length){for(d=0,e=a.length;d-1:f(g).is(h))&&c.push({selector:i,elem:g,level:k});g=g.parentNode,k++}}return c}var l=T.test(a)||typeof a!="string"?f(a,b||this.context):0;for(d=0,e=this.length;d-1:f.find.matchesSelector(g,a)){c.push(g);break}g=g.parentNode;if(!g||!g.ownerDocument||g===b||g.nodeType===11)break}}c=c.length>1?f.unique(c):c;return this.pushStack(c,"closest",a)},index:function(a){if(!a||typeof a=="string")return f.inArray(this[0],a?f(a):this.parent().children());return f.inArray(a.jquery?a[0]:a,this)},add:function(a,b){var c=typeof a=="string"?f(a,b):f.makeArray(a&&a.nodeType?[a]:a),d=f.merge(this.get(),c);return this.pushStack(V(c[0])||V(d[0])?d:f.unique(d))},andSelf:function(){return this.add(this.prevObject)}}),f.each({parent:function(a){var b=a.parentNode;return b&&b.nodeType!==11?b:null},parents:function(a){return f.dir(a,"parentNode")},parentsUntil:function(a,b,c){return f.dir(a,"parentNode",c)},next:function(a){return f.nth(a,2,"nextSibling")},prev:function(a){return f.nth(a,2,"previousSibling")},nextAll:function(a){return f.dir(a,"nextSibling")},prevAll:function(a){return f.dir(a,"previousSibling")},nextUntil:function(a,b,c){return f.dir(a,"nextSibling",c)},prevUntil:function(a,b,c){return f.dir(a,"previousSibling",c)},siblings:function(a){return f.sibling(a.parentNode.firstChild,a)},children:function(a){return f.sibling(a.firstChild)},contents:function(a){return f.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:f.makeArray(a.childNodes)}},function(a,b){f.fn[a]=function(c,d){var e=f.map(this,b,c),g=S.call(arguments);O.test(a)||(d=c),d&&typeof d=="string"&&(e=f.filter(d,e)),e=this.length>1&&!U[a]?f.unique(e):e,(this.length>1||Q.test(d))&&P.test(a)&&(e=e.reverse());return this.pushStack(e,a,g.join(","))}}),f.extend({filter:function(a,b,c){c&&(a=":not("+a+")");return b.length===1?f.find.matchesSelector(b[0],a)?[b[0]]:[]:f.find.matches(a,b)},dir:function(a,c,d){var e=[],g=a[c];while(g&&g.nodeType!==9&&(d===b||g.nodeType!==1||!f(g).is(d)))g.nodeType===1&&e.push(g),g=g[c];return e},nth:function(a,b,c,d){b=b||1;var e=0;for(;a;a=a[c])if(a.nodeType===1&&++e===b)break;return a},sibling:function(a,b){var c=[];for(;a;a=a.nextSibling)a.nodeType===1&&a!==b&&c.push(a);return c}});var X=/ jQuery\d+="(?:\d+|null)"/g,Y=/^\s+/,Z=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,$=/<([\w:]+)/,_=/",""],legend:[1,"
    ","
    "],thead:[1,"","
    "],tr:[2,"","
    "],td:[3,"","
    "],col:[2,"","
    "],area:[1,"",""],_default:[0,"",""]};bf.optgroup=bf.option,bf.tbody=bf.tfoot=bf.colgroup=bf.caption=bf.thead,bf.th=bf.td,f.support.htmlSerialize||(bf._default=[1,"div
    ","
    "]),f.fn.extend({text:function(a){if(f.isFunction(a))return this.each(function(b){var c=f(this);c.text(a.call(this,b,c.text()))});if(typeof a!="object"&&a!==b)return this.empty().append((this[0]&&this[0].ownerDocument||c).createTextNode(a));return f.text(this)},wrapAll:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapAll(a.call(this,b))});if(this[0]){var b=f(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&a.firstChild.nodeType===1)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapInner(a.call(this,b))});return this.each(function(){var b=f(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){return this.each(function(){f(this).wrapAll(a)})},unwrap:function(){return this.parent().each(function(){f.nodeName(this,"body")||f(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this)});if(arguments.length){var a=f(arguments[0]);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this.nextSibling)});if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,f(arguments[0]).toArray());return a}},remove:function(a,b){for(var c=0,d;(d=this[c])!=null;c++)if(!a||f.filter(a,[d]).length)!b&&d.nodeType===1&&(f.cleanData(d.getElementsByTagName("*")),f.cleanData([d])),d.parentNode&&d.parentNode.removeChild(d);return this},empty:function(){for(var a=0,b;(b=this[a])!=null;a++){b.nodeType===1&&f.cleanData(b.getElementsByTagName("*"));while(b.firstChild)b.removeChild(b.firstChild)}return this},clone:function(a,b){a=a==null?!1:a,b=b==null?a:b;return this.map(function(){return f.clone(this,a,b)})},html:function(a){if(a===b)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(X,""):null;if(typeof a=="string"&&!bb.test(a)&&(f.support.leadingWhitespace||!Y.test(a))&&!bf[($.exec(a)||["",""])[1].toLowerCase()]){a=a.replace(Z,"<$1>");try{for(var c=0,d=this.length;c1&&l0?this.clone(!0):this).get();f(e[h])[b](j),d=d.concat(j +/*! + * jQuery JavaScript Library v1.6.2 + * http://jquery.com/ + * + * Copyright 2011, John Resig + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * + * Date: Thu Jun 30 14:16:56 2011 -0400 + */ +(function(a,b){function cv(a){return f.isWindow(a)?a:a.nodeType===9?a.defaultView||a.parentWindow:!1}function cs(a){if(!cg[a]){var b=c.body,d=f("<"+a+">").appendTo(b),e=d.css("display");d.remove();if(e==="none"||e===""){ch||(ch=c.createElement("iframe"),ch.frameBorder=ch.width=ch.height=0),b.appendChild(ch);if(!ci||!ch.createElement)ci=(ch.contentWindow||ch.contentDocument).document,ci.write((c.compatMode==="CSS1Compat"?"":"")+""),ci.close();d=ci.createElement(a),ci.body.appendChild(d),e=f.css(d,"display"),b.removeChild(ch)}cg[a]=e}return cg[a]}function cr(a,b){var c={};f.each(cm.concat.apply([],cm.slice(0,b)),function(){c[this]=a});return c}function cq(){cn=b}function cp(){setTimeout(cq,0);return cn=f.now()}function cf(){try{return new a.ActiveXObject("Microsoft.XMLHTTP")}catch(b){}}function ce(){try{return new a.XMLHttpRequest}catch(b){}}function b$(a,c){a.dataFilter&&(c=a.dataFilter(c,a.dataType));var d=a.dataTypes,e={},g,h,i=d.length,j,k=d[0],l,m,n,o,p;for(g=1;g0){c!=="border"&&f.each(e,function(){c||(d-=parseFloat(f.css(a,"padding"+this))||0),c==="margin"?d+=parseFloat(f.css(a,c+this))||0:d-=parseFloat(f.css(a,"border"+this+"Width"))||0});return d+"px"}d=bx(a,b,b);if(d<0||d==null)d=a.style[b]||0;d=parseFloat(d)||0,c&&f.each(e,function(){d+=parseFloat(f.css(a,"padding"+this))||0,c!=="padding"&&(d+=parseFloat(f.css(a,"border"+this+"Width"))||0),c==="margin"&&(d+=parseFloat(f.css(a,c+this))||0)});return d+"px"}function bm(a,b){b.src?f.ajax({url:b.src,async:!1,dataType:"script"}):f.globalEval((b.text||b.textContent||b.innerHTML||"").replace(be,"/*$0*/")),b.parentNode&&b.parentNode.removeChild(b)}function bl(a){f.nodeName(a,"input")?bk(a):"getElementsByTagName"in a&&f.grep(a.getElementsByTagName("input"),bk)}function bk(a){if(a.type==="checkbox"||a.type==="radio")a.defaultChecked=a.checked}function bj(a){return"getElementsByTagName"in a?a.getElementsByTagName("*"):"querySelectorAll"in a?a.querySelectorAll("*"):[]}function bi(a,b){var c;if(b.nodeType===1){b.clearAttributes&&b.clearAttributes(),b.mergeAttributes&&b.mergeAttributes(a),c=b.nodeName.toLowerCase();if(c==="object")b.outerHTML=a.outerHTML;else if(c!=="input"||a.type!=="checkbox"&&a.type!=="radio"){if(c==="option")b.selected=a.defaultSelected;else if(c==="input"||c==="textarea")b.defaultValue=a.defaultValue}else a.checked&&(b.defaultChecked=b.checked=a.checked),b.value!==a.value&&(b.value=a.value);b.removeAttribute(f.expando)}}function bh(a,b){if(b.nodeType===1&&!!f.hasData(a)){var c=f.expando,d=f.data(a),e=f.data(b,d);if(d=d[c]){var g=d.events;e=e[c]=f.extend({},d);if(g){delete e.handle,e.events={};for(var h in g)for(var i=0,j=g[h].length;i=0===c})}function V(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function N(a,b){return(a&&a!=="*"?a+".":"")+b.replace(z,"`").replace(A,"&")}function M(a){var b,c,d,e,g,h,i,j,k,l,m,n,o,p=[],q=[],r=f._data(this,"events");if(!(a.liveFired===this||!r||!r.live||a.target.disabled||a.button&&a.type==="click")){a.namespace&&(n=new RegExp("(^|\\.)"+a.namespace.split(".").join("\\.(?:.*\\.)?")+"(\\.|$)")),a.liveFired=this;var s=r.live.slice(0);for(i=0;ic)break;a.currentTarget=e.elem,a.data=e.handleObj.data,a.handleObj=e.handleObj,o=e.handleObj.origHandler.apply(e.elem,arguments);if(o===!1||a.isPropagationStopped()){c=e.level,o===!1&&(b=!1);if(a.isImmediatePropagationStopped())break}}return b}}function K(a,c,d){var e=f.extend({},d[0]);e.type=a,e.originalEvent={},e.liveFired=b,f.event.handle.call(c,e),e.isDefaultPrevented()&&d[0].preventDefault()}function E(){return!0}function D(){return!1}function m(a,c,d){var e=c+"defer",g=c+"queue",h=c+"mark",i=f.data(a,e,b,!0);i&&(d==="queue"||!f.data(a,g,b,!0))&&(d==="mark"||!f.data(a,h,b,!0))&&setTimeout(function(){!f.data(a,g,b,!0)&&!f.data(a,h,b,!0)&&(f.removeData(a,e,!0),i.resolve())},0)}function l(a){for(var b in a)if(b!=="toJSON")return!1;return!0}function k(a,c,d){if(d===b&&a.nodeType===1){var e="data-"+c.replace(j,"$1-$2").toLowerCase();d=a.getAttribute(e);if(typeof d=="string"){try{d=d==="true"?!0:d==="false"?!1:d==="null"?null:f.isNaN(d)?i.test(d)?f.parseJSON(d):d:parseFloat(d)}catch(g){}f.data(a,c,d)}else d=b}return d}var c=a.document,d=a.navigator,e=a.location,f=function(){function J(){if(!e.isReady){try{c.documentElement.doScroll("left")}catch(a){setTimeout(J,1);return}e.ready()}}var e=function(a,b){return new e.fn.init(a,b,h)},f=a.jQuery,g=a.$,h,i=/^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,j=/\S/,k=/^\s+/,l=/\s+$/,m=/\d/,n=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,o=/^[\],:{}\s]*$/,p=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,q=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,r=/(?:^|:|,)(?:\s*\[)+/g,s=/(webkit)[ \/]([\w.]+)/,t=/(opera)(?:.*version)?[ \/]([\w.]+)/,u=/(msie) ([\w.]+)/,v=/(mozilla)(?:.*? rv:([\w.]+))?/,w=/-([a-z])/ig,x=function(a,b){return b.toUpperCase()},y=d.userAgent,z,A,B,C=Object.prototype.toString,D=Object.prototype.hasOwnProperty,E=Array.prototype.push,F=Array.prototype.slice,G=String.prototype.trim,H=Array.prototype.indexOf,I={};e.fn=e.prototype={constructor:e,init:function(a,d,f){var g,h,j,k;if(!a)return this;if(a.nodeType){this.context=this[0]=a,this.length=1;return this}if(a==="body"&&!d&&c.body){this.context=c,this[0]=c.body,this.selector=a,this.length=1;return this}if(typeof a=="string"){a.charAt(0)!=="<"||a.charAt(a.length-1)!==">"||a.length<3?g=i.exec(a):g=[null,a,null];if(g&&(g[1]||!d)){if(g[1]){d=d instanceof e?d[0]:d,k=d?d.ownerDocument||d:c,j=n.exec(a),j?e.isPlainObject(d)?(a=[c.createElement(j[1])],e.fn.attr.call(a,d,!0)):a=[k.createElement(j[1])]:(j=e.buildFragment([g[1]],[k]),a=(j.cacheable?e.clone(j.fragment):j.fragment).childNodes);return e.merge(this,a)}h=c.getElementById(g[2]);if(h&&h.parentNode){if(h.id!==g[2])return f.find(a);this.length=1,this[0]=h}this.context=c,this.selector=a;return this}return!d||d.jquery?(d||f).find(a):this.constructor(d).find(a)}if(e.isFunction(a))return f.ready(a);a.selector!==b&&(this.selector=a.selector,this.context=a.context);return e.makeArray(a,this)},selector:"",jquery:"1.6.2",length:0,size:function(){return this.length},toArray:function(){return F.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this[this.length+a]:this[a]},pushStack:function(a,b,c){var d=this.constructor();e.isArray(a)?E.apply(d,a):e.merge(d,a),d.prevObject=this,d.context=this.context,b==="find"?d.selector=this.selector+(this.selector?" ":"")+c:b&&(d.selector=this.selector+"."+b+"("+c+")");return d},each:function(a,b){return e.each(this,a,b)},ready:function(a){e.bindReady(),A.done(a);return this},eq:function(a){return a===-1?this.slice(a):this.slice(a,+a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(F.apply(this,arguments),"slice",F.call(arguments).join(","))},map:function(a){return this.pushStack(e.map(this,function(b,c){return a.call(b,c,b)}))},end:function(){return this.prevObject||this.constructor(null)},push:E,sort:[].sort,splice:[].splice},e.fn.init.prototype=e.fn,e.extend=e.fn.extend=function(){var a,c,d,f,g,h,i=arguments[0]||{},j=1,k=arguments.length,l=!1;typeof i=="boolean"&&(l=i,i=arguments[1]||{},j=2),typeof i!="object"&&!e.isFunction(i)&&(i={}),k===j&&(i=this,--j);for(;j0)return;A.resolveWith(c,[e]),e.fn.trigger&&e(c).trigger("ready").unbind("ready")}},bindReady:function(){if(!A){A=e._Deferred();if(c.readyState==="complete")return setTimeout(e.ready,1);if(c.addEventListener)c.addEventListener("DOMContentLoaded",B,!1),a.addEventListener("load",e.ready,!1);else if(c.attachEvent){c.attachEvent("onreadystatechange",B),a.attachEvent("onload",e.ready);var b=!1;try{b=a.frameElement==null}catch(d){}c.documentElement.doScroll&&b&&J()}}},isFunction:function(a){return e.type(a)==="function"},isArray:Array.isArray||function(a){return e.type(a)==="array"},isWindow:function(a){return a&&typeof a=="object"&&"setInterval"in a},isNaN:function(a){return a==null||!m.test(a)||isNaN(a)},type:function(a){return a==null?String(a):I[C.call(a)]||"object"},isPlainObject:function(a){if(!a||e.type(a)!=="object"||a.nodeType||e.isWindow(a))return!1;if(a.constructor&&!D.call(a,"constructor")&&!D.call(a.constructor.prototype,"isPrototypeOf"))return!1;var c;for(c in a);return c===b||D.call(a,c)},isEmptyObject:function(a){for(var b in a)return!1;return!0},error:function(a){throw a},parseJSON:function(b){if(typeof b!="string"||!b)return null;b=e.trim(b);if(a.JSON&&a.JSON.parse)return a.JSON.parse(b);if(o.test(b.replace(p,"@").replace(q,"]").replace(r,"")))return(new Function("return "+b))();e.error("Invalid JSON: "+b)},parseXML:function(b,c,d){a.DOMParser?(d=new DOMParser,c=d.parseFromString(b,"text/xml")):(c=new ActiveXObject("Microsoft.XMLDOM"),c.async="false",c.loadXML(b)),d=c.documentElement,(!d||!d.nodeName||d.nodeName==="parsererror")&&e.error("Invalid XML: "+b);return c},noop:function(){},globalEval:function(b){b&&j.test(b)&&(a.execScript||function(b){a.eval.call(a,b)})(b)},camelCase:function(a){return a.replace(w,x)},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,c,d){var f,g=0,h=a.length,i=h===b||e.isFunction(a);if(d){if(i){for(f in a)if(c.apply(a[f],d)===!1)break}else for(;g0&&a[0]&&a[j-1]||j===0||e.isArray(a));if(k)for(;i1?h.call(arguments,0):c,--e||g.resolveWith(g,h.call(b,0))}}var b=arguments,c=0,d=b.length,e=d,g=d<=1&&a&&f.isFunction(a.promise)?a:f.Deferred();if(d>1){for(;c
    a",d=a.getElementsByTagName("*"),e=a.getElementsByTagName("a")[0];if(!d||!d.length||!e)return{};g=c.createElement("select"),h=g.appendChild(c.createElement("option")),i=a.getElementsByTagName("input")[0],k={leadingWhitespace:a.firstChild.nodeType===3,tbody:!a.getElementsByTagName("tbody").length,htmlSerialize:!!a.getElementsByTagName("link").length,style:/top/.test(e.getAttribute("style")),hrefNormalized:e.getAttribute("href")==="/a",opacity:/^0.55$/.test(e.style.opacity),cssFloat:!!e.style.cssFloat,checkOn:i.value==="on",optSelected:h.selected,getSetAttribute:a.className!=="t",submitBubbles:!0,changeBubbles:!0,focusinBubbles:!1,deleteExpando:!0,noCloneEvent:!0,inlineBlockNeedsLayout:!1,shrinkWrapBlocks:!1,reliableMarginRight:!0},i.checked=!0,k.noCloneChecked=i.cloneNode(!0).checked,g.disabled=!0,k.optDisabled=!h.disabled;try{delete a.test}catch(v){k.deleteExpando=!1}!a.addEventListener&&a.attachEvent&&a.fireEvent&&(a.attachEvent("onclick",function(){k.noCloneEvent=!1}),a.cloneNode(!0).fireEvent("onclick")),i=c.createElement("input"),i.value="t",i.setAttribute("type","radio"),k.radioValue=i.value==="t",i.setAttribute("checked","checked"),a.appendChild(i),l=c.createDocumentFragment(),l.appendChild(a.firstChild),k.checkClone=l.cloneNode(!0).cloneNode(!0).lastChild.checked,a.innerHTML="",a.style.width=a.style.paddingLeft="1px",m=c.getElementsByTagName("body")[0],o=c.createElement(m?"div":"body"),p={visibility:"hidden",width:0,height:0,border:0,margin:0},m&&f.extend(p,{position:"absolute",left:-1e3,top:-1e3});for(t in p)o.style[t]=p[t];o.appendChild(a),n=m||b,n.insertBefore(o,n.firstChild),k.appendChecked=i.checked,k.boxModel=a.offsetWidth===2,"zoom"in a.style&&(a.style.display="inline",a.style.zoom=1,k.inlineBlockNeedsLayout=a.offsetWidth===2,a.style.display="",a.innerHTML="
    ",k.shrinkWrapBlocks=a.offsetWidth!==2),a.innerHTML="
    t
    ",q=a.getElementsByTagName("td"),u=q[0].offsetHeight===0,q[0].style.display="",q[1].style.display="none",k.reliableHiddenOffsets=u&&q[0].offsetHeight===0,a.innerHTML="",c.defaultView&&c.defaultView.getComputedStyle&&(j=c.createElement("div"),j.style.width="0",j.style.marginRight="0",a.appendChild(j),k.reliableMarginRight=(parseInt((c.defaultView.getComputedStyle(j,null)||{marginRight:0}).marginRight,10)||0)===0),o.innerHTML="",n.removeChild(o);if(a.attachEvent)for(t in{submit:1,change:1,focusin:1})s="on"+t,u=s in a,u||(a.setAttribute(s,"return;"),u=typeof a[s]=="function"),k[t+"Bubbles"]=u;o=l=g=h=m=j=a=i=null;return k}(),f.boxModel=f.support.boxModel;var i=/^(?:\{.*\}|\[.*\])$/,j=/([a-z])([A-Z])/g;f.extend({cache:{},uuid:0,expando:"jQuery"+(f.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:!0},hasData:function(a){a=a.nodeType?f.cache[a[f.expando]]:a[f.expando];return!!a&&!l(a)},data:function(a,c,d,e){if(!!f.acceptData(a)){var g=f.expando,h=typeof c=="string",i,j=a.nodeType,k=j?f.cache:a,l=j?a[f.expando]:a[f.expando]&&f.expando;if((!l||e&&l&&!k[l][g])&&h&&d===b)return;l||(j?a[f.expando]=l=++f.uuid:l=f.expando),k[l]||(k[l]={},j||(k[l].toJSON=f.noop));if(typeof c=="object"||typeof c=="function")e?k[l][g]=f.extend(k[l][g],c):k[l]=f.extend(k[l],c);i=k[l],e&&(i[g]||(i[g]={}),i=i[g]),d!==b&&(i[f.camelCase(c)]=d);if(c==="events"&&!i[c])return i[g]&&i[g].events;return h?i[f.camelCase(c)]||i[c]:i}},removeData:function(b,c,d){if(!!f.acceptData(b)){var e=f.expando,g=b.nodeType,h=g?f.cache:b,i=g?b[f.expando]:f.expando;if(!h[i])return;if(c){var j=d?h[i][e]:h[i];if(j){delete j[c];if(!l(j))return}}if(d){delete h[i][e];if(!l(h[i]))return}var k=h[i][e];f.support.deleteExpando||h!=a?delete h[i]:h[i]=null,k?(h[i]={},g||(h[i].toJSON=f.noop),h[i][e]=k):g&&(f.support.deleteExpando?delete b[f.expando]:b.removeAttribute?b.removeAttribute(f.expando):b[f.expando]=null)}},_data:function(a,b,c){return f.data(a,b,c,!0)},acceptData:function(a){if(a.nodeName){var b=f.noData[a.nodeName.toLowerCase()];if(b)return b!==!0&&a.getAttribute("classid")===b}return!0}}),f.fn.extend({data:function(a,c){var d=null;if(typeof a=="undefined"){if(this.length){d=f.data(this[0]);if(this[0].nodeType===1){var e=this[0].attributes,g;for(var h=0,i=e.length;h-1)return!0;return!1},val:function(a){var c,d,e=this[0];if(!arguments.length){if(e){c=f.valHooks[e.nodeName.toLowerCase()]||f.valHooks[e.type];if(c&&"get"in c&&(d=c.get(e,"value"))!==b)return d;d=e.value;return typeof d=="string"?d.replace(p,""):d==null?"":d}return b}var g=f.isFunction(a);return this.each(function(d){var e=f(this),h;if(this.nodeType===1){g?h=a.call(this,d,e.val()):h=a,h==null?h="":typeof h=="number"?h+="":f.isArray(h)&&(h=f.map(h,function(a){return a==null?"":a+""})),c=f.valHooks[this.nodeName.toLowerCase()]||f.valHooks[this.type];if(!c||!("set"in c)||c.set(this,h,"value")===b)this.value=h}})}}),f.extend({valHooks:{option:{get:function(a){var b=a.attributes.value;return!b||b.specified?a.value:a.text}},select:{get:function(a){var b,c=a.selectedIndex,d=[],e=a.options,g=a.type==="select-one";if(c<0)return null;for(var h=g?c:0,i=g?c+1:e.length;h=0}),c.length||(a.selectedIndex=-1);return c}}},attrFn:{val:!0,css:!0,html:!0,text:!0,data:!0,width:!0,height:!0,offset:!0},attrFix:{tabindex:"tabIndex"},attr:function(a,c,d,e){var g=a.nodeType;if(!a||g===3||g===8||g===2)return b;if(e&&c in f.attrFn)return f(a)[c](d);if(!("getAttribute"in a))return f.prop(a,c,d);var h,i,j=g!==1||!f.isXMLDoc(a);j&&(c=f.attrFix[c]||c,i=f.attrHooks[c],i||(t.test(c)?i=w:v&&c!=="className"&&(f.nodeName(a,"form")||u.test(c))&&(i=v)));if(d!==b){if(d===null){f.removeAttr(a,c);return b}if(i&&"set"in i&&j&&(h=i.set(a,d,c))!==b)return h;a.setAttribute(c,""+d);return d}if(i&&"get"in i&&j&&(h=i.get(a,c))!==null)return h;h=a.getAttribute(c);return h===null?b:h},removeAttr:function(a,b){var c;a.nodeType===1&&(b=f.attrFix[b]||b,f.support.getSetAttribute?a.removeAttribute(b):(f.attr(a,b,""),a.removeAttributeNode(a.getAttributeNode(b))),t.test(b)&&(c=f.propFix[b]||b)in a&&(a[c]=!1))},attrHooks:{type:{set:function(a,b){if(q.test(a.nodeName)&&a.parentNode)f.error("type property can't be changed");else if(!f.support.radioValue&&b==="radio"&&f.nodeName(a,"input")){var c=a.value;a.setAttribute("type",b),c&&(a.value=c);return b}}},tabIndex:{get:function(a){var c=a.getAttributeNode("tabIndex");return c&&c.specified?parseInt(c.value,10):r.test(a.nodeName)||s.test(a.nodeName)&&a.href?0:b}},value:{get:function(a,b){if(v&&f.nodeName(a,"button"))return v.get(a,b);return b in a?a.value:null},set:function(a,b,c){if(v&&f.nodeName(a,"button"))return v.set(a,b,c);a.value=b}}},propFix:{tabindex:"tabIndex",readonly:"readOnly","for":"htmlFor","class":"className",maxlength:"maxLength",cellspacing:"cellSpacing",cellpadding:"cellPadding",rowspan:"rowSpan",colspan:"colSpan",usemap:"useMap",frameborder:"frameBorder",contenteditable:"contentEditable"},prop:function(a,c,d){var e=a.nodeType;if(!a||e===3||e===8||e===2)return b;var g,h,i=e!==1||!f.isXMLDoc(a);i&&(c=f.propFix[c]||c,h=f.propHooks[c]);return d!==b?h&&"set"in h&&(g=h.set(a,d,c))!==b?g:a[c]=d:h&&"get"in h&&(g=h.get(a,c))!==b?g:a[c]},propHooks:{}}),w={get:function(a,c){return f.prop(a,c)?c.toLowerCase():b},set:function(a,b,c){var d;b===!1?f.removeAttr(a,c):(d=f.propFix[c]||c,d in a&&(a[d]=!0),a.setAttribute(c,c.toLowerCase()));return c}},f.support.getSetAttribute||(f.attrFix=f.propFix,v=f.attrHooks.name=f.attrHooks.title=f.valHooks.button={get:function(a,c){var d;d=a.getAttributeNode(c);return d&&d.nodeValue!==""?d.nodeValue:b},set:function(a,b,c){var d=a.getAttributeNode(c);if(d){d.nodeValue=b;return b}}},f.each(["width","height"],function(a,b){f.attrHooks[b]=f.extend(f.attrHooks[b],{set:function(a,c){if(c===""){a.setAttribute(b,"auto");return c}}})})),f.support.hrefNormalized||f.each(["href","src","width","height"],function(a,c){f.attrHooks[c]=f.extend(f.attrHooks[c],{get:function(a){var d=a.getAttribute(c,2);return d===null?b:d}})}),f.support.style||(f.attrHooks.style={get:function(a){return a.style.cssText.toLowerCase()||b},set:function(a,b){return a.style.cssText=""+b}}),f.support.optSelected||(f.propHooks.selected=f.extend(f.propHooks.selected,{get:function(a){var b=a.parentNode;b&&(b.selectedIndex,b.parentNode&&b.parentNode.selectedIndex)}})),f.support.checkOn||f.each(["radio","checkbox"],function(){f.valHooks[this]={get:function(a){return a.getAttribute("value")===null?"on":a.value}}}),f.each(["radio","checkbox"],function(){f.valHooks[this]=f.extend(f.valHooks[this],{set:function(a,b){if(f.isArray(b))return a.checked=f.inArray(f(a).val(),b)>=0}})});var x=/\.(.*)$/,y=/^(?:textarea|input|select)$/i,z=/\./g,A=/ /g,B=/[^\w\s.|`]/g,C=function(a){return a.replace(B,"\\$&")};f.event={add:function(a,c,d,e){if(a.nodeType!==3&&a.nodeType!==8){if(d===!1)d=D;else if(!d)return;var g,h;d.handler&&(g=d,d=g.handler),d.guid||(d.guid=f.guid++);var i=f._data(a);if(!i)return;var j=i.events,k=i.handle;j||(i.events=j={}),k||(i.handle=k=function(a){return typeof f!="undefined"&&(!a||f.event.triggered!==a.type)?f.event.handle.apply(k.elem,arguments):b}),k.elem=a,c=c.split(" ");var l,m=0,n;while(l=c[m++]){h=g?f.extend({},g):{handler:d,data:e},l.indexOf(".")>-1?(n=l.split("."),l=n.shift(),h.namespace=n.slice(0).sort().join(".")):(n=[],h.namespace=""),h.type=l,h.guid||(h.guid=d.guid);var o=j[l],p=f.event.special[l]||{};if(!o){o=j[l]=[];if(!p.setup||p.setup.call(a,e,n,k)===!1)a.addEventListener?a.addEventListener(l,k,!1):a.attachEvent&&a.attachEvent("on"+l,k)}p.add&&(p.add.call(a,h),h.handler.guid||(h.handler.guid=d.guid)),o.push(h),f.event.global[l]=!0}a=null}},global:{},remove:function(a,c,d,e){if(a.nodeType!==3&&a.nodeType!==8){d===!1&&(d=D);var g,h,i,j,k=0,l,m,n,o,p,q,r,s=f.hasData(a)&&f._data(a),t=s&&s.events;if(!s||!t)return;c&&c.type&&(d=c.handler,c=c.type);if(!c||typeof c=="string"&&c.charAt(0)==="."){c=c||"";for(h in t)f.event.remove(a,h+c);return}c=c.split(" ");while(h=c[k++]){r=h,q=null,l=h.indexOf(".")<0,m=[],l||(m=h.split("."),h=m.shift(),n=new RegExp("(^|\\.)"+f.map(m.slice(0).sort(),C).join("\\.(?:.*\\.)?")+"(\\.|$)")),p=t[h];if(!p)continue;if(!d){for(j=0;j=0&&(h=h.slice(0,-1),j=!0),h.indexOf(".")>=0&&(i=h.split("."),h=i. +shift(),i.sort());if(!!e&&!f.event.customEvent[h]||!!f.event.global[h]){c=typeof c=="object"?c[f.expando]?c:new f.Event(h,c):new f.Event(h),c.type=h,c.exclusive=j,c.namespace=i.join("."),c.namespace_re=new RegExp("(^|\\.)"+i.join("\\.(?:.*\\.)?")+"(\\.|$)");if(g||!e)c.preventDefault(),c.stopPropagation();if(!e){f.each(f.cache,function(){var a=f.expando,b=this[a];b&&b.events&&b.events[h]&&f.event.trigger(c,d,b.handle.elem)});return}if(e.nodeType===3||e.nodeType===8)return;c.result=b,c.target=e,d=d!=null?f.makeArray(d):[],d.unshift(c);var k=e,l=h.indexOf(":")<0?"on"+h:"";do{var m=f._data(k,"handle");c.currentTarget=k,m&&m.apply(k,d),l&&f.acceptData(k)&&k[l]&&k[l].apply(k,d)===!1&&(c.result=!1,c.preventDefault()),k=k.parentNode||k.ownerDocument||k===c.target.ownerDocument&&a}while(k&&!c.isPropagationStopped());if(!c.isDefaultPrevented()){var n,o=f.event.special[h]||{};if((!o._default||o._default.call(e.ownerDocument,c)===!1)&&(h!=="click"||!f.nodeName(e,"a"))&&f.acceptData(e)){try{l&&e[h]&&(n=e[l],n&&(e[l]=null),f.event.triggered=h,e[h]())}catch(p){}n&&(e[l]=n),f.event.triggered=b}}return c.result}},handle:function(c){c=f.event.fix(c||a.event);var d=((f._data(this,"events")||{})[c.type]||[]).slice(0),e=!c.exclusive&&!c.namespace,g=Array.prototype.slice.call(arguments,0);g[0]=c,c.currentTarget=this;for(var h=0,i=d.length;h-1?f.map(a.options,function(a){return a.selected}).join("-"):"":f.nodeName(a,"select")&&(c=a.selectedIndex);return c},J=function(c){var d=c.target,e,g;if(!!y.test(d.nodeName)&&!d.readOnly){e=f._data(d,"_change_data"),g=I(d),(c.type!=="focusout"||d.type!=="radio")&&f._data(d,"_change_data",g);if(e===b||g===e)return;if(e!=null||g)c.type="change",c.liveFired=b,f.event.trigger(c,arguments[1],d)}};f.event.special.change={filters:{focusout:J,beforedeactivate:J,click:function(a){var b=a.target,c=f.nodeName(b,"input")?b.type:"";(c==="radio"||c==="checkbox"||f.nodeName(b,"select"))&&J.call(this,a)},keydown:function(a){var b=a.target,c=f.nodeName(b,"input")?b.type:"";(a.keyCode===13&&!f.nodeName(b,"textarea")||a.keyCode===32&&(c==="checkbox"||c==="radio")||c==="select-multiple")&&J.call(this,a)},beforeactivate:function(a){var b=a.target;f._data(b,"_change_data",I(b))}},setup:function(a,b){if(this.type==="file")return!1;for(var c in H)f.event.add(this,c+".specialChange",H[c]);return y.test(this.nodeName)},teardown:function(a){f.event.remove(this,".specialChange");return y.test(this.nodeName)}},H=f.event.special.change.filters,H.focus=H.beforeactivate}f.support.focusinBubbles||f.each({focus:"focusin",blur:"focusout"},function(a,b){function e(a){var c=f.event.fix(a);c.type=b,c.originalEvent={},f.event.trigger(c,null,c.target),c.isDefaultPrevented()&&a.preventDefault()}var d=0;f.event.special[b]={setup:function(){d++===0&&c.addEventListener(a,e,!0)},teardown:function(){--d===0&&c.removeEventListener(a,e,!0)}}}),f.each(["bind","one"],function(a,c){f.fn[c]=function(a,d,e){var g;if(typeof a=="object"){for(var h in a)this[c](h,d,a[h],e);return this}if(arguments.length===2||d===!1)e=d,d=b;c==="one"?(g=function(a){f(this).unbind(a,g);return e.apply(this,arguments)},g.guid=e.guid||f.guid++):g=e;if(a==="unload"&&c!=="one")this.one(a,d,e);else for(var i=0,j=this.length;i0?this.bind(b,a,c):this.trigger(b)},f.attrFn&&(f.attrFn[b]=!0)}),function(){function u(a,b,c,d,e,f){for(var g=0,h=d.length;g0){j=i;break}}i=i[a]}d[g]=j}}}function t(a,b,c,d,e,f){for(var g=0,h=d.length;g+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,d=0,e=Object.prototype.toString,g=!1,h=!0,i=/\\/g,j=/\W/;[0,0].sort(function(){h=!1;return 0});var k=function(b,d,f,g){f=f||[],d=d||c;var h=d;if(d.nodeType!==1&&d.nodeType!==9)return[];if(!b||typeof b!="string")return f;var i,j,n,o,q,r,s,t,u=!0,w=k.isXML(d),x=[],y=b;do{a.exec(""),i=a.exec(y);if(i){y=i[3],x.push(i[1]);if(i[2]){o=i[3];break}}}while(i);if(x.length>1&&m.exec(b))if(x.length===2&&l.relative[x[0]])j=v(x[0]+x[1],d);else{j=l.relative[x[0]]?[d]:k(x.shift(),d);while(x.length)b=x.shift(),l.relative[b]&&(b+=x.shift()),j=v(b,j)}else{!g&&x.length>1&&d.nodeType===9&&!w&&l.match.ID.test(x[0])&&!l.match.ID.test(x[x.length-1])&&(q=k.find(x.shift(),d,w),d=q.expr?k.filter(q.expr,q.set)[0]:q.set[0]);if(d){q=g?{expr:x.pop(),set:p(g)}:k.find(x.pop(),x.length===1&&(x[0]==="~"||x[0]==="+")&&d.parentNode?d.parentNode:d,w),j=q.expr?k.filter(q.expr,q.set):q.set,x.length>0?n=p(j):u=!1;while(x.length)r=x.pop(),s=r,l.relative[r]?s=x.pop():r="",s==null&&(s=d),l.relative[r](n,s,w)}else n=x=[]}n||(n=j),n||k.error(r||b);if(e.call(n)==="[object Array]")if(!u)f.push.apply(f,n);else if(d&&d.nodeType===1)for(t=0;n[t]!=null;t++)n[t]&&(n[t]===!0||n[t].nodeType===1&&k.contains(d,n[t]))&&f.push(j[t]);else for(t=0;n[t]!=null;t++)n[t]&&n[t].nodeType===1&&f.push(j[t]);else p(n,f);o&&(k(o,h,f,g),k.uniqueSort(f));return f};k.uniqueSort=function(a){if(r){g=h,a.sort(r);if(g)for(var b=1;b0},k.find=function(a,b,c){var d;if(!a)return[];for(var e=0,f=l.order.length;e":function(a,b){var c,d=typeof b=="string",e=0,f=a.length;if(d&&!j.test(b)){b=b.toLowerCase();for(;e=0)?c||d.push(h):c&&(b[g]=!1));return!1},ID:function(a){return a[1].replace(i,"")},TAG:function(a,b){return a[1].replace(i,"").toLowerCase()},CHILD:function(a){if(a[1]==="nth"){a[2]||k.error(a[0]),a[2]=a[2].replace(/^\+|\s*/g,"");var b=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(a[2]==="even"&&"2n"||a[2]==="odd"&&"2n+1"||!/\D/.test(a[2])&&"0n+"+a[2]||a[2]);a[2]=b[1]+(b[2]||1)-0,a[3]=b[3]-0}else a[2]&&k.error(a[0]);a[0]=d++;return a},ATTR:function(a,b,c,d,e,f){var g=a[1]=a[1].replace(i,"");!f&&l.attrMap[g]&&(a[1]=l.attrMap[g]),a[4]=(a[4]||a[5]||"").replace(i,""),a[2]==="~="&&(a[4]=" "+a[4]+" ");return a},PSEUDO:function(b,c,d,e,f){if(b[1]==="not")if((a.exec(b[3])||"").length>1||/^\w/.test(b[3]))b[3]=k(b[3],null,null,c);else{var g=k.filter(b[3],c,d,!0^f);d||e.push.apply(e,g);return!1}else if(l.match.POS.test(b[0])||l.match.CHILD.test(b[0]))return!0;return b},POS:function(a){a.unshift(!0);return a}},filters:{enabled:function(a){return a.disabled===!1&&a.type!=="hidden"},disabled:function(a){return a.disabled===!0},checked:function(a){return a.checked===!0},selected:function(a){a.parentNode&&a.parentNode.selectedIndex;return a.selected===!0},parent:function(a){return!!a.firstChild},empty:function(a){return!a.firstChild},has:function(a,b,c){return!!k(c[3],a).length},header:function(a){return/h\d/i.test(a.nodeName)},text:function(a){var b=a.getAttribute("type"),c=a.type;return a.nodeName.toLowerCase()==="input"&&"text"===c&&(b===c||b===null)},radio:function(a){return a.nodeName.toLowerCase()==="input"&&"radio"===a.type},checkbox:function(a){return a.nodeName.toLowerCase()==="input"&&"checkbox"===a.type},file:function(a){return a.nodeName.toLowerCase()==="input"&&"file"===a.type},password:function(a){return a.nodeName.toLowerCase()==="input"&&"password"===a.type},submit:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"submit"===a.type},image:function(a){return a.nodeName.toLowerCase()==="input"&&"image"===a.type},reset:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"reset"===a.type},button:function(a){var b=a.nodeName.toLowerCase();return b==="input"&&"button"===a.type||b==="button"},input:function(a){return/input|select|textarea|button/i.test(a.nodeName)},focus:function(a){return a===a.ownerDocument.activeElement}},setFilters:{first:function(a,b){return b===0},last:function(a,b,c,d){return b===d.length-1},even:function(a,b){return b%2===0},odd:function(a,b){return b%2===1},lt:function(a,b,c){return bc[3]-0},nth:function(a,b,c){return c[3]-0===b},eq:function(a,b,c){return c[3]-0===b}},filter:{PSEUDO:function(a,b,c,d){var e=b[1],f=l.filters[e];if(f)return f(a,c,b,d);if(e==="contains")return(a.textContent||a.innerText||k.getText([a])||"").indexOf(b[3])>=0;if(e==="not"){var g=b[3];for(var h=0,i=g.length;h=0}},ID:function(a,b){return a.nodeType===1&&a.getAttribute("id")===b},TAG:function(a,b){return b==="*"&&a.nodeType===1||a.nodeName.toLowerCase()===b},CLASS:function(a,b){return(" "+(a.className||a.getAttribute("class"))+" ").indexOf(b)>-1},ATTR:function(a,b){var c=b[1],d=l.attrHandle[c]?l.attrHandle[c](a):a[c]!=null?a[c]:a.getAttribute(c),e=d+"",f=b[2],g=b[4];return d==null?f==="!=":f==="="?e===g:f==="*="?e.indexOf(g)>=0:f==="~="?(" "+e+" ").indexOf(g)>=0:g?f==="!="?e!==g:f==="^="?e.indexOf(g)===0:f==="$="?e.substr(e.length-g.length)===g:f==="|="?e===g||e.substr(0,g.length+1)===g+"-":!1:e&&d!==!1},POS:function(a,b,c,d){var e=b[2],f=l.setFilters[e];if(f)return f(a,c,b,d)}}},m=l.match.POS,n=function(a,b){return"\\"+(b-0+1)};for(var o in l.match)l.match[o]=new RegExp(l.match[o].source+/(?![^\[]*\])(?![^\(]*\))/.source),l.leftMatch[o]=new RegExp(/(^(?:.|\r|\n)*?)/.source+l.match[o].source.replace(/\\(\d+)/g,n));var p=function(a,b){a=Array.prototype.slice.call(a,0);if(b){b.push.apply(b,a);return b}return a};try{Array.prototype.slice.call(c.documentElement.childNodes,0)[0].nodeType}catch(q){p=function(a,b){var c=0,d=b||[];if(e.call(a)==="[object Array]")Array.prototype.push.apply(d,a);else if(typeof a.length=="number")for(var f=a.length;c",e.insertBefore(a,e.firstChild),c.getElementById(d)&&(l.find.ID=function(a,c,d){if(typeof c.getElementById!="undefined"&&!d){var e=c.getElementById(a[1]);return e?e.id===a[1]||typeof e.getAttributeNode!="undefined"&&e.getAttributeNode("id").nodeValue===a[1]?[e]:b:[]}},l.filter.ID=function(a,b){var c=typeof a.getAttributeNode!="undefined"&&a.getAttributeNode("id");return a.nodeType===1&&c&&c.nodeValue===b}),e.removeChild(a),e=a=null}(),function(){var a=c.createElement("div");a.appendChild(c.createComment("")),a.getElementsByTagName("*").length>0&&(l.find.TAG=function(a,b){var c=b.getElementsByTagName(a[1]);if(a[1]==="*"){var d=[];for(var e=0;c[e];e++)c[e].nodeType===1&&d.push(c[e]);c=d}return c}),a.innerHTML="",a.firstChild&&typeof a.firstChild.getAttribute!="undefined"&&a.firstChild.getAttribute("href")!=="#"&&(l.attrHandle.href=function(a){return a.getAttribute("href",2)}),a=null}(),c.querySelectorAll&&function(){var a=k,b=c.createElement("div"),d="__sizzle__";b.innerHTML="

    ";if(!b.querySelectorAll||b.querySelectorAll(".TEST").length!==0){k=function(b,e,f,g){e=e||c;if(!g&&!k.isXML(e)){var h=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b);if(h&&(e.nodeType===1||e.nodeType===9)){if(h[1])return p(e.getElementsByTagName(b),f);if(h[2]&&l.find.CLASS&&e.getElementsByClassName)return p(e.getElementsByClassName(h[2]),f)}if(e.nodeType===9){if(b==="body"&&e.body)return p([e.body],f);if(h&&h[3]){var i=e.getElementById(h[3]);if(!i||!i.parentNode)return p([],f);if(i.id===h[3])return p([i],f)}try{return p(e.querySelectorAll(b),f)}catch(j){}}else if(e.nodeType===1&&e.nodeName.toLowerCase()!=="object"){var m=e,n=e.getAttribute("id"),o=n||d,q=e.parentNode,r=/^\s*[+~]/.test(b);n?o=o.replace(/'/g,"\\$&"):e.setAttribute("id",o),r&&q&&(e=e.parentNode);try{if(!r||q)return p(e.querySelectorAll("[id='"+o+"'] "+b),f)}catch(s){}finally{n||m.removeAttribute("id")}}}return a(b,e,f,g)};for(var e in a)k[e]=a[e];b=null}}(),function(){var a=c.documentElement,b=a.matchesSelector||a.mozMatchesSelector||a.webkitMatchesSelector||a.msMatchesSelector;if(b){var d=!b.call(c.createElement("div"),"div"),e=!1;try{b.call(c.documentElement,"[test!='']:sizzle")}catch(f){e=!0}k.matchesSelector=function(a,c){c=c.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!k.isXML(a))try{if(e||!l.match.PSEUDO.test(c)&&!/!=/.test(c)){var f=b.call(a,c);if(f||!d||a.document&&a.document.nodeType!==11)return f}}catch(g){}return k(c,null,null,[a]).length>0}}}(),function(){var a=c.createElement("div");a.innerHTML="
    ";if(!!a.getElementsByClassName&&a.getElementsByClassName("e").length!==0){a.lastChild.className="e";if(a.getElementsByClassName("e").length===1)return;l.order.splice(1,0,"CLASS"),l.find.CLASS=function(a,b,c){if(typeof b.getElementsByClassName!="undefined"&&!c)return b.getElementsByClassName(a[1])},a=null}}(),c.documentElement.contains?k.contains=function(a,b){return a!==b&&(a.contains?a.contains(b):!0)}:c.documentElement.compareDocumentPosition?k.contains=function(a,b){return!!(a.compareDocumentPosition(b)&16)}:k.contains=function(){return!1},k.isXML=function(a){var b=(a?a.ownerDocument||a:0).documentElement;return b?b.nodeName!=="HTML":!1};var v=function(a,b){var c,d=[],e="",f=b.nodeType?[b]:b;while(c=l.match.PSEUDO.exec(a))e+=c[0],a=a.replace(l.match.PSEUDO,"");a=l.relative[a]?a+"*":a;for(var g=0,h=f.length;g0)for(h=g;h0:this.filter(a).length>0)},closest:function(a,b){var c=[],d,e,g=this[0];if(f.isArray(a)){var h,i,j={},k=1;if(g&&a.length){for(d=0,e=a.length;d-1:f(g).is(h))&&c.push({selector:i,elem:g,level:k});g=g.parentNode,k++}}return c}var l=T.test(a)||typeof a!="string"?f(a,b||this.context):0;for(d=0,e=this.length;d-1:f.find.matchesSelector(g,a)){c.push(g);break}g=g.parentNode;if(!g||!g.ownerDocument||g===b||g.nodeType===11)break}}c=c.length>1?f.unique(c):c;return this.pushStack(c,"closest",a)},index:function(a){if(!a||typeof a=="string")return f.inArray(this[0],a?f(a):this.parent().children());return f.inArray(a.jquery?a[0]:a,this)},add:function(a,b){var c=typeof a=="string"?f(a,b):f.makeArray(a&&a.nodeType?[a]:a),d=f.merge(this.get(),c);return this.pushStack(V(c[0])||V(d[0])?d:f.unique(d))},andSelf:function(){return this.add(this.prevObject)}}),f.each({parent:function(a){var b=a.parentNode;return b&&b.nodeType!==11?b:null},parents:function(a){return f.dir(a,"parentNode")},parentsUntil:function(a,b,c){return f.dir(a,"parentNode",c)},next:function(a){return f.nth(a,2,"nextSibling")},prev:function(a){return f.nth(a,2,"previousSibling")},nextAll:function(a){return f.dir(a,"nextSibling")},prevAll:function(a){return f.dir(a,"previousSibling")},nextUntil:function(a,b,c){return f.dir(a,"nextSibling",c)},prevUntil:function(a,b,c){return f.dir(a,"previousSibling",c)},siblings:function(a){return f.sibling(a.parentNode.firstChild,a)},children:function(a){return f.sibling(a.firstChild)},contents:function(a){return f.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:f.makeArray(a.childNodes)}},function(a,b){f.fn[a]=function(c,d){var e=f.map(this,b,c),g=S.call(arguments);O.test(a)||(d=c),d&&typeof d=="string"&&(e=f.filter(d,e)),e=this.length>1&&!U[a]?f.unique(e):e,(this.length>1||Q.test(d))&&P.test(a)&&(e=e.reverse());return this.pushStack(e,a,g.join(","))}}),f.extend({filter:function(a,b,c){c&&(a=":not("+a+")");return b.length===1?f.find.matchesSelector(b[0],a)?[b[0]]:[]:f.find.matches(a,b)},dir:function(a,c,d){var e=[],g=a[c];while(g&&g.nodeType!==9&&(d===b||g.nodeType!==1||!f(g).is(d)))g.nodeType===1&&e.push(g),g=g[c];return e},nth:function(a,b,c,d){b=b||1;var e=0;for(;a;a=a[c])if(a.nodeType===1&&++e===b)break;return a},sibling:function(a,b){var c=[];for(;a;a=a.nextSibling)a.nodeType===1&&a!==b&&c.push(a);return c}});var X=/ jQuery\d+="(?:\d+|null)"/g,Y=/^\s+/,Z=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,$=/<([\w:]+)/,_=/",""],legend:[1,"
    ","
    "],thead:[1,"","
    "],tr:[2,"","
    "],td:[3,"","
    "],col:[2,"","
    "],area:[1,"",""],_default:[0,"",""]};bf.optgroup=bf.option,bf.tbody=bf.tfoot=bf.colgroup=bf.caption=bf.thead,bf.th=bf.td,f.support.htmlSerialize||(bf._default=[1,"div
    ","
    "]),f.fn.extend({text:function(a){if(f.isFunction(a))return this.each(function(b){var c=f(this);c.text(a.call(this,b,c.text()))});if(typeof a!="object"&&a!==b)return this.empty().append((this[0]&&this[0].ownerDocument||c).createTextNode(a));return f.text(this)},wrapAll:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapAll(a.call(this,b))});if(this[0]){var b=f(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&a.firstChild.nodeType===1)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapInner(a.call(this,b))});return this.each(function(){var b=f(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){return this.each(function(){f(this).wrapAll(a)})},unwrap:function(){return this.parent().each(function(){f.nodeName(this,"body")||f(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this)});if(arguments.length){var a=f(arguments[0]);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this.nextSibling)});if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,f(arguments[0]).toArray());return a}},remove:function(a,b){for(var c=0,d;(d=this[c])!=null;c++)if(!a||f.filter(a,[d]).length)!b&&d.nodeType===1&&(f.cleanData(d.getElementsByTagName("*")),f.cleanData([d])),d.parentNode&&d.parentNode.removeChild(d);return this},empty:function(){for(var a=0,b;(b=this[a])!=null;a++){b.nodeType===1&&f.cleanData(b.getElementsByTagName("*"));while(b.firstChild)b.removeChild(b.firstChild)}return this},clone:function(a,b){a=a==null?!1:a,b=b==null?a:b;return this.map(function(){return f.clone(this,a,b)})},html:function(a){if(a===b)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(X,""):null;if(typeof a=="string"&&!bb.test(a)&&(f.support.leadingWhitespace||!Y.test(a))&&!bf[($.exec(a)||["",""])[1].toLowerCase()]){a=a.replace(Z,"<$1>");try{for(var c=0,d=this.length;c1&&l0?this.clone(!0):this).get();f(e[h])[b](j),d=d.concat(j )}return this.pushStack(d,a,e.selector)}}),f.extend({clone:function(a,b,c){var d=a.cloneNode(!0),e,g,h;if((!f.support.noCloneEvent||!f.support.noCloneChecked)&&(a.nodeType===1||a.nodeType===11)&&!f.isXMLDoc(a)){bi(a,d),e=bj(a),g=bj(d);for(h=0;e[h];++h)bi(e[h],g[h])}if(b){bh(a,d);if(c){e=bj(a),g=bj(d);for(h=0;e[h];++h)bh(e[h],g[h])}}e=g=null;return d},clean:function(a,b,d,e){var g;b=b||c,typeof b.createElement=="undefined"&&(b=b.ownerDocument||b[0]&&b[0].ownerDocument||c);var h=[],i;for(var j=0,k;(k=a[j])!=null;j++){typeof k=="number"&&(k+="");if(!k)continue;if(typeof k=="string")if(!ba.test(k))k=b.createTextNode(k);else{k=k.replace(Z,"<$1>");var l=($.exec(k)||["",""])[1].toLowerCase(),m=bf[l]||bf._default,n=m[0],o=b.createElement("div");o.innerHTML=m[1]+k+m[2];while(n--)o=o.lastChild;if(!f.support.tbody){var p=_.test(k),q=l==="table"&&!p?o.firstChild&&o.firstChild.childNodes:m[1]===""&&!p?o.childNodes:[];for(i=q.length-1;i>=0;--i)f.nodeName(q[i],"tbody")&&!q[i].childNodes.length&&q[i].parentNode.removeChild(q[i])}!f.support.leadingWhitespace&&Y.test(k)&&o.insertBefore(b.createTextNode(Y.exec(k)[0]),o.firstChild),k=o.childNodes}var r;if(!f.support.appendChecked)if(k[0]&&typeof (r=k.length)=="number")for(i=0;i=0)return b+"px"}}}),f.support.opacity||(f.cssHooks.opacity={get:function(a,b){return bo.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?parseFloat(RegExp.$1)/100+"":b?"1":""},set:function(a,b){var c=a.style,d=a.currentStyle;c.zoom=1;var e=f.isNaN(b)?"":"alpha(opacity="+b*100+")",g=d&&d.filter||c.filter||"";c.filter=bn.test(g)?g.replace(bn,e):g+" "+e}}),f(function(){f.support.reliableMarginRight||(f.cssHooks.marginRight={get:function(a,b){var c;f.swap(a,{display:"inline-block"},function(){b?c=bx(a,"margin-right","marginRight"):c=a.style.marginRight});return c}})}),c.defaultView&&c.defaultView.getComputedStyle&&(by=function(a,c){var d,e,g;c=c.replace(bp,"-$1").toLowerCase();if(!(e=a.ownerDocument.defaultView))return b;if(g=e.getComputedStyle(a,null))d=g.getPropertyValue(c),d===""&&!f.contains(a.ownerDocument.documentElement,a)&&(d=f.style(a,c));return d}),c.documentElement.currentStyle&&(bz=function(a,b){var c,d=a.currentStyle&&a.currentStyle[b],e=a.runtimeStyle&&a.runtimeStyle[b],f=a.style;!bq.test(d)&&br.test(d)&&(c=f.left,e&&(a.runtimeStyle.left=a.currentStyle.left),f.left=b==="fontSize"?"1em":d||0,d=f.pixelLeft+"px",f.left=c,e&&(a.runtimeStyle.left=e));return d===""?"auto":d}),bx=by||bz,f.expr&&f.expr.filters&&(f.expr.filters.hidden=function(a){var b=a.offsetWidth,c=a.offsetHeight;return b===0&&c===0||!f.support.reliableHiddenOffsets&&(a.style.display||f.css(a,"display"))==="none"},f.expr.filters.visible=function(a){return!f.expr.filters.hidden(a)});var bB=/%20/g,bC=/\[\]$/,bD=/\r?\n/g,bE=/#.*$/,bF=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,bG=/^(?:color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,bH=/^(?:about|app|app\-storage|.+\-extension|file|widget):$/,bI=/^(?:GET|HEAD)$/,bJ=/^\/\//,bK=/\?/,bL=/)<[^<]*)*<\/script>/gi,bM=/^(?:select|textarea)/i,bN=/\s+/,bO=/([?&])_=[^&]*/,bP=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,bQ=f.fn.load,bR={},bS={},bT,bU;try{bT=e.href}catch(bV){bT=c.createElement("a"),bT.href="",bT=bT.href}bU=bP.exec(bT.toLowerCase())||[],f.fn.extend({load:function(a,c,d){if(typeof a!="string"&&bQ)return bQ.apply(this,arguments);if(!this.length)return this;var e=a.indexOf(" ");if(e>=0){var g=a.slice(e,a.length);a=a.slice(0,e)}var h="GET";c&&(f.isFunction(c)?(d=c,c=b):typeof c=="object"&&(c=f.param(c,f.ajaxSettings.traditional),h="POST"));var i=this;f.ajax({url:a,type:h,dataType:"html",data:c,complete:function(a,b,c){c=a.responseText,a.isResolved()&&(a.done(function(a){c=a}),i.html(g?f("
    ").append(c.replace(bL,"")).find(g):c)),d&&i.each(d,[c,b,a])}});return this},serialize:function(){return f.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?f.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||bM.test(this.nodeName)||bG.test(this.type))}).map(function(a,b){var c=f(this).val();return c==null?null:f.isArray(c)?f.map(c,function(a,c){return{name:b.name,value:a.replace(bD,"\r\n")}}):{name:b.name,value:c.replace(bD,"\r\n")}}).get()}}),f.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){f.fn[b]=function(a){return this.bind(b,a)}}),f.each(["get","post"],function(a,c){f[c]=function(a,d,e,g){f.isFunction(d)&&(g=g||e,e=d,d=b);return f.ajax({type:c,url:a,data:d,success:e,dataType:g})}}),f.extend({getScript:function(a,c){return f.get(a,b,c,"script")},getJSON:function(a,b,c){return f.get(a,b,c,"json")},ajaxSetup:function(a,b){b?f.extend(!0,a,f.ajaxSettings,b):(b=a,a=f.extend(!0,f.ajaxSettings,b));for(var c in{context:1,url:1})c in b?a[c]=b[c]:c in f.ajaxSettings&&(a[c]=f.ajaxSettings[c]);return a},ajaxSettings:{url:bT,isLocal:bH.test(bU[1]),global:!0,type:"GET",contentType:"application/x-www-form-urlencoded",processData:!0,async:!0,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":"*/*"},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":a.String,"text html":!0,"text json":f.parseJSON,"text xml":f.parseXML}},ajaxPrefilter:bW(bR),ajaxTransport:bW(bS),ajax:function(a,c){function w(a,c,l,m){if(s!==2){s=2,q&&clearTimeout(q),p=b,n=m||"",v.readyState=a?4:0;var o,r,u,w=l?bZ(d,v,l):b,x,y;if(a>=200&&a<300||a===304){if(d.ifModified){if(x=v.getResponseHeader("Last-Modified"))f.lastModified[k]=x;if(y=v.getResponseHeader("Etag"))f.etag[k]=y}if(a===304)c="notmodified",o=!0;else try{r=b$(d,w),c="success",o=!0}catch(z){c="parsererror",u=z}}else{u=c;if(!c||a)c="error",a<0&&(a=0)}v.status=a,v.statusText=c,o?h.resolveWith(e,[r,c,v]):h.rejectWith(e,[v,c,u]),v.statusCode(j),j=b,t&&g.trigger("ajax"+(o?"Success":"Error"),[v,d,o?r:u]),i.resolveWith(e,[v,c]),t&&(g.trigger("ajaxComplete",[v,d]),--f.active||f.event.trigger("ajaxStop"))}}typeof a=="object"&&(c=a,a=b),c=c||{};var d=f.ajaxSetup({},c),e=d.context||d,g=e!==d&&(e.nodeType||e instanceof f)?f(e):f.event,h=f.Deferred(),i=f._Deferred(),j=d.statusCode||{},k,l={},m={},n,o,p,q,r,s=0,t,u,v={readyState:0,setRequestHeader:function(a,b){if(!s){var c=a.toLowerCase();a=m[c]=m[c]||a,l[a]=b}return this},getAllResponseHeaders:function(){return s===2?n:null},getResponseHeader:function(a){var c;if(s===2){if(!o){o={};while(c=bF.exec(n))o[c[1].toLowerCase()]=c[2]}c=o[a.toLowerCase()]}return c===b?null:c},overrideMimeType:function(a){s||(d.mimeType=a);return this},abort:function(a){a=a||"abort",p&&p.abort(a),w(0,a);return this}};h.promise(v),v.success=v.done,v.error=v.fail,v.complete=i.done,v.statusCode=function(a){if(a){var b;if(s<2)for(b in a)j[b]=[j[b],a[b]];else b=a[v.status],v.then(b,b)}return this},d.url=((a||d.url)+"").replace(bE,"").replace(bJ,bU[1]+"//"),d.dataTypes=f.trim(d.dataType||"*").toLowerCase().split(bN),d.crossDomain==null&&(r=bP.exec(d.url.toLowerCase()),d.crossDomain=!(!r||r[1]==bU[1]&&r[2]==bU[2]&&(r[3]||(r[1]==="http:"?80:443))==(bU[3]||(bU[1]==="http:"?80:443)))),d.data&&d.processData&&typeof d.data!="string"&&(d.data=f.param(d.data,d.traditional)),bX(bR,d,c,v);if(s===2)return!1;t=d.global,d.type=d.type.toUpperCase(),d.hasContent=!bI.test(d.type),t&&f.active++===0&&f.event.trigger("ajaxStart");if(!d.hasContent){d.data&&(d.url+=(bK.test(d.url)?"&":"?")+d.data),k=d.url;if(d.cache===!1){var x=f.now(),y=d.url.replace(bO,"$1_="+x);d.url=y+(y===d.url?(bK.test(d.url)?"&":"?")+"_="+x:"")}}(d.data&&d.hasContent&&d.contentType!==!1||c.contentType)&&v.setRequestHeader("Content-Type",d.contentType),d.ifModified&&(k=k||d.url,f.lastModified[k]&&v.setRequestHeader("If-Modified-Since",f.lastModified[k]),f.etag[k]&&v.setRequestHeader("If-None-Match",f.etag[k])),v.setRequestHeader("Accept",d.dataTypes[0]&&d.accepts[d.dataTypes[0]]?d.accepts[d.dataTypes[0]]+(d.dataTypes[0]!=="*"?", */*; q=0.01":""):d.accepts["*"]);for(u in d.headers)v.setRequestHeader(u,d.headers[u]);if(d.beforeSend&&(d.beforeSend.call(e,v,d)===!1||s===2)){v.abort();return!1}for(u in{success:1,error:1,complete:1})v[u](d[u]);p=bX(bS,d,c,v);if(!p)w(-1,"No Transport");else{v.readyState=1,t&&g.trigger("ajaxSend",[v,d]),d.async&&d.timeout>0&&(q=setTimeout(function(){v.abort("timeout")},d.timeout));try{s=1,p.send(l,w)}catch(z){status<2?w(-1,z):f.error(z)}}return v},param:function(a,c){var d=[],e=function(a,b){b=f.isFunction(b)?b():b,d[d.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)};c===b&&(c=f.ajaxSettings.traditional);if(f.isArray(a)||a.jquery&&!f.isPlainObject(a))f.each(a,function(){e(this.name,this.value)});else for(var g in a)bY(g,a[g],c,e);return d.join("&").replace(bB,"+")}}),f.extend({active:0,lastModified:{},etag:{}});var b_=f.now(),ca=/(\=)\?(&|$)|\?\?/i;f.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return f.expando+"_"+b_++}}),f.ajaxPrefilter("json jsonp",function(b,c,d){var e=b.contentType==="application/x-www-form-urlencoded"&&typeof b.data=="string";if(b.dataTypes[0]==="jsonp"||b.jsonp!==!1&&(ca.test(b.url)||e&&ca.test(b.data))){var g,h=b.jsonpCallback=f.isFunction(b.jsonpCallback)?b.jsonpCallback():b.jsonpCallback,i=a[h],j=b.url,k=b.data,l="$1"+h+"$2";b.jsonp!==!1&&(j=j.replace(ca,l),b.url===j&&(e&&(k=k.replace(ca,l)),b.data===k&&(j+=(/\?/.test(j)?"&":"?")+b.jsonp+"="+h))),b.url=j,b.data=k,a[h]=function(a){g=[a]},d.always(function(){a[h]=i,g&&f.isFunction(i)&&a[h](g[0])}),b.converters["script json"]=function(){g||f.error(h+" was not called");return g[0]},b.dataTypes[0]="json";return"script"}}),f.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(a){f.globalEval(a);return a}}}),f.ajaxPrefilter("script",function(a){a.cache===b&&(a.cache=!1),a.crossDomain&&(a.type="GET",a.global=!1)}),f.ajaxTransport("script",function(a){if(a.crossDomain){var d,e=c.head||c.getElementsByTagName("head")[0]||c.documentElement;return{send:function(f,g){d=c.createElement("script"),d.async="async",a.scriptCharset&&(d.charset=a.scriptCharset),d.src=a.url,d.onload=d.onreadystatechange=function(a,c){if(c||!d.readyState||/loaded|complete/.test(d.readyState))d.onload=d.onreadystatechange=null,e&&d.parentNode&&e.removeChild(d),d=b,c||g(200,"success")},e.insertBefore(d,e.firstChild)},abort:function(){d&&d.onload(0,1)}}}});var cb=a.ActiveXObject?function(){for(var a in cd)cd[a](0,1)}:!1,cc=0,cd;f.ajaxSettings.xhr=a.ActiveXObject?function(){return!this.isLocal&&ce()||cf()}:ce,function(a){f.extend(f.support,{ajax:!!a,cors:!!a&&"withCredentials"in a})}(f.ajaxSettings.xhr()),f.support.ajax&&f.ajaxTransport(function(c){if(!c.crossDomain||f.support.cors){var d;return{send:function(e,g){var h=c.xhr(),i,j;c.username?h.open(c.type,c.url,c.async,c.username,c.password):h.open(c.type,c.url,c.async);if(c.xhrFields)for(j in c.xhrFields)h[j]=c.xhrFields[j];c.mimeType&&h.overrideMimeType&&h.overrideMimeType(c.mimeType),!c.crossDomain&&!e["X-Requested-With"]&&(e["X-Requested-With"]="XMLHttpRequest");try{for(j in e)h.setRequestHeader(j,e[j])}catch(k){}h.send(c.hasContent&&c.data||null),d=function(a,e){var j,k,l,m,n;try{if(d&&(e||h.readyState===4)){d=b,i&&(h.onreadystatechange=f.noop,cb&&delete cd[i]);if(e)h.readyState!==4&&h.abort();else{j=h.status,l=h.getAllResponseHeaders(),m={},n=h.responseXML,n&&n.documentElement&&(m.xml=n),m.text=h.responseText;try{k=h.statusText}catch(o){k=""}!j&&c.isLocal&&!c.crossDomain?j=m.text?200:404:j===1223&&(j=204)}}}catch(p){e||g(-1,p)}m&&g(j,k,m,l)},!c.async||h.readyState===4?d():(i=++cc,cb&&(cd||(cd={},f(a).unload(cb)),cd[i]=d),h.onreadystatechange=d)},abort:function(){d&&d(0,1)}}}});var cg={},ch,ci,cj=/^(?:toggle|show|hide)$/,ck=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,cl,cm=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]],cn,co=a.webkitRequestAnimationFrame||a.mozRequestAnimationFrame||a.oRequestAnimationFrame;f.fn.extend({show:function(a,b,c){var d,e;if(a||a===0)return this.animate(cr("show",3),a,b,c);for(var g=0,h=this.length;g=e.duration+this.startTime){this.now=this.end,this.pos=this.state=1,this.update(),e.animatedProperties[this.prop]=!0;for(g in e.animatedProperties)e.animatedProperties[g]!==!0&&(c=!1);if(c){e.overflow!=null&&!f.support.shrinkWrapBlocks&&f.each(["","X","Y"],function(a,b){d.style["overflow"+b]=e.overflow[a]}),e.hide&&f(d).hide();if(e.hide||e.show)for(var i in e.animatedProperties)f.style(d,i,e.orig[i]);e.complete.call(d)}return!1}e.duration==Infinity?this.now=b:(h=b-this.startTime,this.state=h/e.duration,this.pos=f.easing[e.animatedProperties[this.prop]](this.state,h,0,1,e.duration),this.now=this.start+(this.end-this.start)*this.pos),this.update();return!0}},f.extend(f.fx,{tick:function(){for(var a=f.timers,b=0;b
    ";f.extend(b.style,{position:"absolute",top:0,left:0,margin:0,border:0,width:"1px",height:"1px",visibility:"hidden"}),b.innerHTML=j,a.insertBefore(b,a.firstChild),d=b.firstChild,e=d.firstChild,h=d.nextSibling.firstChild.firstChild,this.doesNotAddBorder=e.offsetTop!==5,this.doesAddBorderForTableAndCells=h.offsetTop===5,e.style.position="fixed",e.style.top="20px",this.supportsFixedPosition=e.offsetTop===20||e.offsetTop===15,e.style.position=e.style.top="",d.style.overflow="hidden",d.style.position="relative",this.subtractsBorderForOverflowNotVisible=e.offsetTop===-5,this.doesNotIncludeMarginInBodyOffset=a.offsetTop!==i,a.removeChild(b),f.offset.initialize=f.noop},bodyOffset:function(a){var b=a.offsetTop,c=a.offsetLeft;f.offset.initialize(),f.offset.doesNotIncludeMarginInBodyOffset&&(b+=parseFloat(f.css(a,"marginTop"))||0,c+=parseFloat(f.css(a,"marginLeft"))||0);return{top:b,left:c}},setOffset:function(a,b,c){var d=f.css(a,"position");d==="static"&&(a.style.position="relative");var e=f(a),g=e.offset(),h=f.css(a,"top"),i=f.css(a,"left"),j=(d==="absolute"||d==="fixed")&&f.inArray("auto",[h,i])>-1,k={},l={},m,n;j?(l=e.position(),m=l.top,n=l.left):(m=parseFloat(h)||0,n=parseFloat(i)||0),f.isFunction(b)&&(b=b.call(a,c,g)),b.top!=null&&(k.top=b.top-g.top+m),b.left!=null&&(k.left=b.left-g.left+n),"using"in b?b.using.call(a,k):e.css(k)}},f.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),c=this.offset(),d=cu.test(b[0].nodeName)?{top:0,left:0}:b.offset();c.top-=parseFloat(f.css(a,"marginTop"))||0,c.left-=parseFloat(f.css(a,"marginLeft"))||0,d.top+=parseFloat(f.css(b[0],"borderTopWidth"))||0,d.left+=parseFloat(f.css(b[0],"borderLeftWidth"))||0;return{top:c.top-d.top,left:c.left-d.left}},offsetParent:function(){return this.map(function(){var a=this.offsetParent||c.body;while(a&&!cu.test(a.nodeName)&&f.css(a,"position")==="static")a=a.offsetParent;return a})}}),f.each(["Left","Top"],function(a,c){var d="scroll"+c;f.fn[d]=function(c){var e,g;if(c===b){e=this[0];if(!e)return null;g=cv(e);return g?"pageXOffset"in g?g[a?"pageYOffset":"pageXOffset"]:f.support.boxModel&&g.document.documentElement[d]||g.document.body[d]:e[d]}return this.each(function(){g=cv(this),g?g.scrollTo(a?f(g).scrollLeft():c,a?c:f(g).scrollTop()):this[d]=c})}}),f.each(["Height","Width"],function(a,c){var d=c.toLowerCase();f.fn["inner"+c]=function(){var a=this[0];return a&&a.style?parseFloat(f.css(a,d,"padding")):null},f.fn["outer"+c]=function(a){var b=this[0];return b&&b.style?parseFloat(f.css(b,d,a?"margin":"border")):null},f.fn[d]=function(a){var e=this[0];if(!e)return a==null?null:this;if(f.isFunction(a))return this.each(function(b){var c=f(this);c[d](a.call(this,b,c[d]()))});if(f.isWindow(e)){var g=e.document.documentElement["client"+c];return e.document.compatMode==="CSS1Compat"&&g||e.document.body["client"+c]||g}if(e.nodeType===9)return Math.max(e.documentElement["client"+c],e.body["scroll"+c],e.documentElement["scroll"+c],e.body["offset"+c],e.documentElement["offset"+c]);if(a===b){var h=f.css(e,d),i=parseFloat(h);return f.isNaN(i)?h:i}return this.css(d,typeof a=="string"?a:a+"px")}}),a.jQuery=a.$=f})(window); \ No newline at end of file diff --git a/js/jquery-ui-1.8.16.custom.min.js b/Wordpress/js/jquery-ui-1.8.16.custom.min.js similarity index 99% rename from js/jquery-ui-1.8.16.custom.min.js rename to Wordpress/js/jquery-ui-1.8.16.custom.min.js index 14c9064..c05c213 100644 --- a/js/jquery-ui-1.8.16.custom.min.js +++ b/Wordpress/js/jquery-ui-1.8.16.custom.min.js @@ -1,791 +1,791 @@ -/*! - * jQuery UI 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI - */ -(function(c,j){function k(a,b){var d=a.nodeName.toLowerCase();if("area"===d){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&l(a)}return(/input|select|textarea|button|object/.test(d)?!a.disabled:"a"==d?a.href||b:b)&&l(a)}function l(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.16", -keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({propAttr:c.fn.prop||c.fn.attr,_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d= -this;setTimeout(function(){c(d).focus();b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this, -"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart": -"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,m,n){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(m)g-=parseFloat(c.curCSS(f,"border"+this+"Width",true))||0;if(n)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight, -outerWidth:c.fn.outerWidth,outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h,d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){return k(a,!isNaN(c.attr(a,"tabindex")))},tabbable:function(a){var b=c.attr(a, -"tabindex"),d=isNaN(b);return(d||b>=0)&&k(a,!d)}});c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&& -a.element[0].parentNode)for(var e=0;e0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted= -false;a.target==this._mouseDownEvent.target&&b.data(a.target,this.widgetName+".preventClickEvent",true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery); -;/* - * jQuery UI Position 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Position - */ -(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY, -left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+= -k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-= -m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left= -d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+= -a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b), -g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery); -;/* - * jQuery UI Draggable 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Draggables - * - * Depends: - * jquery.ui.core.js - * jquery.ui.mouse.js - * jquery.ui.widget.js - */ -(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper== -"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b= -this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;if(b.iframeFix)d(b.iframeFix===true?"iframe":b.iframeFix).each(function(){d('
    ').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")});return true},_mouseStart:function(a){var b=this.options; -this.helper=this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}); -this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions();d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);d.ui.ddmanager&&d.ui.ddmanager.dragStart(this,a);return true}, -_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b= -false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&&this.options.revert.call(this.element,b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration, -10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},_mouseUp:function(a){this.options.iframeFix===true&&d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)});d.ui.ddmanager&&d.ui.ddmanager.dragStop(this,a);return d.ui.mouse.prototype._mouseUp.call(this,a)},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle|| -!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone().removeAttr("id"):this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&& -a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent= -this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"), -10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"), -10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[a.containment=="document"?0:d(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,a.containment=="document"?0:d(window).scrollTop()-this.offset.relative.top-this.offset.parent.top, -(a.containment=="document"?0:d(window).scrollLeft())+d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"?0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&a.containment.constructor!=Array){a=d(a.containment);var b=a[0];if(b){a.offset();var c=d(b).css("overflow")!= -"hidden";this.containment=[(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0),(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0),(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"), -10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom];this.relative_container=a}}else if(a.containment.constructor==Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+ -this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&& -!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,h=a.pageY;if(this.originalPosition){var g;if(this.containment){if(this.relative_container){g=this.relative_container.offset();g=[this.containment[0]+g.left,this.containment[1]+g.top,this.containment[2]+g.left,this.containment[3]+g.top]}else g=this.containment;if(a.pageX-this.offset.click.leftg[2])e=g[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>g[3])h=g[3]+this.offset.click.top}if(b.grid){h=b.grid[1]?this.originalPageY+Math.round((h-this.originalPageY)/b.grid[1])*b.grid[1]:this.originalPageY;h=g?!(h-this.offset.click.topg[3])?h:!(h-this.offset.click.topg[2])?e:!(e-this.offset.click.left=0;i--){var j=c.snapElements[i].left,l=j+c.snapElements[i].width,k=c.snapElements[i].top,m=k+c.snapElements[i].height;if(j-e=j&&f<=l||h>=j&&h<=l||fl)&&(e>= -i&&e<=k||g>=i&&g<=k||ek);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f
    ').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(), -top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle= -this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne", -nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d
    ');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor== -String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),l=0;l=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,l);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection(); -this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){if(!a.disabled){e(this).removeClass("ui-resizable-autohide");b._handles.show()}},function(){if(!a.disabled)if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy(); -var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a= -false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(),d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"}); -this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff= -{width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio:this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis]; -if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);this._updateVirtualBoundaries(b.shiftKey);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize",b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false}, -_mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height;f=f?0:c.sizeDiff.width;f={width:c.helper.width()-f,height:c.helper.height()-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f, -{top:g,left:d}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",b);this._helper&&this.helper.remove();return false},_updateVirtualBoundaries:function(b){var a=this.options,c,d,f;a={minWidth:k(a.minWidth)?a.minWidth:0,maxWidth:k(a.maxWidth)?a.maxWidth:Infinity,minHeight:k(a.minHeight)?a.minHeight:0,maxHeight:k(a.maxHeight)?a.maxHeight: -Infinity};if(this._aspectRatio||b){b=a.minHeight*this.aspectRatio;d=a.minWidth/this.aspectRatio;c=a.maxHeight*this.aspectRatio;f=a.maxWidth/this.aspectRatio;if(b>a.minWidth)a.minWidth=b;if(d>a.minHeight)a.minHeight=d;if(cb.width,h=k(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+this.size.height,l=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&l)b.left=i-a.minWidth;if(d&&l)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left= -null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper||this.element,a=0;a
    ');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+ -a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b,a){return{width:this.originalSize.width+a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+ -c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a,c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]); -b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,{version:"1.8.16"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(), -10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize=b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top- -f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var l=e(this),q=e(this).data("resizable-alsoresize"),p={},r=j&&j.length?j:l.parents(a.originalElement[0]).length?["width","height"]:["width","height","top","left"];e.each(r,function(n,o){if((n=(q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(l.css("position"))){c._revertToRelativePosition=true;l.css({position:"absolute",top:"auto",left:"auto"})}l.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType? -e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})};if(b._revertToRelativePosition){b._revertToRelativePosition=false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a= -e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height-g};g=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing, -step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width,height:i.height});a._updateCache(i);a._propagate("resize",b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement= -e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d=e(a),f=[];e(["Top","Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset; -var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options,d=a.containerOffset,f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left: -a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left:0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper?d.top:0}a.offset.left=a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top- -d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative|absolute/.test(a.containerElement.css("position"));if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height=a.size.width/a.aspectRatio}if(d+a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition, -f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&&!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&&/static/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25, -display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost=="string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable");b.ghost&&b.ghost.css({position:"relative",height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b= -e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;var h=Math.round((c.width-d.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-d.height)/(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height= -d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b,10)||0},k=function(b){return!isNaN(parseInt(b,10))}})(jQuery); -;/* - * jQuery UI Selectable 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Selectables - * - * Depends: - * jquery.ui.core.js - * jquery.ui.mouse.js - * jquery.ui.widget.js - */ -(function(e){e.widget("ui.selectable",e.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=e(c.options.filter,c.element[0]);f.each(function(){var d=e(this),b=d.offset();e.data(this,"selectable-item",{element:this,$element:d,left:b.left,top:b.top,right:b.left+d.outerWidth(),bottom:b.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"), -selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=e("
    ")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX, -c.pageY];if(!this.options.disabled){var d=this.options;this.selectees=e(d.filter,this.element[0]);this._trigger("start",c);e(d.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});d.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!c.metaKey){b.$element.removeClass("ui-selected");b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting", -c,{unselecting:b.element})}});e(c.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){var g=!c.metaKey||!b.$element.hasClass("ui-selected");b.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");b.unselecting=!g;b.selecting=g;(b.selected=g)?f._trigger("selecting",c,{selecting:b.element}):f._trigger("unselecting",c,{unselecting:b.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var d= -this.options,b=this.opos[0],g=this.opos[1],h=c.pageX,i=c.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a||a.element==f.element[0])){var k=false;if(d.tolerance=="touch")k=!(a.left>h||a.righti||a.bottomb&&a.rightg&&a.bottom *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){var a=this.options;this.containerCache={};this.element.addClass("ui-sortable"); -this.refresh();this.floating=this.items.length?a.axis==="x"||/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a=== -"disabled"){this.options[a]=b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&& -!b){var f=false;d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem=c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top, -left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]}; -this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment();if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!= -document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",a,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a); -return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0], -e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(c))this._rearrange(a,c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset(); -c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"): -this.currentItem.show();for(var b=this.containers.length-1;b>=0;b--){this.containers[b]._trigger("deactivate",null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null, -dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem):d(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};d(b).each(function(){var e=(d(a.item||this).attr(a.attribute||"id")||"").match(a.expression||/(.+)[-=_](.+)/);if(e)c.push((a.key||e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});!c.length&&a.key&&c.push(a.key+"=");return c.join("&")}, -toArray:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};b.each(function(){c.push(d(a.item||this).attr(a.attribute||"id")||"")});return c},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+jg&&b+la[this.floating?"width":"height"]?j:g0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith(); -if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h=d.data(f[g],"sortable");if(h&&h!=this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), -this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)});return d(b)},_removeCurrentsFromItems:function(){for(var a=this.currentItem.find(":data(sortable-item)"),b=0;b=0;f--)for(var g=d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable");if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h=0;b--){var c=this.items[b];if(!(c.instance!=this.currentContainer&&this.currentContainer&&c.item[0]!=this.currentItem[0])){var e=this.options.toleranceElement?d(this.options.toleranceElement,c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b= -this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left=e.left;this.containers[b].containerCache.top=e.top;this.containers[b].containerCache.width=this.containers[b].element.outerWidth();this.containers[b].containerCache.height=this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a||this,c=b.options;if(!c.placeholder||c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f= -d(document.createElement(b.currentItem[0].nodeName)).addClass(e||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!e)f.style.visibility="hidden";return f},update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()||g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10));g.width()||g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")|| -0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b=null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out", -a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length===1){this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h- -f)this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g- -this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.topthis.containment[3])?g:!(g-this.offset.click.topthis.containment[2])?f:!(f-this.offset.click.left=0;e--)if(d.ui.contains(this.containers[e].element[0],this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive",g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b||c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this, -this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out",g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop", -a,this._uiHash());for(e=0;e li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var a=this,b=a.options;a.running=0;a.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix"); -a.headers=a.element.find(b.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){b.disabled||c(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){b.disabled||c(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){b.disabled||c(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){b.disabled||c(this).removeClass("ui-state-focus")});a.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom"); -if(b.navigation){var d=a.element.find("a").filter(b.navigationFilter).eq(0);if(d.length){var h=d.closest(".ui-accordion-header");a.active=h.length?h:d.closest(".ui-accordion-content").prev()}}a.active=a._findActive(a.active||b.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");a.active.next().addClass("ui-accordion-content-active");a._createIcons();a.resize();a.element.attr("role","tablist");a.headers.attr("role","tab").bind("keydown.accordion", -function(f){return a._keydown(f)}).next().attr("role","tabpanel");a.headers.not(a.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide();a.active.length?a.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):a.headers.eq(0).attr("tabIndex",0);c.browser.safari||a.headers.find("a").attr("tabIndex",-1);b.event&&a.headers.bind(b.event.split(" ").join(".accordion ")+".accordion",function(f){a._clickHandler.call(a,f,this);f.preventDefault()})},_createIcons:function(){var a= -this.options;if(a.icons){c("").addClass("ui-icon "+a.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(a.icons.header).toggleClass(a.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var a=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex"); -this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(a.autoHeight||a.fillHeight)b.css("height","");return c.Widget.prototype.destroy.call(this)},_setOption:function(a,b){c.Widget.prototype._setOption.apply(this,arguments);a=="active"&&this.activate(b);if(a=="icons"){this._destroyIcons(); -b&&this._createIcons()}if(a=="disabled")this.headers.add(this.headers.next())[b?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(a){if(!(this.options.disabled||a.altKey||a.ctrlKey)){var b=c.ui.keyCode,d=this.headers.length,h=this.headers.index(a.target),f=false;switch(a.keyCode){case b.RIGHT:case b.DOWN:f=this.headers[(h+1)%d];break;case b.LEFT:case b.UP:f=this.headers[(h-1+d)%d];break;case b.SPACE:case b.ENTER:this._clickHandler({target:a.target},a.target); -a.preventDefault()}if(f){c(a.target).attr("tabIndex",-1);c(f).attr("tabIndex",0);f.focus();return false}return true}},resize:function(){var a=this.options,b;if(a.fillSpace){if(c.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}b=this.element.parent().height();c.browser.msie&&this.element.parent().css("overflow",d);this.headers.each(function(){b-=c(this).outerHeight(true)});this.headers.next().each(function(){c(this).height(Math.max(0,b-c(this).innerHeight()+ -c(this).height()))}).css("overflow","auto")}else if(a.autoHeight){b=0;this.headers.next().each(function(){b=Math.max(b,c(this).height("").height())}).height(b)}return this},activate:function(a){this.options.active=a;a=this._findActive(a)[0];this._clickHandler({target:a},a);return this},_findActive:function(a){return a?typeof a==="number"?this.headers.filter(":eq("+a+")"):this.headers.not(this.headers.not(a)):a===false?c([]):this.headers.filter(":eq(0)")},_clickHandler:function(a,b){var d=this.options; -if(!d.disabled)if(a.target){a=c(a.currentTarget||b);b=a[0]===this.active[0];d.active=d.collapsible&&b?false:this.headers.index(a);if(!(this.running||!d.collapsible&&b)){var h=this.active;j=a.next();g=this.active.next();e={options:d,newHeader:b&&d.collapsible?c([]):a,oldHeader:this.active,newContent:b&&d.collapsible?c([]):j,oldContent:g};var f=this.headers.index(this.active[0])>this.headers.index(a[0]);this.active=b?c([]):a;this._toggle(j,g,e,b,f);h.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header); -if(!b){a.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected);a.next().addClass("ui-accordion-content-active")}}}else if(d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);this.active.next().addClass("ui-accordion-content-active");var g=this.active.next(), -e={options:d,newHeader:c([]),oldHeader:d.active,newContent:c([]),oldContent:g},j=this.active=c([]);this._toggle(j,g,e)}},_toggle:function(a,b,d,h,f){var g=this,e=g.options;g.toShow=a;g.toHide=b;g.data=d;var j=function(){if(g)return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data);g.running=b.size()===0?a.size():b.size();if(e.animated){d={};d=e.collapsible&&h?{toShow:c([]),toHide:b,complete:j,down:f,autoHeight:e.autoHeight||e.fillSpace}:{toShow:a,toHide:b,complete:j,down:f,autoHeight:e.autoHeight|| -e.fillSpace};if(!e.proxied)e.proxied=e.animated;if(!e.proxiedDuration)e.proxiedDuration=e.duration;e.animated=c.isFunction(e.proxied)?e.proxied(d):e.proxied;e.duration=c.isFunction(e.proxiedDuration)?e.proxiedDuration(d):e.proxiedDuration;h=c.ui.accordion.animations;var i=e.duration,k=e.animated;if(k&&!h[k]&&!c.easing[k])k="slide";h[k]||(h[k]=function(l){this.slide(l,{easing:k,duration:i||700})});h[k](d)}else{if(e.collapsible&&h)a.toggle();else{b.hide();a.show()}j(true)}b.prev().attr({"aria-expanded":"false", -"aria-selected":"false",tabIndex:-1}).blur();a.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length)this.toHide.parent()[0].className=this.toHide.parent()[0].className;this._trigger("change",null,this.data)}}});c.extend(c.ui.accordion,{version:"1.8.16", -animations:{slide:function(a,b){a=c.extend({easing:"swing",duration:300},a,b);if(a.toHide.size())if(a.toShow.size()){var d=a.toShow.css("overflow"),h=0,f={},g={},e;b=a.toShow;e=b[0].style.width;b.width(parseInt(b.parent().width(),10)-parseInt(b.css("paddingLeft"),10)-parseInt(b.css("paddingRight"),10)-(parseInt(b.css("borderLeftWidth"),10)||0)-(parseInt(b.css("borderRightWidth"),10)||0));c.each(["height","paddingTop","paddingBottom"],function(j,i){g[i]="hide";j=(""+c.css(a.toShow[0],i)).match(/^([\d+-.]+)(.*)$/); -f[i]={value:j[1],unit:j[2]||"px"}});a.toShow.css({height:0,overflow:"hidden"}).show();a.toHide.filter(":hidden").each(a.complete).end().filter(":visible").animate(g,{step:function(j,i){if(i.prop=="height")h=i.end-i.start===0?0:(i.now-i.start)/(i.end-i.start);a.toShow[0].style[i.prop]=h*f[i.prop].value+f[i.prop].unit},duration:a.duration,easing:a.easing,complete:function(){a.autoHeight||a.toShow.css("height","");a.toShow.css({width:e,overflow:d});a.complete()}})}else a.toHide.animate({height:"hide", -paddingTop:"hide",paddingBottom:"hide"},a);else a.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},a)},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1E3:200})}}})})(jQuery); -;/* - * jQuery UI Autocomplete 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Autocomplete - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - * jquery.ui.position.js - */ -(function(d){var e=0;d.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var a=this,b=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled||a.element.propAttr("readOnly"))){g= -false;var f=d.ui.keyCode;switch(c.keyCode){case f.PAGE_UP:a._move("previousPage",c);break;case f.PAGE_DOWN:a._move("nextPage",c);break;case f.UP:a._move("previous",c);c.preventDefault();break;case f.DOWN:a._move("next",c);c.preventDefault();break;case f.ENTER:case f.NUMPAD_ENTER:if(a.menu.active){g=true;c.preventDefault()}case f.TAB:if(!a.menu.active)return;a.menu.select(c);break;case f.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!= -a.element.val()){a.selectedItem=null;a.search(null,c)}},a.options.delay);break}}}).bind("keypress.autocomplete",function(c){if(g){g=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)}; -this.menu=d("
      ").addClass("ui-autocomplete").appendTo(d(this.options.appendTo||"body",b)[0]).mousedown(function(c){var f=a.menu.element[0];d(c.target).closest(".ui-menu-item").length||setTimeout(function(){d(document).one("mousedown",function(h){h.target!==a.element[0]&&h.target!==f&&!d.ui.contains(f,h.target)&&a.close()})},1);setTimeout(function(){clearTimeout(a.closing)},13)}).menu({focus:function(c,f){f=f.item.data("item.autocomplete");false!==a._trigger("focus",c,{item:f})&&/^key/.test(c.originalEvent.type)&& -a.element.val(f.value)},selected:function(c,f){var h=f.item.data("item.autocomplete"),i=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=i;setTimeout(function(){a.previous=i;a.selectedItem=h},1)}false!==a._trigger("select",c,{item:h})&&a.element.val(h.value);a.term=a.element.val();a.close(c);a.selectedItem=h},blur:function(){a.menu.element.is(":visible")&&a.element.val()!==a.term&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu"); -d.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");this.menu.element.remove();d.Widget.prototype.destroy.call(this)},_setOption:function(a,b){d.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource();if(a==="appendTo")this.menu.element.appendTo(d(b||"body",this.element[0].ownerDocument)[0]);a==="disabled"&& -b&&this.xhr&&this.xhr.abort()},_initSource:function(){var a=this,b,g;if(d.isArray(this.options.source)){b=this.options.source;this.source=function(c,f){f(d.ui.autocomplete.filter(b,c.term))}}else if(typeof this.options.source==="string"){g=this.options.source;this.source=function(c,f){a.xhr&&a.xhr.abort();a.xhr=d.ajax({url:g,data:c,dataType:"json",autocompleteRequest:++e,success:function(h){this.autocompleteRequest===e&&f(h)},error:function(){this.autocompleteRequest===e&&f([])}})}}else this.source= -this.options.source},search:function(a,b){a=a!=null?a:this.element.val();this.term=this.element.val();if(a.length
    • ").data("item.autocomplete",b).append(d("").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);else this.search(null,b)},widget:function(){return this.menu.element}});d.extend(d.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, -"\\$&")},filter:function(a,b){var g=new RegExp(d.ui.autocomplete.escapeRegex(b),"i");return d.grep(a,function(c){return g.test(c.label||c.value||c)})}})})(jQuery); -(function(d){d.widget("ui.menu",{_create:function(){var e=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(a){if(d(a.target).closest(".ui-menu-item a").length){a.preventDefault();e.select(a)}});this.refresh()},refresh:function(){var e=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex", --1).mouseenter(function(a){e.activate(a,d(this).parent())}).mouseleave(function(){e.deactivate()})},activate:function(e,a){this.deactivate();if(this.hasScroll()){var b=a.offset().top-this.element.offset().top,g=this.element.scrollTop(),c=this.element.height();if(b<0)this.element.scrollTop(g+b);else b>=c&&this.element.scrollTop(g+b-c+a.height())}this.active=a.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",e,{item:a})},deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id"); -this._trigger("blur");this.active=null}},next:function(e){this.move("next",".ui-menu-item:first",e)},previous:function(e){this.move("prev",".ui-menu-item:last",e)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(e,a,b){if(this.active){e=this.active[e+"All"](".ui-menu-item").eq(0);e.length?this.activate(b,e):this.activate(b,this.element.children(a))}else this.activate(b, -this.element.children(a))},nextPage:function(e){if(this.hasScroll())if(!this.active||this.last())this.activate(e,this.element.children(".ui-menu-item:first"));else{var a=this.active.offset().top,b=this.element.height(),g=this.element.children(".ui-menu-item").filter(function(){var c=d(this).offset().top-a-b+d(this).height();return c<10&&c>-10});g.length||(g=this.element.children(".ui-menu-item:last"));this.activate(e,g)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active|| -this.last()?":first":":last"))},previousPage:function(e){if(this.hasScroll())if(!this.active||this.first())this.activate(e,this.element.children(".ui-menu-item:last"));else{var a=this.active.offset().top,b=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var g=d(this).offset().top-a+b-d(this).height();return g<10&&g>-10});result.length||(result=this.element.children(".ui-menu-item:first"));this.activate(e,result)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active|| -this.first()?":last":":first"))},hasScroll:function(){return this.element.height()").addClass("ui-button-text").html(this.options.label).appendTo(a.empty()).text(),e=this.options.icons,f=e.primary&&e.secondary,d=[];if(e.primary||e.secondary){if(this.options.text)d.push("ui-button-text-icon"+(f?"s":e.primary?"-primary":"-secondary"));e.primary&&a.prepend("");e.secondary&&a.append("");if(!this.options.text){d.push(f?"ui-button-icons-only": -"ui-button-icon-only");this.hasTitle||a.attr("title",c)}}else d.push("ui-button-text-only");a.addClass(d.join(" "))}}});b.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(a,c){a==="disabled"&&this.buttons.button("option",a,c);b.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){var a=this.element.css("direction")=== -"ltr";this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass(a?"ui-corner-left":"ui-corner-right").end().filter(":last").addClass(a?"ui-corner-right":"ui-corner-left").end().end()},destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy"); -b.Widget.prototype.destroy.call(this)}})})(jQuery); -;/* - * jQuery UI Dialog 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Dialog - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - * jquery.ui.button.js - * jquery.ui.draggable.js - * jquery.ui.mouse.js - * jquery.ui.position.js - * jquery.ui.resizable.js - */ -(function(c,l){var m={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},n={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true},o=c.attrFn||{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true,click:true};c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false, -position:{my:"center",at:"center",collision:"fit",using:function(a){var b=c(this).css(a).offset().top;b<0&&c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var a=this,b=a.options,d=b.title||" ",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("
      ")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+ -b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&!i.isDefaultPrevented()&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("
      ")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g), -h=c('').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("").addClass("ui-dialog-title").attr("id", -e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose=b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body"); -a.uiDialog.remove();a.originalTitle&&a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d,e;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!== -b.uiDialog[0]){e=c(this).css("z-index");isNaN(e)||(d=Math.max(d,e))}});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a||!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.scrollTop(),scrollLeft:d.element.scrollLeft()};c.ui.dialog.maxZ+=1; -d.uiDialog.css("z-index",c.ui.dialog.maxZ);d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target=== -f[0]&&e.shiftKey){g.focus(1);return false}}});c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var b=this,d=false,e=c("
      ").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("
      ").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a, -function(){return!(d=true)});if(d){c.each(a,function(f,h){h=c.isFunction(h)?{click:h,text:f}:h;var i=c('').click(function(){h.click.apply(b.element[0],arguments)}).appendTo(g);c.each(h,function(j,k){if(j!=="click")j in o?i[j](k):i.attr(j,k)});c.fn.button&&i.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close", -handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g=d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",f,a(h))},drag:function(f,h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition, -originalSize:f.originalSize,position:f.position,size:f.size}}a=a===l?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize", -f,b(h))},stop:function(f,h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",f,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0],e;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "): -[a[0],a[1]];if(b.length===1)b[1]=b[0];c.each(["left","top"],function(g,f){if(+b[g]===b[g]){d[g]=b[g];b[g]=f}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,a)}else a=c.ui.dialog.prototype.options.position;(e=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(c.extend({of:window},a));e||this.uiDialog.hide()},_setOptions:function(a){var b=this,d={},e=false;c.each(a,function(g,f){b._setOption(g,f); -if(g in m)e=true;if(g in n)d[g]=f});e&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(a,b){var d=this,e=d.uiDialog;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"): -e.removeClass("ui-dialog-disabled");break;case "draggable":var g=e.is(":data(draggable)");g&&!b&&e.draggable("destroy");!g&&b&&d._makeDraggable();break;case "position":d._position(b);break;case "resizable":(g=e.is(":data(resizable)"))&&!b&&e.resizable("destroy");g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b||" "));break}c.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var a= -this.options,b,d,e=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();d=Math.max(0,a.minHeight-b);if(a.height==="auto")if(c.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();a=this.element.css("height","auto").height();e||this.uiDialog.hide();this.element.height(Math.max(a,d))}else this.element.height(Math.max(a.height- -b,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.16",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "), -create:function(a){if(this.instances.length===0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){if(c(d.target).zIndex()").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&& -c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(b.range==="min"||b.range==="max"?" ui-slider-range-"+b.range:""))}for(var j=c.length;j"); -this.handles=c.add(d(e.join("")).appendTo(a.element));this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(g){g.preventDefault()}).hover(function(){b.disabled||d(this).addClass("ui-state-hover")},function(){d(this).removeClass("ui-state-hover")}).focus(function(){if(b.disabled)d(this).blur();else{d(".ui-slider .ui-state-focus").removeClass("ui-state-focus");d(this).addClass("ui-state-focus")}}).blur(function(){d(this).removeClass("ui-state-focus")});this.handles.each(function(g){d(this).data("index.ui-slider-handle", -g)});this.handles.keydown(function(g){var k=true,l=d(this).data("index.ui-slider-handle"),i,h,m;if(!a.options.disabled){switch(g.keyCode){case d.ui.keyCode.HOME:case d.ui.keyCode.END:case d.ui.keyCode.PAGE_UP:case d.ui.keyCode.PAGE_DOWN:case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:k=false;if(!a._keySliding){a._keySliding=true;d(this).addClass("ui-state-active");i=a._start(g,l);if(i===false)return}break}m=a.options.step;i=a.options.values&&a.options.values.length? -(h=a.values(l)):(h=a.value());switch(g.keyCode){case d.ui.keyCode.HOME:h=a._valueMin();break;case d.ui.keyCode.END:h=a._valueMax();break;case d.ui.keyCode.PAGE_UP:h=a._trimAlignValue(i+(a._valueMax()-a._valueMin())/5);break;case d.ui.keyCode.PAGE_DOWN:h=a._trimAlignValue(i-(a._valueMax()-a._valueMin())/5);break;case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:if(i===a._valueMax())return;h=a._trimAlignValue(i+m);break;case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:if(i===a._valueMin())return;h=a._trimAlignValue(i- -m);break}a._slide(g,l,h);return k}}).keyup(function(g){var k=d(this).data("index.ui-slider-handle");if(a._keySliding){a._keySliding=false;a._stop(g,k);a._change(g,k);d(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");this._mouseDestroy(); -return this},_mouseCapture:function(a){var b=this.options,c,f,e,j,g;if(b.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();c=this._normValueFromMouse({x:a.pageX,y:a.pageY});f=this._valueMax()-this._valueMin()+1;j=this;this.handles.each(function(k){var l=Math.abs(c-j.values(k));if(f>l){f=l;e=d(this);g=k}});if(b.range===true&&this.values(1)===b.min){g+=1;e=d(this.handles[g])}if(this._start(a,g)===false)return false; -this._mouseSliding=true;j._handleIndex=g;e.addClass("ui-state-active").focus();b=e.offset();this._clickOffset=!d(a.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:a.pageX-b.left-e.width()/2,top:a.pageY-b.top-e.height()/2-(parseInt(e.css("borderTopWidth"),10)||0)-(parseInt(e.css("borderBottomWidth"),10)||0)+(parseInt(e.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(a,g,c);return this._animateOff=true},_mouseStart:function(){return true},_mouseDrag:function(a){var b= -this._normValueFromMouse({x:a.pageX,y:a.pageY});this._slide(a,this._handleIndex,b);return false},_mouseStop:function(a){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(a,this._handleIndex);this._change(a,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(a){var b;if(this.orientation==="horizontal"){b= -this.elementSize.width;a=a.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{b=this.elementSize.height;a=a.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}b=a/b;if(b>1)b=1;if(b<0)b=0;if(this.orientation==="vertical")b=1-b;a=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+b*a)},_start:function(a,b){var c={handle:this.handles[b],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(b); -c.values=this.values()}return this._trigger("start",a,c)},_slide:function(a,b,c){var f;if(this.options.values&&this.options.values.length){f=this.values(b?0:1);if(this.options.values.length===2&&this.options.range===true&&(b===0&&c>f||b===1&&c1){this.options.values[a]=this._trimAlignValue(b);this._refreshValue();this._change(null,a)}else if(arguments.length)if(d.isArray(arguments[0])){c=this.options.values;f=arguments[0];for(e=0;e=this._valueMax())return this._valueMax();var b=this.options.step>0?this.options.step:1,c=(a-this._valueMin())%b;a=a-c;if(Math.abs(c)*2>=b)a+=c>0?b:-b;return parseFloat(a.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},_refreshValue:function(){var a= -this.options.range,b=this.options,c=this,f=!this._animateOff?b.animate:false,e,j={},g,k,l,i;if(this.options.values&&this.options.values.length)this.handles.each(function(h){e=(c.values(h)-c._valueMin())/(c._valueMax()-c._valueMin())*100;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";d(this).stop(1,1)[f?"animate":"css"](j,b.animate);if(c.options.range===true)if(c.orientation==="horizontal"){if(h===0)c.range.stop(1,1)[f?"animate":"css"]({left:e+"%"},b.animate);if(h===1)c.range[f?"animate":"css"]({width:e- -g+"%"},{queue:false,duration:b.animate})}else{if(h===0)c.range.stop(1,1)[f?"animate":"css"]({bottom:e+"%"},b.animate);if(h===1)c.range[f?"animate":"css"]({height:e-g+"%"},{queue:false,duration:b.animate})}g=e});else{k=this.value();l=this._valueMin();i=this._valueMax();e=i!==l?(k-l)/(i-l)*100:0;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";this.handle.stop(1,1)[f?"animate":"css"](j,b.animate);if(a==="min"&&this.orientation==="horizontal")this.range.stop(1,1)[f?"animate":"css"]({width:e+"%"}, -b.animate);if(a==="max"&&this.orientation==="horizontal")this.range[f?"animate":"css"]({width:100-e+"%"},{queue:false,duration:b.animate});if(a==="min"&&this.orientation==="vertical")this.range.stop(1,1)[f?"animate":"css"]({height:e+"%"},b.animate);if(a==="max"&&this.orientation==="vertical")this.range[f?"animate":"css"]({height:100-e+"%"},{queue:false,duration:b.animate})}}});d.extend(d.ui.slider,{version:"1.8.16"})})(jQuery); -;/* - * jQuery UI Tabs 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Tabs - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - */ -(function(d,p){function u(){return++v}function w(){return++x}var v=0,x=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"
      ",remove:null,select:null,show:null,spinner:"Loading…",tabTemplate:"
    • #{label}
    • "},_create:function(){this._tabify(true)},_setOption:function(b,e){if(b=="selected")this.options.collapsible&& -e==this.options.selected||this.select(e);else{this.options[b]=e;this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+u()},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+w());return d.cookie.apply(null,[b].concat(d.makeArray(arguments)))},_ui:function(b,e){return{tab:b,panel:e,index:this.anchors.index(b)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b= -d(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(b){function e(g,f){g.css("display","");!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}var a=this,c=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(g,f){var i=d(f).attr("href"),l=i.split("#")[0],q;if(l&&(l===location.toString().split("#")[0]|| -(q=d("base")[0])&&l===q.href)){i=f.hash;f.href=i}if(h.test(i))a.panels=a.panels.add(a.element.find(a._sanitizeSelector(i)));else if(i&&i!=="#"){d.data(f,"href.tabs",i);d.data(f,"load.tabs",i.replace(/#.*$/,""));i=a._tabId(f);f.href="#"+i;f=a.element.find("#"+i);if(!f.length){f=d(c.panelTemplate).attr("id",i).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(a.panels[g-1]||a.list);f.data("destroy.tabs",true)}a.panels=a.panels.add(f)}else c.disabled.push(g)});if(b){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"); -this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(c.selected===p){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){c.selected=g;return false}});if(typeof c.selected!=="number"&&c.cookie)c.selected=parseInt(a._cookie(),10);if(typeof c.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)c.selected= -this.lis.index(this.lis.filter(".ui-tabs-selected"));c.selected=c.selected||(this.lis.length?0:-1)}else if(c.selected===null)c.selected=-1;c.selected=c.selected>=0&&this.anchors[c.selected]||c.selected<0?c.selected:0;c.disabled=d.unique(c.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return a.lis.index(g)}))).sort();d.inArray(c.selected,c.disabled)!=-1&&c.disabled.splice(d.inArray(c.selected,c.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active"); -if(c.selected>=0&&this.anchors.length){a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(c.selected).addClass("ui-tabs-selected ui-state-active");a.element.queue("tabs",function(){a._trigger("show",null,a._ui(a.anchors[c.selected],a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash))[0]))});this.load(c.selected)}d(window).bind("unload",function(){a.lis.add(a.anchors).unbind(".tabs");a.lis=a.anchors=a.panels=null})}else c.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")); -this.element[c.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");c.cookie&&this._cookie(c.selected,c.cookie);b=0;for(var j;j=this.lis[b];b++)d(j)[d.inArray(b,c.disabled)!=-1&&!d(j).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");c.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(c.event!=="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+ -g)};this.lis.bind("mouseover.tabs",function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(c.fx)if(d.isArray(c.fx)){m=c.fx[0];o=c.fx[1]}else m=o=c.fx;var r=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal", -function(){e(f,o);a._trigger("show",null,a._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");a._trigger("show",null,a._ui(g,f[0]))},s=m?function(g,f){f.animate(m,m.duration||"normal",function(){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);a.element.dequeue("tabs")})}:function(g,f){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");a.element.dequeue("tabs")}; -this.anchors.bind(c.event+".tabs",function(){var g=this,f=d(g).closest("li"),i=a.panels.filter(":not(.ui-tabs-hide)"),l=a.element.find(a._sanitizeSelector(g.hash));if(f.hasClass("ui-tabs-selected")&&!c.collapsible||f.hasClass("ui-state-disabled")||f.hasClass("ui-state-processing")||a.panels.filter(":animated").length||a._trigger("select",null,a._ui(this,l[0]))===false){this.blur();return false}c.selected=a.anchors.index(this);a.abort();if(c.collapsible)if(f.hasClass("ui-tabs-selected")){c.selected= --1;c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){s(g,i)}).dequeue("tabs");this.blur();return false}else if(!i.length){c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this));this.blur();return false}c.cookie&&a._cookie(c.selected,c.cookie);if(l.length){i.length&&a.element.queue("tabs",function(){s(g,i)});a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier."; -d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(b){if(typeof b=="string")b=this.anchors.index(this.anchors.filter("[href$="+b+"]"));return b},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e= -d.data(this,"href.tabs");if(e)this.href=e;var a=d(this).unbind(".tabs");d.each(["href","load","cache"],function(c,h){a.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});b.cookie&&this._cookie(null,b.cookie);return this},add:function(b, -e,a){if(a===p)a=this.anchors.length;var c=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,b).replace(/#\{label\}/g,e));b=!b.indexOf("#")?b.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var j=c.element.find("#"+b);j.length||(j=d(h.panelTemplate).attr("id",b).data("destroy.tabs",true));j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(a>=this.lis.length){e.appendTo(this.list);j.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[a]); -j.insertBefore(this.panels[a])}h.disabled=d.map(h.disabled,function(k){return k>=a?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");j.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){c._trigger("show",null,c._ui(c.anchors[0],c.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[a],this.panels[a]));return this},remove:function(b){b=this._getIndex(b);var e=this.options,a=this.lis.eq(b).remove(),c=this.panels.eq(b).remove(); -if(a.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(b+(b+1=b?--h:h});this._tabify();this._trigger("remove",null,this._ui(a.find("a")[0],c[0]));return this},enable:function(b){b=this._getIndex(b);var e=this.options;if(d.inArray(b,e.disabled)!=-1){this.lis.eq(b).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=b});this._trigger("enable",null, -this._ui(this.anchors[b],this.panels[b]));return this}},disable:function(b){b=this._getIndex(b);var e=this.options;if(b!=e.selected){this.lis.eq(b).addClass("ui-state-disabled");e.disabled.push(b);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[b],this.panels[b]))}return this},select:function(b){b=this._getIndex(b);if(b==-1)if(this.options.collapsible&&this.options.selected!=-1)b=this.options.selected;else return this;this.anchors.eq(b).trigger(this.options.event+".tabs");return this}, -load:function(b){b=this._getIndex(b);var e=this,a=this.options,c=this.anchors.eq(b)[0],h=d.data(c,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(c,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(b).addClass("ui-state-processing");if(a.spinner){var j=d("span",c);j.data("label.tabs",j.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){e.element.find(e._sanitizeSelector(c.hash)).html(k);e._cleanup();a.cache&&d.data(c, -"cache.tabs",true);e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.error(k,n,b,c)}catch(m){}}}));e.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this}, -url:function(b,e){this.anchors.eq(b).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.16"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(b,e){var a=this,c=this.options,h=a._rotate||(a._rotate=function(j){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=c.selected;a.select(++k'))}function N(a){return a.bind("mouseout", -function(b){b=d(b.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");b.length&&b.removeClass("ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover")}).bind("mouseover",function(b){b=d(b.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");if(!(d.datepicker._isDisabledDatepicker(J.inline?a.parent()[0]:J.input[0])||!b.length)){b.parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover"); -b.addClass("ui-state-hover");b.hasClass("ui-datepicker-prev")&&b.addClass("ui-datepicker-prev-hover");b.hasClass("ui-datepicker-next")&&b.addClass("ui-datepicker-next-hover")}})}function H(a,b){d.extend(a,b);for(var c in b)if(b[c]==null||b[c]==C)a[c]=b[c];return a}d.extend(d.ui,{datepicker:{version:"1.8.16"}});var B=(new Date).getTime(),J;d.extend(M.prototype,{markerClassName:"hasDatepicker",maxRows:4,log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv}, -setDefaults:function(a){H(this._defaults,a||{});return this},_attachDatepicker:function(a,b){var c=null;for(var e in this._defaults){var f=a.getAttribute("date:"+e);if(f){c=c||{};try{c[e]=eval(f)}catch(h){c[e]=f}}}e=a.nodeName.toLowerCase();f=e=="div"||e=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var i=this._newInst(d(a),f);i.settings=d.extend({},b||{},c||{});if(e=="input")this._connectDatepicker(a,i);else f&&this._inlineDatepicker(a,i)},_newInst:function(a,b){return{id:a[0].id.replace(/([^A-Za-z0-9_-])/g, -"\\\\$1"),input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:!b?this.dpDiv:N(d('
      '))}},_connectDatepicker:function(a,b){var c=d(a);b.append=d([]);b.trigger=d([]);if(!c.hasClass(this.markerClassName)){this._attachments(c,b);c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker", -function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});this._autoSize(b);d.data(a,"datepicker",b);b.settings.disabled&&this._disableDatepicker(a)}},_attachments:function(a,b){var c=this._get(b,"appendText"),e=this._get(b,"isRTL");b.append&&b.append.remove();if(c){b.append=d(''+c+"");a[e?"before":"after"](b.append)}a.unbind("focus",this._showDatepicker);b.trigger&&b.trigger.remove();c=this._get(b,"showOn");if(c== -"focus"||c=="both")a.focus(this._showDatepicker);if(c=="button"||c=="both"){c=this._get(b,"buttonText");var f=this._get(b,"buttonImage");b.trigger=d(this._get(b,"buttonImageOnly")?d("").addClass(this._triggerClass).attr({src:f,alt:c,title:c}):d('').addClass(this._triggerClass).html(f==""?c:d("").attr({src:f,alt:c,title:c})));a[e?"before":"after"](b.trigger);b.trigger.click(function(){d.datepicker._datepickerShowing&&d.datepicker._lastInput==a[0]?d.datepicker._hideDatepicker(): -d.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var e=function(f){for(var h=0,i=0,g=0;gh){h=f[g].length;i=g}return i};b.setMonth(e(this._get(a,c.match(/MM/)?"monthNames":"monthNamesShort")));b.setDate(e(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a, -b){var c=d(a);if(!c.hasClass(this.markerClassName)){c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});d.data(a,"datepicker",b);this._setDate(b,this._getDefaultDate(b),true);this._updateDatepicker(b);this._updateAlternate(b);b.settings.disabled&&this._disableDatepicker(a);b.dpDiv.css("display","block")}},_dialogDatepicker:function(a,b,c,e,f){a=this._dialogInst;if(!a){this.uuid+= -1;this._dialogInput=d('');this._dialogInput.keydown(this._doKeyDown);d("body").append(this._dialogInput);a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};d.data(this._dialogInput[0],"datepicker",a)}H(a.settings,e||{});b=b&&b.constructor==Date?this._formatDate(a,b):b;this._dialogInput.val(b);this._pos=f?f.length?f:[f.pageX,f.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/ -2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=c;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);d.blockUI&&d.blockUI(this.dpDiv);d.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var b= -d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();d.removeData(a,"datepicker");if(e=="input"){c.append.remove();c.trigger.remove();b.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)}else if(e=="div"||e=="span")b.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e= -a.nodeName.toLowerCase();if(e=="input"){a.disabled=false;c.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(e=="div"||e=="span"){b=b.children("."+this._inlineClass);b.children().removeClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").removeAttr("disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f})}},_disableDatepicker:function(a){var b=d(a),c=d.data(a, -"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=true;c.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else if(e=="div"||e=="span"){b=b.children("."+this._inlineClass);b.children().addClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").attr("disabled","disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f== -a?null:f});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;for(var b=0;b-1}},_doKeyUp:function(a){a=d.datepicker._getInst(a.target);if(a.input.val()!=a.lastVal)try{if(d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,d.datepicker._getFormatConfig(a))){d.datepicker._setDateFromField(a);d.datepicker._updateAlternate(a);d.datepicker._updateDatepicker(a)}}catch(b){d.datepicker.log(b)}return true},_showDatepicker:function(a){a=a.target||a;if(a.nodeName.toLowerCase()!="input")a=d("input", -a.parentNode)[0];if(!(d.datepicker._isDisabledDatepicker(a)||d.datepicker._lastInput==a)){var b=d.datepicker._getInst(a);if(d.datepicker._curInst&&d.datepicker._curInst!=b){d.datepicker._datepickerShowing&&d.datepicker._triggerOnClose(d.datepicker._curInst);d.datepicker._curInst.dpDiv.stop(true,true)}var c=d.datepicker._get(b,"beforeShow");c=c?c.apply(a,[a,b]):{};if(c!==false){H(b.settings,c);b.lastVal=null;d.datepicker._lastInput=a;d.datepicker._setDateFromField(b);if(d.datepicker._inDialog)a.value= -"";if(!d.datepicker._pos){d.datepicker._pos=d.datepicker._findPos(a);d.datepicker._pos[1]+=a.offsetHeight}var e=false;d(a).parents().each(function(){e|=d(this).css("position")=="fixed";return!e});if(e&&d.browser.opera){d.datepicker._pos[0]-=document.documentElement.scrollLeft;d.datepicker._pos[1]-=document.documentElement.scrollTop}c={left:d.datepicker._pos[0],top:d.datepicker._pos[1]};d.datepicker._pos=null;b.dpDiv.empty();b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});d.datepicker._updateDatepicker(b); -c=d.datepicker._checkOffset(b,c,e);b.dpDiv.css({position:d.datepicker._inDialog&&d.blockUI?"static":e?"fixed":"absolute",display:"none",left:c.left+"px",top:c.top+"px"});if(!b.inline){c=d.datepicker._get(b,"showAnim");var f=d.datepicker._get(b,"duration"),h=function(){var i=b.dpDiv.find("iframe.ui-datepicker-cover");if(i.length){var g=d.datepicker._getBorders(b.dpDiv);i.css({left:-g[0],top:-g[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex(d(a).zIndex()+1);d.datepicker._datepickerShowing= -true;d.effects&&d.effects[c]?b.dpDiv.show(c,d.datepicker._get(b,"showOptions"),f,h):b.dpDiv[c||"show"](c?f:null,h);if(!c||!f)h();b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus();d.datepicker._curInst=b}}}},_updateDatepicker:function(a){this.maxRows=4;var b=d.datepicker._getBorders(a.dpDiv);J=a;a.dpDiv.empty().append(this._generateHTML(a));var c=a.dpDiv.find("iframe.ui-datepicker-cover");c.length&&c.css({left:-b[0],top:-b[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()}); -a.dpDiv.find("."+this._dayOverClass+" a").mouseover();b=this._getNumberOfMonths(a);c=b[1];a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");c>1&&a.dpDiv.addClass("ui-datepicker-multi-"+c).css("width",17*c+"em");a.dpDiv[(b[0]!=1||b[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");a==d.datepicker._curInst&&d.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&& -!a.input.is(":disabled")&&a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var e=a.yearshtml;setTimeout(function(){e===a.yearshtml&&a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml);e=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(c){return{thin:1,medium:2,thick:3}[c]||c};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var e=a.dpDiv.outerWidth(),f=a.dpDiv.outerHeight(), -h=a.input?a.input.outerWidth():0,i=a.input?a.input.outerHeight():0,g=document.documentElement.clientWidth+d(document).scrollLeft(),j=document.documentElement.clientHeight+d(document).scrollTop();b.left-=this._get(a,"isRTL")?e-h:0;b.left-=c&&b.left==a.input.offset().left?d(document).scrollLeft():0;b.top-=c&&b.top==a.input.offset().top+i?d(document).scrollTop():0;b.left-=Math.min(b.left,b.left+e>g&&g>e?Math.abs(b.left+e-g):0);b.top-=Math.min(b.top,b.top+f>j&&j>f?Math.abs(f+i):0);return b},_findPos:function(a){for(var b= -this._get(this._getInst(a),"isRTL");a&&(a.type=="hidden"||a.nodeType!=1||d.expr.filters.hidden(a));)a=a[b?"previousSibling":"nextSibling"];a=d(a).offset();return[a.left,a.top]},_triggerOnClose:function(a){var b=this._get(a,"onClose");if(b)b.apply(a.input?a.input[0]:null,[a.input?a.input.val():"",a])},_hideDatepicker:function(a){var b=this._curInst;if(!(!b||a&&b!=d.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(b,"showAnim");var c=this._get(b,"duration"),e=function(){d.datepicker._tidyDialog(b); -this._curInst=null};d.effects&&d.effects[a]?b.dpDiv.hide(a,d.datepicker._get(b,"showOptions"),c,e):b.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"?"fadeOut":"hide"](a?c:null,e);a||e();d.datepicker._triggerOnClose(b);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if(d.blockUI){d.unblockUI();d("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")}, -_checkExternalClick:function(a){if(d.datepicker._curInst){a=d(a.target);a[0].id!=d.datepicker._mainDivId&&a.parents("#"+d.datepicker._mainDivId).length==0&&!a.hasClass(d.datepicker.markerClassName)&&!a.hasClass(d.datepicker._triggerClass)&&d.datepicker._datepickerShowing&&!(d.datepicker._inDialog&&d.blockUI)&&d.datepicker._hideDatepicker()}},_adjustDate:function(a,b,c){a=d(a);var e=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"): -0),c);this._updateDatepicker(e)}},_gotoToday:function(a){a=d(a);var b=this._getInst(a[0]);if(this._get(b,"gotoCurrent")&&b.currentDay){b.selectedDay=b.currentDay;b.drawMonth=b.selectedMonth=b.currentMonth;b.drawYear=b.selectedYear=b.currentYear}else{var c=new Date;b.selectedDay=c.getDate();b.drawMonth=b.selectedMonth=c.getMonth();b.drawYear=b.selectedYear=c.getFullYear()}this._notifyChange(b);this._adjustDate(a)},_selectMonthYear:function(a,b,c){a=d(a);var e=this._getInst(a[0]);e["selected"+(c=="M"? -"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10);this._notifyChange(e);this._adjustDate(a)},_selectDay:function(a,b,c,e){var f=d(a);if(!(d(e).hasClass(this._unselectableClass)||this._isDisabledDatepicker(f[0]))){f=this._getInst(f[0]);f.selectedDay=f.currentDay=d("a",e).html();f.selectedMonth=f.currentMonth=b;f.selectedYear=f.currentYear=c;this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))}},_clearDate:function(a){a=d(a); -this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,b){a=this._getInst(d(a)[0]);b=b!=null?b:this._formatDate(a);a.input&&a.input.val(b);this._updateAlternate(a);var c=this._get(a,"onSelect");if(c)c.apply(a.input?a.input[0]:null,[b,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a);else{this._hideDatepicker();this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var b=this._get(a,"altField"); -if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),e=this._getDate(a),f=this.formatDate(c,e,this._getFormatConfig(a));d(b).each(function(){d(this).val(f)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var b=a.getTime();a.setMonth(0);a.setDate(1);return Math.floor(Math.round((b-a)/864E5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"? -b.toString():b+"";if(b=="")return null;var e=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;e=typeof e!="string"?e:(new Date).getFullYear()%100+parseInt(e,10);for(var f=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,h=(c?c.dayNames:null)||this._defaults.dayNames,i=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,g=(c?c.monthNames:null)||this._defaults.monthNames,j=c=-1,l=-1,u=-1,k=false,o=function(p){(p=A+1-1){j=1;l=u;do{e=this._getDaysInMonth(c,j-1);if(l<=e)break;j++;l-=e}while(1)}v=this._daylightSavingAdjust(new Date(c,j-1,l));if(v.getFullYear()!=c||v.getMonth()+1!=j||v.getDate()!=l)throw"Invalid date";return v},ATOM:"yy-mm-dd", -COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,b,c){if(!b)return"";var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,h=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort;c=(c?c.monthNames: -null)||this._defaults.monthNames;var i=function(o){(o=k+1 -12?a.getHours()+2:0);return a},_setDate:function(a,b,c){var e=!b,f=a.selectedMonth,h=a.selectedYear;b=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay=a.currentDay=b.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=b.getMonth();a.drawYear=a.selectedYear=a.currentYear=b.getFullYear();if((f!=a.selectedMonth||h!=a.selectedYear)&&!c)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(e?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||a.input&& -a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(),b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),e=this._get(a,"showButtonPanel"),f=this._get(a,"hideIfNoPrevNext"),h=this._get(a,"navigationAsDateFormat"),i=this._getNumberOfMonths(a),g=this._get(a,"showCurrentAtPos"),j=this._get(a,"stepMonths"),l=i[0]!=1||i[1]!=1,u=this._daylightSavingAdjust(!a.currentDay? -new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),k=this._getMinMaxDate(a,"min"),o=this._getMinMaxDate(a,"max");g=a.drawMonth-g;var m=a.drawYear;if(g<0){g+=12;m--}if(o){var n=this._daylightSavingAdjust(new Date(o.getFullYear(),o.getMonth()-i[0]*i[1]+1,o.getDate()));for(n=k&&nn;){g--;if(g<0){g=11;m--}}}a.drawMonth=g;a.drawYear=m;n=this._get(a,"prevText");n=!h?n:this.formatDate(n,this._daylightSavingAdjust(new Date(m,g-j,1)),this._getFormatConfig(a)); -n=this._canAdjustMonth(a,-1,m,g)?''+n+"":f?"":''+n+"";var s=this._get(a,"nextText");s=!h?s:this.formatDate(s,this._daylightSavingAdjust(new Date(m, -g+j,1)),this._getFormatConfig(a));f=this._canAdjustMonth(a,+1,m,g)?''+s+"":f?"":''+s+"";j=this._get(a,"currentText");s=this._get(a,"gotoCurrent")&& -a.currentDay?u:b;j=!h?j:this.formatDate(j,s,this._getFormatConfig(a));h=!a.inline?'":"";e=e?'
      '+(c?h:"")+(this._isInRange(a,s)?'":"")+(c?"":h)+"
      ":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;j=this._get(a,"showWeek");s=this._get(a,"dayNames");this._get(a,"dayNamesShort");var q=this._get(a,"dayNamesMin"),A=this._get(a,"monthNames"),v=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),D=this._get(a,"showOtherMonths"),K=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var E=this._getDefaultDate(a),w="",x=0;x1)switch(G){case 0:y+=" ui-datepicker-group-first";t=" ui-corner-"+(c?"right":"left");break;case i[1]-1:y+=" ui-datepicker-group-last";t=" ui-corner-"+(c?"left":"right");break;default:y+=" ui-datepicker-group-middle";t="";break}y+='">'}y+='
      '+(/all|left/.test(t)&& -x==0?c?f:n:"")+(/all|right/.test(t)&&x==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,k,o,x>0||G>0,A,v)+'
      ';var z=j?'":"";for(t=0;t<7;t++){var r=(t+h)%7;z+="=5?' class="ui-datepicker-week-end"':"")+'>'+q[r]+""}y+=z+"";z=this._getDaysInMonth(m,g);if(m==a.selectedYear&&g==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay, -z);t=(this._getFirstDayOfMonth(m,g)-h+7)%7;z=Math.ceil((t+z)/7);this.maxRows=z=l?this.maxRows>z?this.maxRows:z:z;r=this._daylightSavingAdjust(new Date(m,g,1-t));for(var Q=0;Q";var R=!j?"":'";for(t=0;t<7;t++){var I=p?p.apply(a.input?a.input[0]:null,[r]):[true,""],F=r.getMonth()!=g,L=F&&!K||!I[0]||k&&ro;R+='";r.setDate(r.getDate()+1);r=this._daylightSavingAdjust(r)}y+=R+""}g++;if(g>11){g=0;m++}y+="
      '+this._get(a,"weekHeader")+"
      '+this._get(a,"calculateWeek")(r)+""+(F&&!D?" ":L?''+ -r.getDate()+"":''+r.getDate()+"")+"
      "+(l?""+(i[0]>0&&G==i[1]-1?'
      ':""):"");O+=y}w+=O}w+=e+(d.browser.msie&&parseInt(d.browser.version,10)<7&&!a.inline?'': -"");a._keyEvent=false;return w},_generateMonthYearHeader:function(a,b,c,e,f,h,i,g){var j=this._get(a,"changeMonth"),l=this._get(a,"changeYear"),u=this._get(a,"showMonthAfterYear"),k='
      ',o="";if(h||!j)o+=''+i[b]+"";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='"}u||(k+=o+(h||!(j&&l)?" ":""));if(!a.yearshtml){a.yearshtml="";if(h||!l)k+=''+c+"";else{g=this._get(a,"yearRange").split(":");var s=(new Date).getFullYear();i=function(q){q=q.match(/c[+-].*/)?c+parseInt(q.substring(1),10):q.match(/[+-].*/)?s+parseInt(q,10):parseInt(q,10);return isNaN(q)?s:q};b=i(g[0]);g=Math.max(b,i(g[1]||""));b=e?Math.max(b, -e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()):g;for(a.yearshtml+='";k+=a.yearshtml;a.yearshtml=null}}k+=this._get(a,"yearSuffix");if(u)k+=(h||!(j&&l)?" ":"")+o;k+="
      ";return k},_adjustInstDate:function(a,b,c){var e=a.drawYear+(c=="Y"?b:0),f=a.drawMonth+ -(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");b=c&&ba?a:b},_notifyChange:function(a){var b=this._get(a,"onChangeMonthYear");if(b)b.apply(a.input? -a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-this._daylightSavingAdjust(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,e){var f=this._getNumberOfMonths(a);c=this._daylightSavingAdjust(new Date(c, -e+(b<0?b:f[0]*f[1]),1));b<0&&c.setDate(this._getDaysInMonth(c.getFullYear(),c.getMonth()));return this._isInRange(a,c)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!a||b.getTime()<=a.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10);return{shortYearCutoff:b,dayNamesShort:this._get(a,"dayNamesShort"),dayNames:this._get(a, -"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,e){if(!b){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}b=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(e,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),b,this._getFormatConfig(a))}});d.fn.datepicker=function(a){if(!this.length)return this; -if(!d.datepicker.initialized){d(document).mousedown(d.datepicker._checkExternalClick).find("body").append(d.datepicker.dpDiv);d.datepicker.initialized=true}var b=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));return this.each(function(){typeof a== -"string"?d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this].concat(b)):d.datepicker._attachDatepicker(this,a)})};d.datepicker=new M;d.datepicker.initialized=false;d.datepicker.uuid=(new Date).getTime();d.datepicker.version="1.8.16";window["DP_jQuery_"+B]=d})(jQuery); -;/* - * jQuery UI Progressbar 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Progressbar - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - */ -(function(b,d){b.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=b("
      ").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"); -this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(a){if(a===d)return this._value();this._setOption("value",a);return this},_setOption:function(a,c){if(a==="value"){this.options.value=c;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;if(typeof a!=="number")a=0;return Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100* -this._value()/this.options.max},_refreshValue:function(){var a=this.value(),c=this._percentage();if(this.oldValue!==a){this.oldValue=a;this._trigger("change")}this.valueDiv.toggle(a>this.min).toggleClass("ui-corner-right",a===this.options.max).width(c.toFixed(0)+"%");this.element.attr("aria-valuenow",a)}});b.extend(b.ui.progressbar,{version:"1.8.16"})})(jQuery); -;/* - * jQuery UI Effects 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/ - */ -jQuery.effects||function(f,j){function m(c){var a;if(c&&c.constructor==Array&&c.length==3)return c;if(a=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c))return[parseInt(a[1],10),parseInt(a[2],10),parseInt(a[3],10)];if(a=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c))return[parseFloat(a[1])*2.55,parseFloat(a[2])*2.55,parseFloat(a[3])*2.55];if(a=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c))return[parseInt(a[1], -16),parseInt(a[2],16),parseInt(a[3],16)];if(a=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c))return[parseInt(a[1]+a[1],16),parseInt(a[2]+a[2],16),parseInt(a[3]+a[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(c))return n.transparent;return n[f.trim(c).toLowerCase()]}function s(c,a){var b;do{b=f.curCSS(c,a);if(b!=""&&b!="transparent"||f.nodeName(c,"body"))break;a="backgroundColor"}while(c=c.parentNode);return m(b)}function o(){var c=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle, -a={},b,d;if(c&&c.length&&c[0]&&c[c[0]])for(var e=c.length;e--;){b=c[e];if(typeof c[b]=="string"){d=b.replace(/\-(\w)/g,function(g,h){return h.toUpperCase()});a[d]=c[b]}}else for(b in c)if(typeof c[b]==="string")a[b]=c[b];return a}function p(c){var a,b;for(a in c){b=c[a];if(b==null||f.isFunction(b)||a in t||/scrollbar/.test(a)||!/color/i.test(a)&&isNaN(parseFloat(b)))delete c[a]}return c}function u(c,a){var b={_:0},d;for(d in a)if(c[d]!=a[d])b[d]=a[d];return b}function k(c,a,b,d){if(typeof c=="object"){d= -a;b=null;a=c;c=a.effect}if(f.isFunction(a)){d=a;b=null;a={}}if(typeof a=="number"||f.fx.speeds[a]){d=b;b=a;a={}}if(f.isFunction(b)){d=b;b=null}a=a||{};b=b||a.duration;b=f.fx.off?0:typeof b=="number"?b:b in f.fx.speeds?f.fx.speeds[b]:f.fx.speeds._default;d=d||a.complete;return[c,a,b,d]}function l(c){if(!c||typeof c==="number"||f.fx.speeds[c])return true;if(typeof c==="string"&&!f.effects[c])return true;return false}f.effects={};f.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor", -"borderTopColor","borderColor","color","outlineColor"],function(c,a){f.fx.step[a]=function(b){if(!b.colorInit){b.start=s(b.elem,a);b.end=m(b.end);b.colorInit=true}b.elem.style[a]="rgb("+Math.max(Math.min(parseInt(b.pos*(b.end[0]-b.start[0])+b.start[0],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[1]-b.start[1])+b.start[1],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[2]-b.start[2])+b.start[2],10),255),0)+")"}});var n={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0, -0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211, -211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},q=["add","remove","toggle"],t={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};f.effects.animateClass=function(c,a,b, -d){if(f.isFunction(b)){d=b;b=null}return this.queue(function(){var e=f(this),g=e.attr("style")||" ",h=p(o.call(this)),r,v=e.attr("class");f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});r=p(o.call(this));e.attr("class",v);e.animate(u(h,r),{queue:false,duration:a,easing:b,complete:function(){f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});if(typeof e.attr("style")=="object"){e.attr("style").cssText="";e.attr("style").cssText=g}else e.attr("style",g);d&&d.apply(this,arguments);f.dequeue(this)}})})}; -f.fn.extend({_addClass:f.fn.addClass,addClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{add:c},a,b,d]):this._addClass(c)},_removeClass:f.fn.removeClass,removeClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{remove:c},a,b,d]):this._removeClass(c)},_toggleClass:f.fn.toggleClass,toggleClass:function(c,a,b,d,e){return typeof a=="boolean"||a===j?b?f.effects.animateClass.apply(this,[a?{add:c}:{remove:c},b,d,e]):this._toggleClass(c,a):f.effects.animateClass.apply(this, -[{toggle:c},a,b,d])},switchClass:function(c,a,b,d,e){return f.effects.animateClass.apply(this,[{add:a,remove:c},b,d,e])}});f.extend(f.effects,{version:"1.8.16",save:function(c,a){for(var b=0;b").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}), -d=document.activeElement;c.wrap(b);if(c[0]===d||f.contains(c[0],d))f(d).focus();b=c.parent();if(c.css("position")=="static"){b.css({position:"relative"});c.css({position:"relative"})}else{f.extend(a,{position:c.css("position"),zIndex:c.css("z-index")});f.each(["top","left","bottom","right"],function(e,g){a[g]=c.css(g);if(isNaN(parseInt(a[g],10)))a[g]="auto"});c.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return b.css(a).show()},removeWrapper:function(c){var a,b=document.activeElement; -if(c.parent().is(".ui-effects-wrapper")){a=c.parent().replaceWith(c);if(c[0]===b||f.contains(c[0],b))f(b).focus();return a}return c},setTransition:function(c,a,b,d){d=d||{};f.each(a,function(e,g){unit=c.cssUnit(g);if(unit[0]>0)d[g]=unit[0]*b+unit[1]});return d}});f.fn.extend({effect:function(c){var a=k.apply(this,arguments),b={options:a[1],duration:a[2],callback:a[3]};a=b.options.mode;var d=f.effects[c];if(f.fx.off||!d)return a?this[a](b.duration,b.callback):this.each(function(){b.callback&&b.callback.call(this)}); -return d.call(this,b)},_show:f.fn.show,show:function(c){if(l(c))return this._show.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="show";return this.effect.apply(this,a)}},_hide:f.fn.hide,hide:function(c){if(l(c))return this._hide.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="hide";return this.effect.apply(this,a)}},__toggle:f.fn.toggle,toggle:function(c){if(l(c)||typeof c==="boolean"||f.isFunction(c))return this.__toggle.apply(this,arguments);else{var a=k.apply(this, -arguments);a[1].mode="toggle";return this.effect.apply(this,a)}},cssUnit:function(c){var a=this.css(c),b=[];f.each(["em","px","%","pt"],function(d,e){if(a.indexOf(e)>0)b=[parseFloat(a),e]});return b}});f.easing.jswing=f.easing.swing;f.extend(f.easing,{def:"easeOutQuad",swing:function(c,a,b,d,e){return f.easing[f.easing.def](c,a,b,d,e)},easeInQuad:function(c,a,b,d,e){return d*(a/=e)*a+b},easeOutQuad:function(c,a,b,d,e){return-d*(a/=e)*(a-2)+b},easeInOutQuad:function(c,a,b,d,e){if((a/=e/2)<1)return d/ -2*a*a+b;return-d/2*(--a*(a-2)-1)+b},easeInCubic:function(c,a,b,d,e){return d*(a/=e)*a*a+b},easeOutCubic:function(c,a,b,d,e){return d*((a=a/e-1)*a*a+1)+b},easeInOutCubic:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a+b;return d/2*((a-=2)*a*a+2)+b},easeInQuart:function(c,a,b,d,e){return d*(a/=e)*a*a*a+b},easeOutQuart:function(c,a,b,d,e){return-d*((a=a/e-1)*a*a*a-1)+b},easeInOutQuart:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a+b;return-d/2*((a-=2)*a*a*a-2)+b},easeInQuint:function(c,a,b, -d,e){return d*(a/=e)*a*a*a*a+b},easeOutQuint:function(c,a,b,d,e){return d*((a=a/e-1)*a*a*a*a+1)+b},easeInOutQuint:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a*a+b;return d/2*((a-=2)*a*a*a*a+2)+b},easeInSine:function(c,a,b,d,e){return-d*Math.cos(a/e*(Math.PI/2))+d+b},easeOutSine:function(c,a,b,d,e){return d*Math.sin(a/e*(Math.PI/2))+b},easeInOutSine:function(c,a,b,d,e){return-d/2*(Math.cos(Math.PI*a/e)-1)+b},easeInExpo:function(c,a,b,d,e){return a==0?b:d*Math.pow(2,10*(a/e-1))+b},easeOutExpo:function(c, -a,b,d,e){return a==e?b+d:d*(-Math.pow(2,-10*a/e)+1)+b},easeInOutExpo:function(c,a,b,d,e){if(a==0)return b;if(a==e)return b+d;if((a/=e/2)<1)return d/2*Math.pow(2,10*(a-1))+b;return d/2*(-Math.pow(2,-10*--a)+2)+b},easeInCirc:function(c,a,b,d,e){return-d*(Math.sqrt(1-(a/=e)*a)-1)+b},easeOutCirc:function(c,a,b,d,e){return d*Math.sqrt(1-(a=a/e-1)*a)+b},easeInOutCirc:function(c,a,b,d,e){if((a/=e/2)<1)return-d/2*(Math.sqrt(1-a*a)-1)+b;return d/2*(Math.sqrt(1-(a-=2)*a)+1)+b},easeInElastic:function(c,a,b, -d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h").css({position:"absolute",visibility:"visible",left:-f*(h/d),top:-e*(i/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:h/d,height:i/c,left:g.left+f*(h/d)+(a.options.mode=="show"?(f-Math.floor(d/2))*(h/d):0),top:g.top+e*(i/c)+(a.options.mode=="show"?(e-Math.floor(c/2))*(i/c):0),opacity:a.options.mode=="show"?0:1}).animate({left:g.left+f*(h/d)+(a.options.mode=="show"?0:(f-Math.floor(d/2))*(h/d)),top:g.top+ -e*(i/c)+(a.options.mode=="show"?0:(e-Math.floor(c/2))*(i/c)),opacity:a.options.mode=="show"?1:0},a.duration||500);setTimeout(function(){a.options.mode=="show"?b.css({visibility:"visible"}):b.css({visibility:"visible"}).hide();a.callback&&a.callback.apply(b[0]);b.dequeue();j("div.ui-effects-explode").remove()},a.duration||500)})}})(jQuery); -;/* - * jQuery UI Effects Fade 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Fade - * - * Depends: - * jquery.effects.core.js - */ -(function(b){b.effects.fade=function(a){return this.queue(function(){var c=b(this),d=b.effects.setMode(c,a.options.mode||"hide");c.animate({opacity:d},{queue:false,duration:a.duration,easing:a.options.easing,complete:function(){a.callback&&a.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery); -;/* - * jQuery UI Effects Fold 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Fold - * - * Depends: - * jquery.effects.core.js - */ -(function(c){c.effects.fold=function(a){return this.queue(function(){var b=c(this),j=["position","top","bottom","left","right"],d=c.effects.setMode(b,a.options.mode||"hide"),g=a.options.size||15,h=!!a.options.horizFirst,k=a.duration?a.duration/2:c.fx.speeds._default/2;c.effects.save(b,j);b.show();var e=c.effects.createWrapper(b).css({overflow:"hidden"}),f=d=="show"!=h,l=f?["width","height"]:["height","width"];f=f?[e.width(),e.height()]:[e.height(),e.width()];var i=/([0-9]+)%/.exec(g);if(i)g=parseInt(i[1], -10)/100*f[d=="hide"?0:1];if(d=="show")e.css(h?{height:0,width:g}:{height:g,width:0});h={};i={};h[l[0]]=d=="show"?f[0]:g;i[l[1]]=d=="show"?f[1]:0;e.animate(h,k,a.options.easing).animate(i,k,a.options.easing,function(){d=="hide"&&b.hide();c.effects.restore(b,j);c.effects.removeWrapper(b);a.callback&&a.callback.apply(b[0],arguments);b.dequeue()})})}})(jQuery); -;/* - * jQuery UI Effects Highlight 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Highlight - * - * Depends: - * jquery.effects.core.js - */ -(function(b){b.effects.highlight=function(c){return this.queue(function(){var a=b(this),e=["backgroundImage","backgroundColor","opacity"],d=b.effects.setMode(a,c.options.mode||"show"),f={backgroundColor:a.css("backgroundColor")};if(d=="hide")f.opacity=0;b.effects.save(a,e);a.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(f,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){d=="hide"&&a.hide();b.effects.restore(a,e);d=="show"&&!b.support.opacity&& -this.style.removeAttribute("filter");c.callback&&c.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); -;/* - * jQuery UI Effects Pulsate 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Pulsate - * - * Depends: - * jquery.effects.core.js - */ -(function(d){d.effects.pulsate=function(a){return this.queue(function(){var b=d(this),c=d.effects.setMode(b,a.options.mode||"show");times=(a.options.times||5)*2-1;duration=a.duration?a.duration/2:d.fx.speeds._default/2;isVisible=b.is(":visible");animateTo=0;if(!isVisible){b.css("opacity",0).show();animateTo=1}if(c=="hide"&&isVisible||c=="show"&&!isVisible)times--;for(c=0;c').appendTo(document.body).addClass(a.options.className).css({top:d.top,left:d.left,height:b.innerHeight(),width:b.innerWidth(),position:"absolute"}).animate(c,a.duration,a.options.easing,function(){f.remove();a.callback&&a.callback.apply(b[0],arguments); -b.dequeue()})})}})(jQuery); +/*! + * jQuery UI 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI + */ +(function(c,j){function k(a,b){var d=a.nodeName.toLowerCase();if("area"===d){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&l(a)}return(/input|select|textarea|button|object/.test(d)?!a.disabled:"a"==d?a.href||b:b)&&l(a)}function l(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.16", +keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({propAttr:c.fn.prop||c.fn.attr,_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d= +this;setTimeout(function(){c(d).focus();b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this, +"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart": +"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,m,n){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(m)g-=parseFloat(c.curCSS(f,"border"+this+"Width",true))||0;if(n)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight, +outerWidth:c.fn.outerWidth,outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h,d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){return k(a,!isNaN(c.attr(a,"tabindex")))},tabbable:function(a){var b=c.attr(a, +"tabindex"),d=isNaN(b);return(d||b>=0)&&k(a,!d)}});c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&& +a.element[0].parentNode)for(var e=0;e0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted= +false;a.target==this._mouseDownEvent.target&&b.data(a.target,this.widgetName+".preventClickEvent",true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery); +;/* + * jQuery UI Position 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Position + */ +(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY, +left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+= +k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-= +m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left= +d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+= +a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b), +g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery); +;/* + * jQuery UI Draggable 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Draggables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper== +"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b= +this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;if(b.iframeFix)d(b.iframeFix===true?"iframe":b.iframeFix).each(function(){d('
      ').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")});return true},_mouseStart:function(a){var b=this.options; +this.helper=this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}); +this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions();d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);d.ui.ddmanager&&d.ui.ddmanager.dragStart(this,a);return true}, +_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b= +false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&&this.options.revert.call(this.element,b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration, +10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},_mouseUp:function(a){this.options.iframeFix===true&&d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)});d.ui.ddmanager&&d.ui.ddmanager.dragStop(this,a);return d.ui.mouse.prototype._mouseUp.call(this,a)},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle|| +!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone().removeAttr("id"):this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&& +a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent= +this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"), +10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"), +10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[a.containment=="document"?0:d(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,a.containment=="document"?0:d(window).scrollTop()-this.offset.relative.top-this.offset.parent.top, +(a.containment=="document"?0:d(window).scrollLeft())+d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"?0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&a.containment.constructor!=Array){a=d(a.containment);var b=a[0];if(b){a.offset();var c=d(b).css("overflow")!= +"hidden";this.containment=[(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0),(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0),(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"), +10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom];this.relative_container=a}}else if(a.containment.constructor==Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+ +this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&& +!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,h=a.pageY;if(this.originalPosition){var g;if(this.containment){if(this.relative_container){g=this.relative_container.offset();g=[this.containment[0]+g.left,this.containment[1]+g.top,this.containment[2]+g.left,this.containment[3]+g.top]}else g=this.containment;if(a.pageX-this.offset.click.leftg[2])e=g[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>g[3])h=g[3]+this.offset.click.top}if(b.grid){h=b.grid[1]?this.originalPageY+Math.round((h-this.originalPageY)/b.grid[1])*b.grid[1]:this.originalPageY;h=g?!(h-this.offset.click.topg[3])?h:!(h-this.offset.click.topg[2])?e:!(e-this.offset.click.left=0;i--){var j=c.snapElements[i].left,l=j+c.snapElements[i].width,k=c.snapElements[i].top,m=k+c.snapElements[i].height;if(j-e=j&&f<=l||h>=j&&h<=l||fl)&&(e>= +i&&e<=k||g>=i&&g<=k||ek);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(), +top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle= +this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne", +nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor== +String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),l=0;l=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,l);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection(); +this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){if(!a.disabled){e(this).removeClass("ui-resizable-autohide");b._handles.show()}},function(){if(!a.disabled)if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy(); +var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a= +false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(),d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"}); +this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff= +{width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio:this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis]; +if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);this._updateVirtualBoundaries(b.shiftKey);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize",b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false}, +_mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height;f=f?0:c.sizeDiff.width;f={width:c.helper.width()-f,height:c.helper.height()-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f, +{top:g,left:d}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",b);this._helper&&this.helper.remove();return false},_updateVirtualBoundaries:function(b){var a=this.options,c,d,f;a={minWidth:k(a.minWidth)?a.minWidth:0,maxWidth:k(a.maxWidth)?a.maxWidth:Infinity,minHeight:k(a.minHeight)?a.minHeight:0,maxHeight:k(a.maxHeight)?a.maxHeight: +Infinity};if(this._aspectRatio||b){b=a.minHeight*this.aspectRatio;d=a.minWidth/this.aspectRatio;c=a.maxHeight*this.aspectRatio;f=a.maxWidth/this.aspectRatio;if(b>a.minWidth)a.minWidth=b;if(d>a.minHeight)a.minHeight=d;if(cb.width,h=k(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+this.size.height,l=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&l)b.left=i-a.minWidth;if(d&&l)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left= +null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper||this.element,a=0;a');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+ +a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b,a){return{width:this.originalSize.width+a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+ +c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a,c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]); +b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,{version:"1.8.16"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(), +10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize=b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top- +f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var l=e(this),q=e(this).data("resizable-alsoresize"),p={},r=j&&j.length?j:l.parents(a.originalElement[0]).length?["width","height"]:["width","height","top","left"];e.each(r,function(n,o){if((n=(q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(l.css("position"))){c._revertToRelativePosition=true;l.css({position:"absolute",top:"auto",left:"auto"})}l.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType? +e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})};if(b._revertToRelativePosition){b._revertToRelativePosition=false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a= +e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height-g};g=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing, +step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width,height:i.height});a._updateCache(i);a._propagate("resize",b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement= +e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d=e(a),f=[];e(["Top","Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset; +var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options,d=a.containerOffset,f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left: +a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left:0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper?d.top:0}a.offset.left=a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top- +d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative|absolute/.test(a.containerElement.css("position"));if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height=a.size.width/a.aspectRatio}if(d+a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition, +f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&&!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&&/static/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25, +display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost=="string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable");b.ghost&&b.ghost.css({position:"relative",height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b= +e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;var h=Math.round((c.width-d.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-d.height)/(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height= +d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b,10)||0},k=function(b){return!isNaN(parseInt(b,10))}})(jQuery); +;/* + * jQuery UI Selectable 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function(e){e.widget("ui.selectable",e.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=e(c.options.filter,c.element[0]);f.each(function(){var d=e(this),b=d.offset();e.data(this,"selectable-item",{element:this,$element:d,left:b.left,top:b.top,right:b.left+d.outerWidth(),bottom:b.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"), +selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=e("
      ")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX, +c.pageY];if(!this.options.disabled){var d=this.options;this.selectees=e(d.filter,this.element[0]);this._trigger("start",c);e(d.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});d.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!c.metaKey){b.$element.removeClass("ui-selected");b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting", +c,{unselecting:b.element})}});e(c.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){var g=!c.metaKey||!b.$element.hasClass("ui-selected");b.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");b.unselecting=!g;b.selecting=g;(b.selected=g)?f._trigger("selecting",c,{selecting:b.element}):f._trigger("unselecting",c,{unselecting:b.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var d= +this.options,b=this.opos[0],g=this.opos[1],h=c.pageX,i=c.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a||a.element==f.element[0])){var k=false;if(d.tolerance=="touch")k=!(a.left>h||a.righti||a.bottomb&&a.rightg&&a.bottom *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){var a=this.options;this.containerCache={};this.element.addClass("ui-sortable"); +this.refresh();this.floating=this.items.length?a.axis==="x"||/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a=== +"disabled"){this.options[a]=b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&& +!b){var f=false;d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem=c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top, +left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]}; +this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment();if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!= +document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",a,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a); +return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0], +e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(c))this._rearrange(a,c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset(); +c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"): +this.currentItem.show();for(var b=this.containers.length-1;b>=0;b--){this.containers[b]._trigger("deactivate",null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null, +dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem):d(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};d(b).each(function(){var e=(d(a.item||this).attr(a.attribute||"id")||"").match(a.expression||/(.+)[-=_](.+)/);if(e)c.push((a.key||e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});!c.length&&a.key&&c.push(a.key+"=");return c.join("&")}, +toArray:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};b.each(function(){c.push(d(a.item||this).attr(a.attribute||"id")||"")});return c},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+jg&&b+la[this.floating?"width":"height"]?j:g0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith(); +if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h=d.data(f[g],"sortable");if(h&&h!=this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), +this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)});return d(b)},_removeCurrentsFromItems:function(){for(var a=this.currentItem.find(":data(sortable-item)"),b=0;b=0;f--)for(var g=d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable");if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h=0;b--){var c=this.items[b];if(!(c.instance!=this.currentContainer&&this.currentContainer&&c.item[0]!=this.currentItem[0])){var e=this.options.toleranceElement?d(this.options.toleranceElement,c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b= +this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left=e.left;this.containers[b].containerCache.top=e.top;this.containers[b].containerCache.width=this.containers[b].element.outerWidth();this.containers[b].containerCache.height=this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a||this,c=b.options;if(!c.placeholder||c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f= +d(document.createElement(b.currentItem[0].nodeName)).addClass(e||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!e)f.style.visibility="hidden";return f},update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()||g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10));g.width()||g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")|| +0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b=null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out", +a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length===1){this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h- +f)this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g- +this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.topthis.containment[3])?g:!(g-this.offset.click.topthis.containment[2])?f:!(f-this.offset.click.left=0;e--)if(d.ui.contains(this.containers[e].element[0],this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive",g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b||c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this, +this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out",g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop", +a,this._uiHash());for(e=0;e li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var a=this,b=a.options;a.running=0;a.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix"); +a.headers=a.element.find(b.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){b.disabled||c(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){b.disabled||c(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){b.disabled||c(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){b.disabled||c(this).removeClass("ui-state-focus")});a.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom"); +if(b.navigation){var d=a.element.find("a").filter(b.navigationFilter).eq(0);if(d.length){var h=d.closest(".ui-accordion-header");a.active=h.length?h:d.closest(".ui-accordion-content").prev()}}a.active=a._findActive(a.active||b.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");a.active.next().addClass("ui-accordion-content-active");a._createIcons();a.resize();a.element.attr("role","tablist");a.headers.attr("role","tab").bind("keydown.accordion", +function(f){return a._keydown(f)}).next().attr("role","tabpanel");a.headers.not(a.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide();a.active.length?a.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):a.headers.eq(0).attr("tabIndex",0);c.browser.safari||a.headers.find("a").attr("tabIndex",-1);b.event&&a.headers.bind(b.event.split(" ").join(".accordion ")+".accordion",function(f){a._clickHandler.call(a,f,this);f.preventDefault()})},_createIcons:function(){var a= +this.options;if(a.icons){c("").addClass("ui-icon "+a.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(a.icons.header).toggleClass(a.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var a=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex"); +this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(a.autoHeight||a.fillHeight)b.css("height","");return c.Widget.prototype.destroy.call(this)},_setOption:function(a,b){c.Widget.prototype._setOption.apply(this,arguments);a=="active"&&this.activate(b);if(a=="icons"){this._destroyIcons(); +b&&this._createIcons()}if(a=="disabled")this.headers.add(this.headers.next())[b?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(a){if(!(this.options.disabled||a.altKey||a.ctrlKey)){var b=c.ui.keyCode,d=this.headers.length,h=this.headers.index(a.target),f=false;switch(a.keyCode){case b.RIGHT:case b.DOWN:f=this.headers[(h+1)%d];break;case b.LEFT:case b.UP:f=this.headers[(h-1+d)%d];break;case b.SPACE:case b.ENTER:this._clickHandler({target:a.target},a.target); +a.preventDefault()}if(f){c(a.target).attr("tabIndex",-1);c(f).attr("tabIndex",0);f.focus();return false}return true}},resize:function(){var a=this.options,b;if(a.fillSpace){if(c.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}b=this.element.parent().height();c.browser.msie&&this.element.parent().css("overflow",d);this.headers.each(function(){b-=c(this).outerHeight(true)});this.headers.next().each(function(){c(this).height(Math.max(0,b-c(this).innerHeight()+ +c(this).height()))}).css("overflow","auto")}else if(a.autoHeight){b=0;this.headers.next().each(function(){b=Math.max(b,c(this).height("").height())}).height(b)}return this},activate:function(a){this.options.active=a;a=this._findActive(a)[0];this._clickHandler({target:a},a);return this},_findActive:function(a){return a?typeof a==="number"?this.headers.filter(":eq("+a+")"):this.headers.not(this.headers.not(a)):a===false?c([]):this.headers.filter(":eq(0)")},_clickHandler:function(a,b){var d=this.options; +if(!d.disabled)if(a.target){a=c(a.currentTarget||b);b=a[0]===this.active[0];d.active=d.collapsible&&b?false:this.headers.index(a);if(!(this.running||!d.collapsible&&b)){var h=this.active;j=a.next();g=this.active.next();e={options:d,newHeader:b&&d.collapsible?c([]):a,oldHeader:this.active,newContent:b&&d.collapsible?c([]):j,oldContent:g};var f=this.headers.index(this.active[0])>this.headers.index(a[0]);this.active=b?c([]):a;this._toggle(j,g,e,b,f);h.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header); +if(!b){a.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected);a.next().addClass("ui-accordion-content-active")}}}else if(d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);this.active.next().addClass("ui-accordion-content-active");var g=this.active.next(), +e={options:d,newHeader:c([]),oldHeader:d.active,newContent:c([]),oldContent:g},j=this.active=c([]);this._toggle(j,g,e)}},_toggle:function(a,b,d,h,f){var g=this,e=g.options;g.toShow=a;g.toHide=b;g.data=d;var j=function(){if(g)return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data);g.running=b.size()===0?a.size():b.size();if(e.animated){d={};d=e.collapsible&&h?{toShow:c([]),toHide:b,complete:j,down:f,autoHeight:e.autoHeight||e.fillSpace}:{toShow:a,toHide:b,complete:j,down:f,autoHeight:e.autoHeight|| +e.fillSpace};if(!e.proxied)e.proxied=e.animated;if(!e.proxiedDuration)e.proxiedDuration=e.duration;e.animated=c.isFunction(e.proxied)?e.proxied(d):e.proxied;e.duration=c.isFunction(e.proxiedDuration)?e.proxiedDuration(d):e.proxiedDuration;h=c.ui.accordion.animations;var i=e.duration,k=e.animated;if(k&&!h[k]&&!c.easing[k])k="slide";h[k]||(h[k]=function(l){this.slide(l,{easing:k,duration:i||700})});h[k](d)}else{if(e.collapsible&&h)a.toggle();else{b.hide();a.show()}j(true)}b.prev().attr({"aria-expanded":"false", +"aria-selected":"false",tabIndex:-1}).blur();a.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length)this.toHide.parent()[0].className=this.toHide.parent()[0].className;this._trigger("change",null,this.data)}}});c.extend(c.ui.accordion,{version:"1.8.16", +animations:{slide:function(a,b){a=c.extend({easing:"swing",duration:300},a,b);if(a.toHide.size())if(a.toShow.size()){var d=a.toShow.css("overflow"),h=0,f={},g={},e;b=a.toShow;e=b[0].style.width;b.width(parseInt(b.parent().width(),10)-parseInt(b.css("paddingLeft"),10)-parseInt(b.css("paddingRight"),10)-(parseInt(b.css("borderLeftWidth"),10)||0)-(parseInt(b.css("borderRightWidth"),10)||0));c.each(["height","paddingTop","paddingBottom"],function(j,i){g[i]="hide";j=(""+c.css(a.toShow[0],i)).match(/^([\d+-.]+)(.*)$/); +f[i]={value:j[1],unit:j[2]||"px"}});a.toShow.css({height:0,overflow:"hidden"}).show();a.toHide.filter(":hidden").each(a.complete).end().filter(":visible").animate(g,{step:function(j,i){if(i.prop=="height")h=i.end-i.start===0?0:(i.now-i.start)/(i.end-i.start);a.toShow[0].style[i.prop]=h*f[i.prop].value+f[i.prop].unit},duration:a.duration,easing:a.easing,complete:function(){a.autoHeight||a.toShow.css("height","");a.toShow.css({width:e,overflow:d});a.complete()}})}else a.toHide.animate({height:"hide", +paddingTop:"hide",paddingBottom:"hide"},a);else a.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},a)},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1E3:200})}}})})(jQuery); +;/* + * jQuery UI Autocomplete 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.position.js + */ +(function(d){var e=0;d.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var a=this,b=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled||a.element.propAttr("readOnly"))){g= +false;var f=d.ui.keyCode;switch(c.keyCode){case f.PAGE_UP:a._move("previousPage",c);break;case f.PAGE_DOWN:a._move("nextPage",c);break;case f.UP:a._move("previous",c);c.preventDefault();break;case f.DOWN:a._move("next",c);c.preventDefault();break;case f.ENTER:case f.NUMPAD_ENTER:if(a.menu.active){g=true;c.preventDefault()}case f.TAB:if(!a.menu.active)return;a.menu.select(c);break;case f.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!= +a.element.val()){a.selectedItem=null;a.search(null,c)}},a.options.delay);break}}}).bind("keypress.autocomplete",function(c){if(g){g=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)}; +this.menu=d("
        ").addClass("ui-autocomplete").appendTo(d(this.options.appendTo||"body",b)[0]).mousedown(function(c){var f=a.menu.element[0];d(c.target).closest(".ui-menu-item").length||setTimeout(function(){d(document).one("mousedown",function(h){h.target!==a.element[0]&&h.target!==f&&!d.ui.contains(f,h.target)&&a.close()})},1);setTimeout(function(){clearTimeout(a.closing)},13)}).menu({focus:function(c,f){f=f.item.data("item.autocomplete");false!==a._trigger("focus",c,{item:f})&&/^key/.test(c.originalEvent.type)&& +a.element.val(f.value)},selected:function(c,f){var h=f.item.data("item.autocomplete"),i=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=i;setTimeout(function(){a.previous=i;a.selectedItem=h},1)}false!==a._trigger("select",c,{item:h})&&a.element.val(h.value);a.term=a.element.val();a.close(c);a.selectedItem=h},blur:function(){a.menu.element.is(":visible")&&a.element.val()!==a.term&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu"); +d.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");this.menu.element.remove();d.Widget.prototype.destroy.call(this)},_setOption:function(a,b){d.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource();if(a==="appendTo")this.menu.element.appendTo(d(b||"body",this.element[0].ownerDocument)[0]);a==="disabled"&& +b&&this.xhr&&this.xhr.abort()},_initSource:function(){var a=this,b,g;if(d.isArray(this.options.source)){b=this.options.source;this.source=function(c,f){f(d.ui.autocomplete.filter(b,c.term))}}else if(typeof this.options.source==="string"){g=this.options.source;this.source=function(c,f){a.xhr&&a.xhr.abort();a.xhr=d.ajax({url:g,data:c,dataType:"json",autocompleteRequest:++e,success:function(h){this.autocompleteRequest===e&&f(h)},error:function(){this.autocompleteRequest===e&&f([])}})}}else this.source= +this.options.source},search:function(a,b){a=a!=null?a:this.element.val();this.term=this.element.val();if(a.length").data("item.autocomplete",b).append(d("").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);else this.search(null,b)},widget:function(){return this.menu.element}});d.extend(d.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, +"\\$&")},filter:function(a,b){var g=new RegExp(d.ui.autocomplete.escapeRegex(b),"i");return d.grep(a,function(c){return g.test(c.label||c.value||c)})}})})(jQuery); +(function(d){d.widget("ui.menu",{_create:function(){var e=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(a){if(d(a.target).closest(".ui-menu-item a").length){a.preventDefault();e.select(a)}});this.refresh()},refresh:function(){var e=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex", +-1).mouseenter(function(a){e.activate(a,d(this).parent())}).mouseleave(function(){e.deactivate()})},activate:function(e,a){this.deactivate();if(this.hasScroll()){var b=a.offset().top-this.element.offset().top,g=this.element.scrollTop(),c=this.element.height();if(b<0)this.element.scrollTop(g+b);else b>=c&&this.element.scrollTop(g+b-c+a.height())}this.active=a.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",e,{item:a})},deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id"); +this._trigger("blur");this.active=null}},next:function(e){this.move("next",".ui-menu-item:first",e)},previous:function(e){this.move("prev",".ui-menu-item:last",e)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(e,a,b){if(this.active){e=this.active[e+"All"](".ui-menu-item").eq(0);e.length?this.activate(b,e):this.activate(b,this.element.children(a))}else this.activate(b, +this.element.children(a))},nextPage:function(e){if(this.hasScroll())if(!this.active||this.last())this.activate(e,this.element.children(".ui-menu-item:first"));else{var a=this.active.offset().top,b=this.element.height(),g=this.element.children(".ui-menu-item").filter(function(){var c=d(this).offset().top-a-b+d(this).height();return c<10&&c>-10});g.length||(g=this.element.children(".ui-menu-item:last"));this.activate(e,g)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active|| +this.last()?":first":":last"))},previousPage:function(e){if(this.hasScroll())if(!this.active||this.first())this.activate(e,this.element.children(".ui-menu-item:last"));else{var a=this.active.offset().top,b=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var g=d(this).offset().top-a+b-d(this).height();return g<10&&g>-10});result.length||(result=this.element.children(".ui-menu-item:first"));this.activate(e,result)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active|| +this.first()?":last":":first"))},hasScroll:function(){return this.element.height()").addClass("ui-button-text").html(this.options.label).appendTo(a.empty()).text(),e=this.options.icons,f=e.primary&&e.secondary,d=[];if(e.primary||e.secondary){if(this.options.text)d.push("ui-button-text-icon"+(f?"s":e.primary?"-primary":"-secondary"));e.primary&&a.prepend("");e.secondary&&a.append("");if(!this.options.text){d.push(f?"ui-button-icons-only": +"ui-button-icon-only");this.hasTitle||a.attr("title",c)}}else d.push("ui-button-text-only");a.addClass(d.join(" "))}}});b.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(a,c){a==="disabled"&&this.buttons.button("option",a,c);b.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){var a=this.element.css("direction")=== +"ltr";this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass(a?"ui-corner-left":"ui-corner-right").end().filter(":last").addClass(a?"ui-corner-right":"ui-corner-left").end().end()},destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy"); +b.Widget.prototype.destroy.call(this)}})})(jQuery); +;/* + * jQuery UI Dialog 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.button.js + * jquery.ui.draggable.js + * jquery.ui.mouse.js + * jquery.ui.position.js + * jquery.ui.resizable.js + */ +(function(c,l){var m={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},n={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true},o=c.attrFn||{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true,click:true};c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false, +position:{my:"center",at:"center",collision:"fit",using:function(a){var b=c(this).css(a).offset().top;b<0&&c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var a=this,b=a.options,d=b.title||" ",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("
        ")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+ +b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&!i.isDefaultPrevented()&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("
        ")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g), +h=c('').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("").addClass("ui-dialog-title").attr("id", +e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose=b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body"); +a.uiDialog.remove();a.originalTitle&&a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d,e;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!== +b.uiDialog[0]){e=c(this).css("z-index");isNaN(e)||(d=Math.max(d,e))}});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a||!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.scrollTop(),scrollLeft:d.element.scrollLeft()};c.ui.dialog.maxZ+=1; +d.uiDialog.css("z-index",c.ui.dialog.maxZ);d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target=== +f[0]&&e.shiftKey){g.focus(1);return false}}});c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var b=this,d=false,e=c("
        ").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("
        ").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a, +function(){return!(d=true)});if(d){c.each(a,function(f,h){h=c.isFunction(h)?{click:h,text:f}:h;var i=c('').click(function(){h.click.apply(b.element[0],arguments)}).appendTo(g);c.each(h,function(j,k){if(j!=="click")j in o?i[j](k):i.attr(j,k)});c.fn.button&&i.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close", +handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g=d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",f,a(h))},drag:function(f,h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition, +originalSize:f.originalSize,position:f.position,size:f.size}}a=a===l?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize", +f,b(h))},stop:function(f,h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",f,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0],e;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "): +[a[0],a[1]];if(b.length===1)b[1]=b[0];c.each(["left","top"],function(g,f){if(+b[g]===b[g]){d[g]=b[g];b[g]=f}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,a)}else a=c.ui.dialog.prototype.options.position;(e=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(c.extend({of:window},a));e||this.uiDialog.hide()},_setOptions:function(a){var b=this,d={},e=false;c.each(a,function(g,f){b._setOption(g,f); +if(g in m)e=true;if(g in n)d[g]=f});e&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(a,b){var d=this,e=d.uiDialog;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"): +e.removeClass("ui-dialog-disabled");break;case "draggable":var g=e.is(":data(draggable)");g&&!b&&e.draggable("destroy");!g&&b&&d._makeDraggable();break;case "position":d._position(b);break;case "resizable":(g=e.is(":data(resizable)"))&&!b&&e.resizable("destroy");g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b||" "));break}c.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var a= +this.options,b,d,e=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();d=Math.max(0,a.minHeight-b);if(a.height==="auto")if(c.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();a=this.element.css("height","auto").height();e||this.uiDialog.hide();this.element.height(Math.max(a,d))}else this.element.height(Math.max(a.height- +b,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.16",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "), +create:function(a){if(this.instances.length===0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){if(c(d.target).zIndex()").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&& +c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(b.range==="min"||b.range==="max"?" ui-slider-range-"+b.range:""))}for(var j=c.length;j"); +this.handles=c.add(d(e.join("")).appendTo(a.element));this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(g){g.preventDefault()}).hover(function(){b.disabled||d(this).addClass("ui-state-hover")},function(){d(this).removeClass("ui-state-hover")}).focus(function(){if(b.disabled)d(this).blur();else{d(".ui-slider .ui-state-focus").removeClass("ui-state-focus");d(this).addClass("ui-state-focus")}}).blur(function(){d(this).removeClass("ui-state-focus")});this.handles.each(function(g){d(this).data("index.ui-slider-handle", +g)});this.handles.keydown(function(g){var k=true,l=d(this).data("index.ui-slider-handle"),i,h,m;if(!a.options.disabled){switch(g.keyCode){case d.ui.keyCode.HOME:case d.ui.keyCode.END:case d.ui.keyCode.PAGE_UP:case d.ui.keyCode.PAGE_DOWN:case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:k=false;if(!a._keySliding){a._keySliding=true;d(this).addClass("ui-state-active");i=a._start(g,l);if(i===false)return}break}m=a.options.step;i=a.options.values&&a.options.values.length? +(h=a.values(l)):(h=a.value());switch(g.keyCode){case d.ui.keyCode.HOME:h=a._valueMin();break;case d.ui.keyCode.END:h=a._valueMax();break;case d.ui.keyCode.PAGE_UP:h=a._trimAlignValue(i+(a._valueMax()-a._valueMin())/5);break;case d.ui.keyCode.PAGE_DOWN:h=a._trimAlignValue(i-(a._valueMax()-a._valueMin())/5);break;case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:if(i===a._valueMax())return;h=a._trimAlignValue(i+m);break;case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:if(i===a._valueMin())return;h=a._trimAlignValue(i- +m);break}a._slide(g,l,h);return k}}).keyup(function(g){var k=d(this).data("index.ui-slider-handle");if(a._keySliding){a._keySliding=false;a._stop(g,k);a._change(g,k);d(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");this._mouseDestroy(); +return this},_mouseCapture:function(a){var b=this.options,c,f,e,j,g;if(b.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();c=this._normValueFromMouse({x:a.pageX,y:a.pageY});f=this._valueMax()-this._valueMin()+1;j=this;this.handles.each(function(k){var l=Math.abs(c-j.values(k));if(f>l){f=l;e=d(this);g=k}});if(b.range===true&&this.values(1)===b.min){g+=1;e=d(this.handles[g])}if(this._start(a,g)===false)return false; +this._mouseSliding=true;j._handleIndex=g;e.addClass("ui-state-active").focus();b=e.offset();this._clickOffset=!d(a.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:a.pageX-b.left-e.width()/2,top:a.pageY-b.top-e.height()/2-(parseInt(e.css("borderTopWidth"),10)||0)-(parseInt(e.css("borderBottomWidth"),10)||0)+(parseInt(e.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(a,g,c);return this._animateOff=true},_mouseStart:function(){return true},_mouseDrag:function(a){var b= +this._normValueFromMouse({x:a.pageX,y:a.pageY});this._slide(a,this._handleIndex,b);return false},_mouseStop:function(a){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(a,this._handleIndex);this._change(a,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(a){var b;if(this.orientation==="horizontal"){b= +this.elementSize.width;a=a.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{b=this.elementSize.height;a=a.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}b=a/b;if(b>1)b=1;if(b<0)b=0;if(this.orientation==="vertical")b=1-b;a=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+b*a)},_start:function(a,b){var c={handle:this.handles[b],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(b); +c.values=this.values()}return this._trigger("start",a,c)},_slide:function(a,b,c){var f;if(this.options.values&&this.options.values.length){f=this.values(b?0:1);if(this.options.values.length===2&&this.options.range===true&&(b===0&&c>f||b===1&&c1){this.options.values[a]=this._trimAlignValue(b);this._refreshValue();this._change(null,a)}else if(arguments.length)if(d.isArray(arguments[0])){c=this.options.values;f=arguments[0];for(e=0;e=this._valueMax())return this._valueMax();var b=this.options.step>0?this.options.step:1,c=(a-this._valueMin())%b;a=a-c;if(Math.abs(c)*2>=b)a+=c>0?b:-b;return parseFloat(a.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},_refreshValue:function(){var a= +this.options.range,b=this.options,c=this,f=!this._animateOff?b.animate:false,e,j={},g,k,l,i;if(this.options.values&&this.options.values.length)this.handles.each(function(h){e=(c.values(h)-c._valueMin())/(c._valueMax()-c._valueMin())*100;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";d(this).stop(1,1)[f?"animate":"css"](j,b.animate);if(c.options.range===true)if(c.orientation==="horizontal"){if(h===0)c.range.stop(1,1)[f?"animate":"css"]({left:e+"%"},b.animate);if(h===1)c.range[f?"animate":"css"]({width:e- +g+"%"},{queue:false,duration:b.animate})}else{if(h===0)c.range.stop(1,1)[f?"animate":"css"]({bottom:e+"%"},b.animate);if(h===1)c.range[f?"animate":"css"]({height:e-g+"%"},{queue:false,duration:b.animate})}g=e});else{k=this.value();l=this._valueMin();i=this._valueMax();e=i!==l?(k-l)/(i-l)*100:0;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";this.handle.stop(1,1)[f?"animate":"css"](j,b.animate);if(a==="min"&&this.orientation==="horizontal")this.range.stop(1,1)[f?"animate":"css"]({width:e+"%"}, +b.animate);if(a==="max"&&this.orientation==="horizontal")this.range[f?"animate":"css"]({width:100-e+"%"},{queue:false,duration:b.animate});if(a==="min"&&this.orientation==="vertical")this.range.stop(1,1)[f?"animate":"css"]({height:e+"%"},b.animate);if(a==="max"&&this.orientation==="vertical")this.range[f?"animate":"css"]({height:100-e+"%"},{queue:false,duration:b.animate})}}});d.extend(d.ui.slider,{version:"1.8.16"})})(jQuery); +;/* + * jQuery UI Tabs 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function(d,p){function u(){return++v}function w(){return++x}var v=0,x=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"
        ",remove:null,select:null,show:null,spinner:"Loading…",tabTemplate:"
      • #{label}
      • "},_create:function(){this._tabify(true)},_setOption:function(b,e){if(b=="selected")this.options.collapsible&& +e==this.options.selected||this.select(e);else{this.options[b]=e;this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+u()},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+w());return d.cookie.apply(null,[b].concat(d.makeArray(arguments)))},_ui:function(b,e){return{tab:b,panel:e,index:this.anchors.index(b)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b= +d(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(b){function e(g,f){g.css("display","");!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}var a=this,c=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(g,f){var i=d(f).attr("href"),l=i.split("#")[0],q;if(l&&(l===location.toString().split("#")[0]|| +(q=d("base")[0])&&l===q.href)){i=f.hash;f.href=i}if(h.test(i))a.panels=a.panels.add(a.element.find(a._sanitizeSelector(i)));else if(i&&i!=="#"){d.data(f,"href.tabs",i);d.data(f,"load.tabs",i.replace(/#.*$/,""));i=a._tabId(f);f.href="#"+i;f=a.element.find("#"+i);if(!f.length){f=d(c.panelTemplate).attr("id",i).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(a.panels[g-1]||a.list);f.data("destroy.tabs",true)}a.panels=a.panels.add(f)}else c.disabled.push(g)});if(b){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"); +this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(c.selected===p){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){c.selected=g;return false}});if(typeof c.selected!=="number"&&c.cookie)c.selected=parseInt(a._cookie(),10);if(typeof c.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)c.selected= +this.lis.index(this.lis.filter(".ui-tabs-selected"));c.selected=c.selected||(this.lis.length?0:-1)}else if(c.selected===null)c.selected=-1;c.selected=c.selected>=0&&this.anchors[c.selected]||c.selected<0?c.selected:0;c.disabled=d.unique(c.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return a.lis.index(g)}))).sort();d.inArray(c.selected,c.disabled)!=-1&&c.disabled.splice(d.inArray(c.selected,c.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active"); +if(c.selected>=0&&this.anchors.length){a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(c.selected).addClass("ui-tabs-selected ui-state-active");a.element.queue("tabs",function(){a._trigger("show",null,a._ui(a.anchors[c.selected],a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash))[0]))});this.load(c.selected)}d(window).bind("unload",function(){a.lis.add(a.anchors).unbind(".tabs");a.lis=a.anchors=a.panels=null})}else c.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")); +this.element[c.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");c.cookie&&this._cookie(c.selected,c.cookie);b=0;for(var j;j=this.lis[b];b++)d(j)[d.inArray(b,c.disabled)!=-1&&!d(j).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");c.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(c.event!=="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+ +g)};this.lis.bind("mouseover.tabs",function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(c.fx)if(d.isArray(c.fx)){m=c.fx[0];o=c.fx[1]}else m=o=c.fx;var r=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal", +function(){e(f,o);a._trigger("show",null,a._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");a._trigger("show",null,a._ui(g,f[0]))},s=m?function(g,f){f.animate(m,m.duration||"normal",function(){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);a.element.dequeue("tabs")})}:function(g,f){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");a.element.dequeue("tabs")}; +this.anchors.bind(c.event+".tabs",function(){var g=this,f=d(g).closest("li"),i=a.panels.filter(":not(.ui-tabs-hide)"),l=a.element.find(a._sanitizeSelector(g.hash));if(f.hasClass("ui-tabs-selected")&&!c.collapsible||f.hasClass("ui-state-disabled")||f.hasClass("ui-state-processing")||a.panels.filter(":animated").length||a._trigger("select",null,a._ui(this,l[0]))===false){this.blur();return false}c.selected=a.anchors.index(this);a.abort();if(c.collapsible)if(f.hasClass("ui-tabs-selected")){c.selected= +-1;c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){s(g,i)}).dequeue("tabs");this.blur();return false}else if(!i.length){c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this));this.blur();return false}c.cookie&&a._cookie(c.selected,c.cookie);if(l.length){i.length&&a.element.queue("tabs",function(){s(g,i)});a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier."; +d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(b){if(typeof b=="string")b=this.anchors.index(this.anchors.filter("[href$="+b+"]"));return b},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e= +d.data(this,"href.tabs");if(e)this.href=e;var a=d(this).unbind(".tabs");d.each(["href","load","cache"],function(c,h){a.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});b.cookie&&this._cookie(null,b.cookie);return this},add:function(b, +e,a){if(a===p)a=this.anchors.length;var c=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,b).replace(/#\{label\}/g,e));b=!b.indexOf("#")?b.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var j=c.element.find("#"+b);j.length||(j=d(h.panelTemplate).attr("id",b).data("destroy.tabs",true));j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(a>=this.lis.length){e.appendTo(this.list);j.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[a]); +j.insertBefore(this.panels[a])}h.disabled=d.map(h.disabled,function(k){return k>=a?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");j.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){c._trigger("show",null,c._ui(c.anchors[0],c.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[a],this.panels[a]));return this},remove:function(b){b=this._getIndex(b);var e=this.options,a=this.lis.eq(b).remove(),c=this.panels.eq(b).remove(); +if(a.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(b+(b+1=b?--h:h});this._tabify();this._trigger("remove",null,this._ui(a.find("a")[0],c[0]));return this},enable:function(b){b=this._getIndex(b);var e=this.options;if(d.inArray(b,e.disabled)!=-1){this.lis.eq(b).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=b});this._trigger("enable",null, +this._ui(this.anchors[b],this.panels[b]));return this}},disable:function(b){b=this._getIndex(b);var e=this.options;if(b!=e.selected){this.lis.eq(b).addClass("ui-state-disabled");e.disabled.push(b);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[b],this.panels[b]))}return this},select:function(b){b=this._getIndex(b);if(b==-1)if(this.options.collapsible&&this.options.selected!=-1)b=this.options.selected;else return this;this.anchors.eq(b).trigger(this.options.event+".tabs");return this}, +load:function(b){b=this._getIndex(b);var e=this,a=this.options,c=this.anchors.eq(b)[0],h=d.data(c,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(c,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(b).addClass("ui-state-processing");if(a.spinner){var j=d("span",c);j.data("label.tabs",j.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){e.element.find(e._sanitizeSelector(c.hash)).html(k);e._cleanup();a.cache&&d.data(c, +"cache.tabs",true);e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.error(k,n,b,c)}catch(m){}}}));e.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this}, +url:function(b,e){this.anchors.eq(b).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.16"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(b,e){var a=this,c=this.options,h=a._rotate||(a._rotate=function(j){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=c.selected;a.select(++k'))}function N(a){return a.bind("mouseout", +function(b){b=d(b.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");b.length&&b.removeClass("ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover")}).bind("mouseover",function(b){b=d(b.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");if(!(d.datepicker._isDisabledDatepicker(J.inline?a.parent()[0]:J.input[0])||!b.length)){b.parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover"); +b.addClass("ui-state-hover");b.hasClass("ui-datepicker-prev")&&b.addClass("ui-datepicker-prev-hover");b.hasClass("ui-datepicker-next")&&b.addClass("ui-datepicker-next-hover")}})}function H(a,b){d.extend(a,b);for(var c in b)if(b[c]==null||b[c]==C)a[c]=b[c];return a}d.extend(d.ui,{datepicker:{version:"1.8.16"}});var B=(new Date).getTime(),J;d.extend(M.prototype,{markerClassName:"hasDatepicker",maxRows:4,log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv}, +setDefaults:function(a){H(this._defaults,a||{});return this},_attachDatepicker:function(a,b){var c=null;for(var e in this._defaults){var f=a.getAttribute("date:"+e);if(f){c=c||{};try{c[e]=eval(f)}catch(h){c[e]=f}}}e=a.nodeName.toLowerCase();f=e=="div"||e=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var i=this._newInst(d(a),f);i.settings=d.extend({},b||{},c||{});if(e=="input")this._connectDatepicker(a,i);else f&&this._inlineDatepicker(a,i)},_newInst:function(a,b){return{id:a[0].id.replace(/([^A-Za-z0-9_-])/g, +"\\\\$1"),input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:!b?this.dpDiv:N(d('
        '))}},_connectDatepicker:function(a,b){var c=d(a);b.append=d([]);b.trigger=d([]);if(!c.hasClass(this.markerClassName)){this._attachments(c,b);c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker", +function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});this._autoSize(b);d.data(a,"datepicker",b);b.settings.disabled&&this._disableDatepicker(a)}},_attachments:function(a,b){var c=this._get(b,"appendText"),e=this._get(b,"isRTL");b.append&&b.append.remove();if(c){b.append=d(''+c+"");a[e?"before":"after"](b.append)}a.unbind("focus",this._showDatepicker);b.trigger&&b.trigger.remove();c=this._get(b,"showOn");if(c== +"focus"||c=="both")a.focus(this._showDatepicker);if(c=="button"||c=="both"){c=this._get(b,"buttonText");var f=this._get(b,"buttonImage");b.trigger=d(this._get(b,"buttonImageOnly")?d("").addClass(this._triggerClass).attr({src:f,alt:c,title:c}):d('').addClass(this._triggerClass).html(f==""?c:d("").attr({src:f,alt:c,title:c})));a[e?"before":"after"](b.trigger);b.trigger.click(function(){d.datepicker._datepickerShowing&&d.datepicker._lastInput==a[0]?d.datepicker._hideDatepicker(): +d.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var e=function(f){for(var h=0,i=0,g=0;gh){h=f[g].length;i=g}return i};b.setMonth(e(this._get(a,c.match(/MM/)?"monthNames":"monthNamesShort")));b.setDate(e(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a, +b){var c=d(a);if(!c.hasClass(this.markerClassName)){c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});d.data(a,"datepicker",b);this._setDate(b,this._getDefaultDate(b),true);this._updateDatepicker(b);this._updateAlternate(b);b.settings.disabled&&this._disableDatepicker(a);b.dpDiv.css("display","block")}},_dialogDatepicker:function(a,b,c,e,f){a=this._dialogInst;if(!a){this.uuid+= +1;this._dialogInput=d('');this._dialogInput.keydown(this._doKeyDown);d("body").append(this._dialogInput);a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};d.data(this._dialogInput[0],"datepicker",a)}H(a.settings,e||{});b=b&&b.constructor==Date?this._formatDate(a,b):b;this._dialogInput.val(b);this._pos=f?f.length?f:[f.pageX,f.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/ +2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=c;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);d.blockUI&&d.blockUI(this.dpDiv);d.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var b= +d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();d.removeData(a,"datepicker");if(e=="input"){c.append.remove();c.trigger.remove();b.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)}else if(e=="div"||e=="span")b.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e= +a.nodeName.toLowerCase();if(e=="input"){a.disabled=false;c.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(e=="div"||e=="span"){b=b.children("."+this._inlineClass);b.children().removeClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").removeAttr("disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f})}},_disableDatepicker:function(a){var b=d(a),c=d.data(a, +"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=true;c.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else if(e=="div"||e=="span"){b=b.children("."+this._inlineClass);b.children().addClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").attr("disabled","disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f== +a?null:f});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;for(var b=0;b-1}},_doKeyUp:function(a){a=d.datepicker._getInst(a.target);if(a.input.val()!=a.lastVal)try{if(d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,d.datepicker._getFormatConfig(a))){d.datepicker._setDateFromField(a);d.datepicker._updateAlternate(a);d.datepicker._updateDatepicker(a)}}catch(b){d.datepicker.log(b)}return true},_showDatepicker:function(a){a=a.target||a;if(a.nodeName.toLowerCase()!="input")a=d("input", +a.parentNode)[0];if(!(d.datepicker._isDisabledDatepicker(a)||d.datepicker._lastInput==a)){var b=d.datepicker._getInst(a);if(d.datepicker._curInst&&d.datepicker._curInst!=b){d.datepicker._datepickerShowing&&d.datepicker._triggerOnClose(d.datepicker._curInst);d.datepicker._curInst.dpDiv.stop(true,true)}var c=d.datepicker._get(b,"beforeShow");c=c?c.apply(a,[a,b]):{};if(c!==false){H(b.settings,c);b.lastVal=null;d.datepicker._lastInput=a;d.datepicker._setDateFromField(b);if(d.datepicker._inDialog)a.value= +"";if(!d.datepicker._pos){d.datepicker._pos=d.datepicker._findPos(a);d.datepicker._pos[1]+=a.offsetHeight}var e=false;d(a).parents().each(function(){e|=d(this).css("position")=="fixed";return!e});if(e&&d.browser.opera){d.datepicker._pos[0]-=document.documentElement.scrollLeft;d.datepicker._pos[1]-=document.documentElement.scrollTop}c={left:d.datepicker._pos[0],top:d.datepicker._pos[1]};d.datepicker._pos=null;b.dpDiv.empty();b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});d.datepicker._updateDatepicker(b); +c=d.datepicker._checkOffset(b,c,e);b.dpDiv.css({position:d.datepicker._inDialog&&d.blockUI?"static":e?"fixed":"absolute",display:"none",left:c.left+"px",top:c.top+"px"});if(!b.inline){c=d.datepicker._get(b,"showAnim");var f=d.datepicker._get(b,"duration"),h=function(){var i=b.dpDiv.find("iframe.ui-datepicker-cover");if(i.length){var g=d.datepicker._getBorders(b.dpDiv);i.css({left:-g[0],top:-g[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex(d(a).zIndex()+1);d.datepicker._datepickerShowing= +true;d.effects&&d.effects[c]?b.dpDiv.show(c,d.datepicker._get(b,"showOptions"),f,h):b.dpDiv[c||"show"](c?f:null,h);if(!c||!f)h();b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus();d.datepicker._curInst=b}}}},_updateDatepicker:function(a){this.maxRows=4;var b=d.datepicker._getBorders(a.dpDiv);J=a;a.dpDiv.empty().append(this._generateHTML(a));var c=a.dpDiv.find("iframe.ui-datepicker-cover");c.length&&c.css({left:-b[0],top:-b[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()}); +a.dpDiv.find("."+this._dayOverClass+" a").mouseover();b=this._getNumberOfMonths(a);c=b[1];a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");c>1&&a.dpDiv.addClass("ui-datepicker-multi-"+c).css("width",17*c+"em");a.dpDiv[(b[0]!=1||b[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");a==d.datepicker._curInst&&d.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&& +!a.input.is(":disabled")&&a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var e=a.yearshtml;setTimeout(function(){e===a.yearshtml&&a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml);e=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(c){return{thin:1,medium:2,thick:3}[c]||c};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var e=a.dpDiv.outerWidth(),f=a.dpDiv.outerHeight(), +h=a.input?a.input.outerWidth():0,i=a.input?a.input.outerHeight():0,g=document.documentElement.clientWidth+d(document).scrollLeft(),j=document.documentElement.clientHeight+d(document).scrollTop();b.left-=this._get(a,"isRTL")?e-h:0;b.left-=c&&b.left==a.input.offset().left?d(document).scrollLeft():0;b.top-=c&&b.top==a.input.offset().top+i?d(document).scrollTop():0;b.left-=Math.min(b.left,b.left+e>g&&g>e?Math.abs(b.left+e-g):0);b.top-=Math.min(b.top,b.top+f>j&&j>f?Math.abs(f+i):0);return b},_findPos:function(a){for(var b= +this._get(this._getInst(a),"isRTL");a&&(a.type=="hidden"||a.nodeType!=1||d.expr.filters.hidden(a));)a=a[b?"previousSibling":"nextSibling"];a=d(a).offset();return[a.left,a.top]},_triggerOnClose:function(a){var b=this._get(a,"onClose");if(b)b.apply(a.input?a.input[0]:null,[a.input?a.input.val():"",a])},_hideDatepicker:function(a){var b=this._curInst;if(!(!b||a&&b!=d.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(b,"showAnim");var c=this._get(b,"duration"),e=function(){d.datepicker._tidyDialog(b); +this._curInst=null};d.effects&&d.effects[a]?b.dpDiv.hide(a,d.datepicker._get(b,"showOptions"),c,e):b.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"?"fadeOut":"hide"](a?c:null,e);a||e();d.datepicker._triggerOnClose(b);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if(d.blockUI){d.unblockUI();d("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")}, +_checkExternalClick:function(a){if(d.datepicker._curInst){a=d(a.target);a[0].id!=d.datepicker._mainDivId&&a.parents("#"+d.datepicker._mainDivId).length==0&&!a.hasClass(d.datepicker.markerClassName)&&!a.hasClass(d.datepicker._triggerClass)&&d.datepicker._datepickerShowing&&!(d.datepicker._inDialog&&d.blockUI)&&d.datepicker._hideDatepicker()}},_adjustDate:function(a,b,c){a=d(a);var e=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"): +0),c);this._updateDatepicker(e)}},_gotoToday:function(a){a=d(a);var b=this._getInst(a[0]);if(this._get(b,"gotoCurrent")&&b.currentDay){b.selectedDay=b.currentDay;b.drawMonth=b.selectedMonth=b.currentMonth;b.drawYear=b.selectedYear=b.currentYear}else{var c=new Date;b.selectedDay=c.getDate();b.drawMonth=b.selectedMonth=c.getMonth();b.drawYear=b.selectedYear=c.getFullYear()}this._notifyChange(b);this._adjustDate(a)},_selectMonthYear:function(a,b,c){a=d(a);var e=this._getInst(a[0]);e["selected"+(c=="M"? +"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10);this._notifyChange(e);this._adjustDate(a)},_selectDay:function(a,b,c,e){var f=d(a);if(!(d(e).hasClass(this._unselectableClass)||this._isDisabledDatepicker(f[0]))){f=this._getInst(f[0]);f.selectedDay=f.currentDay=d("a",e).html();f.selectedMonth=f.currentMonth=b;f.selectedYear=f.currentYear=c;this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))}},_clearDate:function(a){a=d(a); +this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,b){a=this._getInst(d(a)[0]);b=b!=null?b:this._formatDate(a);a.input&&a.input.val(b);this._updateAlternate(a);var c=this._get(a,"onSelect");if(c)c.apply(a.input?a.input[0]:null,[b,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a);else{this._hideDatepicker();this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var b=this._get(a,"altField"); +if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),e=this._getDate(a),f=this.formatDate(c,e,this._getFormatConfig(a));d(b).each(function(){d(this).val(f)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var b=a.getTime();a.setMonth(0);a.setDate(1);return Math.floor(Math.round((b-a)/864E5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"? +b.toString():b+"";if(b=="")return null;var e=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;e=typeof e!="string"?e:(new Date).getFullYear()%100+parseInt(e,10);for(var f=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,h=(c?c.dayNames:null)||this._defaults.dayNames,i=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,g=(c?c.monthNames:null)||this._defaults.monthNames,j=c=-1,l=-1,u=-1,k=false,o=function(p){(p=A+1-1){j=1;l=u;do{e=this._getDaysInMonth(c,j-1);if(l<=e)break;j++;l-=e}while(1)}v=this._daylightSavingAdjust(new Date(c,j-1,l));if(v.getFullYear()!=c||v.getMonth()+1!=j||v.getDate()!=l)throw"Invalid date";return v},ATOM:"yy-mm-dd", +COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,b,c){if(!b)return"";var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,h=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort;c=(c?c.monthNames: +null)||this._defaults.monthNames;var i=function(o){(o=k+1 +12?a.getHours()+2:0);return a},_setDate:function(a,b,c){var e=!b,f=a.selectedMonth,h=a.selectedYear;b=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay=a.currentDay=b.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=b.getMonth();a.drawYear=a.selectedYear=a.currentYear=b.getFullYear();if((f!=a.selectedMonth||h!=a.selectedYear)&&!c)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(e?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||a.input&& +a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(),b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),e=this._get(a,"showButtonPanel"),f=this._get(a,"hideIfNoPrevNext"),h=this._get(a,"navigationAsDateFormat"),i=this._getNumberOfMonths(a),g=this._get(a,"showCurrentAtPos"),j=this._get(a,"stepMonths"),l=i[0]!=1||i[1]!=1,u=this._daylightSavingAdjust(!a.currentDay? +new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),k=this._getMinMaxDate(a,"min"),o=this._getMinMaxDate(a,"max");g=a.drawMonth-g;var m=a.drawYear;if(g<0){g+=12;m--}if(o){var n=this._daylightSavingAdjust(new Date(o.getFullYear(),o.getMonth()-i[0]*i[1]+1,o.getDate()));for(n=k&&nn;){g--;if(g<0){g=11;m--}}}a.drawMonth=g;a.drawYear=m;n=this._get(a,"prevText");n=!h?n:this.formatDate(n,this._daylightSavingAdjust(new Date(m,g-j,1)),this._getFormatConfig(a)); +n=this._canAdjustMonth(a,-1,m,g)?''+n+"":f?"":''+n+"";var s=this._get(a,"nextText");s=!h?s:this.formatDate(s,this._daylightSavingAdjust(new Date(m, +g+j,1)),this._getFormatConfig(a));f=this._canAdjustMonth(a,+1,m,g)?''+s+"":f?"":''+s+"";j=this._get(a,"currentText");s=this._get(a,"gotoCurrent")&& +a.currentDay?u:b;j=!h?j:this.formatDate(j,s,this._getFormatConfig(a));h=!a.inline?'":"";e=e?'
        '+(c?h:"")+(this._isInRange(a,s)?'":"")+(c?"":h)+"
        ":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;j=this._get(a,"showWeek");s=this._get(a,"dayNames");this._get(a,"dayNamesShort");var q=this._get(a,"dayNamesMin"),A=this._get(a,"monthNames"),v=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),D=this._get(a,"showOtherMonths"),K=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var E=this._getDefaultDate(a),w="",x=0;x1)switch(G){case 0:y+=" ui-datepicker-group-first";t=" ui-corner-"+(c?"right":"left");break;case i[1]-1:y+=" ui-datepicker-group-last";t=" ui-corner-"+(c?"left":"right");break;default:y+=" ui-datepicker-group-middle";t="";break}y+='">'}y+='
        '+(/all|left/.test(t)&& +x==0?c?f:n:"")+(/all|right/.test(t)&&x==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,k,o,x>0||G>0,A,v)+'
        ';var z=j?'":"";for(t=0;t<7;t++){var r=(t+h)%7;z+="=5?' class="ui-datepicker-week-end"':"")+'>'+q[r]+""}y+=z+"";z=this._getDaysInMonth(m,g);if(m==a.selectedYear&&g==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay, +z);t=(this._getFirstDayOfMonth(m,g)-h+7)%7;z=Math.ceil((t+z)/7);this.maxRows=z=l?this.maxRows>z?this.maxRows:z:z;r=this._daylightSavingAdjust(new Date(m,g,1-t));for(var Q=0;Q";var R=!j?"":'";for(t=0;t<7;t++){var I=p?p.apply(a.input?a.input[0]:null,[r]):[true,""],F=r.getMonth()!=g,L=F&&!K||!I[0]||k&&ro;R+='";r.setDate(r.getDate()+1);r=this._daylightSavingAdjust(r)}y+=R+""}g++;if(g>11){g=0;m++}y+="
        '+this._get(a,"weekHeader")+"
        '+this._get(a,"calculateWeek")(r)+""+(F&&!D?" ":L?''+ +r.getDate()+"":''+r.getDate()+"")+"
        "+(l?""+(i[0]>0&&G==i[1]-1?'
        ':""):"");O+=y}w+=O}w+=e+(d.browser.msie&&parseInt(d.browser.version,10)<7&&!a.inline?'': +"");a._keyEvent=false;return w},_generateMonthYearHeader:function(a,b,c,e,f,h,i,g){var j=this._get(a,"changeMonth"),l=this._get(a,"changeYear"),u=this._get(a,"showMonthAfterYear"),k='
        ',o="";if(h||!j)o+=''+i[b]+"";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='"}u||(k+=o+(h||!(j&&l)?" ":""));if(!a.yearshtml){a.yearshtml="";if(h||!l)k+=''+c+"";else{g=this._get(a,"yearRange").split(":");var s=(new Date).getFullYear();i=function(q){q=q.match(/c[+-].*/)?c+parseInt(q.substring(1),10):q.match(/[+-].*/)?s+parseInt(q,10):parseInt(q,10);return isNaN(q)?s:q};b=i(g[0]);g=Math.max(b,i(g[1]||""));b=e?Math.max(b, +e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()):g;for(a.yearshtml+='";k+=a.yearshtml;a.yearshtml=null}}k+=this._get(a,"yearSuffix");if(u)k+=(h||!(j&&l)?" ":"")+o;k+="
        ";return k},_adjustInstDate:function(a,b,c){var e=a.drawYear+(c=="Y"?b:0),f=a.drawMonth+ +(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");b=c&&ba?a:b},_notifyChange:function(a){var b=this._get(a,"onChangeMonthYear");if(b)b.apply(a.input? +a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-this._daylightSavingAdjust(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,e){var f=this._getNumberOfMonths(a);c=this._daylightSavingAdjust(new Date(c, +e+(b<0?b:f[0]*f[1]),1));b<0&&c.setDate(this._getDaysInMonth(c.getFullYear(),c.getMonth()));return this._isInRange(a,c)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!a||b.getTime()<=a.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10);return{shortYearCutoff:b,dayNamesShort:this._get(a,"dayNamesShort"),dayNames:this._get(a, +"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,e){if(!b){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}b=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(e,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),b,this._getFormatConfig(a))}});d.fn.datepicker=function(a){if(!this.length)return this; +if(!d.datepicker.initialized){d(document).mousedown(d.datepicker._checkExternalClick).find("body").append(d.datepicker.dpDiv);d.datepicker.initialized=true}var b=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));return this.each(function(){typeof a== +"string"?d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this].concat(b)):d.datepicker._attachDatepicker(this,a)})};d.datepicker=new M;d.datepicker.initialized=false;d.datepicker.uuid=(new Date).getTime();d.datepicker.version="1.8.16";window["DP_jQuery_"+B]=d})(jQuery); +;/* + * jQuery UI Progressbar 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function(b,d){b.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=b("
        ").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"); +this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(a){if(a===d)return this._value();this._setOption("value",a);return this},_setOption:function(a,c){if(a==="value"){this.options.value=c;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;if(typeof a!=="number")a=0;return Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100* +this._value()/this.options.max},_refreshValue:function(){var a=this.value(),c=this._percentage();if(this.oldValue!==a){this.oldValue=a;this._trigger("change")}this.valueDiv.toggle(a>this.min).toggleClass("ui-corner-right",a===this.options.max).width(c.toFixed(0)+"%");this.element.attr("aria-valuenow",a)}});b.extend(b.ui.progressbar,{version:"1.8.16"})})(jQuery); +;/* + * jQuery UI Effects 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/ + */ +jQuery.effects||function(f,j){function m(c){var a;if(c&&c.constructor==Array&&c.length==3)return c;if(a=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c))return[parseInt(a[1],10),parseInt(a[2],10),parseInt(a[3],10)];if(a=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c))return[parseFloat(a[1])*2.55,parseFloat(a[2])*2.55,parseFloat(a[3])*2.55];if(a=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c))return[parseInt(a[1], +16),parseInt(a[2],16),parseInt(a[3],16)];if(a=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c))return[parseInt(a[1]+a[1],16),parseInt(a[2]+a[2],16),parseInt(a[3]+a[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(c))return n.transparent;return n[f.trim(c).toLowerCase()]}function s(c,a){var b;do{b=f.curCSS(c,a);if(b!=""&&b!="transparent"||f.nodeName(c,"body"))break;a="backgroundColor"}while(c=c.parentNode);return m(b)}function o(){var c=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle, +a={},b,d;if(c&&c.length&&c[0]&&c[c[0]])for(var e=c.length;e--;){b=c[e];if(typeof c[b]=="string"){d=b.replace(/\-(\w)/g,function(g,h){return h.toUpperCase()});a[d]=c[b]}}else for(b in c)if(typeof c[b]==="string")a[b]=c[b];return a}function p(c){var a,b;for(a in c){b=c[a];if(b==null||f.isFunction(b)||a in t||/scrollbar/.test(a)||!/color/i.test(a)&&isNaN(parseFloat(b)))delete c[a]}return c}function u(c,a){var b={_:0},d;for(d in a)if(c[d]!=a[d])b[d]=a[d];return b}function k(c,a,b,d){if(typeof c=="object"){d= +a;b=null;a=c;c=a.effect}if(f.isFunction(a)){d=a;b=null;a={}}if(typeof a=="number"||f.fx.speeds[a]){d=b;b=a;a={}}if(f.isFunction(b)){d=b;b=null}a=a||{};b=b||a.duration;b=f.fx.off?0:typeof b=="number"?b:b in f.fx.speeds?f.fx.speeds[b]:f.fx.speeds._default;d=d||a.complete;return[c,a,b,d]}function l(c){if(!c||typeof c==="number"||f.fx.speeds[c])return true;if(typeof c==="string"&&!f.effects[c])return true;return false}f.effects={};f.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor", +"borderTopColor","borderColor","color","outlineColor"],function(c,a){f.fx.step[a]=function(b){if(!b.colorInit){b.start=s(b.elem,a);b.end=m(b.end);b.colorInit=true}b.elem.style[a]="rgb("+Math.max(Math.min(parseInt(b.pos*(b.end[0]-b.start[0])+b.start[0],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[1]-b.start[1])+b.start[1],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[2]-b.start[2])+b.start[2],10),255),0)+")"}});var n={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0, +0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211, +211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},q=["add","remove","toggle"],t={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};f.effects.animateClass=function(c,a,b, +d){if(f.isFunction(b)){d=b;b=null}return this.queue(function(){var e=f(this),g=e.attr("style")||" ",h=p(o.call(this)),r,v=e.attr("class");f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});r=p(o.call(this));e.attr("class",v);e.animate(u(h,r),{queue:false,duration:a,easing:b,complete:function(){f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});if(typeof e.attr("style")=="object"){e.attr("style").cssText="";e.attr("style").cssText=g}else e.attr("style",g);d&&d.apply(this,arguments);f.dequeue(this)}})})}; +f.fn.extend({_addClass:f.fn.addClass,addClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{add:c},a,b,d]):this._addClass(c)},_removeClass:f.fn.removeClass,removeClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{remove:c},a,b,d]):this._removeClass(c)},_toggleClass:f.fn.toggleClass,toggleClass:function(c,a,b,d,e){return typeof a=="boolean"||a===j?b?f.effects.animateClass.apply(this,[a?{add:c}:{remove:c},b,d,e]):this._toggleClass(c,a):f.effects.animateClass.apply(this, +[{toggle:c},a,b,d])},switchClass:function(c,a,b,d,e){return f.effects.animateClass.apply(this,[{add:a,remove:c},b,d,e])}});f.extend(f.effects,{version:"1.8.16",save:function(c,a){for(var b=0;b").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}), +d=document.activeElement;c.wrap(b);if(c[0]===d||f.contains(c[0],d))f(d).focus();b=c.parent();if(c.css("position")=="static"){b.css({position:"relative"});c.css({position:"relative"})}else{f.extend(a,{position:c.css("position"),zIndex:c.css("z-index")});f.each(["top","left","bottom","right"],function(e,g){a[g]=c.css(g);if(isNaN(parseInt(a[g],10)))a[g]="auto"});c.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return b.css(a).show()},removeWrapper:function(c){var a,b=document.activeElement; +if(c.parent().is(".ui-effects-wrapper")){a=c.parent().replaceWith(c);if(c[0]===b||f.contains(c[0],b))f(b).focus();return a}return c},setTransition:function(c,a,b,d){d=d||{};f.each(a,function(e,g){unit=c.cssUnit(g);if(unit[0]>0)d[g]=unit[0]*b+unit[1]});return d}});f.fn.extend({effect:function(c){var a=k.apply(this,arguments),b={options:a[1],duration:a[2],callback:a[3]};a=b.options.mode;var d=f.effects[c];if(f.fx.off||!d)return a?this[a](b.duration,b.callback):this.each(function(){b.callback&&b.callback.call(this)}); +return d.call(this,b)},_show:f.fn.show,show:function(c){if(l(c))return this._show.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="show";return this.effect.apply(this,a)}},_hide:f.fn.hide,hide:function(c){if(l(c))return this._hide.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="hide";return this.effect.apply(this,a)}},__toggle:f.fn.toggle,toggle:function(c){if(l(c)||typeof c==="boolean"||f.isFunction(c))return this.__toggle.apply(this,arguments);else{var a=k.apply(this, +arguments);a[1].mode="toggle";return this.effect.apply(this,a)}},cssUnit:function(c){var a=this.css(c),b=[];f.each(["em","px","%","pt"],function(d,e){if(a.indexOf(e)>0)b=[parseFloat(a),e]});return b}});f.easing.jswing=f.easing.swing;f.extend(f.easing,{def:"easeOutQuad",swing:function(c,a,b,d,e){return f.easing[f.easing.def](c,a,b,d,e)},easeInQuad:function(c,a,b,d,e){return d*(a/=e)*a+b},easeOutQuad:function(c,a,b,d,e){return-d*(a/=e)*(a-2)+b},easeInOutQuad:function(c,a,b,d,e){if((a/=e/2)<1)return d/ +2*a*a+b;return-d/2*(--a*(a-2)-1)+b},easeInCubic:function(c,a,b,d,e){return d*(a/=e)*a*a+b},easeOutCubic:function(c,a,b,d,e){return d*((a=a/e-1)*a*a+1)+b},easeInOutCubic:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a+b;return d/2*((a-=2)*a*a+2)+b},easeInQuart:function(c,a,b,d,e){return d*(a/=e)*a*a*a+b},easeOutQuart:function(c,a,b,d,e){return-d*((a=a/e-1)*a*a*a-1)+b},easeInOutQuart:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a+b;return-d/2*((a-=2)*a*a*a-2)+b},easeInQuint:function(c,a,b, +d,e){return d*(a/=e)*a*a*a*a+b},easeOutQuint:function(c,a,b,d,e){return d*((a=a/e-1)*a*a*a*a+1)+b},easeInOutQuint:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a*a+b;return d/2*((a-=2)*a*a*a*a+2)+b},easeInSine:function(c,a,b,d,e){return-d*Math.cos(a/e*(Math.PI/2))+d+b},easeOutSine:function(c,a,b,d,e){return d*Math.sin(a/e*(Math.PI/2))+b},easeInOutSine:function(c,a,b,d,e){return-d/2*(Math.cos(Math.PI*a/e)-1)+b},easeInExpo:function(c,a,b,d,e){return a==0?b:d*Math.pow(2,10*(a/e-1))+b},easeOutExpo:function(c, +a,b,d,e){return a==e?b+d:d*(-Math.pow(2,-10*a/e)+1)+b},easeInOutExpo:function(c,a,b,d,e){if(a==0)return b;if(a==e)return b+d;if((a/=e/2)<1)return d/2*Math.pow(2,10*(a-1))+b;return d/2*(-Math.pow(2,-10*--a)+2)+b},easeInCirc:function(c,a,b,d,e){return-d*(Math.sqrt(1-(a/=e)*a)-1)+b},easeOutCirc:function(c,a,b,d,e){return d*Math.sqrt(1-(a=a/e-1)*a)+b},easeInOutCirc:function(c,a,b,d,e){if((a/=e/2)<1)return-d/2*(Math.sqrt(1-a*a)-1)+b;return d/2*(Math.sqrt(1-(a-=2)*a)+1)+b},easeInElastic:function(c,a,b, +d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h").css({position:"absolute",visibility:"visible",left:-f*(h/d),top:-e*(i/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:h/d,height:i/c,left:g.left+f*(h/d)+(a.options.mode=="show"?(f-Math.floor(d/2))*(h/d):0),top:g.top+e*(i/c)+(a.options.mode=="show"?(e-Math.floor(c/2))*(i/c):0),opacity:a.options.mode=="show"?0:1}).animate({left:g.left+f*(h/d)+(a.options.mode=="show"?0:(f-Math.floor(d/2))*(h/d)),top:g.top+ +e*(i/c)+(a.options.mode=="show"?0:(e-Math.floor(c/2))*(i/c)),opacity:a.options.mode=="show"?1:0},a.duration||500);setTimeout(function(){a.options.mode=="show"?b.css({visibility:"visible"}):b.css({visibility:"visible"}).hide();a.callback&&a.callback.apply(b[0]);b.dequeue();j("div.ui-effects-explode").remove()},a.duration||500)})}})(jQuery); +;/* + * jQuery UI Effects Fade 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fade + * + * Depends: + * jquery.effects.core.js + */ +(function(b){b.effects.fade=function(a){return this.queue(function(){var c=b(this),d=b.effects.setMode(c,a.options.mode||"hide");c.animate({opacity:d},{queue:false,duration:a.duration,easing:a.options.easing,complete:function(){a.callback&&a.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Fold 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fold + * + * Depends: + * jquery.effects.core.js + */ +(function(c){c.effects.fold=function(a){return this.queue(function(){var b=c(this),j=["position","top","bottom","left","right"],d=c.effects.setMode(b,a.options.mode||"hide"),g=a.options.size||15,h=!!a.options.horizFirst,k=a.duration?a.duration/2:c.fx.speeds._default/2;c.effects.save(b,j);b.show();var e=c.effects.createWrapper(b).css({overflow:"hidden"}),f=d=="show"!=h,l=f?["width","height"]:["height","width"];f=f?[e.width(),e.height()]:[e.height(),e.width()];var i=/([0-9]+)%/.exec(g);if(i)g=parseInt(i[1], +10)/100*f[d=="hide"?0:1];if(d=="show")e.css(h?{height:0,width:g}:{height:g,width:0});h={};i={};h[l[0]]=d=="show"?f[0]:g;i[l[1]]=d=="show"?f[1]:0;e.animate(h,k,a.options.easing).animate(i,k,a.options.easing,function(){d=="hide"&&b.hide();c.effects.restore(b,j);c.effects.removeWrapper(b);a.callback&&a.callback.apply(b[0],arguments);b.dequeue()})})}})(jQuery); +;/* + * jQuery UI Effects Highlight 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Highlight + * + * Depends: + * jquery.effects.core.js + */ +(function(b){b.effects.highlight=function(c){return this.queue(function(){var a=b(this),e=["backgroundImage","backgroundColor","opacity"],d=b.effects.setMode(a,c.options.mode||"show"),f={backgroundColor:a.css("backgroundColor")};if(d=="hide")f.opacity=0;b.effects.save(a,e);a.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(f,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){d=="hide"&&a.hide();b.effects.restore(a,e);d=="show"&&!b.support.opacity&& +this.style.removeAttribute("filter");c.callback&&c.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Pulsate 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Pulsate + * + * Depends: + * jquery.effects.core.js + */ +(function(d){d.effects.pulsate=function(a){return this.queue(function(){var b=d(this),c=d.effects.setMode(b,a.options.mode||"show");times=(a.options.times||5)*2-1;duration=a.duration?a.duration/2:d.fx.speeds._default/2;isVisible=b.is(":visible");animateTo=0;if(!isVisible){b.css("opacity",0).show();animateTo=1}if(c=="hide"&&isVisible||c=="show"&&!isVisible)times--;for(c=0;c').appendTo(document.body).addClass(a.options.className).css({top:d.top,left:d.left,height:b.innerHeight(),width:b.innerWidth(),position:"absolute"}).animate(c,a.duration,a.options.easing,function(){f.remove();a.callback&&a.callback.apply(b[0],arguments); +b.dequeue()})})}})(jQuery); ; \ No newline at end of file diff --git a/js/showcase.js b/Wordpress/js/showcase.js similarity index 94% rename from js/showcase.js rename to Wordpress/js/showcase.js index d9fb2fe..89d523f 100644 --- a/js/showcase.js +++ b/Wordpress/js/showcase.js @@ -1,17 +1,17 @@ -(function($) { - $(document).ready( function() { - $('.feature-slider a').click(function(e) { - $('.featured-posts section.featured-post').css({ - opacity: 0, - visibility: 'hidden' - }); - $(this.hash).css({ - opacity: 1, - visibility: 'visible' - }); - $('.feature-slider a').removeClass('active'); - $(this).addClass('active'); - e.preventDefault(); - }); - }); +(function($) { + $(document).ready( function() { + $('.feature-slider a').click(function(e) { + $('.featured-posts section.featured-post').css({ + opacity: 0, + visibility: 'hidden' + }); + $(this.hash).css({ + opacity: 1, + visibility: 'visible' + }); + $('.feature-slider a').removeClass('active'); + $(this).addClass('active'); + e.preventDefault(); + }); + }); })(jQuery); \ No newline at end of file diff --git a/languages/twentyeleven.pot b/Wordpress/languages/twentyeleven.pot similarity index 96% rename from languages/twentyeleven.pot rename to Wordpress/languages/twentyeleven.pot index 77bf8d2..0ed117c 100644 --- a/languages/twentyeleven.pot +++ b/Wordpress/languages/twentyeleven.pot @@ -1,657 +1,657 @@ -# Copyright (C) 2010 Twenty Eleven -# This file is distributed under the same license as the Twenty Eleven package. -msgid "" -msgstr "" -"Project-Id-Version: Twenty Eleven 1.3\n" -"Report-Msgid-Bugs-To: http://wordpress.org/tag/twentyeleven\n" -"POT-Creation-Date: 2011-12-10 19:47:15+00:00\n" -"MIME-Version: 1.0\n" -"Content-Type: text/plain; charset=UTF-8\n" -"Content-Transfer-Encoding: 8bit\n" -"PO-Revision-Date: 2010-MO-DA HO:MI+ZONE\n" -"Last-Translator: FULL NAME \n" -"Language-Team: LANGUAGE \n" - -#: content-quote.php:14 showcase.php:115 showcase.php:194 content.php:15 -#: content.php:19 content-image.php:15 content-gallery.php:16 -#: content-gallery.php:48 content-aside.php:16 content-status.php:15 -#: inc/widgets.php:89 content-link.php:16 content-featured.php:14 -msgid "Permalink to %s" -msgstr "" - -#: content-quote.php:15 -msgid "Quote" -msgstr "" - -#: content-quote.php:24 content.php:30 content-image.php:21 -#: content-aside.php:22 content-status.php:21 content-link.php:22 -msgid "Reply" -msgstr "" - -#: content-quote.php:24 content.php:30 content-image.php:21 -#: content-aside.php:22 content-status.php:21 content-link.php:22 -msgctxt "comments number" -msgid "1" -msgstr "" - -#: content-quote.php:24 content.php:30 content-image.php:21 -#: content-aside.php:22 content-status.php:21 content-link.php:22 -msgctxt "comments number" -msgid "%" -msgstr "" - -#: content-quote.php:35 content.php:41 content-image.php:27 -#: content-gallery.php:32 content-aside.php:33 functions.php:327 -#: content-status.php:34 content-link.php:33 -msgid "Continue reading " -msgstr "" - -#: content-quote.php:36 content.php:42 content-image.php:28 -#: content-single.php:24 content-intro.php:18 content-gallery.php:54 -#: content-aside.php:34 image.php:90 content-status.php:35 content-page.php:18 -#: content-link.php:34 content-featured.php:23 -msgid "Pages:" -msgstr "" - -#. translators: used between list items, there is a space after the comma -#: content-quote.php:44 content-quote.php:54 content.php:51 content.php:61 -#: content-image.php:47 content-image.php:56 content-single.php:30 -#: content-single.php:33 content-gallery.php:62 content-gallery.php:72 -#: content-featured.php:29 content-featured.php:38 -msgid ", " -msgstr "" - -#: content-quote.php:48 content.php:55 content-image.php:51 -#: content-gallery.php:66 -msgid "Posted in %2$s" -msgstr "" - -#: content-quote.php:60 content.php:67 content-image.php:59 -#: content-gallery.php:78 -msgid "Tagged %2$s" -msgstr "" - -#: content-quote.php:69 showcase.php:196 content.php:77 content-image.php:64 -#: content-gallery.php:87 content-aside.php:42 content-status.php:43 -#: content-link.php:42 -msgid "Leave a reply" -msgstr "" - -#: content-quote.php:69 showcase.php:196 content.php:77 content-image.php:64 -#: content-gallery.php:87 content-aside.php:42 content-status.php:43 -#: content-link.php:42 -msgid "1 Reply" -msgstr "" - -#: content-quote.php:69 showcase.php:196 content.php:77 content-image.php:64 -#: content-gallery.php:87 content-aside.php:42 content-status.php:43 -#: content-link.php:42 -msgid "% Replies" -msgstr "" - -#: content-quote.php:72 content.php:80 content-image.php:68 -#: content-single.php:52 content-intro.php:19 content-gallery.php:90 -#: content-aside.php:44 image.php:41 functions.php:505 functions.php:533 -#: content-status.php:45 content-page.php:21 content-link.php:44 -#: content-featured.php:45 -msgid "Edit" -msgstr "" - -#: showcase.php:72 -msgid "Featured Post" -msgstr "" - -#: showcase.php:145 -msgid "Featuring: %s" -msgstr "" - -#: showcase.php:155 -msgid "Recent Posts" -msgstr "" - -#: index.php:37 category.php:50 tag.php:50 author.php:74 search.php:42 -#: archive.php:57 -msgid "Nothing Found" -msgstr "" - -#: index.php:41 category.php:54 tag.php:54 author.php:78 archive.php:61 -msgid "" -"Apologies, but no results were found for the requested archive. Perhaps " -"searching will help find a related post." -msgstr "" - -#: content.php:16 -msgid "Featured" -msgstr "" - -#. #-#-#-#-# twentyeleven.pot (Twenty Eleven 1.3) #-#-#-#-# -#. Author URI of the plugin/theme -#: footer.php:27 -msgid "http://wordpress.org/" -msgstr "" - -#: footer.php:27 -msgid "Semantic Personal Publishing Platform" -msgstr "" - -#: footer.php:27 -msgid "Proudly powered by %s" -msgstr "" - -#: category.php:19 -msgid "Category Archives: %s" -msgstr "" - -#: content-image.php:16 -msgid "Image" -msgstr "" - -#: content-image.php:34 -msgid "" -" by " -" %6$s" -msgstr "" - -#: content-image.php:39 functions.php:570 -msgid "View all posts by %s" -msgstr "" - -#: sidebar.php:19 -msgid "Archives" -msgstr "" - -#: sidebar.php:26 -msgid "Meta" -msgstr "" - -#: content-single.php:35 -msgid "" -"This entry was posted in %1$s and tagged %2$s by %5$s. " -"Bookmark the permalink." -msgstr "" - -#: content-single.php:37 -msgid "" -"This entry was posted in %1$s by %5$s. Bookmark the permalink." -msgstr "" - -#: content-single.php:39 -msgid "" -"This entry was posted by %5$s. Bookmark the permalink." -msgstr "" - -#: content-single.php:60 author.php:49 -msgid "About %s" -msgstr "" - -#: content-single.php:64 -msgid "View all posts by %s " -msgstr "" - -#: tag.php:19 -msgid "Tag Archives: %s" -msgstr "" - -#: content-gallery.php:17 -msgid "Gallery" -msgstr "" - -#: content-gallery.php:47 -msgid "This gallery contains %2$s photo." -msgid_plural "This gallery contains %2$s photos." -msgstr[0] "" -msgstr[1] "" - -#: comments.php:17 -msgid "" -"This post is password protected. Enter the password to view any comments." -msgstr "" - -#: comments.php:33 -msgid "One thought on “%2$s”" -msgid_plural "%1$s thoughts on “%2$s”" -msgstr[0] "" -msgstr[1] "" - -#: comments.php:40 comments.php:60 -msgid "Comment navigation" -msgstr "" - -#: comments.php:41 comments.php:61 -msgid "← Older Comments" -msgstr "" - -#: comments.php:42 comments.php:62 -msgid "Newer Comments →" -msgstr "" - -#: comments.php:72 -msgid "Comments are closed." -msgstr "" - -#: content-aside.php:17 -msgid "Aside" -msgstr "" - -#: 404.php:17 -msgid "This is somewhat embarrassing, isn’t it?" -msgstr "" - -#: 404.php:21 -msgid "" -"It seems we can’t find what you’re looking for. Perhaps " -"searching, or one of the links below, can help." -msgstr "" - -#: 404.php:28 -msgid "Most Used Categories" -msgstr "" - -#. translators: %1$s: smilie -#: 404.php:36 -msgid "Try looking in the monthly archives. %1$s" -msgstr "" - -#: image.php:18 -msgid "Image navigation" -msgstr "" - -#: image.php:19 -msgid "← Previous" -msgstr "" - -#: image.php:20 -msgid "Next →" -msgstr "" - -#: image.php:30 -msgid "" -"Published %2$s " -"at %4$s × %5$s " -"in %8$s" -msgstr "" - -#: functions.php:101 -msgid "Primary Menu" -msgstr "" - -#. translators: header image description -#: functions.php:149 -msgid "Wheel" -msgstr "" - -#. translators: header image description -#: functions.php:155 -msgid "Shore" -msgstr "" - -#. translators: header image description -#: functions.php:161 -msgid "Trolley" -msgstr "" - -#. translators: header image description -#: functions.php:167 -msgid "Pine Cone" -msgstr "" - -#. translators: header image description -#: functions.php:173 -msgid "Chessboard" -msgstr "" - -#. translators: header image description -#: functions.php:179 -msgid "Lanterns" -msgstr "" - -#. translators: header image description -#: functions.php:185 -msgid "Willow" -msgstr "" - -#. translators: header image description -#: functions.php:191 -msgid "Hanoi Plant" -msgstr "" - -#: functions.php:374 -msgid "Main Sidebar" -msgstr "" - -#: functions.php:383 -msgid "Showcase Sidebar" -msgstr "" - -#: functions.php:385 -msgid "The sidebar for the optional Showcase Template" -msgstr "" - -#: functions.php:393 -msgid "Footer Area One" -msgstr "" - -#: functions.php:395 functions.php:405 functions.php:415 -msgid "An optional widget area for your site footer" -msgstr "" - -#: functions.php:403 -msgid "Footer Area Two" -msgstr "" - -#: functions.php:413 -msgid "Footer Area Three" -msgstr "" - -#: functions.php:433 single.php:18 -msgid "Post navigation" -msgstr "" - -#: functions.php:434 -msgid " Older posts" -msgstr "" - -#: functions.php:435 -msgid "Newer posts " -msgstr "" - -#: functions.php:505 -msgid "Pingback:" -msgstr "" - -#. translators: 1: comment author, 2: date and time -#: functions.php:522 -msgid "%1$s on %2$s said:" -msgstr "" - -#. translators: 1: date, 2: time -#: functions.php:528 -msgid "%1$s at %2$s" -msgstr "" - -#: functions.php:537 -msgid "Your comment is awaiting moderation." -msgstr "" - -#: functions.php:546 -msgid "Reply " -msgstr "" - -#: functions.php:564 -msgid "" -"Posted on by %7$s" -msgstr "" - -#: header.php:45 -msgid "Page %s" -msgstr "" - -#: header.php:113 -msgid "Main menu" -msgstr "" - -#: header.php:115 -msgid "Skip to primary content" -msgstr "" - -#: header.php:116 -msgid "Skip to secondary content" -msgstr "" - -#: author.php:28 -msgid "Author Archives: %s" -msgstr "" - -#: content-status.php:16 -msgid "Status" -msgstr "" - -#: inc/theme-options.php:61 -msgid "Color Scheme" -msgstr "" - -#: inc/theme-options.php:67 -msgid "Link Color" -msgstr "" - -#: inc/theme-options.php:68 -msgid "Default Layout" -msgstr "" - -#: inc/theme-options.php:100 inc/theme-options.php:101 -msgid "Theme Options" -msgstr "" - -#: inc/theme-options.php:116 -msgid "" -"Some themes provide customization options that are grouped together on a " -"Theme Options screen. If you change themes, options may change or disappear, " -"as they are theme-specific. Your current theme, Twenty Eleven, provides the " -"following Theme Options:" -msgstr "" - -#: inc/theme-options.php:118 -msgid "" -"Color Scheme: You can choose a color palette of \"Light" -"\" (light background with dark text) or \"Dark\" (dark background with light " -"text) for your site." -msgstr "" - -#: inc/theme-options.php:119 -msgid "" -"Link Color: You can choose the color used for text links on " -"your site. You can enter the HTML color or hex code, or you can choose " -"visually by clicking the \"Select a Color\" button to pick from a color " -"wheel." -msgstr "" - -#: inc/theme-options.php:120 -msgid "" -"Default Layout: You can choose if you want your site’" -"s default layout to have a sidebar on the left, the right, or not at all." -msgstr "" - -#: inc/theme-options.php:122 -msgid "" -"Remember to click \"Save Changes\" to save any changes you have made to the " -"theme options." -msgstr "" - -#: inc/theme-options.php:124 -msgid "For more information:" -msgstr "" - -#: inc/theme-options.php:125 -msgid "" -"Documentation on Theme Options" -msgstr "" - -#: inc/theme-options.php:126 -msgid "" -"Support Forums" -msgstr "" - -#: inc/theme-options.php:133 -msgid "Overview" -msgstr "" - -#: inc/theme-options.php:155 -msgid "Light" -msgstr "" - -#: inc/theme-options.php:161 -msgid "Dark" -msgstr "" - -#: inc/theme-options.php:179 -msgid "Content on left" -msgstr "" - -#: inc/theme-options.php:184 -msgid "Content on right" -msgstr "" - -#: inc/theme-options.php:189 -msgid "One-column, no sidebar" -msgstr "" - -#: inc/theme-options.php:279 -msgid "Select a Color" -msgstr "" - -#: inc/theme-options.php:282 -msgid "Default color: %s" -msgstr "" - -#: inc/theme-options.php:317 -msgid "%s Theme Options" -msgstr "" - -#: inc/widgets.php:19 -msgid "" -"Use this widget to list your recent Aside, Status, Quote, and Link posts" -msgstr "" - -#: inc/widgets.php:20 -msgid "Twenty Eleven Ephemera" -msgstr "" - -#: inc/widgets.php:52 -msgid "Ephemera" -msgstr "" - -#: inc/widgets.php:91 inc/widgets.php:107 -msgid "0 comments →" -msgstr "" - -#: inc/widgets.php:91 inc/widgets.php:107 -msgid "1 comment →" -msgstr "" - -#: inc/widgets.php:91 inc/widgets.php:107 -msgid "% comments →" -msgstr "" - -#: inc/widgets.php:105 -msgid "Link to %s" -msgstr "" - -#: inc/widgets.php:157 -msgid "Title:" -msgstr "" - -#: inc/widgets.php:160 -msgid "Number of posts to show:" -msgstr "" - -#: search.php:18 -msgid "Search Results for: %s" -msgstr "" - -#: search.php:46 -msgid "" -"Sorry, but nothing matched your search criteria. Please try again with some " -"different keywords." -msgstr "" - -#: archive.php:25 -msgid "Daily Archives: %s" -msgstr "" - -#: archive.php:27 -msgid "Monthly Archives: %s" -msgstr "" - -#: archive.php:27 -msgctxt "monthly archives date format" -msgid "F Y" -msgstr "" - -#: archive.php:29 -msgid "Yearly Archives: %s" -msgstr "" - -#: archive.php:29 -msgctxt "yearly archives date format" -msgid "Y" -msgstr "" - -#: archive.php:31 -msgid "Blog Archives" -msgstr "" - -#: content-link.php:17 -msgid "Link" -msgstr "" - -#: content-featured.php:31 -msgid "" -"This entry was posted in %1$s and tagged %2$s. Bookmark the permalink." -msgstr "" - -#: content-featured.php:33 -msgid "" -"This entry was posted in %1$s. Bookmark the permalink." -msgstr "" - -#: single.php:19 -msgid " Previous" -msgstr "" - -#: single.php:20 -msgid "Next " -msgstr "" - -#: searchform.php:11 searchform.php:12 searchform.php:13 -msgid "Search" -msgstr "" - -#. Theme Name of the plugin/theme -msgid "Twenty Eleven" -msgstr "" - -#. Theme URI of the plugin/theme -msgid "http://wordpress.org/extend/themes/twentyeleven" -msgstr "" - -#. Description of the plugin/theme -msgid "" -"The 2011 theme for WordPress is sophisticated, lightweight, and adaptable. " -"Make it yours with a custom menu, header image, and background -- then go " -"further with available theme options for light or dark color scheme, custom " -"link colors, and three layout choices. Twenty Eleven comes equipped with a " -"Showcase page template that transforms your front page into a showcase to " -"show off your best content, widget support galore (sidebar, three footer " -"areas, and a Showcase page widget area), and a custom \"Ephemera\" widget to " -"display your Aside, Link, Quote, or Status posts. Included are styles for " -"print and for the admin editor, support for featured images (as custom " -"header images on posts and pages and as large images on featured \"sticky\" " -"posts), and special styles for six different post formats." -msgstr "" - -#. Author of the plugin/theme -msgid "the WordPress team" -msgstr "" - -#. Tags of the plugin/theme -msgid "" -"dark, light, white, black, gray, one-column, two-columns, left-sidebar, " -"right-sidebar, fixed-width, flexible-width, custom-background, custom-" -"colors, custom-header, custom-menu, editor-style, featured-image-header, " -"featured-images, full-width-template, microformats, post-formats, rtl-" -"language-support, sticky-post, theme-options, translation-ready" -msgstr "" +# Copyright (C) 2010 Twenty Eleven +# This file is distributed under the same license as the Twenty Eleven package. +msgid "" +msgstr "" +"Project-Id-Version: Twenty Eleven 1.3\n" +"Report-Msgid-Bugs-To: http://wordpress.org/tag/twentyeleven\n" +"POT-Creation-Date: 2011-12-10 19:47:15+00:00\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"PO-Revision-Date: 2010-MO-DA HO:MI+ZONE\n" +"Last-Translator: FULL NAME \n" +"Language-Team: LANGUAGE \n" + +#: content-quote.php:14 showcase.php:115 showcase.php:194 content.php:15 +#: content.php:19 content-image.php:15 content-gallery.php:16 +#: content-gallery.php:48 content-aside.php:16 content-status.php:15 +#: inc/widgets.php:89 content-link.php:16 content-featured.php:14 +msgid "Permalink to %s" +msgstr "" + +#: content-quote.php:15 +msgid "Quote" +msgstr "" + +#: content-quote.php:24 content.php:30 content-image.php:21 +#: content-aside.php:22 content-status.php:21 content-link.php:22 +msgid "Reply" +msgstr "" + +#: content-quote.php:24 content.php:30 content-image.php:21 +#: content-aside.php:22 content-status.php:21 content-link.php:22 +msgctxt "comments number" +msgid "1" +msgstr "" + +#: content-quote.php:24 content.php:30 content-image.php:21 +#: content-aside.php:22 content-status.php:21 content-link.php:22 +msgctxt "comments number" +msgid "%" +msgstr "" + +#: content-quote.php:35 content.php:41 content-image.php:27 +#: content-gallery.php:32 content-aside.php:33 functions.php:327 +#: content-status.php:34 content-link.php:33 +msgid "Continue reading " +msgstr "" + +#: content-quote.php:36 content.php:42 content-image.php:28 +#: content-single.php:24 content-intro.php:18 content-gallery.php:54 +#: content-aside.php:34 image.php:90 content-status.php:35 content-page.php:18 +#: content-link.php:34 content-featured.php:23 +msgid "Pages:" +msgstr "" + +#. translators: used between list items, there is a space after the comma +#: content-quote.php:44 content-quote.php:54 content.php:51 content.php:61 +#: content-image.php:47 content-image.php:56 content-single.php:30 +#: content-single.php:33 content-gallery.php:62 content-gallery.php:72 +#: content-featured.php:29 content-featured.php:38 +msgid ", " +msgstr "" + +#: content-quote.php:48 content.php:55 content-image.php:51 +#: content-gallery.php:66 +msgid "Posted in %2$s" +msgstr "" + +#: content-quote.php:60 content.php:67 content-image.php:59 +#: content-gallery.php:78 +msgid "Tagged %2$s" +msgstr "" + +#: content-quote.php:69 showcase.php:196 content.php:77 content-image.php:64 +#: content-gallery.php:87 content-aside.php:42 content-status.php:43 +#: content-link.php:42 +msgid "Leave a reply" +msgstr "" + +#: content-quote.php:69 showcase.php:196 content.php:77 content-image.php:64 +#: content-gallery.php:87 content-aside.php:42 content-status.php:43 +#: content-link.php:42 +msgid "1 Reply" +msgstr "" + +#: content-quote.php:69 showcase.php:196 content.php:77 content-image.php:64 +#: content-gallery.php:87 content-aside.php:42 content-status.php:43 +#: content-link.php:42 +msgid "% Replies" +msgstr "" + +#: content-quote.php:72 content.php:80 content-image.php:68 +#: content-single.php:52 content-intro.php:19 content-gallery.php:90 +#: content-aside.php:44 image.php:41 functions.php:505 functions.php:533 +#: content-status.php:45 content-page.php:21 content-link.php:44 +#: content-featured.php:45 +msgid "Edit" +msgstr "" + +#: showcase.php:72 +msgid "Featured Post" +msgstr "" + +#: showcase.php:145 +msgid "Featuring: %s" +msgstr "" + +#: showcase.php:155 +msgid "Recent Posts" +msgstr "" + +#: index.php:37 category.php:50 tag.php:50 author.php:74 search.php:42 +#: archive.php:57 +msgid "Nothing Found" +msgstr "" + +#: index.php:41 category.php:54 tag.php:54 author.php:78 archive.php:61 +msgid "" +"Apologies, but no results were found for the requested archive. Perhaps " +"searching will help find a related post." +msgstr "" + +#: content.php:16 +msgid "Featured" +msgstr "" + +#. #-#-#-#-# twentyeleven.pot (Twenty Eleven 1.3) #-#-#-#-# +#. Author URI of the plugin/theme +#: footer.php:27 +msgid "http://wordpress.org/" +msgstr "" + +#: footer.php:27 +msgid "Semantic Personal Publishing Platform" +msgstr "" + +#: footer.php:27 +msgid "Proudly powered by %s" +msgstr "" + +#: category.php:19 +msgid "Category Archives: %s" +msgstr "" + +#: content-image.php:16 +msgid "Image" +msgstr "" + +#: content-image.php:34 +msgid "" +" by " +" %6$s" +msgstr "" + +#: content-image.php:39 functions.php:570 +msgid "View all posts by %s" +msgstr "" + +#: sidebar.php:19 +msgid "Archives" +msgstr "" + +#: sidebar.php:26 +msgid "Meta" +msgstr "" + +#: content-single.php:35 +msgid "" +"This entry was posted in %1$s and tagged %2$s by %5$s. " +"Bookmark the permalink." +msgstr "" + +#: content-single.php:37 +msgid "" +"This entry was posted in %1$s by %5$s. Bookmark the permalink." +msgstr "" + +#: content-single.php:39 +msgid "" +"This entry was posted by %5$s. Bookmark the permalink." +msgstr "" + +#: content-single.php:60 author.php:49 +msgid "About %s" +msgstr "" + +#: content-single.php:64 +msgid "View all posts by %s " +msgstr "" + +#: tag.php:19 +msgid "Tag Archives: %s" +msgstr "" + +#: content-gallery.php:17 +msgid "Gallery" +msgstr "" + +#: content-gallery.php:47 +msgid "This gallery contains %2$s photo." +msgid_plural "This gallery contains %2$s photos." +msgstr[0] "" +msgstr[1] "" + +#: comments.php:17 +msgid "" +"This post is password protected. Enter the password to view any comments." +msgstr "" + +#: comments.php:33 +msgid "One thought on “%2$s”" +msgid_plural "%1$s thoughts on “%2$s”" +msgstr[0] "" +msgstr[1] "" + +#: comments.php:40 comments.php:60 +msgid "Comment navigation" +msgstr "" + +#: comments.php:41 comments.php:61 +msgid "← Older Comments" +msgstr "" + +#: comments.php:42 comments.php:62 +msgid "Newer Comments →" +msgstr "" + +#: comments.php:72 +msgid "Comments are closed." +msgstr "" + +#: content-aside.php:17 +msgid "Aside" +msgstr "" + +#: 404.php:17 +msgid "This is somewhat embarrassing, isn’t it?" +msgstr "" + +#: 404.php:21 +msgid "" +"It seems we can’t find what you’re looking for. Perhaps " +"searching, or one of the links below, can help." +msgstr "" + +#: 404.php:28 +msgid "Most Used Categories" +msgstr "" + +#. translators: %1$s: smilie +#: 404.php:36 +msgid "Try looking in the monthly archives. %1$s" +msgstr "" + +#: image.php:18 +msgid "Image navigation" +msgstr "" + +#: image.php:19 +msgid "← Previous" +msgstr "" + +#: image.php:20 +msgid "Next →" +msgstr "" + +#: image.php:30 +msgid "" +"Published %2$s " +"at %4$s × %5$s " +"in %8$s" +msgstr "" + +#: functions.php:101 +msgid "Primary Menu" +msgstr "" + +#. translators: header image description +#: functions.php:149 +msgid "Wheel" +msgstr "" + +#. translators: header image description +#: functions.php:155 +msgid "Shore" +msgstr "" + +#. translators: header image description +#: functions.php:161 +msgid "Trolley" +msgstr "" + +#. translators: header image description +#: functions.php:167 +msgid "Pine Cone" +msgstr "" + +#. translators: header image description +#: functions.php:173 +msgid "Chessboard" +msgstr "" + +#. translators: header image description +#: functions.php:179 +msgid "Lanterns" +msgstr "" + +#. translators: header image description +#: functions.php:185 +msgid "Willow" +msgstr "" + +#. translators: header image description +#: functions.php:191 +msgid "Hanoi Plant" +msgstr "" + +#: functions.php:374 +msgid "Main Sidebar" +msgstr "" + +#: functions.php:383 +msgid "Showcase Sidebar" +msgstr "" + +#: functions.php:385 +msgid "The sidebar for the optional Showcase Template" +msgstr "" + +#: functions.php:393 +msgid "Footer Area One" +msgstr "" + +#: functions.php:395 functions.php:405 functions.php:415 +msgid "An optional widget area for your site footer" +msgstr "" + +#: functions.php:403 +msgid "Footer Area Two" +msgstr "" + +#: functions.php:413 +msgid "Footer Area Three" +msgstr "" + +#: functions.php:433 single.php:18 +msgid "Post navigation" +msgstr "" + +#: functions.php:434 +msgid " Older posts" +msgstr "" + +#: functions.php:435 +msgid "Newer posts " +msgstr "" + +#: functions.php:505 +msgid "Pingback:" +msgstr "" + +#. translators: 1: comment author, 2: date and time +#: functions.php:522 +msgid "%1$s on %2$s said:" +msgstr "" + +#. translators: 1: date, 2: time +#: functions.php:528 +msgid "%1$s at %2$s" +msgstr "" + +#: functions.php:537 +msgid "Your comment is awaiting moderation." +msgstr "" + +#: functions.php:546 +msgid "Reply " +msgstr "" + +#: functions.php:564 +msgid "" +"Posted on by %7$s" +msgstr "" + +#: header.php:45 +msgid "Page %s" +msgstr "" + +#: header.php:113 +msgid "Main menu" +msgstr "" + +#: header.php:115 +msgid "Skip to primary content" +msgstr "" + +#: header.php:116 +msgid "Skip to secondary content" +msgstr "" + +#: author.php:28 +msgid "Author Archives: %s" +msgstr "" + +#: content-status.php:16 +msgid "Status" +msgstr "" + +#: inc/theme-options.php:61 +msgid "Color Scheme" +msgstr "" + +#: inc/theme-options.php:67 +msgid "Link Color" +msgstr "" + +#: inc/theme-options.php:68 +msgid "Default Layout" +msgstr "" + +#: inc/theme-options.php:100 inc/theme-options.php:101 +msgid "Theme Options" +msgstr "" + +#: inc/theme-options.php:116 +msgid "" +"Some themes provide customization options that are grouped together on a " +"Theme Options screen. If you change themes, options may change or disappear, " +"as they are theme-specific. Your current theme, Twenty Eleven, provides the " +"following Theme Options:" +msgstr "" + +#: inc/theme-options.php:118 +msgid "" +"Color Scheme: You can choose a color palette of \"Light" +"\" (light background with dark text) or \"Dark\" (dark background with light " +"text) for your site." +msgstr "" + +#: inc/theme-options.php:119 +msgid "" +"Link Color: You can choose the color used for text links on " +"your site. You can enter the HTML color or hex code, or you can choose " +"visually by clicking the \"Select a Color\" button to pick from a color " +"wheel." +msgstr "" + +#: inc/theme-options.php:120 +msgid "" +"Default Layout: You can choose if you want your site’" +"s default layout to have a sidebar on the left, the right, or not at all." +msgstr "" + +#: inc/theme-options.php:122 +msgid "" +"Remember to click \"Save Changes\" to save any changes you have made to the " +"theme options." +msgstr "" + +#: inc/theme-options.php:124 +msgid "For more information:" +msgstr "" + +#: inc/theme-options.php:125 +msgid "" +"Documentation on Theme Options" +msgstr "" + +#: inc/theme-options.php:126 +msgid "" +"Support Forums" +msgstr "" + +#: inc/theme-options.php:133 +msgid "Overview" +msgstr "" + +#: inc/theme-options.php:155 +msgid "Light" +msgstr "" + +#: inc/theme-options.php:161 +msgid "Dark" +msgstr "" + +#: inc/theme-options.php:179 +msgid "Content on left" +msgstr "" + +#: inc/theme-options.php:184 +msgid "Content on right" +msgstr "" + +#: inc/theme-options.php:189 +msgid "One-column, no sidebar" +msgstr "" + +#: inc/theme-options.php:279 +msgid "Select a Color" +msgstr "" + +#: inc/theme-options.php:282 +msgid "Default color: %s" +msgstr "" + +#: inc/theme-options.php:317 +msgid "%s Theme Options" +msgstr "" + +#: inc/widgets.php:19 +msgid "" +"Use this widget to list your recent Aside, Status, Quote, and Link posts" +msgstr "" + +#: inc/widgets.php:20 +msgid "Twenty Eleven Ephemera" +msgstr "" + +#: inc/widgets.php:52 +msgid "Ephemera" +msgstr "" + +#: inc/widgets.php:91 inc/widgets.php:107 +msgid "0 comments →" +msgstr "" + +#: inc/widgets.php:91 inc/widgets.php:107 +msgid "1 comment →" +msgstr "" + +#: inc/widgets.php:91 inc/widgets.php:107 +msgid "% comments →" +msgstr "" + +#: inc/widgets.php:105 +msgid "Link to %s" +msgstr "" + +#: inc/widgets.php:157 +msgid "Title:" +msgstr "" + +#: inc/widgets.php:160 +msgid "Number of posts to show:" +msgstr "" + +#: search.php:18 +msgid "Search Results for: %s" +msgstr "" + +#: search.php:46 +msgid "" +"Sorry, but nothing matched your search criteria. Please try again with some " +"different keywords." +msgstr "" + +#: archive.php:25 +msgid "Daily Archives: %s" +msgstr "" + +#: archive.php:27 +msgid "Monthly Archives: %s" +msgstr "" + +#: archive.php:27 +msgctxt "monthly archives date format" +msgid "F Y" +msgstr "" + +#: archive.php:29 +msgid "Yearly Archives: %s" +msgstr "" + +#: archive.php:29 +msgctxt "yearly archives date format" +msgid "Y" +msgstr "" + +#: archive.php:31 +msgid "Blog Archives" +msgstr "" + +#: content-link.php:17 +msgid "Link" +msgstr "" + +#: content-featured.php:31 +msgid "" +"This entry was posted in %1$s and tagged %2$s. Bookmark the permalink." +msgstr "" + +#: content-featured.php:33 +msgid "" +"This entry was posted in %1$s. Bookmark the permalink." +msgstr "" + +#: single.php:19 +msgid " Previous" +msgstr "" + +#: single.php:20 +msgid "Next " +msgstr "" + +#: searchform.php:11 searchform.php:12 searchform.php:13 +msgid "Search" +msgstr "" + +#. Theme Name of the plugin/theme +msgid "Twenty Eleven" +msgstr "" + +#. Theme URI of the plugin/theme +msgid "http://wordpress.org/extend/themes/twentyeleven" +msgstr "" + +#. Description of the plugin/theme +msgid "" +"The 2011 theme for WordPress is sophisticated, lightweight, and adaptable. " +"Make it yours with a custom menu, header image, and background -- then go " +"further with available theme options for light or dark color scheme, custom " +"link colors, and three layout choices. Twenty Eleven comes equipped with a " +"Showcase page template that transforms your front page into a showcase to " +"show off your best content, widget support galore (sidebar, three footer " +"areas, and a Showcase page widget area), and a custom \"Ephemera\" widget to " +"display your Aside, Link, Quote, or Status posts. Included are styles for " +"print and for the admin editor, support for featured images (as custom " +"header images on posts and pages and as large images on featured \"sticky\" " +"posts), and special styles for six different post formats." +msgstr "" + +#. Author of the plugin/theme +msgid "the WordPress team" +msgstr "" + +#. Tags of the plugin/theme +msgid "" +"dark, light, white, black, gray, one-column, two-columns, left-sidebar, " +"right-sidebar, fixed-width, flexible-width, custom-background, custom-" +"colors, custom-header, custom-menu, editor-style, featured-image-header, " +"featured-images, full-width-template, microformats, post-formats, rtl-" +"language-support, sticky-post, theme-options, translation-ready" +msgstr "" diff --git a/license.txt b/Wordpress/license.txt similarity index 98% rename from license.txt rename to Wordpress/license.txt index 5fbe4a7..d31195a 100644 --- a/license.txt +++ b/Wordpress/license.txt @@ -1,281 +1,281 @@ - GNU GENERAL PUBLIC LICENSE - Version 2, June 1991 - - Copyright (C) 1989, 1991 Free Software Foundation, Inc. - 51 Franklin St, Fifth Floor, Boston, MA 02110, USA - - Everyone is permitted to copy and distribute verbatim copies - of this license document, but changing it is not allowed. - - Preamble - - The licenses for most software are designed to take away your -freedom to share and change it. By contrast, the GNU General Public -License is intended to guarantee your freedom to share and change free -software--to make sure the software is free for all its users. This -General Public License applies to most of the Free Software -Foundation's software and to any other program whose authors commit to -using it. (Some other Free Software Foundation software is covered by -the GNU Library General Public License instead.) You can apply it to -your programs, too. - - When we speak of free software, we are referring to freedom, not -price. Our General Public Licenses are designed to make sure that you -have the freedom to distribute copies of free software (and charge for -this service if you wish), that you receive source code or can get it -if you want it, that you can change the software or use pieces of it -in new free programs; and that you know you can do these things. - - To protect your rights, we need to make restrictions that forbid -anyone to deny you these rights or to ask you to surrender the rights. -These restrictions translate to certain responsibilities for you if you -distribute copies of the software, or if you modify it. - - For example, if you distribute copies of such a program, whether -gratis or for a fee, you must give the recipients all the rights that -you have. You must make sure that they, too, receive or can get the -source code. And you must show them these terms so they know their -rights. - - We protect your rights with two steps: (1) copyright the software, and -(2) offer you this license which gives you legal permission to copy, -distribute and/or modify the software. - - Also, for each author's protection and ours, we want to make certain -that everyone understands that there is no warranty for this free -software. If the software is modified by someone else and passed on, we -want its recipients to know that what they have is not the original, so -that any problems introduced by others will not reflect on the original -authors' reputations. - - Finally, any free program is threatened constantly by software -patents. We wish to avoid the danger that redistributors of a free -program will individually obtain patent licenses, in effect making the -program proprietary. To prevent this, we have made it clear that any -patent must be licensed for everyone's free use or not licensed at all. - - The precise terms and conditions for copying, distribution and -modification follow. - - GNU GENERAL PUBLIC LICENSE - TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION - - 0. This License applies to any program or other work which contains -a notice placed by the copyright holder saying it may be distributed -under the terms of this General Public License. The "Program", below, -refers to any such program or work, and a "work based on the Program" -means either the Program or any derivative work under copyright law: -that is to say, a work containing the Program or a portion of it, -either verbatim or with modifications and/or translated into another -language. (Hereinafter, translation is included without limitation in -the term "modification".) Each licensee is addressed as "you". - -Activities other than copying, distribution and modification are not -covered by this License; they are outside its scope. The act of -running the Program is not restricted, and the output from the Program -is covered only if its contents constitute a work based on the -Program (independent of having been made by running the Program). -Whether that is true depends on what the Program does. - - 1. You may copy and distribute verbatim copies of the Program's -source code as you receive it, in any medium, provided that you -conspicuously and appropriately publish on each copy an appropriate -copyright notice and disclaimer of warranty; keep intact all the -notices that refer to this License and to the absence of any warranty; -and give any other recipients of the Program a copy of this License -along with the Program. - -You may charge a fee for the physical act of transferring a copy, and -you may at your option offer warranty protection in exchange for a fee. - - 2. You may modify your copy or copies of the Program or any portion -of it, thus forming a work based on the Program, and copy and -distribute such modifications or work under the terms of Section 1 -above, provided that you also meet all of these conditions: - - a) You must cause the modified files to carry prominent notices - stating that you changed the files and the date of any change. - - b) You must cause any work that you distribute or publish, that in - whole or in part contains or is derived from the Program or any - part thereof, to be licensed as a whole at no charge to all third - parties under the terms of this License. - - c) If the modified program normally reads commands interactively - when run, you must cause it, when started running for such - interactive use in the most ordinary way, to print or display an - announcement including an appropriate copyright notice and a - notice that there is no warranty (or else, saying that you provide - a warranty) and that users may redistribute the program under - these conditions, and telling the user how to view a copy of this - License. (Exception: if the Program itself is interactive but - does not normally print such an announcement, your work based on - the Program is not required to print an announcement.) - -These requirements apply to the modified work as a whole. If -identifiable sections of that work are not derived from the Program, -and can be reasonably considered independent and separate works in -themselves, then this License, and its terms, do not apply to those -sections when you distribute them as separate works. But when you -distribute the same sections as part of a whole which is a work based -on the Program, the distribution of the whole must be on the terms of -this License, whose permissions for other licensees extend to the -entire whole, and thus to each and every part regardless of who wrote it. -Thus, it is not the intent of this section to claim rights or contest -your rights to work written entirely by you; rather, the intent is to -exercise the right to control the distribution of derivative or -collective works based on the Program. - -In addition, mere aggregation of another work not based on the Program -with the Program (or with a work based on the Program) on a volume of -a storage or distribution medium does not bring the other work under -the scope of this License. - - 3. You may copy and distribute the Program (or a work based on it, -under Section 2) in object code or executable form under the terms of -Sections 1 and 2 above provided that you also do one of the following: - - a) Accompany it with the complete corresponding machine-readable - source code, which must be distributed under the terms of Sections - 1 and 2 above on a medium customarily used for software interchange; or, - - b) Accompany it with a written offer, valid for at least three - years, to give any third party, for a charge no more than your - cost of physically performing source distribution, a complete - machine-readable copy of the corresponding source code, to be - distributed under the terms of Sections 1 and 2 above on a medium - customarily used for software interchange; or, - - c) Accompany it with the information you received as to the offer - to distribute corresponding source code. (This alternative is - allowed only for noncommercial distribution and only if you - received the program in object code or executable form with such - an offer, in accord with Subsection b above.) - -The source code for a work means the preferred form of the work for -making modifications to it. For an executable work, complete source -code means all the source code for all modules it contains, plus any -associated interface definition files, plus the scripts used to -control compilation and installation of the executable. However, as a -special exception, the source code distributed need not include -anything that is normally distributed (in either source or binary -form) with the major components (compiler, kernel, and so on) of the -operating system on which the executable runs, unless that component -itself accompanies the executable. - -If distribution of executable or object code is made by offering -access to copy from a designated place, then offering equivalent -access to copy the source code from the same place counts as -distribution of the source code, even though third parties are not -compelled to copy the source along with the object code. - - 4. You may not copy, modify, sublicense, or distribute the Program -except as expressly provided under this License. Any attempt -otherwise to copy, modify, sublicense or distribute the Program is -void, and will automatically terminate your rights under this License. -However, parties who have received copies, or rights, from you under -this License will not have their licenses terminated so long as such -parties remain in full compliance. - - 5. You are not required to accept this License, since you have not -signed it. However, nothing else grants you permission to modify or -distribute the Program or its derivative works. These actions are -prohibited by law if you do not accept this License. Therefore, by -modifying or distributing the Program (or any work based on the -Program), you indicate your acceptance of this License to do so, and -all its terms and conditions for copying, distributing or modifying -the Program or works based on it. - - 6. Each time you redistribute the Program (or any work based on the -Program), the recipient automatically receives a license from the -original licensor to copy, distribute or modify the Program subject to -these terms and conditions. You may not impose any further -restrictions on the recipients' exercise of the rights granted herein. -You are not responsible for enforcing compliance by third parties to -this License. - - 7. If, as a consequence of a court judgment or allegation of patent -infringement or for any other reason (not limited to patent issues), -conditions are imposed on you (whether by court order, agreement or -otherwise) that contradict the conditions of this License, they do not -excuse you from the conditions of this License. If you cannot -distribute so as to satisfy simultaneously your obligations under this -License and any other pertinent obligations, then as a consequence you -may not distribute the Program at all. For example, if a patent -license would not permit royalty-free redistribution of the Program by -all those who receive copies directly or indirectly through you, then -the only way you could satisfy both it and this License would be to -refrain entirely from distribution of the Program. - -If any portion of this section is held invalid or unenforceable under -any particular circumstance, the balance of the section is intended to -apply and the section as a whole is intended to apply in other -circumstances. - -It is not the purpose of this section to induce you to infringe any -patents or other property right claims or to contest validity of any -such claims; this section has the sole purpose of protecting the -integrity of the free software distribution system, which is -implemented by public license practices. Many people have made -generous contributions to the wide range of software distributed -through that system in reliance on consistent application of that -system; it is up to the author/donor to decide if he or she is willing -to distribute software through any other system and a licensee cannot -impose that choice. - -This section is intended to make thoroughly clear what is believed to -be a consequence of the rest of this License. - - 8. If the distribution and/or use of the Program is restricted in -certain countries either by patents or by copyrighted interfaces, the -original copyright holder who places the Program under this License -may add an explicit geographical distribution limitation excluding -those countries, so that distribution is permitted only in or among -countries not thus excluded. In such case, this License incorporates -the limitation as if written in the body of this License. - - 9. The Free Software Foundation may publish revised and/or new versions -of the General Public License from time to time. Such new versions will -be similar in spirit to the present version, but may differ in detail to -address new problems or concerns. - -Each version is given a distinguishing version number. If the Program -specifies a version number of this License which applies to it and "any -later version", you have the option of following the terms and conditions -either of that version or of any later version published by the Free -Software Foundation. If the Program does not specify a version number of -this License, you may choose any version ever published by the Free Software -Foundation. - - 10. If you wish to incorporate parts of the Program into other free -programs whose distribution conditions are different, write to the author -to ask for permission. For software which is copyrighted by the Free -Software Foundation, write to the Free Software Foundation; we sometimes -make exceptions for this. Our decision will be guided by the two goals -of preserving the free status of all derivatives of our free software and -of promoting the sharing and reuse of software generally. - - NO WARRANTY - - 11. BECAUSE THE PROGRAM IS LICENSED FREE OF CHARGE, THERE IS NO WARRANTY -FOR THE PROGRAM, TO THE EXTENT PERMITTED BY APPLICABLE LAW. EXCEPT WHEN -OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR OTHER PARTIES -PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED -OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF -MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE. THE ENTIRE RISK AS -TO THE QUALITY AND PERFORMANCE OF THE PROGRAM IS WITH YOU. SHOULD THE -PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF ALL NECESSARY SERVICING, -REPAIR OR CORRECTION. - - 12. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING -WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY AND/OR -REDISTRIBUTE THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES, -INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING -OUT OF THE USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED -TO LOSS OF DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY -YOU OR THIRD PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER -PROGRAMS), EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE -POSSIBILITY OF SUCH DAMAGES. - - END OF TERMS AND CONDITIONS - + GNU GENERAL PUBLIC LICENSE + Version 2, June 1991 + + Copyright (C) 1989, 1991 Free Software Foundation, Inc. + 51 Franklin St, Fifth Floor, Boston, MA 02110, USA + + Everyone is permitted to copy and distribute verbatim copies + of this license document, but changing it is not allowed. + + Preamble + + The licenses for most software are designed to take away your +freedom to share and change it. By contrast, the GNU General Public +License is intended to guarantee your freedom to share and change free +software--to make sure the software is free for all its users. This +General Public License applies to most of the Free Software +Foundation's software and to any other program whose authors commit to +using it. (Some other Free Software Foundation software is covered by +the GNU Library General Public License instead.) You can apply it to +your programs, too. + + When we speak of free software, we are referring to freedom, not +price. Our General Public Licenses are designed to make sure that you +have the freedom to distribute copies of free software (and charge for +this service if you wish), that you receive source code or can get it +if you want it, that you can change the software or use pieces of it +in new free programs; and that you know you can do these things. + + To protect your rights, we need to make restrictions that forbid +anyone to deny you these rights or to ask you to surrender the rights. +These restrictions translate to certain responsibilities for you if you +distribute copies of the software, or if you modify it. + + For example, if you distribute copies of such a program, whether +gratis or for a fee, you must give the recipients all the rights that +you have. You must make sure that they, too, receive or can get the +source code. And you must show them these terms so they know their +rights. + + We protect your rights with two steps: (1) copyright the software, and +(2) offer you this license which gives you legal permission to copy, +distribute and/or modify the software. + + Also, for each author's protection and ours, we want to make certain +that everyone understands that there is no warranty for this free +software. If the software is modified by someone else and passed on, we +want its recipients to know that what they have is not the original, so +that any problems introduced by others will not reflect on the original +authors' reputations. + + Finally, any free program is threatened constantly by software +patents. We wish to avoid the danger that redistributors of a free +program will individually obtain patent licenses, in effect making the +program proprietary. To prevent this, we have made it clear that any +patent must be licensed for everyone's free use or not licensed at all. + + The precise terms and conditions for copying, distribution and +modification follow. + + GNU GENERAL PUBLIC LICENSE + TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION + + 0. This License applies to any program or other work which contains +a notice placed by the copyright holder saying it may be distributed +under the terms of this General Public License. The "Program", below, +refers to any such program or work, and a "work based on the Program" +means either the Program or any derivative work under copyright law: +that is to say, a work containing the Program or a portion of it, +either verbatim or with modifications and/or translated into another +language. (Hereinafter, translation is included without limitation in +the term "modification".) Each licensee is addressed as "you". + +Activities other than copying, distribution and modification are not +covered by this License; they are outside its scope. The act of +running the Program is not restricted, and the output from the Program +is covered only if its contents constitute a work based on the +Program (independent of having been made by running the Program). +Whether that is true depends on what the Program does. + + 1. You may copy and distribute verbatim copies of the Program's +source code as you receive it, in any medium, provided that you +conspicuously and appropriately publish on each copy an appropriate +copyright notice and disclaimer of warranty; keep intact all the +notices that refer to this License and to the absence of any warranty; +and give any other recipients of the Program a copy of this License +along with the Program. + +You may charge a fee for the physical act of transferring a copy, and +you may at your option offer warranty protection in exchange for a fee. + + 2. You may modify your copy or copies of the Program or any portion +of it, thus forming a work based on the Program, and copy and +distribute such modifications or work under the terms of Section 1 +above, provided that you also meet all of these conditions: + + a) You must cause the modified files to carry prominent notices + stating that you changed the files and the date of any change. + + b) You must cause any work that you distribute or publish, that in + whole or in part contains or is derived from the Program or any + part thereof, to be licensed as a whole at no charge to all third + parties under the terms of this License. + + c) If the modified program normally reads commands interactively + when run, you must cause it, when started running for such + interactive use in the most ordinary way, to print or display an + announcement including an appropriate copyright notice and a + notice that there is no warranty (or else, saying that you provide + a warranty) and that users may redistribute the program under + these conditions, and telling the user how to view a copy of this + License. (Exception: if the Program itself is interactive but + does not normally print such an announcement, your work based on + the Program is not required to print an announcement.) + +These requirements apply to the modified work as a whole. If +identifiable sections of that work are not derived from the Program, +and can be reasonably considered independent and separate works in +themselves, then this License, and its terms, do not apply to those +sections when you distribute them as separate works. But when you +distribute the same sections as part of a whole which is a work based +on the Program, the distribution of the whole must be on the terms of +this License, whose permissions for other licensees extend to the +entire whole, and thus to each and every part regardless of who wrote it. +Thus, it is not the intent of this section to claim rights or contest +your rights to work written entirely by you; rather, the intent is to +exercise the right to control the distribution of derivative or +collective works based on the Program. + +In addition, mere aggregation of another work not based on the Program +with the Program (or with a work based on the Program) on a volume of +a storage or distribution medium does not bring the other work under +the scope of this License. + + 3. You may copy and distribute the Program (or a work based on it, +under Section 2) in object code or executable form under the terms of +Sections 1 and 2 above provided that you also do one of the following: + + a) Accompany it with the complete corresponding machine-readable + source code, which must be distributed under the terms of Sections + 1 and 2 above on a medium customarily used for software interchange; or, + + b) Accompany it with a written offer, valid for at least three + years, to give any third party, for a charge no more than your + cost of physically performing source distribution, a complete + machine-readable copy of the corresponding source code, to be + distributed under the terms of Sections 1 and 2 above on a medium + customarily used for software interchange; or, + + c) Accompany it with the information you received as to the offer + to distribute corresponding source code. (This alternative is + allowed only for noncommercial distribution and only if you + received the program in object code or executable form with such + an offer, in accord with Subsection b above.) + +The source code for a work means the preferred form of the work for +making modifications to it. For an executable work, complete source +code means all the source code for all modules it contains, plus any +associated interface definition files, plus the scripts used to +control compilation and installation of the executable. However, as a +special exception, the source code distributed need not include +anything that is normally distributed (in either source or binary +form) with the major components (compiler, kernel, and so on) of the +operating system on which the executable runs, unless that component +itself accompanies the executable. + +If distribution of executable or object code is made by offering +access to copy from a designated place, then offering equivalent +access to copy the source code from the same place counts as +distribution of the source code, even though third parties are not +compelled to copy the source along with the object code. + + 4. You may not copy, modify, sublicense, or distribute the Program +except as expressly provided under this License. Any attempt +otherwise to copy, modify, sublicense or distribute the Program is +void, and will automatically terminate your rights under this License. +However, parties who have received copies, or rights, from you under +this License will not have their licenses terminated so long as such +parties remain in full compliance. + + 5. You are not required to accept this License, since you have not +signed it. However, nothing else grants you permission to modify or +distribute the Program or its derivative works. These actions are +prohibited by law if you do not accept this License. Therefore, by +modifying or distributing the Program (or any work based on the +Program), you indicate your acceptance of this License to do so, and +all its terms and conditions for copying, distributing or modifying +the Program or works based on it. + + 6. Each time you redistribute the Program (or any work based on the +Program), the recipient automatically receives a license from the +original licensor to copy, distribute or modify the Program subject to +these terms and conditions. You may not impose any further +restrictions on the recipients' exercise of the rights granted herein. +You are not responsible for enforcing compliance by third parties to +this License. + + 7. If, as a consequence of a court judgment or allegation of patent +infringement or for any other reason (not limited to patent issues), +conditions are imposed on you (whether by court order, agreement or +otherwise) that contradict the conditions of this License, they do not +excuse you from the conditions of this License. If you cannot +distribute so as to satisfy simultaneously your obligations under this +License and any other pertinent obligations, then as a consequence you +may not distribute the Program at all. For example, if a patent +license would not permit royalty-free redistribution of the Program by +all those who receive copies directly or indirectly through you, then +the only way you could satisfy both it and this License would be to +refrain entirely from distribution of the Program. + +If any portion of this section is held invalid or unenforceable under +any particular circumstance, the balance of the section is intended to +apply and the section as a whole is intended to apply in other +circumstances. + +It is not the purpose of this section to induce you to infringe any +patents or other property right claims or to contest validity of any +such claims; this section has the sole purpose of protecting the +integrity of the free software distribution system, which is +implemented by public license practices. Many people have made +generous contributions to the wide range of software distributed +through that system in reliance on consistent application of that +system; it is up to the author/donor to decide if he or she is willing +to distribute software through any other system and a licensee cannot +impose that choice. + +This section is intended to make thoroughly clear what is believed to +be a consequence of the rest of this License. + + 8. If the distribution and/or use of the Program is restricted in +certain countries either by patents or by copyrighted interfaces, the +original copyright holder who places the Program under this License +may add an explicit geographical distribution limitation excluding +those countries, so that distribution is permitted only in or among +countries not thus excluded. In such case, this License incorporates +the limitation as if written in the body of this License. + + 9. The Free Software Foundation may publish revised and/or new versions +of the General Public License from time to time. Such new versions will +be similar in spirit to the present version, but may differ in detail to +address new problems or concerns. + +Each version is given a distinguishing version number. If the Program +specifies a version number of this License which applies to it and "any +later version", you have the option of following the terms and conditions +either of that version or of any later version published by the Free +Software Foundation. If the Program does not specify a version number of +this License, you may choose any version ever published by the Free Software +Foundation. + + 10. If you wish to incorporate parts of the Program into other free +programs whose distribution conditions are different, write to the author +to ask for permission. For software which is copyrighted by the Free +Software Foundation, write to the Free Software Foundation; we sometimes +make exceptions for this. Our decision will be guided by the two goals +of preserving the free status of all derivatives of our free software and +of promoting the sharing and reuse of software generally. + + NO WARRANTY + + 11. BECAUSE THE PROGRAM IS LICENSED FREE OF CHARGE, THERE IS NO WARRANTY +FOR THE PROGRAM, TO THE EXTENT PERMITTED BY APPLICABLE LAW. EXCEPT WHEN +OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR OTHER PARTIES +PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED +OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE. THE ENTIRE RISK AS +TO THE QUALITY AND PERFORMANCE OF THE PROGRAM IS WITH YOU. SHOULD THE +PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF ALL NECESSARY SERVICING, +REPAIR OR CORRECTION. + + 12. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING +WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY AND/OR +REDISTRIBUTE THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES, +INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING +OUT OF THE USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED +TO LOSS OF DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY +YOU OR THIRD PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER +PROGRAMS), EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE +POSSIBILITY OF SUCH DAMAGES. + + END OF TERMS AND CONDITIONS + diff --git a/mainpage.php b/Wordpress/mainpage.php similarity index 92% rename from mainpage.php rename to Wordpress/mainpage.php index 922e722..d943690 100644 --- a/mainpage.php +++ b/Wordpress/mainpage.php @@ -1,20 +1,20 @@ - - - - - -
        -
        - Read the rest of this page »

        '); ?> - - '

        Pages: ', 'after' => '

        ', 'next_or_number' => 'number')); ?> - -
        -
        - - + + + + + +
        +
        + Read the rest of this page »

        '); ?> + + '

        Pages: ', 'after' => '

        ', 'next_or_number' => 'number')); ?> + +
        +
        + + \ No newline at end of file diff --git a/page.php b/Wordpress/page.php similarity index 92% rename from page.php rename to Wordpress/page.php index 951fc98..b71f157 100644 --- a/page.php +++ b/Wordpress/page.php @@ -1,31 +1,31 @@ - - -
        -
        - - - - - - - - - -
        -
        - + + +
        +
        + + + + + + + + + +
        +
        + \ No newline at end of file diff --git a/rtl.css b/Wordpress/rtl.css similarity index 94% rename from rtl.css rename to Wordpress/rtl.css index 945f6c9..02cca82 100644 --- a/rtl.css +++ b/Wordpress/rtl.css @@ -1,583 +1,583 @@ -/* -Theme Name: HuskyPress - -Adding support for language written in a Right To Left (RTL) direction is easy - -it's just a matter of overwriting all the horizontal positioning attributes -of your CSS stylesheet in a separate stylesheet file named rtl.css. - -http://codex.wordpress.org/Right_to_Left_Language_Support - -*/ - -/* =Reset reset ------------------------------------------------ */ - -caption, th, td { - text-align: right; -} - -/* =Structure ------------------------------------------------ */ - -body { - direction:rtl; - unicode-bidi:embed; -} - -/* Showcase */ -.page-template-showcase-php section.recent-posts { - float: left; - margin: 0 31% 0 0; -} -.page-template-showcase-php #main .widget-area { - float: right; - margin: 0 0 0 -22.15%; -} - -/* One column */ - -.one-column article.feature-image.small .entry-summary a { - left: auto; - right: -9%; -} - -/* Simplify the pullquotes and pull styles */ -.one-column.singular .entry-meta .edit-link a { - right: 0px; - left: auto; -} -/* Make sure we have room for our comment avatars */ -.one-column .commentlist > li.comment { - margin-left: 0; - margin-right: 102px; -} -/* Make sure the logo and search form don't collide */ -.one-column #branding #searchform { - right: auto; - left: 40px; -} -/* Talking avatars take up too much room at this size */ -.one-column .commentlist > li.comment { - margin-right: 0; -} -.one-column .commentlist > li.comment .comment-meta, -.one-column .commentlist > li.comment .comment-content { - margin-right: 0; - margin-left: 85px; -} -.one-column .commentlist .avatar { - right: auto; - left: 1.625em; -} -.one-column .commentlist .children .avatar { - left: auto; - right: 2.2em; -} - -/* =Global ------------------------------------------------ */ - -/* Text elements */ -p { - margin-bottom: 1.625em; -} -ul, ol { - margin: 0 2.5em 1.625em 0; -} -.ltr ul, .ltr ol { - margin: 0 0 1.625em 2.5em; -} -blockquote { - font-family: Arial, sans-serif; -} -blockquote em, blockquote i, blockquote cite { - font-style: normal; -} - -/* Forms */ -textarea { - padding-left: 0; - padding-right: 3px; -} -input#s { - background-position: 97% 6px; - padding: 4px 28px 4px 10px; -} - -/* Assistive text */ -#access a.assistive-text:active, -#access a.assistive-text:focus { - left: auto; - right: 7.6%; -} - -/* =Header ------------------------------------------------ */ - -#site-title { - margin-right: 0; - margin-left: 270px; -} - -#site-description { - margin: 0 0 3.65625em 270px; -} - -/* =Menu --------------------------------------------------------------- */ - -#access { - float: right; -} -#access ul { - margin: 0 -0.8125em 0 0; - padding-right: 0; -} -#access li { - float: right; -} -#access ul ul { - float: right; - left: auto; - right: 0; -} -#access ul ul ul { - left: auto; - right: 100%; -} - -/* Search Form */ -#branding #searchform { - right: auto; - left: 7.6%; - text-align: left; -} -#branding #s { - float: left; -} -#branding .only-search + #access div { - padding-right: 0; - padding-left: 205px; -} - - -/* =Content ------------------------------------------------ */ -.entry-title, -.entry-header .entry-meta { - padding-right: 0; - padding-left: 76px; -} -.entry-content td, -.comment-content td { - padding: 6px 0 6px 10px; -} -.page-link span { - margin-right: 0; - margin-left: 6px; -} -.entry-meta .edit-link a { - float: left; -} -/* Images */ - -.wp-caption .wp-caption-text, -.gallery-caption { - font-family: Arial, sans-serif; -} -.wp-caption .wp-caption-text { - padding: 10px 40px 5px 0px; -} -.wp-caption .wp-caption-text:before { - margin-right: 0; - margin-left: 5px; - left: auto; - right: 10px; -} -#content .gallery-columns-4 .gallery-item { - padding-right:0; - padding-left:2%; -} - -/* Author Info */ -.singular #author-info { - margin: 2.2em -35.4% 0 -35.6%; -} -#author-avatar { - float: right; - margin-right: 0; - margin-left: -78px; -} -#author-description { - float: right; - margin-left: 0; - margin-right: 108px; -} -/* Comments link */ -.entry-header .comments-link a { - background-image: url(images/comment-bubble-rtl.png); - right: auto; - left: 0; -} - -/* - Post Formats Headings -*/ -.singular .entry-title, -.singular .entry-header .entry-meta { - padding-left: 0; -} -.singular .entry-header .entry-meta { - left: auto; - right: 0; -} -.singular .entry-meta .edit-link a { - left: auto; - right: 50px; -} - - -/* =Gallery ------------------------------------------------ */ - -.format-gallery .gallery-thumb { - float: right; - margin: .375em 0 0 1.625em; -} - - -/* =Status ------------------------------------------------ */ - -.format-status img.avatar { - float: right; - margin: 4px 0 2px 10px; -} - - -/* =Image ------------------------------------------------ */ - -.indexed.format-image div.entry-meta { - float: right; -} -/* =error404 ----------------------- -------------------------- */ -.error404 #main .widget { - float: right; - margin-right: auto; - margin-left: 3.7%; -} -.error404 #main .widget_archive { - margin-left: 0; -} -.error404 #main .widget_tag_cloud { - margin-left: 0; -} - -/* =Showcase ------------------------------------------------ */ - -article.intro .edit-link a { - right: auto; - left: 20px; -} - -/* Featured post */ -section.featured-post { - float: right; -} - -/* Small featured post */ -section.featured-post .attachment-small-feature { - float: left; - margin: 0 0 1.625em -8.9%; - right: auto; - left: -15px; -} -article.feature-image.small { - float: right; -} -article.feature-image.small .entry-summary p a { - left:auto; - right: -23.8%; - padding: 9px 85px 9px 26px; -} - -/* Large featured post */ -section.feature-image.large .hentry { - left:auto; - right: 9%; - margin: 1.625em 0 0 9%; -} -/* Featured Slider */ -.featured-posts .showcase-heading { - padding-left: 0; - padding-right: 8.9%; -} -.featured-posts section.featured-post { - left: auto; - right: 0; -} -#content .feature-slider { - right: auto; - left: 8.9%; -} -.feature-slider li { - float: right; -} -/* Recent Posts */ -section.recent-posts .other-recent-posts a[rel="bookmark"] { - float: right; -} -section.recent-posts .other-recent-posts .comments-link a, -section.recent-posts .other-recent-posts .comments-link > span { - padding: 0.3125em 1em 0.3125em 0; - right: auto; - left: 0; - text-align: left; -} - -/* =Attachments ------------------------------------------------ */ - -/* =Navigation --------------------------------------------------------------- */ - -.nav-previous { - float: right; -} -.nav-next { - float: left; - text-align: left; -} - -/* Singular navigation */ -#nav-single { - float: left; - text-align: left; -} -#nav-single .nav-next { - padding-left: 0; - padding-right: .5em; -} - - -/* =Widgets ------------------------------------------------ */ - -.widget ul ul { - margin-left: 0; - margin-right: 1.5em; -} - -/* Twitter */ -.widget_twitter .timesince { - margin-right: 0; - margin-left: -10px; - text-align: left; -} - -/* =Comments ------------------------------------------------ */ - -.commentlist .children li.comment { - border-left: none; - border-right: 1px solid #ddd; - -moz-border-radius: 3px 0 0 3px; - border-radius: 3px 0 0 3px; -} -.commentlist .children li.comment .comment-meta { - margin-left: 0; - margin-right: 50px; -} -.commentlist .avatar { - left: auto; - right: -102px; -} -.commentlist > li:before { - content: url(images/comment-arrow-rtl.png); - left:auto; - right: -21px; -} -.commentlist > li.pingback:before { - content: ''; -} -.commentlist .children .avatar { - left: auto; - right: 2.2em; -} - -/* Post author highlighting */ -.commentlist > li.bypostauthor:before { - content: url(images/comment-arrow-bypostauthor-rtl.png); -} - -/* sidebar-page.php comments */ -/* Make sure we have room for our comment avatars */ -.page-template-sidebar-page-php .commentlist > li.comment, -.page-template-sidebar-page-php.commentlist .pingback { - margin-left: 0; - margin-right: 102px; -} - -/* Comment Form */ -#respond .comment-form-author label, -#respond .comment-form-email label, -#respond .comment-form-url label, -#respond .comment-form-comment label { - left: auto; - right: 4px; -} -#respond .comment-form-author label, -#respond .comment-form-email label, -#respond .comment-form-url label, -#respond .comment-form-comment label { - -webkit-box-shadow: -1px 2px 2px rgba(204,204,204,0.8); - -moz-box-shadow: -1px 2px 2px rgba(204,204,204,0.8); - box-shadow: -1px 2px 2px rgba(204,204,204,0.8); -} -#respond .comment-form-author .required, -#respond .comment-form-email .required { - left: auto; - right: 75%; -} -#respond .form-submit { - float: left; -} -#respond input#submit { - left: auto; - right: 30px; - padding: 5px 22px 5px 42px; -} -#respond #cancel-comment-reply-link { - margin-left: 0; - margin-right: 10px; -} -#cancel-comment-reply-link { - right: auto; - left: 1.625em; -} - -/* =Footer ------------------------------------------------ */ - -/* Two Footer Widget Areas */ -#supplementary.two .widget-area { - float: right; - margin-right: 0; - margin-left: 3.7%; -} -#supplementary.two .widget-area + .widget-area { - margin-left: 0; -} - -/* Three Footer Widget Areas */ -#supplementary.three .widget-area { - float: right; - margin-right: 0; - margin-left: 3.7%; -} -#supplementary.three .widget-area + .widget-area + .widget-area { - margin-left: 0; -} - -/* Site Generator Line */ -#site-generator .sep { - background-position: right center; -} - - -/* =Responsive Structure ------------------------------------------------ */ - -@media (max-width: 800px) { - /* Simplify the showcase template when small feature */ - section.featured-post .attachment-small-feature, - .one-column section.featured-post .attachment-small-feature { - float: right; - } - article.feature-image.small { - float: left; - } - article.feature-image.small .entry-summary p a { - right: 0; - } - .singular .entry-meta .edit-link a { - left: auto; - right: 0px; - } - /* Make sure we have room for our comment avatars */ - .commentlist > li.comment, - .commentlist .pingback { - margin-left: 0; - margin-right: 102px; - } - /* No need to float footer widgets at this size */ - #colophon #supplementary .widget-area { - margin-left: 0; - } - /* No need to float 404 widgets at this size */ - .error404 #main .widget { - margin-left: 0; - } -} -@media (max-width: 650px) { - /* @media (max-width: 650px) Reduce font-sizes for better readability on smaller devices */ - #site-title, - #site-description { - margin-left: 0; - } - /* Talking avatars take up too much room at this size */ - .commentlist > li.comment, - .commentlist > li.pingback { - margin-right: 0 !important; - } - .commentlist .children .avatar { - left: auto; - right: 2.2em; - } - /* Use the available space in the smaller comment form */ - #respond .comment-form-author .required, - #respond .comment-form-email .required { - left: auto; - right: 95%; - } - #content .gallery-columns-3 .gallery-item { - padding-right: 0; - padding-left:2%; - } -} -@media (max-width: 450px) { - #content .gallery-columns-2 .gallery-item { - padding-right:0; - padding-left:4%; - } -} - -/* =Print ------------------------------------------------ */ - -@media print { - #primary { - float: right; - } - /* Comments */ - .commentlist .avatar { - left: auto; - right: 2.2em; - } - .commentlist li.comment .comment-meta { - margin-left: 0; - margin-right: 50px; - } -} - -/* =IE7 ------------------------------------------------ */ - -#ie7 section.recent-posts { - margin-right: 0; - margin-left: 7.6%; -} +/* +Theme Name: HuskyPress + +Adding support for language written in a Right To Left (RTL) direction is easy - +it's just a matter of overwriting all the horizontal positioning attributes +of your CSS stylesheet in a separate stylesheet file named rtl.css. + +http://codex.wordpress.org/Right_to_Left_Language_Support + +*/ + +/* =Reset reset +----------------------------------------------- */ + +caption, th, td { + text-align: right; +} + +/* =Structure +----------------------------------------------- */ + +body { + direction:rtl; + unicode-bidi:embed; +} + +/* Showcase */ +.page-template-showcase-php section.recent-posts { + float: left; + margin: 0 31% 0 0; +} +.page-template-showcase-php #main .widget-area { + float: right; + margin: 0 0 0 -22.15%; +} + +/* One column */ + +.one-column article.feature-image.small .entry-summary a { + left: auto; + right: -9%; +} + +/* Simplify the pullquotes and pull styles */ +.one-column.singular .entry-meta .edit-link a { + right: 0px; + left: auto; +} +/* Make sure we have room for our comment avatars */ +.one-column .commentlist > li.comment { + margin-left: 0; + margin-right: 102px; +} +/* Make sure the logo and search form don't collide */ +.one-column #branding #searchform { + right: auto; + left: 40px; +} +/* Talking avatars take up too much room at this size */ +.one-column .commentlist > li.comment { + margin-right: 0; +} +.one-column .commentlist > li.comment .comment-meta, +.one-column .commentlist > li.comment .comment-content { + margin-right: 0; + margin-left: 85px; +} +.one-column .commentlist .avatar { + right: auto; + left: 1.625em; +} +.one-column .commentlist .children .avatar { + left: auto; + right: 2.2em; +} + +/* =Global +----------------------------------------------- */ + +/* Text elements */ +p { + margin-bottom: 1.625em; +} +ul, ol { + margin: 0 2.5em 1.625em 0; +} +.ltr ul, .ltr ol { + margin: 0 0 1.625em 2.5em; +} +blockquote { + font-family: Arial, sans-serif; +} +blockquote em, blockquote i, blockquote cite { + font-style: normal; +} + +/* Forms */ +textarea { + padding-left: 0; + padding-right: 3px; +} +input#s { + background-position: 97% 6px; + padding: 4px 28px 4px 10px; +} + +/* Assistive text */ +#access a.assistive-text:active, +#access a.assistive-text:focus { + left: auto; + right: 7.6%; +} + +/* =Header +----------------------------------------------- */ + +#site-title { + margin-right: 0; + margin-left: 270px; +} + +#site-description { + margin: 0 0 3.65625em 270px; +} + +/* =Menu +-------------------------------------------------------------- */ + +#access { + float: right; +} +#access ul { + margin: 0 -0.8125em 0 0; + padding-right: 0; +} +#access li { + float: right; +} +#access ul ul { + float: right; + left: auto; + right: 0; +} +#access ul ul ul { + left: auto; + right: 100%; +} + +/* Search Form */ +#branding #searchform { + right: auto; + left: 7.6%; + text-align: left; +} +#branding #s { + float: left; +} +#branding .only-search + #access div { + padding-right: 0; + padding-left: 205px; +} + + +/* =Content +----------------------------------------------- */ +.entry-title, +.entry-header .entry-meta { + padding-right: 0; + padding-left: 76px; +} +.entry-content td, +.comment-content td { + padding: 6px 0 6px 10px; +} +.page-link span { + margin-right: 0; + margin-left: 6px; +} +.entry-meta .edit-link a { + float: left; +} +/* Images */ + +.wp-caption .wp-caption-text, +.gallery-caption { + font-family: Arial, sans-serif; +} +.wp-caption .wp-caption-text { + padding: 10px 40px 5px 0px; +} +.wp-caption .wp-caption-text:before { + margin-right: 0; + margin-left: 5px; + left: auto; + right: 10px; +} +#content .gallery-columns-4 .gallery-item { + padding-right:0; + padding-left:2%; +} + +/* Author Info */ +.singular #author-info { + margin: 2.2em -35.4% 0 -35.6%; +} +#author-avatar { + float: right; + margin-right: 0; + margin-left: -78px; +} +#author-description { + float: right; + margin-left: 0; + margin-right: 108px; +} +/* Comments link */ +.entry-header .comments-link a { + background-image: url(images/comment-bubble-rtl.png); + right: auto; + left: 0; +} + +/* + Post Formats Headings +*/ +.singular .entry-title, +.singular .entry-header .entry-meta { + padding-left: 0; +} +.singular .entry-header .entry-meta { + left: auto; + right: 0; +} +.singular .entry-meta .edit-link a { + left: auto; + right: 50px; +} + + +/* =Gallery +----------------------------------------------- */ + +.format-gallery .gallery-thumb { + float: right; + margin: .375em 0 0 1.625em; +} + + +/* =Status +----------------------------------------------- */ + +.format-status img.avatar { + float: right; + margin: 4px 0 2px 10px; +} + + +/* =Image +----------------------------------------------- */ + +.indexed.format-image div.entry-meta { + float: right; +} +/* =error404 +---------------------- +------------------------- */ +.error404 #main .widget { + float: right; + margin-right: auto; + margin-left: 3.7%; +} +.error404 #main .widget_archive { + margin-left: 0; +} +.error404 #main .widget_tag_cloud { + margin-left: 0; +} + +/* =Showcase +----------------------------------------------- */ + +article.intro .edit-link a { + right: auto; + left: 20px; +} + +/* Featured post */ +section.featured-post { + float: right; +} + +/* Small featured post */ +section.featured-post .attachment-small-feature { + float: left; + margin: 0 0 1.625em -8.9%; + right: auto; + left: -15px; +} +article.feature-image.small { + float: right; +} +article.feature-image.small .entry-summary p a { + left:auto; + right: -23.8%; + padding: 9px 85px 9px 26px; +} + +/* Large featured post */ +section.feature-image.large .hentry { + left:auto; + right: 9%; + margin: 1.625em 0 0 9%; +} +/* Featured Slider */ +.featured-posts .showcase-heading { + padding-left: 0; + padding-right: 8.9%; +} +.featured-posts section.featured-post { + left: auto; + right: 0; +} +#content .feature-slider { + right: auto; + left: 8.9%; +} +.feature-slider li { + float: right; +} +/* Recent Posts */ +section.recent-posts .other-recent-posts a[rel="bookmark"] { + float: right; +} +section.recent-posts .other-recent-posts .comments-link a, +section.recent-posts .other-recent-posts .comments-link > span { + padding: 0.3125em 1em 0.3125em 0; + right: auto; + left: 0; + text-align: left; +} + +/* =Attachments +----------------------------------------------- */ + +/* =Navigation +-------------------------------------------------------------- */ + +.nav-previous { + float: right; +} +.nav-next { + float: left; + text-align: left; +} + +/* Singular navigation */ +#nav-single { + float: left; + text-align: left; +} +#nav-single .nav-next { + padding-left: 0; + padding-right: .5em; +} + + +/* =Widgets +----------------------------------------------- */ + +.widget ul ul { + margin-left: 0; + margin-right: 1.5em; +} + +/* Twitter */ +.widget_twitter .timesince { + margin-right: 0; + margin-left: -10px; + text-align: left; +} + +/* =Comments +----------------------------------------------- */ + +.commentlist .children li.comment { + border-left: none; + border-right: 1px solid #ddd; + -moz-border-radius: 3px 0 0 3px; + border-radius: 3px 0 0 3px; +} +.commentlist .children li.comment .comment-meta { + margin-left: 0; + margin-right: 50px; +} +.commentlist .avatar { + left: auto; + right: -102px; +} +.commentlist > li:before { + content: url(images/comment-arrow-rtl.png); + left:auto; + right: -21px; +} +.commentlist > li.pingback:before { + content: ''; +} +.commentlist .children .avatar { + left: auto; + right: 2.2em; +} + +/* Post author highlighting */ +.commentlist > li.bypostauthor:before { + content: url(images/comment-arrow-bypostauthor-rtl.png); +} + +/* sidebar-page.php comments */ +/* Make sure we have room for our comment avatars */ +.page-template-sidebar-page-php .commentlist > li.comment, +.page-template-sidebar-page-php.commentlist .pingback { + margin-left: 0; + margin-right: 102px; +} + +/* Comment Form */ +#respond .comment-form-author label, +#respond .comment-form-email label, +#respond .comment-form-url label, +#respond .comment-form-comment label { + left: auto; + right: 4px; +} +#respond .comment-form-author label, +#respond .comment-form-email label, +#respond .comment-form-url label, +#respond .comment-form-comment label { + -webkit-box-shadow: -1px 2px 2px rgba(204,204,204,0.8); + -moz-box-shadow: -1px 2px 2px rgba(204,204,204,0.8); + box-shadow: -1px 2px 2px rgba(204,204,204,0.8); +} +#respond .comment-form-author .required, +#respond .comment-form-email .required { + left: auto; + right: 75%; +} +#respond .form-submit { + float: left; +} +#respond input#submit { + left: auto; + right: 30px; + padding: 5px 22px 5px 42px; +} +#respond #cancel-comment-reply-link { + margin-left: 0; + margin-right: 10px; +} +#cancel-comment-reply-link { + right: auto; + left: 1.625em; +} + +/* =Footer +----------------------------------------------- */ + +/* Two Footer Widget Areas */ +#supplementary.two .widget-area { + float: right; + margin-right: 0; + margin-left: 3.7%; +} +#supplementary.two .widget-area + .widget-area { + margin-left: 0; +} + +/* Three Footer Widget Areas */ +#supplementary.three .widget-area { + float: right; + margin-right: 0; + margin-left: 3.7%; +} +#supplementary.three .widget-area + .widget-area + .widget-area { + margin-left: 0; +} + +/* Site Generator Line */ +#site-generator .sep { + background-position: right center; +} + + +/* =Responsive Structure +----------------------------------------------- */ + +@media (max-width: 800px) { + /* Simplify the showcase template when small feature */ + section.featured-post .attachment-small-feature, + .one-column section.featured-post .attachment-small-feature { + float: right; + } + article.feature-image.small { + float: left; + } + article.feature-image.small .entry-summary p a { + right: 0; + } + .singular .entry-meta .edit-link a { + left: auto; + right: 0px; + } + /* Make sure we have room for our comment avatars */ + .commentlist > li.comment, + .commentlist .pingback { + margin-left: 0; + margin-right: 102px; + } + /* No need to float footer widgets at this size */ + #colophon #supplementary .widget-area { + margin-left: 0; + } + /* No need to float 404 widgets at this size */ + .error404 #main .widget { + margin-left: 0; + } +} +@media (max-width: 650px) { + /* @media (max-width: 650px) Reduce font-sizes for better readability on smaller devices */ + #site-title, + #site-description { + margin-left: 0; + } + /* Talking avatars take up too much room at this size */ + .commentlist > li.comment, + .commentlist > li.pingback { + margin-right: 0 !important; + } + .commentlist .children .avatar { + left: auto; + right: 2.2em; + } + /* Use the available space in the smaller comment form */ + #respond .comment-form-author .required, + #respond .comment-form-email .required { + left: auto; + right: 95%; + } + #content .gallery-columns-3 .gallery-item { + padding-right: 0; + padding-left:2%; + } +} +@media (max-width: 450px) { + #content .gallery-columns-2 .gallery-item { + padding-right:0; + padding-left:4%; + } +} + +/* =Print +----------------------------------------------- */ + +@media print { + #primary { + float: right; + } + /* Comments */ + .commentlist .avatar { + left: auto; + right: 2.2em; + } + .commentlist li.comment .comment-meta { + margin-left: 0; + margin-right: 50px; + } +} + +/* =IE7 +----------------------------------------------- */ + +#ie7 section.recent-posts { + margin-right: 0; + margin-left: 7.6%; +} diff --git a/screenshot.png b/Wordpress/screenshot.png similarity index 100% rename from screenshot.png rename to Wordpress/screenshot.png diff --git a/search.php b/Wordpress/search.php similarity index 95% rename from search.php rename to Wordpress/search.php index a8f6f84..c76e3d8 100644 --- a/search.php +++ b/Wordpress/search.php @@ -1,57 +1,57 @@ - - -
        -
        - - - - - - - - - - - - - - - - - - -
        -
        -

        -
        - -
        -

        - -
        -
        - - - -
        -
        - - + + +
        +
        + + + + + + + + + + + + + + + + + + +
        +
        +

        +
        + +
        +

        + +
        +
        + + + +
        +
        + + \ No newline at end of file diff --git a/searchform.php b/Wordpress/searchform.php similarity index 97% rename from searchform.php rename to Wordpress/searchform.php index d284c31..d119063 100644 --- a/searchform.php +++ b/Wordpress/searchform.php @@ -1,14 +1,14 @@ - -
        - - - -
        + +
        + + + +
        diff --git a/showcase.php b/Wordpress/showcase.php similarity index 96% rename from showcase.php rename to Wordpress/showcase.php index 7235bf0..cc1ec75 100644 --- a/showcase.php +++ b/Wordpress/showcase.php @@ -1,222 +1,222 @@ - - -
        -
        - - - - - - - - $sticky, - 'post_status' => 'publish', - 'posts_per_page' => 10, - 'no_found_rows' => true, - ); - - // The Featured Posts query. - $featured = new WP_Query( $featured_args ); - - // Proceed only if published posts exist - if ( $featured->have_posts() ) : - - /** - * We will need to count featured posts starting from zero - * to create the slider navigation. - */ - $counter_slider = 0; - - ?> - - - - - -
        -

        - - 'DESC', - 'post__not_in' => get_option( 'sticky_posts' ), - 'tax_query' => array( - array( - 'taxonomy' => 'post_format', - 'terms' => array( 'post-format-aside', 'post-format-link', 'post-format-quote', 'post-format-status' ), - 'field' => 'slug', - 'operator' => 'NOT IN', - ), - ), - 'no_found_rows' => true, - ); - - // Our new query for the Recent Posts section. - $recent = new WP_Query( $recent_args ); - - // The first Recent post is displayed normally - if ( $recent->have_posts() ) : $recent->the_post(); - - // Set $more to 0 in order to only get the first part of the post. - global $more; - $more = 0; - - get_template_part( 'content', get_post_format() ); - - echo '
          '; - - endif; - - // For all other recent posts, just display the title and comment status. - while ( $recent->have_posts() ) : $recent->the_post(); ?> - -
        1. - - - ' . __( 'Leave a reply', 'twentyeleven' ) . '', __( '1 Reply', 'twentyeleven' ), __( '% Replies', 'twentyeleven' ) ); ?> - -
        2. - - - if ( $recent->post_count > 0 ) - echo '
        '; - ?> -
        - - - -
        -
        - + + +
        +
        + + + + + + + + $sticky, + 'post_status' => 'publish', + 'posts_per_page' => 10, + 'no_found_rows' => true, + ); + + // The Featured Posts query. + $featured = new WP_Query( $featured_args ); + + // Proceed only if published posts exist + if ( $featured->have_posts() ) : + + /** + * We will need to count featured posts starting from zero + * to create the slider navigation. + */ + $counter_slider = 0; + + ?> + + + + + +
        +

        + + 'DESC', + 'post__not_in' => get_option( 'sticky_posts' ), + 'tax_query' => array( + array( + 'taxonomy' => 'post_format', + 'terms' => array( 'post-format-aside', 'post-format-link', 'post-format-quote', 'post-format-status' ), + 'field' => 'slug', + 'operator' => 'NOT IN', + ), + ), + 'no_found_rows' => true, + ); + + // Our new query for the Recent Posts section. + $recent = new WP_Query( $recent_args ); + + // The first Recent post is displayed normally + if ( $recent->have_posts() ) : $recent->the_post(); + + // Set $more to 0 in order to only get the first part of the post. + global $more; + $more = 0; + + get_template_part( 'content', get_post_format() ); + + echo '
          '; + + endif; + + // For all other recent posts, just display the title and comment status. + while ( $recent->have_posts() ) : $recent->the_post(); ?> + +
        1. + + + ' . __( 'Leave a reply', 'twentyeleven' ) . '', __( '1 Reply', 'twentyeleven' ), __( '% Replies', 'twentyeleven' ) ); ?> + +
        2. + + + if ( $recent->post_count > 0 ) + echo '
        '; + ?> +
        + + + +
        +
        + \ No newline at end of file diff --git a/sidebar-footer.php b/Wordpress/sidebar-footer.php similarity index 94% rename from sidebar-footer.php rename to Wordpress/sidebar-footer.php index 518796b..b23cf0e 100644 --- a/sidebar-footer.php +++ b/Wordpress/sidebar-footer.php @@ -1,42 +1,42 @@ - - - -
        > - - - - - - - - - - - + + + +
        > + + + + + + + + + + +
        \ No newline at end of file diff --git a/sidebar-page.php b/Wordpress/sidebar-page.php similarity index 91% rename from sidebar-page.php rename to Wordpress/sidebar-page.php index 16c1a4f..e3deb6f 100644 --- a/sidebar-page.php +++ b/Wordpress/sidebar-page.php @@ -1,28 +1,28 @@ - - -
        -
        - - - - - - - - - -
        -
        - - + + +
        +
        + + + + + + + + + +
        +
        + + \ No newline at end of file diff --git a/sidebar.php b/Wordpress/sidebar.php similarity index 94% rename from sidebar.php rename to Wordpress/sidebar.php index e1b8391..8bed2ae 100644 --- a/sidebar.php +++ b/Wordpress/sidebar.php @@ -1,36 +1,36 @@ - - + + \ No newline at end of file diff --git a/single.php b/Wordpress/single.php similarity index 94% rename from single.php rename to Wordpress/single.php index 4c0357a..f98baec 100644 --- a/single.php +++ b/Wordpress/single.php @@ -1,32 +1,32 @@ - - -
        -
        - - - - - - - - - - - -
        -
        - + + +
        +
        + + + + + + + + + + + +
        +
        + \ No newline at end of file diff --git a/style.css b/Wordpress/style.css similarity index 94% rename from style.css rename to Wordpress/style.css index c487d38..26675a6 100644 --- a/style.css +++ b/Wordpress/style.css @@ -1,545 +1,545 @@ -/* -Theme Name: HuskyPress -Theme URI: uconn.edu -Description: Wordpress theme in the style of UConn.edu. Built off of the wordpress theme "TwentyEleven." -Author: Dave Hicking and Erik Reynolds -Author URI: http://lib.uconn.edu -Template: huskypress -Version: 1.0 -*/ -@import url("twentyeleven.css"); - -/*Home Page */ - -#hero { - background: #3182c3; /* Old browsers */ - background: -moz-linear-gradient(top, #3182c3 0%, #003093 100%); /* FF3.6+ */ - background: -webkit-gradient(linear, left top, left bottom, color-stop(0%,#3182c3), color-stop(100%,#003093)); /* Chrome,Safari4+ */ - background: -webkit-linear-gradient(top, #3182c3 0%,#003093 100%); /* Chrome10+,Safari5.1+ */ - background: -o-linear-gradient(top, #3182c3 0%,#003093 100%); /* Opera 11.10+ */ - background: -ms-linear-gradient(top, #3182c3 0%,#003093 100%); /* IE10+ */ - background: linear-gradient(top, #3182c3 0%,#003093 100%); /* W3C */ - -ms-filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#3182c3', endColorstr='#003093', GradientType=0 ); /* IE6-9 */ - border: #3182c3; -} - -.top { - min-height:260px; -} - -.top.herohelp { - min-height: 310px; -} - -.bottom { - min-height:150px; - background: initial; - color: black; -} - -.second { - padding: 1em 2em 1em 2em; - background: white; - min-height: 200px; -} - -.second-help { min-height: 400px; } - -#hero, .second { - color: white; - /*font-family: 'Myriad Pro', 'Helvetica Neue', Arial, sans-serif; */ - /*font-family: 'Myriad Pro', Lucida Grande, Arial, sans-serif;*/ - font-family: 'Myriad Pro', Tahoma, Geneva, sans-serif; -} - -#hero .top { - padding: 3em 2em 2em 2em; -} - -#hero h2, .second h2 { - font-size: 2.5em; - margin-top: 1%; - line-height: 1.5em; -} - -#hero h3, .second h3 { - font-size: 1.6em; - line-height: 1.5em; - margin-right: 1em; - margin-top: 1em; -} - -#hero h4, .second h4 { - font-size: 1.4em; - line-height: 1.5em; - margin-right: 1em; - margin-top: 1em; -} - -#hero .left, .second .left { - width: 50%; - margin-left: 0em; - padding-right: 2em; -} - -#hero .right, .second .right { - width: 40%; - margin-right: 1em; -} - -.second .left { - border-right: 1px solid #cdcdcd; - padding-right: 2em; -} - -.second p { margin-top: 5px; } - -p.help { -font-size: 1.5em; -} - -#hero .top a, #hero .top a:visited, #hero .top a:hover { - color: #ffffff; -} - -.heroButton { - width: 100%; - padding: 10px; - border: #CCC solid 2px; - border-radius: 15px; - box-shadow: rgba(0, 0, 0, 0.2) 0px 1px 2px; -} - -.heroButton:first { margin-top: 1em; } - -#other_clients { - margin-top: 0px; - -} - -.divider { height: 1em; width 100%; display: block; } - -.left { float:left; } -.right { float:right; } -.clear { clear: both; } - -p { -margin-bottom: 0em; -} - -#catchphrase { - margin-top: 5em; - font-size: 1.6em; - font-style: italic; -} - -.ui-accordion-header { -font-size: 1.4em; -} - -.ui-accordion-content ul { -font-family: 'Myriad Pro', Tahoma, Geneva, sans-serif; -font-size: 1.3em; --webkit-column-count: 2; - -} - - -/*End Home Page */ - -html { -margin-top: none; -} - -#page { -background: none; -min-width: 480px; -} - -h1, h2 { -font-family: 'Myriad Pro', Tahoma, Geneva, sans-serif; -} - -h2 { - font-size: 1.8em; -} - -body, input, textarea { -font: 15px Helvetica, sans-serif; -line-height: 1.625em; -} - -.headline { -font-family: 'Myriad Pro', Tahoma, Geneva, sans-serif; -font-size: 1.3em; -} - -input[type=text] { - padding: 0px; - height: 25px; -} - -body { -background: #CCCCCC; -} - -#branding { -border-top: none; -background-image: url(http://web2.uconn.edu/webtools/global/4.0/head-foot/images/hd-blue.png); -background-repeat: repeat-x; -box-shadow: rgba(0, 0, 0, 0.4) 0px 1px 2px; -border-radius: 7px 7px 0px 0px; -} - -#branding .with-image #searchform { -max-width: 200px; -} - -#branding .only-search + #access div { -padding-right:0px; -} - -.cufon-active h1 { /* for Cufon.replace('h1') */ - font-size: 2em; -} - -.entry-title a { -font-size: 26px; -} - -#uc-website-title { -margin-left: 15px; -} - -#uc-website-title a{ -color:white; -position: relative; -top: -25px; -} - -#branding img { -width:auto; -margin-left: 10px -} - -#branding .only-search #searchform { -top: 0em; -right: 1em; -color: white; -} - -#searchform li { -float: left; -list-style: none; -font-size: .7em; -} - -#searchform #sa { -margin:0; -} - -#access { -background: #E2E2E2; -margin: auto; -} - -#access a { -font: bold 1em Helvetica, sans-serif; -color: black; -padding: 1em 17px .8em 17px; -} - -#access ul ul { -top: 3.0em; -z-index: 1000; -} - -#access div { -margin: 0 1.6em; -} - -#main { -clear: none; -padding: 0; -} - -ul, ol { -margin: 1em 0 1.625em 2.5em; -} - -#primary { -background: white; -padding: 0; -box-shadow: rgba(0, 0, 0, 0.4) 0px 1px 2px; -} - -.page-title.author { -font-size: inherit; -} - -.singular .entry-header .entry-meta { -left: inherit; -} - -.singular.page .hentry { - padding: 0 0 0; -} - -.singular .hentry { -padding: 3em 0 0; -} - -.singular #content, -.left-sidebar.singular #content { - margin: 1em; -} - -.singular .entry-header, .singular .entry-content, .singular footer.entry-meta, .singular #comments-title { -width: 85%; -} - -#content nav{ -padding: 0 2em 0 0; -} - -#nav-single .nav-previous, #nav-single .nav-next { -float: left; -} - -#secondary { -padding-top: 1.8em; -background: white; -} - -#page { -margin: 1em auto; -max-width: 950px; -} - -#colophon { -box-shadow: rgba(0, 0, 0, 0.4) 0px 1px 2px; -border-radius: 0px 0px 7px 7px; -background: #003093; /* Old browsers */ -background: -moz-linear-gradient(top, #003093 0%, #00165f 100%); /* FF3.6+ */ -background: -webkit-gradient(linear, left top, left bottom, color-stop(0%,#003093), color-stop(100%,#00165f)); /* Chrome,Safari4+ */ -background: -webkit-linear-gradient(top, #003093 0%,#00165f 100%); /* Chrome10+,Safari5.1+ */ -background: -o-linear-gradient(top, #003093 0%,#00165f 100%); /* Opera 11.10+ */ -background: -ms-linear-gradient(top, #003093 0%,#00165f 100%); /* IE10+ */ -background: linear-gradient(top, #003093 0%,#00165f 100%); /* W3C */ -filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#003093', endColorstr='#00165f',GradientType=0 ); /* IE6-9 */ -} - -#colophon a { -color: white; -} - -#content { - margin: 0 15% 0 10%; - width: 75%; -} - -.widget-area { -text-align: center; -} - -.widget-area ul { - list-style-type: none; -} - -#secondary { - width: 15%; - margin-right: 1.8em; -} - -#supplementary { -padding: 1.5em 7.6%; -} - -#tabs-1 div { text-align: center; margin-top: 2em; } - -div.step { - margin-top: 1.5em; -} - -div.step p { margin-bottom: 0.5em; } - -div.step img { margin: 0.5em auto; } - -div.featurebox { - float: left; - width: 96%; - border: 1px solid #f4f4f4; - height: 150px; - margin: 2%; -} - -.featurebox div { padding: 1em; } -.featurebox h2 { - display: block; - text-align: center; - padding: 0.5em; - background-color: #3f3f4d; -} - -.featurebox h2 a, .featurebox h2 a:visited { color: #ffffff; } -/* =Responsive Structure for narrow screens -* to keep min width and sidebar --------------------------------------------- */ -@media (max-width: 800px) { - # -/* keep the sidebar - for right sidebar */ - .right-sidebar #main #content { - margin: 0 29% 0 1%; - width: 70%; - } - .right-sidebar #main #secondary { - float: right; - margin: 0 1% 0 1%; - width: 24%; - } -/* keep the sidebar - for left sidebar */ - .left-sidebar #main #content { - margin: 0 1% 0 29%; - width: 60%; - } - .left-sidebar #main #secondary { - float: right; - margin: 0 -1% 0 2%; - width: 24%; - } -/* correction for 'showcase' template */ - .page-template-showcase-php #main #primary.showcase { - float: right; - margin: 0 2% 0 2%; - width: 96%; - } - .page-template-showcase-php #main #primary.showcase #content { - margin: 0 6% 0 6%; - width: 88%; - } - .page-template-showcase-php section.recent-posts { - float: right; - margin-right: 0pt; - margin-left: 31%; - width: 69%; - } - .page-template-showcase-php #main .widget-area { - float: left; - margin-right: -22.15%; - margin-left: 0pt; - width: 22.15%; - } - - #main #content { - width:60%; - } -/* correction for singular posts/pages without sidebar */ - .singular #main #content { - margin: 0 8% 0 8%; - width: 84%; - } -/* keep floating footer widgets side-by-side at this size */ - #colophon #supplementary .widget-area { - float: left; - margin-right: 1%; - width: 32%; - } -} - -@media (max-width: 750px) { - -#main #secondary { -margin: auto; -} - -.entry-header .comments-link a { -display:none; -} - -#main #secondary ul { -list-style: none; -} - -#main #secondary .widget { -margin: auto; -} - -} - -@media (max-width: 680px) { - -#page { -margin: 0; -} -#branding { -border-radius: 0px; -} - -#hero .right { -margin-left: 0em; -margin-right: 0em; -} - -#hero .left, -#hero .right, -{ -width: 100% -} - -#hero .left, .second .left{ -width: 100%; -margin-left: 0; -padding-right: 0; -border-right: 0px; -padding-bottom: 1em; -} - -#hero .right, .second .right { -width: 100%; -} - -.top { -padding: 30px 30px 30px 30px; -} - -.second { -padding: 30px 30px 30px 30px; -} - -#view_client { -width: 90%; -box-shadow:rgba(0, 0, 0, 0) 0px 1px 2px; -} - -#other_clients a img { - box-shadow: rgba(0, 0, 0, 0) 0px 1px 2px; - width: 90%; - } -.heroButton { - box-shadow: rgba(0, 0, 0, 0) 0px 1px 2px; - width: 90%; -} -.right{ -float: none; -} - -.bottom.right{ -padding-top:10px; -} - -#branding #searchform { -display:none; -} - - - - -#supplementary { -padding: none; -} - -#colophon { -border-radius: 0px; -} - +/* +Theme Name: HuskyPress +Theme URI: uconn.edu +Description: Wordpress theme in the style of UConn.edu. Built off of the wordpress theme "TwentyEleven." +Author: Dave Hicking and Erik Reynolds +Author URI: http://lib.uconn.edu +Template: huskypress +Version: 1.0 +*/ +@import url("twentyeleven.css"); + +/*Home Page */ + +#hero { + background: #3182c3; /* Old browsers */ + background: -moz-linear-gradient(top, #3182c3 0%, #003093 100%); /* FF3.6+ */ + background: -webkit-gradient(linear, left top, left bottom, color-stop(0%,#3182c3), color-stop(100%,#003093)); /* Chrome,Safari4+ */ + background: -webkit-linear-gradient(top, #3182c3 0%,#003093 100%); /* Chrome10+,Safari5.1+ */ + background: -o-linear-gradient(top, #3182c3 0%,#003093 100%); /* Opera 11.10+ */ + background: -ms-linear-gradient(top, #3182c3 0%,#003093 100%); /* IE10+ */ + background: linear-gradient(top, #3182c3 0%,#003093 100%); /* W3C */ + -ms-filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#3182c3', endColorstr='#003093', GradientType=0 ); /* IE6-9 */ + border: #3182c3; +} + +.top { + min-height:260px; +} + +.top.herohelp { + min-height: 310px; +} + +.bottom { + min-height:150px; + background: initial; + color: black; +} + +.second { + padding: 1em 2em 1em 2em; + background: white; + min-height: 200px; +} + +.second-help { min-height: 400px; } + +#hero, .second { + color: white; + /*font-family: 'Myriad Pro', 'Helvetica Neue', Arial, sans-serif; */ + /*font-family: 'Myriad Pro', Lucida Grande, Arial, sans-serif;*/ + font-family: 'Myriad Pro', Tahoma, Geneva, sans-serif; +} + +#hero .top { + padding: 3em 2em 2em 2em; +} + +#hero h2, .second h2 { + font-size: 2.5em; + margin-top: 1%; + line-height: 1.5em; +} + +#hero h3, .second h3 { + font-size: 1.6em; + line-height: 1.5em; + margin-right: 1em; + margin-top: 1em; +} + +#hero h4, .second h4 { + font-size: 1.4em; + line-height: 1.5em; + margin-right: 1em; + margin-top: 1em; +} + +#hero .left, .second .left { + width: 50%; + margin-left: 0em; + padding-right: 2em; +} + +#hero .right, .second .right { + width: 40%; + margin-right: 1em; +} + +.second .left { + border-right: 1px solid #cdcdcd; + padding-right: 2em; +} + +.second p { margin-top: 5px; } + +p.help { +font-size: 1.5em; +} + +#hero .top a, #hero .top a:visited, #hero .top a:hover { + color: #ffffff; +} + +.heroButton { + width: 100%; + padding: 10px; + border: #CCC solid 2px; + border-radius: 15px; + box-shadow: rgba(0, 0, 0, 0.2) 0px 1px 2px; +} + +.heroButton:first { margin-top: 1em; } + +#other_clients { + margin-top: 0px; + +} + +.divider { height: 1em; width 100%; display: block; } + +.left { float:left; } +.right { float:right; } +.clear { clear: both; } + +p { +margin-bottom: 0em; +} + +#catchphrase { + margin-top: 5em; + font-size: 1.6em; + font-style: italic; +} + +.ui-accordion-header { +font-size: 1.4em; +} + +.ui-accordion-content ul { +font-family: 'Myriad Pro', Tahoma, Geneva, sans-serif; +font-size: 1.3em; +-webkit-column-count: 2; + +} + + +/*End Home Page */ + +html { +margin-top: none; +} + +#page { +background: none; +min-width: 480px; +} + +h1, h2 { +font-family: 'Myriad Pro', Tahoma, Geneva, sans-serif; +} + +h2 { + font-size: 1.8em; +} + +body, input, textarea { +font: 15px Helvetica, sans-serif; +line-height: 1.625em; +} + +.headline { +font-family: 'Myriad Pro', Tahoma, Geneva, sans-serif; +font-size: 1.3em; +} + +input[type=text] { + padding: 0px; + height: 25px; +} + +body { +background: #CCCCCC; +} + +#branding { +border-top: none; +background-image: url(http://web2.uconn.edu/webtools/global/4.0/head-foot/images/hd-blue.png); +background-repeat: repeat-x; +box-shadow: rgba(0, 0, 0, 0.4) 0px 1px 2px; +border-radius: 7px 7px 0px 0px; +} + +#branding .with-image #searchform { +max-width: 200px; +} + +#branding .only-search + #access div { +padding-right:0px; +} + +.cufon-active h1 { /* for Cufon.replace('h1') */ + font-size: 2em; +} + +.entry-title a { +font-size: 26px; +} + +#uc-website-title { +margin-left: 15px; +} + +#uc-website-title a{ +color:white; +position: relative; +top: -25px; +} + +#branding img { +width:auto; +margin-left: 10px +} + +#branding .only-search #searchform { +top: 0em; +right: 1em; +color: white; +} + +#searchform li { +float: left; +list-style: none; +font-size: .7em; +} + +#searchform #sa { +margin:0; +} + +#access { +background: #E2E2E2; +margin: auto; +} + +#access a { +font: bold 1em Helvetica, sans-serif; +color: black; +padding: 1em 17px .8em 17px; +} + +#access ul ul { +top: 3.0em; +z-index: 1000; +} + +#access div { +margin: 0 1.6em; +} + +#main { +clear: none; +padding: 0; +} + +ul, ol { +margin: 1em 0 1.625em 2.5em; +} + +#primary { +background: white; +padding: 0; +box-shadow: rgba(0, 0, 0, 0.4) 0px 1px 2px; +} + +.page-title.author { +font-size: inherit; +} + +.singular .entry-header .entry-meta { +left: inherit; +} + +.singular.page .hentry { + padding: 0 0 0; +} + +.singular .hentry { +padding: 3em 0 0; +} + +.singular #content, +.left-sidebar.singular #content { + margin: 1em; +} + +.singular .entry-header, .singular .entry-content, .singular footer.entry-meta, .singular #comments-title { +width: 85%; +} + +#content nav{ +padding: 0 2em 0 0; +} + +#nav-single .nav-previous, #nav-single .nav-next { +float: left; +} + +#secondary { +padding-top: 1.8em; +background: white; +} + +#page { +margin: 1em auto; +max-width: 950px; +} + +#colophon { +box-shadow: rgba(0, 0, 0, 0.4) 0px 1px 2px; +border-radius: 0px 0px 7px 7px; +background: #003093; /* Old browsers */ +background: -moz-linear-gradient(top, #003093 0%, #00165f 100%); /* FF3.6+ */ +background: -webkit-gradient(linear, left top, left bottom, color-stop(0%,#003093), color-stop(100%,#00165f)); /* Chrome,Safari4+ */ +background: -webkit-linear-gradient(top, #003093 0%,#00165f 100%); /* Chrome10+,Safari5.1+ */ +background: -o-linear-gradient(top, #003093 0%,#00165f 100%); /* Opera 11.10+ */ +background: -ms-linear-gradient(top, #003093 0%,#00165f 100%); /* IE10+ */ +background: linear-gradient(top, #003093 0%,#00165f 100%); /* W3C */ +filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#003093', endColorstr='#00165f',GradientType=0 ); /* IE6-9 */ +} + +#colophon a { +color: white; +} + +#content { + margin: 0 15% 0 10%; + width: 75%; +} + +.widget-area { +text-align: center; +} + +.widget-area ul { + list-style-type: none; +} + +#secondary { + width: 15%; + margin-right: 1.8em; +} + +#supplementary { +padding: 1.5em 7.6%; +} + +#tabs-1 div { text-align: center; margin-top: 2em; } + +div.step { + margin-top: 1.5em; +} + +div.step p { margin-bottom: 0.5em; } + +div.step img { margin: 0.5em auto; } + +div.featurebox { + float: left; + width: 96%; + border: 1px solid #f4f4f4; + height: 150px; + margin: 2%; +} + +.featurebox div { padding: 1em; } +.featurebox h2 { + display: block; + text-align: center; + padding: 0.5em; + background-color: #3f3f4d; +} + +.featurebox h2 a, .featurebox h2 a:visited { color: #ffffff; } +/* =Responsive Structure for narrow screens +* to keep min width and sidebar +-------------------------------------------- */ +@media (max-width: 800px) { + # +/* keep the sidebar - for right sidebar */ + .right-sidebar #main #content { + margin: 0 29% 0 1%; + width: 70%; + } + .right-sidebar #main #secondary { + float: right; + margin: 0 1% 0 1%; + width: 24%; + } +/* keep the sidebar - for left sidebar */ + .left-sidebar #main #content { + margin: 0 1% 0 29%; + width: 60%; + } + .left-sidebar #main #secondary { + float: right; + margin: 0 -1% 0 2%; + width: 24%; + } +/* correction for 'showcase' template */ + .page-template-showcase-php #main #primary.showcase { + float: right; + margin: 0 2% 0 2%; + width: 96%; + } + .page-template-showcase-php #main #primary.showcase #content { + margin: 0 6% 0 6%; + width: 88%; + } + .page-template-showcase-php section.recent-posts { + float: right; + margin-right: 0pt; + margin-left: 31%; + width: 69%; + } + .page-template-showcase-php #main .widget-area { + float: left; + margin-right: -22.15%; + margin-left: 0pt; + width: 22.15%; + } + + #main #content { + width:60%; + } +/* correction for singular posts/pages without sidebar */ + .singular #main #content { + margin: 0 8% 0 8%; + width: 84%; + } +/* keep floating footer widgets side-by-side at this size */ + #colophon #supplementary .widget-area { + float: left; + margin-right: 1%; + width: 32%; + } +} + +@media (max-width: 750px) { + +#main #secondary { +margin: auto; +} + +.entry-header .comments-link a { +display:none; +} + +#main #secondary ul { +list-style: none; +} + +#main #secondary .widget { +margin: auto; +} + +} + +@media (max-width: 680px) { + +#page { +margin: 0; +} +#branding { +border-radius: 0px; +} + +#hero .right { +margin-left: 0em; +margin-right: 0em; +} + +#hero .left, +#hero .right, +{ +width: 100% +} + +#hero .left, .second .left{ +width: 100%; +margin-left: 0; +padding-right: 0; +border-right: 0px; +padding-bottom: 1em; +} + +#hero .right, .second .right { +width: 100%; +} + +.top { +padding: 30px 30px 30px 30px; +} + +.second { +padding: 30px 30px 30px 30px; +} + +#view_client { +width: 90%; +box-shadow:rgba(0, 0, 0, 0) 0px 1px 2px; +} + +#other_clients a img { + box-shadow: rgba(0, 0, 0, 0) 0px 1px 2px; + width: 90%; + } +.heroButton { + box-shadow: rgba(0, 0, 0, 0) 0px 1px 2px; + width: 90%; +} +.right{ +float: none; +} + +.bottom.right{ +padding-top:10px; +} + +#branding #searchform { +display:none; +} + + + + +#supplementary { +padding: none; +} + +#colophon { +border-radius: 0px; +} + } \ No newline at end of file diff --git a/tag.php b/Wordpress/tag.php similarity index 96% rename from tag.php rename to Wordpress/tag.php index 3723bf9..8b6d27b 100644 --- a/tag.php +++ b/Wordpress/tag.php @@ -1,65 +1,65 @@ - - -
        -
        - - - -
        ' ); - ?> - - - - - - - - - - - - - - - -
        -
        -

        -
        - -
        -

        - -
        -
        - - - -
        - - - - + + +
        +
        + + + +
        ' ); + ?> + + + + + + + + + + + + + + + +
        +
        +

        +
        + +
        +

        + +
        +
        + + + + +
        + + + diff --git a/twentyeleven.css b/Wordpress/twentyeleven.css similarity index 95% rename from twentyeleven.css rename to Wordpress/twentyeleven.css index 765b5f7..db24941 100644 --- a/twentyeleven.css +++ b/Wordpress/twentyeleven.css @@ -1,5356 +1,5356 @@ -/* -Theme Name: HuskyPress -Theme URI: -Author: the WordPress team -Author URI: http://uconn.edu -Description: Adapted from the Wordpress TwentyEleven theme. -Version: 1.0 -License: GNU General Public License -License URI: license.txt -Tags: dark, light, white, black, gray, one-column, two-columns, left-sidebar, right-sidebar, fixed-width, flexible-width, custom-background, custom-colors, custom-header, custom-menu, editor-style, featured-image-header, featured-images, full-width-template, microformats, post-formats, rtl-language-support, sticky-post, theme-options, translation-ready -*/ - -/* =Reset default browser CSS. Based on work by Eric Meyer: http://meyerweb.com/eric/tools/css/reset/index.html --------------------------------------------------------------- */ - -html, body, div, span, applet, object, iframe, -h1, h2, h3, h4, h5, h6, p, blockquote, pre, -a, abbr, acronym, address, big, cite, code, -del, dfn, em, font, ins, kbd, q, s, samp, -small, strike, strong, sub, sup, tt, var, -dl, dt, dd, ol, ul, li, -fieldset, form, label, legend, -table, caption, tbody, tfoot, thead, tr, th, td { - border: 0; - font-family: inherit; - font-size: 100%; - font-style: inherit; - font-weight: inherit; - margin: 0; - outline: 0; - padding: 0; - vertical-align: baseline; -} -:focus {/* remember to define focus styles! */ - outline: 0; -} -body { - background: #fff; - line-height: 1; -} -ol, ul { - list-style: none; -} -table {/* tables still need 'cellspacing="0"' in the markup */ - border-collapse: separate; - border-spacing: 0; -} -caption, th, td { - font-weight: normal; - text-align: left; -} -blockquote:before, blockquote:after, -q:before, q:after { - content: ""; -} -blockquote, q { - quotes: "" ""; -} -a img { - border: 0; -} -article, aside, details, figcaption, figure, -footer, header, hgroup, menu, nav, section { - display: block; -} - - -/* =Structure ------------------------------------------------ */ - -body { - padding: 0 2em; -} -#page { - margin: 2em auto; - max-width: 1000px; -} -#branding hgroup { - margin: 0 7.6%; -} -#access div { - margin: 0 7.6%; -} -#primary { - float: left; - margin: 0 -26.4% 0 0; - width: 100%; -} -#content { - margin: 0 34% 0 7.6%; - width: 58.4%; -} -#secondary { - float: right; - margin-right: 7.6%; - width: 18.8%; -} - -/* Singular */ -.singular #primary { - margin: 0; -} -.singular #content, -.left-sidebar.singular #content { - margin: 0 7.6%; - position: relative; - width: auto; -} -.singular .entry-header, -.singular .entry-content, -.singular footer.entry-meta, -.singular #comments-title { - margin: 0 auto; - width: 68.9%; -} - -/* Attachments */ -.singular .image-attachment .entry-content { - margin: 0 auto; - width: auto; -} -.singular .image-attachment .entry-description { - margin: 0 auto; - width: 68.9%; -} - -/* Showcase */ -.page-template-showcase-php #primary, -.left-sidebar.page-template-showcase-php #primary { - margin: 0; -} -.page-template-showcase-php #content, -.left-sidebar.page-template-showcase-php #content { - margin: 0 7.6%; - width: auto; -} -.page-template-showcase-php section.recent-posts { - float: right; - margin: 0 0 0 31%; - width: 69%; -} -.page-template-showcase-php #main .widget-area { - float: left; - margin: 0 -22.15% 0 0; - width: 22.15%; -} - -/* error404 */ -.error404 #primary { - float: none; - margin: 0; -} -.error404 #primary #content { - margin: 0 7.6%; - width: auto; -} - -/* Alignment */ -.alignleft { - display: inline; - float: left; - margin-right: 1.625em; -} -.alignright { - display: inline; - float: right; - margin-left: 1.625em; -} -.aligncenter { - clear: both; - display: block; - margin-left: auto; - margin-right: auto; -} - -/* Right Content */ -.left-sidebar #primary { - float: right; - margin: 0 0 0 -26.4%; - width: 100%; -} -.left-sidebar #content { - margin: 0 7.6% 0 34%; - width: 58.4%; -} -.left-sidebar #secondary { - float: left; - margin-left: 7.6%; - margin-right: 0; - width: 18.8%; -} - -/* One column */ -.one-column #page { - max-width: 690px; -} -.one-column #content { - margin: 0 7.6%; - width: auto; -} -.one-column #nav-below { - border-bottom: 1px solid #ddd; - margin-bottom: 1.625em; -} -.one-column #secondary { - float: none; - margin: 0 7.6%; - width: auto; -} -/* Simplify the showcase template */ -.one-column .page-template-showcase-php section.recent-posts { - float: none; - margin: 0; - width: 100%; -} -.one-column .page-template-showcase-php #main .widget-area { - float: none; - margin: 0; - width: auto; -} -.one-column .page-template-showcase-php .other-recent-posts { - border-bottom: 1px solid #ddd; -} -/* Simplify the showcase template when small feature */ -.one-column section.featured-post .attachment-small-feature { - border: none; - display: block; - height: auto; - max-width: 60%; - position: static; -} -.one-column article.feature-image.small { - margin: 0 0 1.625em; - padding: 0; -} -.one-column article.feature-image.small .entry-title { - font-size: 20px; - line-height: 1.3em; -} -.one-column article.feature-image.small .entry-summary { - height: 150px; - overflow: hidden; - padding: 0; - text-overflow: ellipsis; -} -.one-column article.feature-image.small .entry-summary a { - left: -9%; -} -/* Remove the margin on singular articles */ -.one-column.singular .entry-header, -.one-column.singular .entry-content, -.one-column.singular footer.entry-meta, -.one-column.singular #comments-title { - width: 100%; -} -/* Simplify the pullquotes and pull styles */ -.one-column.singular blockquote.pull { - margin: 0 0 1.625em; -} -.one-column.singular .pull.alignleft { - margin: 0 1.625em 0 0; -} -.one-column.singular .pull.alignright { - margin: 0 0 0 1.625em; -} -.one-column.singular .entry-meta .edit-link a { - position: absolute; - left: 0; - top: 40px; -} -.one-column.singular #author-info { - margin: 2.2em -8.8% 0; - padding: 20px 8.8%; -} -/* Make sure we have room for our comment avatars */ -.one-column .commentlist > li.comment { - margin-left: 102px; - width: auto; -} -/* Make sure the logo and search form don't collide */ -.one-column #branding #searchform { - right: 40px; - top: 4em; -} -/* Talking avatars take up too much room at this size */ -.one-column .commentlist > li.comment { - margin-left: 0; -} -.one-column .commentlist > li.comment .comment-meta, -.one-column .commentlist > li.comment .comment-content { - margin-right: 85px; -} -.one-column .commentlist .avatar { - background: transparent; - display: block; - padding: 0; - top: 1.625em; - left: auto; - right: 1.625em; -} -.one-column .commentlist .children .avatar { - background: none; - padding: 0; - position: absolute; - top: 2.2em; - left: 2.2em; -} -.one-column #respond { - width: auto; -} - - -/* =Global ------------------------------------------------ */ - -body, input, textarea { - color: #373737; - font: 15px "Helvetica Neue", Helvetica, Arial, sans-serif; - font-weight: 300; - line-height: 1.625; -} -body { - background: #e2e2e2; -} -#page { - background: #fff; -} - -/* Headings */ -h1,h2,h3,h4,h5,h6 { - clear: both; -} -hr { - background-color: #ccc; - border: 0; - height: 1px; - margin-bottom: 1.625em; -} - -/* Text elements */ -p { - margin-bottom: 1.625em; -} -ul, ol { - margin: 0 0 1.625em 2.5em; -} -ul { - list-style: square; -} -ol { - list-style-type: decimal; -} -ol ol { - list-style: upper-alpha; -} -ol ol ol { - list-style: lower-roman; -} -ol ol ol ol { - list-style: lower-alpha; -} -ul ul, ol ol, ul ol, ol ul { - margin-bottom: 0; -} -dl { - margin: 0 1.625em; -} -dt { - font-weight: bold; -} -dd { - margin-bottom: 1.625em; -} -strong { - font-weight: bold; -} -cite, em, i { - font-style: italic; -} -blockquote { - font-family: Georgia, "Bitstream Charter", serif; - font-style: italic; - font-weight: normal; - margin: 0 3em; -} -blockquote em, blockquote i, blockquote cite { - font-style: normal; -} -blockquote cite { - color: #666; - font: 12px "Helvetica Neue", Helvetica, Arial, sans-serif; - font-weight: 300; - letter-spacing: 0.05em; - text-transform: uppercase; -} -pre { - background: #f4f4f4; - font: 13px "Courier 10 Pitch", Courier, monospace; - line-height: 1.5; - margin-bottom: 1.625em; - overflow: auto; - padding: 0.75em 1.625em; -} -code, kbd { - font: 13px Monaco, Consolas, "Andale Mono", "DejaVu Sans Mono", monospace; -} -abbr, acronym, dfn { - border-bottom: 1px dotted #666; - cursor: help; -} -address { - display: block; - margin: 0 0 1.625em; -} -ins { - background: #fff9c0; - text-decoration: none; -} -sup, -sub { - font-size: 10px; - height: 0; - line-height: 1; - position: relative; - vertical-align: baseline; -} -sup { - bottom: 1ex; -} -sub { - top: .5ex; -} - -/* Forms */ -input[type=text], -input[type=password], -textarea { - background: #fafafa; - -moz-box-shadow: inset 0 1px 1px rgba(0,0,0,0.1); - -webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,0.1); - box-shadow: inset 0 1px 1px rgba(0,0,0,0.1); - border: 1px solid #ddd; - color: #888; -} -input[type=text]:focus, -textarea:focus { - color: #373737; -} -textarea { - padding-left: 3px; - width: 98%; -} -input[type=text] { - padding: 3px; -} -input#s { - background: url(images/search.png) no-repeat 5px 6px; - -moz-border-radius: 2px; - border-radius: 2px; - font-size: 14px; - height: 22px; - line-height: 1.2em; - padding: 4px 10px 4px 28px; -} -input#searchsubmit { - display: none; -} - -/* Links */ -a { - color: #1982d1; - text-decoration: none; -} -a:focus, -a:active, -a:hover { - text-decoration: underline; -} - -/* Assistive text */ -.assistive-text { - position: absolute !important; - clip: rect(1px 1px 1px 1px); /* IE6, IE7 */ - clip: rect(1px, 1px, 1px, 1px); -} -#access a.assistive-text:active, -#access a.assistive-text:focus { - background: #eee; - border-bottom: 1px solid #ddd; - color: #1982d1; - clip: auto !important; - font-size: 12px; - position: absolute; - text-decoration: underline; - top: 0; - left: 7.6%; -} - - -/* =Header ------------------------------------------------ */ - -#branding { - border-top: 2px solid #bbb; - - position: relative; - z-index: 9999; -} -#site-title { - margin-right: 270px; - padding: 3.65625em 0 0; -} -#site-title a { - color: #111; - font-size: 30px; - font-weight: bold; - line-height: 36px; - text-decoration: none; -} -#site-title a:hover, -#site-title a:focus, -#site-title a:active { - color: #1982d1; -} -#site-description { - color: #7a7a7a; - font-size: 14px; - margin: 0 270px 3.65625em 0; -} -#branding img { - height: auto; - margin-bottom: -7px; - width: 100%; -} - - -/* =Menu --------------------------------------------------------------- */ - -#access { - background: #222; /* Show a solid color for older browsers */ - background: -moz-linear-gradient(#252525, #0a0a0a); - background: -o-linear-gradient(#252525, #0a0a0a); - background: -webkit-gradient(linear, 0% 0%, 0% 100%, from(#252525), to(#0a0a0a)); /* older webkit syntax */ - background: -webkit-linear-gradient(#252525, #0a0a0a); - -webkit-box-shadow: rgba(0, 0, 0, 0.4) 0px 1px 2px; - -moz-box-shadow: rgba(0, 0, 0, 0.4) 0px 1px 2px; - box-shadow: rgba(0, 0, 0, 0.4) 0px 1px 2px; - clear: both; - display: block; - float: left; - margin: 0 auto 6px; - width: 100%; -} -#access ul { - font-size: 13px; - list-style: none; - margin: 0 0 0 -0.8125em; - padding-left: 0; -} -#access li { - float: left; - position: relative; -} -#access a { - color: #eee; - display: block; - line-height: 3.333em; - padding: 0 1.2125em; - text-decoration: none; -} -#access ul ul { - -moz-box-shadow: 0 3px 3px rgba(0,0,0,0.2); - -webkit-box-shadow: 0 3px 3px rgba(0,0,0,0.2); - box-shadow: 0 3px 3px rgba(0,0,0,0.2); - display: none; - float: left; - margin: 0; - position: absolute; - top: 3.333em; - left: 0; - width: 188px; - z-index: 99999; -} -#access ul ul ul { - left: 100%; - top: 0; -} -#access ul ul a { - background: #f9f9f9; - border-bottom: 1px dotted #ddd; - color: #444; - font-size: 13px; - font-weight: normal; - height: auto; - line-height: 1.4em; - padding: 10px 10px; - width: 168px; -} -#access li:hover > a, -#access ul ul :hover > a, -#access a:focus { - background: #efefef; -} -#access li:hover > a, -#access a:focus { - background: #f9f9f9; /* Show a solid color for older browsers */ - background: -moz-linear-gradient(#f9f9f9, #e5e5e5); - background: -o-linear-gradient(#f9f9f9, #e5e5e5); - background: -webkit-gradient(linear, 0% 0%, 0% 100%, from(#f9f9f9), to(#e5e5e5)); /* Older webkit syntax */ - background: -webkit-linear-gradient(#f9f9f9, #e5e5e5); - color: #373737; -} -#access ul li:hover > ul { - display: block; -} -#access .current-menu-item > a, -#access .current-menu-ancestor > a, -#access .current_page_item > a, -#access .current_page_ancestor > a { - font-weight: bold; -} - -/* Search Form */ -#branding #searchform { - position: absolute; - top: 3.8em; - right: 7.6%; - text-align: right; -} -#branding #searchform div { - margin: 0; -} -#branding #s { - float: right; - -webkit-transition-duration: 400ms; - -webkit-transition-property: width, background; - -webkit-transition-timing-function: ease; - -moz-transition-duration: 400ms; - -moz-transition-property: width, background; - -moz-transition-timing-function: ease; - -o-transition-duration: 400ms; - -o-transition-property: width, background; - -o-transition-timing-function: ease; - width: 72px; -} -#branding #s:focus { - background-color: #f9f9f9; - width: 196px; -} -#branding #searchsubmit { - display: none; -} -#branding .only-search #searchform { - top: 5px; - z-index: 1; -} -#branding .only-search #s { - background-color: #666; - border-color: #000; - color: #222; -} -#branding .only-search #s, -#branding .only-search #s:focus { - width: 85%; -} -#branding .only-search #s:focus { - background-color: #bbb; -} -#branding .with-image #searchform { - top: auto; - bottom: -27px; - max-width: 195px; -} -#branding .only-search + #access div { - padding-right: 205px; -} - - -/* =Content ------------------------------------------------ */ - -#main { - clear: both; - padding: 1.625em 0 0; -} -.page-title { - color: #666; - font-size: 10px; - font-weight: 500; - letter-spacing: 0.1em; - line-height: 2.6em; - margin: 0 0 2.6em; - text-transform: uppercase; -} -.page-title a { - font-size: 12px; - font-weight: bold; - letter-spacing: 0; - text-transform: none; -} -.hentry, -.no-results { - border-bottom: 1px solid #ddd; - margin: 0 0 1.625em; - padding: 0 0 1.625em; - position: relative; -} -.hentry:last-child, -.no-results { - border-bottom: none; -} -.blog .sticky .entry-header .entry-meta { - clip: rect(1px 1px 1px 1px); /* IE6, IE7 */ - clip: rect(1px, 1px, 1px, 1px); - position: absolute !important; -} -.entry-title, -.entry-header .entry-meta { - padding-right: 76px; -} -.entry-title { - clear: both; - color: #222; - font-size: 26px; - font-weight: bold; - line-height: 1.5em; - padding-bottom: .3em; - padding-top: 15px; -} -.entry-title, -.entry-title a { - color: #222; - text-decoration: none; -} -.entry-title a:hover, -.entry-title a:focus, -.entry-title a:active { - color: #1982d1; -} -.entry-meta { - color: #666; - clear: both; - font-size: 12px; - line-height: 18px; -} -.entry-meta a { - font-weight: bold; -} -.single-author .entry-meta .by-author { - display: none; -} -.entry-content, -.entry-summary { - padding: 1.625em 0 0; -} -.entry-content h1, -.entry-content h2, -.comment-content h1, -.comment-content h2 { - color: #000; - font-weight: bold; -} -.entry-content h3, -.comment-content h3 { - font-size: 10px; - letter-spacing: 0.1em; - line-height: 2.6em; - text-transform: uppercase; -} -.entry-content table, -.comment-content table { - border-bottom: 1px solid #ddd; - margin: 0 0 1.625em; - width: 100%; -} -.entry-content th, -.comment-content th { - color: #666; - font-size: 10px; - font-weight: 500; - letter-spacing: 0.1em; - line-height: 2.6em; - text-transform: uppercase; -} -.entry-content td, -.comment-content td { - border-top: 1px solid #ddd; - padding: 6px 10px 6px 0; -} -.entry-content #s { - width: 75%; -} -.comment-content ul, -.comment-content ol { - margin-bottom: 1.625em; -} -.comment-content ul ul, -.comment-content ol ol, -.comment-content ul ol, -.comment-content ol ul { - margin-bottom: 0; -} -dl.gallery-item { - margin: 0; -} -.page-link { - clear: both; - display: block; - margin: 0 0 1.625em; -} -.page-link a { - background: #eee; - color: #373737; - margin: 0; - padding: 2px 3px; - text-decoration: none; -} -.page-link a:hover { - background: #888; - color: #fff; - font-weight: bold; -} -.page-link span { - margin-right: 6px; -} -.entry-meta .edit-link a, -.commentlist .edit-link a { - background: #eee; - -moz-border-radius: 3px; - border-radius: 3px; - color: #666; - float: right; - font-size: 12px; - line-height: 1.5em; - font-weight: 300; - text-decoration: none; - padding: 0 8px; -} -.entry-meta .edit-link a:hover, -.commentlist .edit-link a:hover { - background: #888; - color: #fff; -} -.entry-content .edit-link { - clear: both; - display: block; -} - -/* Images */ -.entry-content img, -.comment-content img, -.widget img { - max-width: 97.5%; /* Fluid images for posts, comments, and widgets */ -} -img[class*="align"], -img[class*="wp-image-"], -img[class*="attachment-"] { - height: auto; /* Make sure images with WordPress-added height and width attributes are scaled correctly */ -} -img.size-full, -img.size-large { - max-width: 97.5%; - width: auto; /* Prevent stretching of full-size and large-size images with height and width attributes in IE8 */ - height: auto; /* Make sure images with WordPress-added height and width attributes are scaled correctly */ -} -.entry-content img.wp-smiley { - border: none; - margin-bottom: 0; - margin-top: 0; - padding: 0; -} -img.alignleft, -img.alignright, -img.aligncenter { - margin-bottom: 1.625em; -} -p img, -.wp-caption { - margin-top: 0.4em; -} -.wp-caption { - background: #eee; - margin-bottom: 1.625em; - max-width: 96%; - padding: 9px; -} -.wp-caption img { - display: block; - margin: 0 auto; - max-width: 98%; -} -.wp-caption .wp-caption-text, -.gallery-caption { - color: #666; - font-family: Georgia, serif; - font-size: 12px; -} -.wp-caption .wp-caption-text { - margin-bottom: 0.6em; - padding: 10px 0 5px 40px; - position: relative; -} -.wp-caption .wp-caption-text:before { - color: #666; - content: '\2014'; - font-size: 14px; - font-style: normal; - font-weight: bold; - margin-right: 5px; - position: absolute; - left: 10px; - top: 7px; -} -#content .gallery { - margin: 0 auto 1.625em; -} -#content .gallery a img { - border: none; -} -img#wpstats { - display: block; - margin: 0 auto 1.625em; -} -#content .gallery-columns-4 .gallery-item { - width: 23%; - padding-right: 2%; -} -#content .gallery-columns-4 .gallery-item img { - width: 100%; - height: auto; -} - -/* Image borders */ -img[class*="align"], -img[class*="wp-image-"], -#content .gallery .gallery-icon img {/* Add fancy borders to all WordPress-added images but not things like badges and icons and the like */ - border: 1px solid #ddd; - padding: 6px; -} -.wp-caption img { - border-color: #eee; -} -a:focus img[class*="align"], -a:hover img[class*="align"], -a:active img[class*="align"], -a:focus img[class*="wp-image-"], -a:hover img[class*="wp-image-"], -a:active img[class*="wp-image-"], -#content .gallery .gallery-icon a:focus img, -#content .gallery .gallery-icon a:hover img, -#content .gallery .gallery-icon a:active img {/* Add some useful style to those fancy borders for linked images ... */ - background: #eee; - border-color: #bbb; -} -.wp-caption a:focus img, -.wp-caption a:active img, -.wp-caption a:hover img {/* ... including captioned images! */ - background: #fff; - border-color: #ddd; -} - -/* Make sure embeds and iframes fit their containers */ -embed, -iframe, -object { - max-width: 100%; -} - -/* Password Protected Posts */ -.post-password-required .entry-header .comments-link { - margin: 1.625em 0 0; -} -.post-password-required input[type=password] { - margin: 0.8125em 0; -} -.post-password-required input[type=password]:focus { - background: #f7f7f7; -} - -/* Author Info */ -#author-info { - font-size: 12px; - overflow: hidden; -} -.singular #author-info { - background: #f9f9f9; - border-top: 1px solid #ddd; - border-bottom: 1px solid #ddd; - margin: 2.2em -35.6% 0 -35.4%; - padding: 20px 35.4%; -} -.archive #author-info { - border-bottom: 1px solid #ddd; - margin: 0 0 2.2em; - padding: 0 0 2.2em; -} -#author-avatar { - float: left; - margin-right: -78px; -} -#author-avatar img { - background: #fff; - -moz-border-radius: 3px; - border-radius: 3px; - -webkit-box-shadow: 0 1px 2px #bbb; - -moz-box-shadow: 0 1px 2px #bbb; - box-shadow: 0 1px 2px #bbb; - padding: 3px; -} -#author-description { - float: left; - margin-left: 108px; -} -#author-description h2 { - color: #000; - font-size: 15px; - font-weight: bold; - margin: 5px 0 10px; -} - -/* Comments link */ -.entry-header .comments-link a { - background: #eee url(images/comment-bubble.png) no-repeat; - color: #666; - font-size: 13px; - font-weight: normal; - line-height: 35px; - overflow: hidden; - padding: 0 0 0; - position: absolute; - top: 1.5em; - right: 0; - text-align: center; - text-decoration: none; - width: 43px; - height: 36px; -} -.entry-header .comments-link a:hover, -.entry-header .comments-link a:focus, -.entry-header .comments-link a:active { - background-color: #1982d1; - color: #fff; - color: rgba(255,255,255,0.8); -} -.entry-header .comments-link .leave-reply { - visibility: hidden; -} - -/* -Post Formats Headings -To hide the headings, display: none the ".entry-header .entry-format" selector, -and remove the padding rules below. -*/ -.entry-header .entry-format { - color: #666; - font-size: 10px; - font-weight: 500; - letter-spacing: 0.1em; - line-height: 2.6em; - position: absolute; - text-transform: uppercase; - top: -5px; -} -.entry-header hgroup .entry-title { - padding-top: 15px; -} -article.format-aside .entry-content, -article.format-link .entry-content, -article.format-status .entry-content { - padding: 20px 0 0; -} -article.format-status .entry-content { - min-height: 65px; -} -.recent-posts .entry-header .entry-format { - display: none; -} -.recent-posts .entry-header hgroup .entry-title { - padding-top: 0; -} - -/* Singular content styles for Posts and Pages */ -.singular .hentry { - border-bottom: none; - padding: 4.875em 0 0; - position: relative; -} -.singular.page .hentry { - padding: 3.5em 0 0; -} -.singular .entry-title { - color: #000; - font-size: 36px; - font-weight: bold; - line-height: 48px; -} -.singular .entry-title, -.singular .entry-header .entry-meta { - padding-right: 0; -} -.singular .entry-header .entry-meta { - position: absolute; - top: 0; - left: 0; -} -blockquote.pull { - font-size: 21px; - font-weight: bold; - line-height: 1.6125em; - margin: 0 0 1.625em; - text-align: center; -} -.singular blockquote.pull { - margin: 0 -22.25% 1.625em; -} -.pull.alignleft { - margin: 0 1.625em 0 0; - text-align: right; - width: 33%; -} -.singular .pull.alignleft { - margin: 0 1.625em 0 -22.25%; -} -.pull.alignright { - margin: 0 0 0 1.625em; - text-align: left; - width: 33%; -} -.singular .pull.alignright { - margin: 0 -22.25% 0 1.625em; -} -.singular blockquote.pull.alignleft, -.singular blockquote.pull.alignright { - width: 33%; -} -.singular .entry-meta .edit-link a { - bottom: auto; - left: 50px; - position: absolute; - right: auto; - top: 80px; -} - - -/* =Aside ------------------------------------------------ */ - -.format-aside .entry-title, -.format-aside .entry-header .comments-link { - display: none; -} -.singular .format-aside .entry-title { - display: block; -} -.format-aside .entry-content { - padding: 0; -} -.singular .format-aside .entry-content { - padding: 1.625em 0 0; -} - - -/* =Link ------------------------------------------------ */ - -.format-link .entry-title, -.format-link .entry-header .comments-link { - display: none; -} -.singular .format-link .entry-title { - display: block; -} -.format-link .entry-content { - padding: 0; -} -.singular .format-link .entry-content { - padding: 1.625em 0 0; -} - - -/* =Gallery ------------------------------------------------ */ - -.format-gallery .gallery-thumb { - float: left; - display: block; - margin: .375em 1.625em 0 0; -} - - -/* =Status ------------------------------------------------ */ - -.format-status .entry-title, -.format-status .entry-header .comments-link { - display: none; -} -.singular .format-status .entry-title { - display: block; -} -.format-status .entry-content { - padding: 0; -} -.singular .format-status .entry-content { - padding: 1.625em 0 0; -} -.format-status img.avatar { - -moz-border-radius: 3px; - border-radius: 3px; - -webkit-box-shadow: 0 1px 2px #ccc; - -moz-box-shadow: 0 1px 2px #ccc; - box-shadow: 0 1px 2px #ccc; - float: left; - margin: 4px 10px 2px 0; - padding: 0; -} - - -/* =Quote ------------------------------------------------ */ - -.format-quote blockquote { - color: #555; - font-size: 17px; - margin: 0; -} - - -/* =Image ------------------------------------------------ */ - -.indexed.format-image .entry-header { - min-height: 61px; /* Prevent the comment icon from colliding with the image when there is no title */ -} -.indexed.format-image .entry-content { - padding-top: 0.5em; -} -.indexed.format-image p, -.indexed.format-image p img { - margin-bottom: 0; -} -.indexed.format-image footer.entry-meta { - background: #ddd; - margin-top: -7px; - padding: 20px 30px; - overflow: hidden; -} -.indexed.format-image div.entry-meta { - display: inline-block; - float: left; - width: 35%; -} -.indexed.format-image div.entry-meta + div.entry-meta { - float: none; - width: 65%; -} -.indexed.format-image .entry-meta span.cat-links, -.indexed.format-image .entry-meta span.tag-links, -.indexed.format-image .entry-meta span.comments-link { - display: block; -} -.indexed.format-image footer.entry-meta a { - color: #444; -} -.indexed.format-image footer.entry-meta a:hover { - color: #fff; -} -#content .indexed.format-image img { - border: none; - max-width: 100%; - padding: 0; -} -.indexed.format-image .wp-caption { - background: #111; - margin-bottom: 0; - max-width: 96%; - padding: 11px; -} -.indexed.format-image .wp-caption .wp-caption-text { - color: #ddd; -} -.indexed.format-image .wp-caption .wp-caption-text:before { - color: #444; -} -.indexed.format-image a:hover img { - opacity: 0.8; -} - - -/* =error404 ------------------------------------------------ */ - -.error404 #main #searchform { - background: #f9f9f9; - border: 1px solid #ddd; - border-width: 1px 0; - margin: 0 -8.9% 1.625em; - overflow: hidden; - padding: 1.625em 8.9%; -} -.error404 #main #s { - width: 95%; -} -.error404 #main .widget { - clear: none; - float: left; - margin-right: 3.7%; - width: 30.85%; -} -.error404 #main .widget_archive { - margin-right: 0; -} -.error404 #main .widget_tag_cloud { - float: none; - margin-right: 0; - width: 100%; -} -.error404 .widgettitle { - font-size: 10px; - letter-spacing: 0.1em; - line-height: 2.6em; - text-transform: uppercase; -} - - -/* =Showcase ------------------------------------------------ */ - -h1.showcase-heading { - color: #666; - font-size: 10px; - font-weight: 500; - letter-spacing: 0.1em; - line-height: 2.6em; - text-transform: uppercase; -} - -/* Intro */ -article.intro { - background: #f9f9f9; - border-bottom: none; - margin: -1.855em -8.9% 1.625em; - padding: 0 8.9%; -} -article.intro .entry-title { - display: none; -} -article.intro .entry-content { - color: #111; - font-size: 16px; - padding: 1.625em 0 0.625em; -} -article.intro .edit-link a { - background: #aaa; - -moz-border-radius: 3px; - border-radius: 3px; - color: #fff; - font-size: 12px; - padding: 0 8px; - position: absolute; - top: 30px; - right: 20px; - text-decoration: none; -} -article.intro .edit-link a:hover, -article.intro .edit-link a:focus, -article.intro .edit-link a:active { - background: #777; -} - -/* Featured post */ -section.featured-post { - float: left; - margin: -1.625em -8.9% 1.625em; - padding: 1.625em 8.9% 0; - position: relative; - width: 100%; -} -section.featured-post .hentry { - border: none; - color: #666; - margin: 0; -} -section.featured-post .entry-meta { - clip: rect(1px 1px 1px 1px); /* IE6, IE7 */ - clip: rect(1px, 1px, 1px, 1px); - position: absolute !important; -} - -/* Small featured post */ -section.featured-post .attachment-small-feature { - float: right; - height: auto; - margin: 0 -8.9% 1.625em 0; - max-width: 59%; - position: relative; - right: -15px; -} -section.featured-post.small { - padding-top: 0; -} -section.featured-post .attachment-small-feature:hover, -section.featured-post .attachment-small-feature:focus, -section.featured-post .attachment-small-feature:active { - opacity: .8; -} -article.feature-image.small { - float: left; - margin: 0 0 1.625em; - width: 45%; -} -article.feature-image.small .entry-title { - line-height: 1.2em; -} -article.feature-image.small .entry-summary { - color: #555; - font-size: 13px; -} -article.feature-image.small .entry-summary p a { - background: #222; - color: #eee; - display: block; - left: -23.8%; - padding: 9px 26px 9px 85px; - position: relative; - text-decoration: none; - top: 20px; - width: 180px; - z-index: 1; -} -article.feature-image.small .entry-summary p a:hover { - background: #1982d1; - color: #eee; - color: rgba(255,255,255,0.8); -} - -/* Large featured post */ -section.feature-image.large { - border: none; - max-height: 288px; - padding: 0; - width: 100%; -} -section.feature-image.large .showcase-heading { - display: none; -} -section.feature-image.large .hentry { - border-bottom: none; - left: 9%; - margin: 1.625em 9% 0 0; - position: absolute; - top: 0; -} -article.feature-image.large .entry-title a { - background: #222; - background: rgba(0,0,0,0.8); - -moz-border-radius: 3px; - border-radius: 3px; - color: #fff; - display: inline-block; - font-weight: 300; - padding: .2em 20px; -} -section.feature-image.large:hover .entry-title a, -section.feature-image.large .entry-title:hover a { - background: #eee; - background: rgba(255,255,255,0.8); - color: #222; -} -article.feature-image.large .entry-summary { - display: none; -} -section.feature-image.large img { - display: block; - height: auto; - max-width: 117.9%; - padding: 0 0 6px; -} - -/* Featured Slider */ -.featured-posts { - border-bottom: 1px solid #ddd; - display: block; - height: 328px; - margin: 1.625em -8.9% 20px; - max-width: 1000px; - padding: 0; - position: relative; - overflow: hidden; -} -.featured-posts .showcase-heading { - padding-left: 8.9%; -} -.featured-posts section.featured-post { - background: #fff; - height: 288px; - left: 0; - margin: 0; - position: absolute; - top: 30px; - width: auto; -} -.featured-posts section.featured-post.large { - max-width: 100%; - overflow: hidden; -} -.featured-posts section.featured-post { - -webkit-transition-duration: 200ms; - -webkit-transition-property: opacity, visibility; - -webkit-transition-timing-function: ease; - -moz-transition-duration: 200ms; - -moz-transition-property: opacity, visibility; - -moz-transition-timing-function: ease; -} -.featured-posts section.featured-post { - opacity: 0; - visibility: hidden; -} -.featured-posts #featured-post-1 { - opacity: 1; - visibility: visible; -} -.featured-post .feature-text:after, -.featured-post .feature-image.small:after { - content: ' '; - background: -moz-linear-gradient(top, rgba(255,255,255,0) 0%, rgba(255,255,255,1) 100%); /* FF3.6+ */ - background: -webkit-gradient(linear, left top, left bottom, color-stop(0%,rgba(255,255,255,0)), color-stop(100%,rgba(255,255,255,1))); /* Chrome,Safari4+ */ - background: -webkit-linear-gradient(top, rgba(255,255,255,0) 0%,rgba(255,255,255,1) 100%); /* Chrome10+,Safari5.1+ */ - background: -o-linear-gradient(top, rgba(255,255,255,0) 0%,rgba(255,255,255,1) 100%); /* Opera11.10+ */ - background: -ms-linear-gradient(top, rgba(255,255,255,0) 0%,rgba(255,255,255,1) 100%); /* IE10+ */ - filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#00ffffff', endColorstr='#ffffff',GradientType=0 ); /* IE6-9 */ - background: linear-gradient(top, rgba(255,255,255,0) 0%,rgba(255,255,255,1) 100%); /* W3C */ - width: 100%; - height: 45px; - position: absolute; - top: 230px; -} -.featured-post .feature-image.small:after { - top: 253px; -} -#content .feature-slider { - top: 5px; - right: 8.9%; - overflow: visible; - position: absolute; -} -.feature-slider ul { - list-style-type: none; - margin: 0; -} -.feature-slider li { - float: left; - margin: 0 6px; -} -.feature-slider a { - background: #3c3c3c; - background: rgba(60,60,60,0.9); - -moz-border-radius: 12px; - border-radius: 12px; - -webkit-box-shadow: inset 1px 1px 5px rgba(0,0,0,0.5), inset 0 0 2px rgba(255,255,255,0.5); - -moz-box-shadow: inset 1px 1px 5px rgba(0,0,0,0.5), inset 0 0 2px rgba(255,255,255,0.5); - box-shadow: inset 1px 1px 5px rgba(0,0,0,0.5), inset 0 0 2px rgba(255,255,255,0.5); - display: block; - width: 14px; - height: 14px; -} -.feature-slider a.active { - background: #1982d1; - -webkit-box-shadow: inset 1px 1px 5px rgba(0,0,0,0.4), inset 0 0 2px rgba(255,255,255,0.8); - -moz-box-shadow: inset 1px 1px 5px rgba(0,0,0,0.4), inset 0 0 2px rgba(255,255,255,0.8); - box-shadow: inset 1px 1px 5px rgba(0,0,0,0.4), inset 0 0 2px rgba(255,255,255,0.8); - cursor: default; - opacity: 0.5; -} - -/* Recent Posts */ -section.recent-posts { - padding: 0 0 1.625em; -} -section.recent-posts .hentry { - border: none; - margin: 0; -} -section.recent-posts .other-recent-posts { - border-bottom: 1px solid #ddd; - list-style: none; - margin: 0; -} -section.recent-posts .other-recent-posts li { - padding: 0.3125em 0; - position: relative; -} -section.recent-posts .other-recent-posts .entry-title { - border-top: 1px solid #ddd; - font-size: 17px; -} -section.recent-posts .other-recent-posts a[rel="bookmark"] { - color: #373737; - float: left; - max-width: 84%; -} -section.recent-posts .other-recent-posts a[rel="bookmark"]:after { - content: '-'; - color: transparent; - font-size: 11px; -} -section.recent-posts .other-recent-posts a[rel="bookmark"]:hover { -} -section.recent-posts .other-recent-posts .comments-link a, -section.recent-posts .other-recent-posts .comments-link > span { - border-bottom: 2px solid #999; - bottom: -2px; - color: #444; - display: block; - font-size: 10px; - font-weight: 500; - line-height: 2.76333em; - padding: 0.3125em 0 0.3125em 1em; - position: absolute; - right: 0; - text-align: right; - text-transform: uppercase; - z-index: 1; -} -section.recent-posts .other-recent-posts .comments-link > span { - border-color: #bbb; - color: #888; -} -section.recent-posts .other-recent-posts .comments-link a:hover { - color: #1982d1; - border-color: #1982d1; -} -section.recent-posts .other-recent-posts li:after { - clear: both; - content: '.'; - display: block; - height: 0; - visibility: hidden; -} - - -/* =Attachments ------------------------------------------------ */ - -.image-attachment div.attachment { - background: #f9f9f9; - border: 1px solid #ddd; - border-width: 1px 0; - margin: 0 -8.9% 1.625em; - overflow: hidden; - padding: 1.625em 1.625em 0; - text-align: center; -} -.image-attachment div.attachment img { - display: block; - height: auto; - margin: 0 auto 1.625em; - max-width: 100%; -} -.image-attachment div.attachment a img { - border-color: #f9f9f9; -} -.image-attachment div.attachment a:focus img, -.image-attachment div.attachment a:hover img, -.image-attachment div.attachment a:active img { - border-color: #ddd; - background: #fff; -} -.image-attachment .entry-caption p { - font-size: 10px; - letter-spacing: 0.1em; - line-height: 2.6em; - margin: 0 0 2.6em; - text-transform: uppercase; -} - - -/* =Navigation --------------------------------------------------------------- */ - -#content nav { - clear: both; - overflow: hidden; - padding: 0 0 1.625em; -} -#content nav a { - font-size: 12px; - font-weight: bold; - line-height: 2.2em; -} -#nav-above { - padding: 0 0 1.625em; -} -#nav-above { - display: none; -} -.paged #nav-above { - display: block; -} -.nav-previous { - float: left; - width: 50%; -} -.nav-next { - float: right; - text-align: right; - width: 50%; -} -#content nav .meta-nav { - font-weight: normal; -} - -/* Singular navigation */ -#nav-single { - float: right; - position: relative; - top: -0.3em; - text-align: right; - z-index: 1; -} -#nav-single .nav-previous, -#nav-single .nav-next { - float: none; - width: auto; -} -#nav-single .nav-next { - padding-left: .5em; -} - - -/* =Widgets ------------------------------------------------ */ - -.widget-area { - font-size: 12px; -} -.widget { - clear: both; - margin: 0 0 2.2em; -} -.widget-title { - color: #666; - font-size: 10px; - font-weight: 500; - letter-spacing: 0.1em; - line-height: 2.6em; - text-transform: uppercase; -} -.widget ul { - font-size: 15px; - margin: 0; -} -.widget ul ul { - margin-left: 1.5em; -} -.widget ul li { - color: #777; - font-size: 13px; -} -.widget a { - font-weight: bold; - text-decoration: none; -} -.widget a:hover, -.widget a:focus, -.widget a:active { - text-decoration: underline; -} - -/* Search Widget */ -.widget_search form { - margin: 0 0 1.625em; -} -.widget_search #s { - width: 77%; -} -.widget_search #searchsubmit { - background: #ddd; - border: 1px solid #ccc; - -webkit-box-shadow: inset 0px -1px 1px rgba(0, 0, 0, 0.09); - -moz-box-shadow: inset 0px -1px 1px rgba(0, 0, 0, 0.09); - box-shadow: inset 0px -1px 1px rgba(0, 0, 0, 0.09); - color: #888; - font-size: 13px; - line-height: 25px; - position: relative; - top: -2px; -} -.widget_search #searchsubmit:active { - background: #1982d1; - border-color: #0861a5; - -webkit-box-shadow: inset 0px 1px 1px rgba(0, 0, 0, 0.1); - -moz-box-shadow: inset 0px 1px 1px rgba(0, 0, 0, 0.1); - box-shadow: inset 0px 1px 1px rgba(0, 0, 0, 0.1); - color: #bfddf3; -} - -/* Ephemera Widget */ -section.ephemera ol, -.widget_twentyeleven_ephemera ol { - list-style: square; - margin: 5px 0 0; -} -.widget_twentyeleven_ephemera .widget-entry-title { - font-size: 15px; - font-weight: bold; - padding: 0; -} -.widget_twentyeleven_ephemera .comments-link a, -.widget_twentyeleven_ephemera .comments-link > span { - color: #666; - display: block; - font-size: 10px; - font-weight: 500; - line-height: 2.76333em; - text-transform: uppercase; -} -section.ephemera .entry-title .comments-link a:hover, -.widget_twentyeleven_ephemera .entry-title .comments-link a:hover { -} -section.ephemera .entry-title a span { - color: #29628d; -} - -/* Twitter */ -.widget_twitter li { - list-style-type: none; - margin-bottom: 14px; -} -.widget_twitter .timesince { - display: block; - font-size: 11px; - margin-right: -10px; - text-align: right; -} - -/* Widget Image */ -.widget_image img { - height: auto; - max-width: 100%; -} - -/* Calendar Widget */ - -.widget_calendar #wp-calendar { - color: #555; - width: 95%; - text-align: center; -} -.widget_calendar #wp-calendar caption, -.widget_calendar #wp-calendar td, -.widget_calendar #wp-calendar th { - text-align: center; -} -.widget_calendar #wp-calendar caption { - font-size: 11px; - font-weight: 500; - padding: 5px 0 3px 0; - text-transform: uppercase; -} -.widget_calendar #wp-calendar th { - background: #f4f4f4; - border-top: 1px solid #ccc; - border-bottom: 1px solid #ccc; - font-weight: bold; -} -.widget_calendar #wp-calendar tfoot td { - background: #f4f4f4; - border-top: 1px solid #ccc; - border-bottom: 1px solid #ccc; -} - - -/* =Comments ------------------------------------------------ */ - -#comments-title { - color: #666; - font-size: 10px; - font-weight: 500; - line-height: 2.6em; - padding: 0 0 2.6em; - text-transform: uppercase; -} -.nopassword, -.nocomments { - color: #aaa; - font-size: 24px; - font-weight: 100; - margin: 26px 0; - text-align: center; -} -.commentlist { - list-style: none; - margin: 0 auto; - width: 68.9%; -} -.content .commentlist, -.page-template-sidebar-page-php .commentlist { - width: 100%; /* reset the width for the one-column and sidebar page layout */ -} -.commentlist > li.comment { - background: #f6f6f6; - border: 1px solid #ddd; - -moz-border-radius: 3px; - border-radius: 3px; - margin: 0 0 1.625em; - padding: 1.625em; - position: relative; -} -.commentlist .pingback { - margin: 0 0 1.625em; - padding: 0 1.625em; -} -.commentlist .children { - list-style: none; - margin: 0; -} -.commentlist .children li.comment { - background: #fff; - border-left: 1px solid #ddd; - -moz-border-radius: 0 3px 3px 0; - border-radius: 0 3px 3px 0; - margin: 1.625em 0 0; - padding: 1.625em; - position: relative; -} -.commentlist .children li.comment .fn { - display: block; -} -.comment-meta .fn { - font-style: normal; -} -.comment-meta { - color: #666; - font-size: 12px; - line-height: 2.2em; -} -.commentlist .children li.comment .comment-meta { - line-height: 1.625em; - margin-left: 50px; -} -.commentlist .children li.comment .comment-content { - margin: 1.625em 0 0; -} -.comment-meta a { - font-weight: bold; -} -.comment-meta a:focus, -.comment-meta a:active, -.comment-meta a:hover { -} -.commentlist .avatar { - -moz-border-radius: 3px; - border-radius: 3px; - -webkit-box-shadow: 0 1px 2px #ccc; - -moz-box-shadow: 0 1px 2px #ccc; - box-shadow: 0 1px 2px #ccc; - left: -102px; - padding: 0; - position: absolute; - top: 0; -} -.commentlist > li:before { - content: url(images/comment-arrow.png); - left: -21px; - position: absolute; -} -.commentlist > li.pingback:before { - content: ''; -} -.commentlist .children .avatar { - background: none; - -webkit-box-shadow: none; - -moz-box-shadow: none; - box-shadow: none; - left: 2.2em; - padding: 0; - top: 2.2em; -} -a.comment-reply-link { - background: #eee; - -moz-border-radius: 3px; - border-radius: 3px; - color: #666; - display: inline-block; - font-size: 12px; - padding: 0 8px; - text-decoration: none; -} -a.comment-reply-link:hover, -a.comment-reply-link:focus, -a.comment-reply-link:active { - background: #888; - color: #fff; -} -a.comment-reply-link > span { - display: inline-block; - position: relative; - top: -1px; -} - -/* Post author highlighting */ -.commentlist > li.bypostauthor { - background: #ddd; - border-color: #d3d3d3; -} -.commentlist > li.bypostauthor .comment-meta { - color: #575757; -} -.commentlist > li.bypostauthor .comment-meta a:focus, -.commentlist > li.bypostauthor .comment-meta a:active, -.commentlist > li.bypostauthor .comment-meta a:hover { -} -.commentlist > li.bypostauthor:before { - content: url(images/comment-arrow-bypostauthor.png); -} - -/* Post Author threaded comments */ -.commentlist .children > li.bypostauthor { - background: #ddd; - border-color: #d3d3d3; -} - -/* sidebar-page.php comments */ -/* Make sure we have room for our comment avatars */ -.page-template-sidebar-page-php .commentlist > li.comment, -.page-template-sidebar-page-php.commentlist .pingback { - margin-left: 102px; - width: auto; -} -/* And a full-width comment form */ -.page-template-sidebar-page-php #respond { - width: auto; -} - -/* Comment Form */ -#respond { - background: #ddd; - border: 1px solid #d3d3d3; - -moz-border-radius: 3px; - border-radius: 3px; - margin: 0 auto 1.625em; - padding: 1.625em; - position: relative; - width: 68.9%; -} -#respond input[type="text"], -#respond textarea { - background: #fff; - border: 4px solid #eee; - -moz-border-radius: 5px; - border-radius: 5px; - -webkit-box-shadow: inset 0 1px 3px rgba(204,204,204,0.95); - -moz-box-shadow: inset 0 1px 3px rgba(204,204,204,0.95); - box-shadow: inset 0 1px 3px rgba(204,204,204,0.95); - position: relative; - padding: 10px; - text-indent: 80px; -} -#respond .comment-form-author, -#respond .comment-form-email, -#respond .comment-form-url, -#respond .comment-form-comment { - position: relative; -} -#respond .comment-form-author label, -#respond .comment-form-email label, -#respond .comment-form-url label, -#respond .comment-form-comment label { - background: #eee; - -webkit-box-shadow: 1px 2px 2px rgba(204,204,204,0.8); - -moz-box-shadow: 1px 2px 2px rgba(204,204,204,0.8); - box-shadow: 1px 2px 2px rgba(204,204,204,0.8); - color: #555; - display: inline-block; - font-size: 13px; - left: 4px; - min-width: 60px; - padding: 4px 10px; - position: relative; - top: 40px; - z-index: 1; -} -#respond input[type="text"]:focus, -#respond textarea:focus { - text-indent: 0; - z-index: 1; -} -#respond textarea { - resize: vertical; - width: 95%; -} -#respond .comment-form-author .required, -#respond .comment-form-email .required { - color: #bd3500; - font-size: 22px; - font-weight: bold; - left: 75%; - position: absolute; - top: 45px; - z-index: 1; -} -#respond .comment-notes, -#respond .logged-in-as { - font-size: 13px; -} -#respond p { - margin: 10px 0; -} -#respond .form-submit { - float: right; - margin: -20px 0 10px; -} -#respond input#submit { - background: #222; - border: none; - -moz-border-radius: 3px; - border-radius: 3px; - -webkit-box-shadow: 0px 1px 2px rgba(0,0,0,0.3); - -moz-box-shadow: 0px 1px 2px rgba(0,0,0,0.3); - box-shadow: 0px 1px 2px rgba(0,0,0,0.3); - color: #eee; - cursor: pointer; - font-size: 15px; - margin: 20px 0; - padding: 5px 42px 5px 22px; - position: relative; - left: 30px; - text-shadow: 0 -1px 0 rgba(0,0,0,0.3); -} -#respond input#submit:active { - background: #1982d1; - color: #bfddf3; -} -#respond #cancel-comment-reply-link { - color: #666; - margin-left: 10px; - text-decoration: none; -} -#respond .logged-in-as a:hover, -#respond #cancel-comment-reply-link:hover { - text-decoration: underline; -} -.commentlist #respond { - margin: 1.625em 0 0; - width: auto; -} -#reply-title { - color: #373737; - font-size: 24px; - font-weight: bold; - line-height: 30px; -} -#cancel-comment-reply-link { - color: #888; - display: block; - font-size: 10px; - font-weight: normal; - line-height: 2.2em; - letter-spacing: 0.05em; - position: absolute; - right: 1.625em; - text-decoration: none; - text-transform: uppercase; - top: 1.1em; -} -#cancel-comment-reply-link:focus, -#cancel-comment-reply-link:active, -#cancel-comment-reply-link:hover { - color: #ff4b33; -} -#respond label { - line-height: 2.2em; -} -#respond input[type=text] { - display: block; - height: 24px; - width: 75%; -} -#respond p { - font-size: 12px; -} -p.comment-form-comment { - margin: 0; -} -.form-allowed-tags { - display: none; -} - - -/* =Footer ------------------------------------------------ */ - -#colophon { - clear: both; -} -#supplementary { - border-top: 1px solid #ddd; - padding: 1.625em 7.6%; - overflow: hidden; -} - -/* Two Footer Widget Areas */ -#supplementary.two .widget-area { - float: left; - margin-right: 3.7%; - width: 48.1%; -} -#supplementary.two .widget-area + .widget-area { - margin-right: 0; -} - -/* Three Footer Widget Areas */ -#supplementary.three .widget-area { - float: left; - margin-right: 3.7%; - width: 30.85%; -} -#supplementary.three .widget-area + .widget-area + .widget-area { - margin-right: 0; -} - -/* Site Generator Line */ -#site-generator { - background: #f9f9f9; - border-top: 1px solid #ddd; - color: #666; - font-size: 12px; - line-height: 2.2em; - padding: 2.2em 0.5em; - text-align: center; -} -#site-generator a { - color: #555; - font-weight: bold; -} -#site-generator .sep { - background: url(images/wordpress.png) center left no-repeat; - color: transparent; - display: inline-block; - height: 16px; - line-height: 16px; - margin: 0 7px; - width: 16px; -} - - -/* =Responsive Structure ------------------------------------------------ */ - -@media (max-width: 800px) { - /* Simplify the basic layout */ - #main #content { - margin: 0 7.6%; - width: auto; - } - #nav-below { - border-bottom: 1px solid #ddd; - margin-bottom: 1.625em; - } - #main #secondary { - float: none; - margin: 0 7.6%; - width: auto; - } - /* Simplify the showcase template */ - .page-template-showcase-php .featured-posts { - min-height: 280px; - } - .featured-posts section.featured-post { - height: auto; - } - .page-template-showcase-php section.recent-posts { - float: none; - margin: 0; - width: 100%; - } - .page-template-showcase-php #main .widget-area { - float: none; - margin: 0; - width: auto; - } - .page-template-showcase-php .other-recent-posts { - border-bottom: 1px solid #ddd; - } - /* Simplify the showcase template when small feature */ - section.featured-post .attachment-small-feature, - .one-column section.featured-post .attachment-small-feature { - border: none; - display: block; - float: left; - height: auto; - margin: 0.625em auto 1.025em; - max-width: 30%; - position: static; - } - article.feature-image.small { - float: right; - margin: 0 0 1.625em; - width: 64%; - } - .one-column article.feature-image.small .entry-summary { - height: auto; - } - article.feature-image.small .entry-summary p a { - left: 0; - padding-left: 20px; - padding-right: 20px; - width: auto; - } - /* Remove the margin on singular articles */ - .singular .entry-header, - .singular .entry-content, - .singular footer.entry-meta, - .singular #comments-title { - width: 100%; - } - /* Simplify the pullquotes and pull styles */ - .singular blockquote.pull { - margin: 0 0 1.625em; - } - .singular .pull.alignleft { - margin: 0 1.625em 0 0; - } - .singular .pull.alignright { - margin: 0 0 0 1.625em; - } - .singular .entry-meta .edit-link a { - left: 0; - position: absolute; - top: 40px; - } - .singular #author-info { - margin: 2.2em -8.8% 0; - padding: 20px 8.8%; - } - /* Make sure we have room for our comment avatars */ - .commentlist { - width: 100%; - } - .commentlist > li.comment, - .commentlist .pingback { - margin-left: 102px; - width: auto; - } - /* And a full-width comment form */ - #respond { - width: auto; - } - /* No need to float footer widgets at this size */ - #colophon #supplementary .widget-area { - float: none; - margin-right: 0; - width: auto; - } - /* No need to float 404 widgets at this size */ - .error404 #main .widget { - float: none; - margin-right: 0; - width: auto; - } - -} -@media (max-width: 650px) { - /* @media (max-width: 650px) Reduce font-sizes for better readability on smaller devices */ - body, input, textarea { - font-size: 13px; - } - #site-title a { - font-size: 24px; - } - #site-description { - font-size: 12px; - } - #access ul { - font-size: 12px; - } - article.intro .entry-content { - font-size: 12px; - } - .entry-title { - font-size: 21px; - } - .featured-post .entry-title { - font-size: 14px; - } - .singular .entry-title { - font-size: 28px; - } - .entry-meta { - font-size: 12px; - } - blockquote { - margin: 0; - } - blockquote.pull { - font-size: 17px; - } - /* Reposition the site title and description slightly */ - #site-title { - padding: 5.30625em 0 0; - } - #site-title, - #site-description { - margin-right: 0; - } - /* Make sure the logo and search form don't collide */ - #branding #searchform { - top: 1.625em !important; - } - /* Floated content doesn't work well at this size */ - .alignleft, - .alignright { - float: none; - margin-left: 0; - margin-right: 0; - } - /* Make sure the post-post navigation doesn't collide with anything */ - #nav-single { - display: block; - position: static; - } - .singular .hentry { - padding: 1.625em 0 0; - } - .singular.page .hentry { - padding: 1.625em 0 0; - } - /* Talking avatars take up too much room at this size */ - .commentlist > li.comment, - .commentlist > li.pingback { - margin-left: 0 !important; - } - .commentlist .avatar { - background: transparent; - display: block; - padding: 0; - position: static; - } - .commentlist .children .avatar { - background: none; - left: 2.2em; - padding: 0; - position: absolute; - top: 2.2em; - } - /* Use the available space in the smaller comment form */ - #respond input[type="text"] { - width: 95%; - } - #respond .comment-form-author .required, - #respond .comment-form-email .required { - left: 95%; - } - #content .gallery-columns-3 .gallery-item { - width: 31%; - padding-right: 2%; - } - #content .gallery-columns-3 .gallery-item img { - width: 100%; - height: auto; - } - -} -@media (max-width: 450px) { - #content .gallery-columns-2 .gallery-item { - width: 45%; - padding-right: 4%; - } - #content .gallery-columns-2 .gallery-item img { - width: 100%; - height: auto; - } - -} -@media only screen and (min-device-width: 320px) and (max-device-width: 480px) { - body { - padding: 0; - } - #page { - margin-top: 0; - } - #branding { - border-top: none; - } - -} - - -/* =Print ------------------------------------------------ */ - -@media print { - body { - background: none !important; - font-size: 10pt; - } - footer.entry-meta a[rel=bookmark]:link:after, - footer.entry-meta a[rel=bookmark]:visited:after { - content: " [" attr(href) "] "; /* Show URLs */ - } - #page { - clear: both !important; - display: block !important; - float: none !important; - max-width: 100%; - position: relative !important; - } - #branding { - border-top: none !important; - padding: 0; - } - #branding hgroup { - margin: 0; - } - #site-title a { - font-size: 21pt; - } - #site-description { - font-size: 10pt; - } - #branding #searchform { - display: none; - } - #branding img { - display: none; - } - #access { - display: none; - } - #main { - border-top: none; - box-shadow: none; - } - #primary { - float: left; - margin: 0; - width: 100%; - } - #content { - margin: 0; - width: auto; - } - .singular #content { - margin: 0; - width: 100%; - } - .singular .entry-header .entry-meta { - position: static; - } - .entry-meta .edit-link a { - display: none; - } - #content nav { - display: none; - } - .singular .entry-header, - .singular .entry-content, - .singular footer.entry-meta, - .singular #comments-title { - margin: 0; - width: 100%; - } - .singular .hentry { - padding: 0; - } - .entry-title, - .singular .entry-title { - font-size: 21pt; - } - .entry-meta { - font-size: 10pt; - } - .entry-header .comments-link { - display: none; - } - .page-link { - display: none; - } - .singular #author-info { - background: none; - border-bottom: none; - border-top: none; - margin: 2.2em 0 0; - padding: 0; - } - #respond { - display: none; - } - .widget-area { - display: none; - } - #colophon { - display: none; - } - - /* Comments */ - .commentlist > li.comment { - background: none; - border: 1px solid #ddd; - -moz-border-radius: 3px 3px 3px 3px; - border-radius: 3px 3px 3px 3px; - margin: 0 auto 1.625em; - padding: 1.625em; - position: relative; - width: auto; - } - .commentlist .avatar { - height: 39px; - left: 2.2em; - top: 2.2em; - width: 39px; - } - .commentlist li.comment .comment-meta { - line-height: 1.625em; - margin-left: 50px; - } - .commentlist li.comment .fn { - display: block; - } - .commentlist li.comment .comment-content { - margin: 1.625em 0 0; - } - .commentlist .comment-edit-link { - display: none; - } - .commentlist > li::before, - .commentlist > li.bypostauthor::before { - content: ''; - } - .commentlist .reply { - display: none; - } - - /* Post author highlighting */ - .commentlist > li.bypostauthor { - color: #444; - } - .commentlist > li.bypostauthor .comment-meta { - color: #666; - } - .commentlist > li.bypostauthor:before { - content: none; - } - - /* Post Author threaded comments */ - .commentlist .children > li.bypostauthor { - background: #fff; - border-color: #ddd; - } - .commentlist .children > li.bypostauthor > article, - .commentlist .children > li.bypostauthor > article .comment-meta { - color: #666; - } - -} - - -/* =IE7 ------------------------------------------------ */ - -#ie7 article.intro { - margin-left: -7.6%; - margin-right: -7.6%; - padding-left: -7.6%; - padding-right: -7.6%; - max-width: 1000px; -} -#ie7 section.featured-post { - margin-left: -7.6%; - margin-right: -7.6%; - max-width: 850px; -} -#ie7 section.recent-posts { - margin-right: 7.6%; -} -/* -Theme Name: HuskyPress -Theme URI: http://wordpress.org/extend/themes/twentyeleven -Author: the WordPress team -Author URI: http://uconn.edu -Description: -Version: 1.3 -License: GNU General Public License -License URI: license.txt -Tags: dark, light, white, black, gray, one-column, two-columns, left-sidebar, right-sidebar, fixed-width, flexible-width, custom-background, custom-colors, custom-header, custom-menu, editor-style, featured-image-header, featured-images, full-width-template, microformats, post-formats, rtl-language-support, sticky-post, theme-options, translation-ready -*/ - -/* =Reset default browser CSS. Based on work by Eric Meyer: http://meyerweb.com/eric/tools/css/reset/index.html --------------------------------------------------------------- */ - -html, body, div, span, applet, object, iframe, -h1, h2, h3, h4, h5, h6, p, blockquote, pre, -a, abbr, acronym, address, big, cite, code, -del, dfn, em, font, ins, kbd, q, s, samp, -small, strike, strong, sub, sup, tt, var, -dl, dt, dd, ol, ul, li, -fieldset, form, label, legend, -table, caption, tbody, tfoot, thead, tr, th, td { - border: 0; - font-family: inherit; - font-size: 100%; - font-style: inherit; - font-weight: inherit; - margin: 0; - outline: 0; - padding: 0; - vertical-align: baseline; -} -:focus {/* remember to define focus styles! */ - outline: 0; -} -body { - background: #fff; - line-height: 1; -} -ol, ul { - list-style: none; -} -table {/* tables still need 'cellspacing="0"' in the markup */ - border-collapse: separate; - border-spacing: 0; -} -caption, th, td { - font-weight: normal; - text-align: left; -} -blockquote:before, blockquote:after, -q:before, q:after { - content: ""; -} -blockquote, q { - quotes: "" ""; -} -a img { - border: 0; -} -article, aside, details, figcaption, figure, -footer, header, hgroup, menu, nav, section { - display: block; -} - - -/* =Structure ------------------------------------------------ */ - -body { - padding: 0 2em; -} -#page { - margin: 2em auto; - max-width: 1000px; -} -#branding hgroup { - margin: 0 7.6%; -} -#access div { - margin: 0 7.6%; -} -#primary { - float: left; - margin: 0 -26.4% 0 0; - width: 100%; -} -#content { - margin: 0 34% 0 7.6%; - width: 58.4%; -} -#secondary { - float: right; - margin-right: 7.6%; - width: 18.8%; -} - -/* Singular */ -.singular #primary { - margin: 0; -} -.singular #content, -.left-sidebar.singular #content { - margin: 0 7.6%; - position: relative; - width: auto; -} -.singular .entry-header, -.singular .entry-content, -.singular footer.entry-meta, -.singular #comments-title { - margin: 0 auto; - width: 68.9%; -} - -/* Attachments */ -.singular .image-attachment .entry-content { - margin: 0 auto; - width: auto; -} -.singular .image-attachment .entry-description { - margin: 0 auto; - width: 68.9%; -} - -/* Showcase */ -.page-template-showcase-php #primary, -.left-sidebar.page-template-showcase-php #primary { - margin: 0; -} -.page-template-showcase-php #content, -.left-sidebar.page-template-showcase-php #content { - margin: 0 7.6%; - width: auto; -} -.page-template-showcase-php section.recent-posts { - float: right; - margin: 0 0 0 31%; - width: 69%; -} -.page-template-showcase-php #main .widget-area { - float: left; - margin: 0 -22.15% 0 0; - width: 22.15%; -} - -/* error404 */ -.error404 #primary { - float: none; - margin: 0; -} -.error404 #primary #content { - margin: 0 7.6%; - width: auto; -} - -/* Alignment */ -.alignleft { - display: inline; - float: left; - margin-right: 1.625em; -} -.alignright { - display: inline; - float: right; - margin-left: 1.625em; -} -.aligncenter { - clear: both; - display: block; - margin-left: auto; - margin-right: auto; -} - -/* Right Content */ -.left-sidebar #primary { - float: right; - margin: 0 0 0 -26.4%; - width: 100%; -} -.left-sidebar #content { - margin: 0 7.6% 0 34%; - width: 58.4%; -} -.left-sidebar #secondary { - float: left; - margin-left: 7.6%; - margin-right: 0; - width: 18.8%; -} - -/* One column */ -.one-column #page { - max-width: 690px; -} -.one-column #content { - margin: 0 7.6%; - width: auto; -} -.one-column #nav-below { - border-bottom: 1px solid #ddd; - margin-bottom: 1.625em; -} -.one-column #secondary { - float: none; - margin: 0 7.6%; - width: auto; -} -/* Simplify the showcase template */ -.one-column .page-template-showcase-php section.recent-posts { - float: none; - margin: 0; - width: 100%; -} -.one-column .page-template-showcase-php #main .widget-area { - float: none; - margin: 0; - width: auto; -} -.one-column .page-template-showcase-php .other-recent-posts { - border-bottom: 1px solid #ddd; -} -/* Simplify the showcase template when small feature */ -.one-column section.featured-post .attachment-small-feature { - border: none; - display: block; - height: auto; - max-width: 60%; - position: static; -} -.one-column article.feature-image.small { - margin: 0 0 1.625em; - padding: 0; -} -.one-column article.feature-image.small .entry-title { - font-size: 20px; - line-height: 1.3em; -} -.one-column article.feature-image.small .entry-summary { - height: 150px; - overflow: hidden; - padding: 0; - text-overflow: ellipsis; -} -.one-column article.feature-image.small .entry-summary a { - left: -9%; -} -/* Remove the margin on singular articles */ -.one-column.singular .entry-header, -.one-column.singular .entry-content, -.one-column.singular footer.entry-meta, -.one-column.singular #comments-title { - width: 100%; -} -/* Simplify the pullquotes and pull styles */ -.one-column.singular blockquote.pull { - margin: 0 0 1.625em; -} -.one-column.singular .pull.alignleft { - margin: 0 1.625em 0 0; -} -.one-column.singular .pull.alignright { - margin: 0 0 0 1.625em; -} -.one-column.singular .entry-meta .edit-link a { - position: absolute; - left: 0; - top: 40px; -} -.one-column.singular #author-info { - margin: 2.2em -8.8% 0; - padding: 20px 8.8%; -} -/* Make sure we have room for our comment avatars */ -.one-column .commentlist > li.comment { - margin-left: 102px; - width: auto; -} -/* Make sure the logo and search form don't collide */ -.one-column #branding #searchform { - right: 40px; - top: 4em; -} -/* Talking avatars take up too much room at this size */ -.one-column .commentlist > li.comment { - margin-left: 0; -} -.one-column .commentlist > li.comment .comment-meta, -.one-column .commentlist > li.comment .comment-content { - margin-right: 85px; -} -.one-column .commentlist .avatar { - background: transparent; - display: block; - padding: 0; - top: 1.625em; - left: auto; - right: 1.625em; -} -.one-column .commentlist .children .avatar { - background: none; - padding: 0; - position: absolute; - top: 2.2em; - left: 2.2em; -} -.one-column #respond { - width: auto; -} - - -/* =Global ------------------------------------------------ */ - -body, input, textarea { - color: #373737; - font: 15px "Helvetica Neue", Helvetica, Arial, sans-serif; - font-weight: 300; - line-height: 1.625; -} -body { - background: #e2e2e2; -} -#page { - background: #fff; -} - -/* Headings */ -h1,h2,h3,h4,h5,h6 { - clear: both; -} -hr { - background-color: #ccc; - border: 0; - height: 1px; - margin-bottom: 1.625em; -} - -/* Text elements */ -p { - margin-bottom: 1.625em; -} -ul, ol { - margin: 0 0 1.625em 2.5em; -} -ul { - list-style: square; -} -ol { - list-style-type: decimal; -} -ol ol { - list-style: upper-alpha; -} -ol ol ol { - list-style: lower-roman; -} -ol ol ol ol { - list-style: lower-alpha; -} -ul ul, ol ol, ul ol, ol ul { - margin-bottom: 0; -} -dl { - margin: 0 1.625em; -} -dt { - font-weight: bold; -} -dd { - margin-bottom: 1.625em; -} -strong { - font-weight: bold; -} -cite, em, i { - font-style: italic; -} -blockquote { - font-family: Georgia, "Bitstream Charter", serif; - font-style: italic; - font-weight: normal; - margin: 0 3em; -} -blockquote em, blockquote i, blockquote cite { - font-style: normal; -} -blockquote cite { - color: #666; - font: 12px "Helvetica Neue", Helvetica, Arial, sans-serif; - font-weight: 300; - letter-spacing: 0.05em; - text-transform: uppercase; -} -pre { - background: #f4f4f4; - font: 13px "Courier 10 Pitch", Courier, monospace; - line-height: 1.5; - margin-bottom: 1.625em; - overflow: auto; - padding: 0.75em 1.625em; -} -code, kbd { - font: 13px Monaco, Consolas, "Andale Mono", "DejaVu Sans Mono", monospace; -} -abbr, acronym, dfn { - border-bottom: 1px dotted #666; - cursor: help; -} -address { - display: block; - margin: 0 0 1.625em; -} -ins { - background: #fff9c0; - text-decoration: none; -} -sup, -sub { - font-size: 10px; - height: 0; - line-height: 1; - position: relative; - vertical-align: baseline; -} -sup { - bottom: 1ex; -} -sub { - top: .5ex; -} - -/* Forms */ -input[type=text], -input[type=password], -textarea { - background: #fafafa; - -moz-box-shadow: inset 0 1px 1px rgba(0,0,0,0.1); - -webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,0.1); - box-shadow: inset 0 1px 1px rgba(0,0,0,0.1); - border: 1px solid #ddd; - color: #888; -} -input[type=text]:focus, -textarea:focus { - color: #373737; -} -textarea { - padding-left: 3px; - width: 98%; -} -input[type=text] { - padding: 3px; -} -input#s { - background: url(images/search.png) no-repeat 5px 6px; - -moz-border-radius: 2px; - border-radius: 2px; - font-size: 14px; - height: 22px; - line-height: 1.2em; - padding: 4px 10px 4px 28px; -} -input#searchsubmit { - display: none; -} - -/* Links */ -a { - color: #1982d1; - text-decoration: none; -} -a:focus, -a:active, -a:hover { - text-decoration: underline; -} - -/* Assistive text */ -.assistive-text { - position: absolute !important; - clip: rect(1px 1px 1px 1px); /* IE6, IE7 */ - clip: rect(1px, 1px, 1px, 1px); -} -#access a.assistive-text:active, -#access a.assistive-text:focus { - background: #eee; - border-bottom: 1px solid #ddd; - color: #1982d1; - clip: auto !important; - font-size: 12px; - position: absolute; - text-decoration: underline; - top: 0; - left: 7.6%; -} - - -/* =Header ------------------------------------------------ */ - -#branding { - border-top: 2px solid #bbb; - padding-bottom: 10px; - position: relative; - z-index: 9999; -} -#site-title { - margin-right: 270px; - padding: 3.65625em 0 0; -} -#site-title a { - color: #111; - font-size: 30px; - font-weight: bold; - line-height: 36px; - text-decoration: none; -} -#site-title a:hover, -#site-title a:focus, -#site-title a:active { - color: #1982d1; -} -#site-description { - color: #7a7a7a; - font-size: 14px; - margin: 0 270px 3.65625em 0; -} -#branding img { - height: auto; - margin-bottom: -7px; - width: 100%; -} - - -/* =Menu --------------------------------------------------------------- */ - -#access { - background: #222; /* Show a solid color for older browsers */ - background: -moz-linear-gradient(#252525, #0a0a0a); - background: -o-linear-gradient(#252525, #0a0a0a); - background: -webkit-gradient(linear, 0% 0%, 0% 100%, from(#252525), to(#0a0a0a)); /* older webkit syntax */ - background: -webkit-linear-gradient(#252525, #0a0a0a); - -webkit-box-shadow: rgba(0, 0, 0, 0.4) 0px 1px 2px; - -moz-box-shadow: rgba(0, 0, 0, 0.4) 0px 1px 2px; - box-shadow: rgba(0, 0, 0, 0.4) 0px 1px 2px; - clear: both; - display: block; - float: left; - margin: 0 auto 6px; - width: 100%; -} -#access ul { - font-size: 13px; - list-style: none; - margin: 0 0 0 -0.8125em; - padding-left: 0; -} -#access li { - float: left; - position: relative; -} -#access a { - color: #eee; - display: block; - line-height: 3.333em; - padding: 0 1.2125em; - text-decoration: none; -} -#access ul ul { - -moz-box-shadow: 0 3px 3px rgba(0,0,0,0.2); - -webkit-box-shadow: 0 3px 3px rgba(0,0,0,0.2); - box-shadow: 0 3px 3px rgba(0,0,0,0.2); - display: none; - float: left; - margin: 0; - position: absolute; - top: 3.333em; - left: 0; - width: 188px; - z-index: 99999; -} -#access ul ul ul { - left: 100%; - top: 0; -} -#access ul ul a { - background: #f9f9f9; - border-bottom: 1px dotted #ddd; - color: #444; - font-size: 13px; - font-weight: normal; - height: auto; - line-height: 1.4em; - padding: 10px 10px; - width: 168px; -} -#access li:hover > a, -#access ul ul :hover > a, -#access a:focus { - background: #efefef; -} -#access li:hover > a, -#access a:focus { - background: #f9f9f9; /* Show a solid color for older browsers */ - background: -moz-linear-gradient(#f9f9f9, #e5e5e5); - background: -o-linear-gradient(#f9f9f9, #e5e5e5); - background: -webkit-gradient(linear, 0% 0%, 0% 100%, from(#f9f9f9), to(#e5e5e5)); /* Older webkit syntax */ - background: -webkit-linear-gradient(#f9f9f9, #e5e5e5); - color: #373737; -} -#access ul li:hover > ul { - display: block; -} -#access .current-menu-item > a, -#access .current-menu-ancestor > a, -#access .current_page_item > a, -#access .current_page_ancestor > a { - font-weight: bold; -} - -/* Search Form */ -#branding #searchform { - position: absolute; - top: 3.8em; - right: 7.6%; - text-align: right; -} -#branding #searchform div { - margin: 0; -} -#branding #s { - float: right; - -webkit-transition-duration: 400ms; - -webkit-transition-property: width, background; - -webkit-transition-timing-function: ease; - -moz-transition-duration: 400ms; - -moz-transition-property: width, background; - -moz-transition-timing-function: ease; - -o-transition-duration: 400ms; - -o-transition-property: width, background; - -o-transition-timing-function: ease; - width: 72px; -} -#branding #s:focus { - background-color: #f9f9f9; - width: 196px; -} -#branding #searchsubmit { - display: none; -} -#branding .only-search #searchform { - top: 5px; - z-index: 1; -} -#branding .only-search #s { - background-color: #666; - border-color: #000; - color: #222; -} -#branding .only-search #s, -#branding .only-search #s:focus { - width: 85%; -} -#branding .only-search #s:focus { - background-color: #bbb; -} -#branding .with-image #searchform { - top: auto; - bottom: -27px; - max-width: 195px; -} -#branding .only-search + #access div { - padding-right: 205px; -} - - -/* =Content ------------------------------------------------ */ - -#main { - clear: both; - padding: 1.625em 0 0; -} -.page-title { - color: #666; - font-size: 10px; - font-weight: 500; - letter-spacing: 0.1em; - line-height: 2.6em; - margin: 0 0 2.6em; - text-transform: uppercase; -} -.page-title a { - font-size: 12px; - font-weight: bold; - letter-spacing: 0; - text-transform: none; -} -.hentry, -.no-results { - border-bottom: 1px solid #ddd; - margin: 0 0 1.625em; - padding: 0 0 1.625em; - position: relative; -} -.hentry:last-child, -.no-results { - border-bottom: none; -} -.blog .sticky .entry-header .entry-meta { - clip: rect(1px 1px 1px 1px); /* IE6, IE7 */ - clip: rect(1px, 1px, 1px, 1px); - position: absolute !important; -} -.entry-title, -.entry-header .entry-meta { - padding-right: 76px; -} -.entry-title { - clear: both; - color: #222; - font-size: 26px; - font-weight: bold; - line-height: 1.5em; - padding-bottom: .3em; - padding-top: 15px; -} -.entry-title, -.entry-title a { - color: #222; - text-decoration: none; -} -.entry-title a:hover, -.entry-title a:focus, -.entry-title a:active { - color: #1982d1; -} -.entry-meta { - color: #666; - clear: both; - font-size: 12px; - line-height: 18px; -} -.entry-meta a { - font-weight: bold; -} -.single-author .entry-meta .by-author { - display: none; -} -.entry-content, -.entry-summary { - padding: 1.625em 0 0; -} -.entry-content h1, -.entry-content h2, -.comment-content h1, -.comment-content h2 { - color: #000; - font-weight: bold; -} -.entry-content h3, -.comment-content h3 { - font-size: 10px; - letter-spacing: 0.1em; - line-height: 2.6em; - text-transform: uppercase; -} -.entry-content table, -.comment-content table { - border-bottom: 1px solid #ddd; - margin: 0 0 1.625em; - width: 100%; -} -.entry-content th, -.comment-content th { - color: #666; - font-size: 10px; - font-weight: 500; - letter-spacing: 0.1em; - line-height: 2.6em; - text-transform: uppercase; -} -.entry-content td, -.comment-content td { - border-top: 1px solid #ddd; - padding: 6px 10px 6px 0; -} -.entry-content #s { - width: 75%; -} -.comment-content ul, -.comment-content ol { - margin-bottom: 1.625em; -} -.comment-content ul ul, -.comment-content ol ol, -.comment-content ul ol, -.comment-content ol ul { - margin-bottom: 0; -} -dl.gallery-item { - margin: 0; -} -.page-link { - clear: both; - display: block; - margin: 0 0 1.625em; -} -.page-link a { - background: #eee; - color: #373737; - margin: 0; - padding: 2px 3px; - text-decoration: none; -} -.page-link a:hover { - background: #888; - color: #fff; - font-weight: bold; -} -.page-link span { - margin-right: 6px; -} -.entry-meta .edit-link a, -.commentlist .edit-link a { - background: #eee; - -moz-border-radius: 3px; - border-radius: 3px; - color: #666; - float: right; - font-size: 12px; - line-height: 1.5em; - font-weight: 300; - text-decoration: none; - padding: 0 8px; -} -.entry-meta .edit-link a:hover, -.commentlist .edit-link a:hover { - background: #888; - color: #fff; -} -.entry-content .edit-link { - clear: both; - display: block; -} - -/* Images */ -.entry-content img, -.comment-content img, -.widget img { - max-width: 97.5%; /* Fluid images for posts, comments, and widgets */ -} -img[class*="align"], -img[class*="wp-image-"], -img[class*="attachment-"] { - height: auto; /* Make sure images with WordPress-added height and width attributes are scaled correctly */ -} -img.size-full, -img.size-large { - max-width: 97.5%; - width: auto; /* Prevent stretching of full-size and large-size images with height and width attributes in IE8 */ - height: auto; /* Make sure images with WordPress-added height and width attributes are scaled correctly */ -} -.entry-content img.wp-smiley { - border: none; - margin-bottom: 0; - margin-top: 0; - padding: 0; -} -img.alignleft, -img.alignright, -img.aligncenter { - margin-bottom: 1.625em; -} -p img, -.wp-caption { - margin-top: 0.4em; -} -.wp-caption { - background: #eee; - margin-bottom: 1.625em; - max-width: 96%; - padding: 9px; -} -.wp-caption img { - display: block; - margin: 0 auto; - max-width: 98%; -} -.wp-caption .wp-caption-text, -.gallery-caption { - color: #666; - font-family: Georgia, serif; - font-size: 12px; -} -.wp-caption .wp-caption-text { - margin-bottom: 0.6em; - padding: 10px 0 5px 40px; - position: relative; -} -.wp-caption .wp-caption-text:before { - color: #666; - content: '\2014'; - font-size: 14px; - font-style: normal; - font-weight: bold; - margin-right: 5px; - position: absolute; - left: 10px; - top: 7px; -} -#content .gallery { - margin: 0 auto 1.625em; -} -#content .gallery a img { - border: none; -} -img#wpstats { - display: block; - margin: 0 auto 1.625em; -} -#content .gallery-columns-4 .gallery-item { - width: 23%; - padding-right: 2%; -} -#content .gallery-columns-4 .gallery-item img { - width: 100%; - height: auto; -} - -/* Image borders */ -img[class*="align"], -img[class*="wp-image-"], -#content .gallery .gallery-icon img {/* Add fancy borders to all WordPress-added images but not things like badges and icons and the like */ - border: 1px solid #ddd; - padding: 6px; -} -.wp-caption img { - border-color: #eee; -} -a:focus img[class*="align"], -a:hover img[class*="align"], -a:active img[class*="align"], -a:focus img[class*="wp-image-"], -a:hover img[class*="wp-image-"], -a:active img[class*="wp-image-"], -#content .gallery .gallery-icon a:focus img, -#content .gallery .gallery-icon a:hover img, -#content .gallery .gallery-icon a:active img {/* Add some useful style to those fancy borders for linked images ... */ - background: #eee; - border-color: #bbb; -} -.wp-caption a:focus img, -.wp-caption a:active img, -.wp-caption a:hover img {/* ... including captioned images! */ - background: #fff; - border-color: #ddd; -} - -/* Make sure embeds and iframes fit their containers */ -embed, -iframe, -object { - max-width: 100%; -} - -/* Password Protected Posts */ -.post-password-required .entry-header .comments-link { - margin: 1.625em 0 0; -} -.post-password-required input[type=password] { - margin: 0.8125em 0; -} -.post-password-required input[type=password]:focus { - background: #f7f7f7; -} - -/* Author Info */ -#author-info { - font-size: 12px; - overflow: hidden; -} -.singular #author-info { - background: #f9f9f9; - border-top: 1px solid #ddd; - border-bottom: 1px solid #ddd; - margin: 2.2em -35.6% 0 -35.4%; - padding: 20px 35.4%; -} -.archive #author-info { - border-bottom: 1px solid #ddd; - margin: 0 0 2.2em; - padding: 0 0 2.2em; -} -#author-avatar { - float: left; - margin-right: -78px; -} -#author-avatar img { - background: #fff; - -moz-border-radius: 3px; - border-radius: 3px; - -webkit-box-shadow: 0 1px 2px #bbb; - -moz-box-shadow: 0 1px 2px #bbb; - box-shadow: 0 1px 2px #bbb; - padding: 3px; -} -#author-description { - float: left; - margin-left: 108px; -} -#author-description h2 { - color: #000; - font-size: 15px; - font-weight: bold; - margin: 5px 0 10px; -} - -/* Comments link */ -.entry-header .comments-link a { - background: #eee url(images/comment-bubble.png) no-repeat; - color: #666; - font-size: 13px; - font-weight: normal; - line-height: 35px; - overflow: hidden; - padding: 0 0 0; - position: absolute; - top: 1.5em; - right: 0; - text-align: center; - text-decoration: none; - width: 43px; - height: 36px; -} -.entry-header .comments-link a:hover, -.entry-header .comments-link a:focus, -.entry-header .comments-link a:active { - background-color: #1982d1; - color: #fff; - color: rgba(255,255,255,0.8); -} -.entry-header .comments-link .leave-reply { - visibility: hidden; -} - -/* -Post Formats Headings -To hide the headings, display: none the ".entry-header .entry-format" selector, -and remove the padding rules below. -*/ -.entry-header .entry-format { - color: #666; - font-size: 10px; - font-weight: 500; - letter-spacing: 0.1em; - line-height: 2.6em; - position: absolute; - text-transform: uppercase; - top: -5px; -} -.entry-header hgroup .entry-title { - padding-top: 15px; -} -article.format-aside .entry-content, -article.format-link .entry-content, -article.format-status .entry-content { - padding: 20px 0 0; -} -article.format-status .entry-content { - min-height: 65px; -} -.recent-posts .entry-header .entry-format { - display: none; -} -.recent-posts .entry-header hgroup .entry-title { - padding-top: 0; -} - -/* Singular content styles for Posts and Pages */ -.singular .hentry { - border-bottom: none; - padding: 4.875em 0 0; - position: relative; -} -.singular.page .hentry { - padding: 3.5em 0 0; -} -.singular .entry-title { - color: #000; - font-size: 36px; - font-weight: bold; - line-height: 48px; -} -.singular .entry-title, -.singular .entry-header .entry-meta { - padding-right: 0; -} -.singular .entry-header .entry-meta { - position: absolute; - top: 0; - left: 0; -} -blockquote.pull { - font-size: 21px; - font-weight: bold; - line-height: 1.6125em; - margin: 0 0 1.625em; - text-align: center; -} -.singular blockquote.pull { - margin: 0 -22.25% 1.625em; -} -.pull.alignleft { - margin: 0 1.625em 0 0; - text-align: right; - width: 33%; -} -.singular .pull.alignleft { - margin: 0 1.625em 0 -22.25%; -} -.pull.alignright { - margin: 0 0 0 1.625em; - text-align: left; - width: 33%; -} -.singular .pull.alignright { - margin: 0 -22.25% 0 1.625em; -} -.singular blockquote.pull.alignleft, -.singular blockquote.pull.alignright { - width: 33%; -} -.singular .entry-meta .edit-link a { - bottom: auto; - left: 50px; - position: absolute; - right: auto; - top: 80px; -} - - -/* =Aside ------------------------------------------------ */ - -.format-aside .entry-title, -.format-aside .entry-header .comments-link { - display: none; -} -.singular .format-aside .entry-title { - display: block; -} -.format-aside .entry-content { - padding: 0; -} -.singular .format-aside .entry-content { - padding: 1.625em 0 0; -} - - -/* =Link ------------------------------------------------ */ - -.format-link .entry-title, -.format-link .entry-header .comments-link { - display: none; -} -.singular .format-link .entry-title { - display: block; -} -.format-link .entry-content { - padding: 0; -} -.singular .format-link .entry-content { - padding: 1.625em 0 0; -} - - -/* =Gallery ------------------------------------------------ */ - -.format-gallery .gallery-thumb { - float: left; - display: block; - margin: .375em 1.625em 0 0; -} - - -/* =Status ------------------------------------------------ */ - -.format-status .entry-title, -.format-status .entry-header .comments-link { - display: none; -} -.singular .format-status .entry-title { - display: block; -} -.format-status .entry-content { - padding: 0; -} -.singular .format-status .entry-content { - padding: 1.625em 0 0; -} -.format-status img.avatar { - -moz-border-radius: 3px; - border-radius: 3px; - -webkit-box-shadow: 0 1px 2px #ccc; - -moz-box-shadow: 0 1px 2px #ccc; - box-shadow: 0 1px 2px #ccc; - float: left; - margin: 4px 10px 2px 0; - padding: 0; -} - - -/* =Quote ------------------------------------------------ */ - -.format-quote blockquote { - color: #555; - font-size: 17px; - margin: 0; -} - - -/* =Image ------------------------------------------------ */ - -.indexed.format-image .entry-header { - min-height: 61px; /* Prevent the comment icon from colliding with the image when there is no title */ -} -.indexed.format-image .entry-content { - padding-top: 0.5em; -} -.indexed.format-image p, -.indexed.format-image p img { - margin-bottom: 0; -} -.indexed.format-image footer.entry-meta { - background: #ddd; - margin-top: -7px; - padding: 20px 30px; - overflow: hidden; -} -.indexed.format-image div.entry-meta { - display: inline-block; - float: left; - width: 35%; -} -.indexed.format-image div.entry-meta + div.entry-meta { - float: none; - width: 65%; -} -.indexed.format-image .entry-meta span.cat-links, -.indexed.format-image .entry-meta span.tag-links, -.indexed.format-image .entry-meta span.comments-link { - display: block; -} -.indexed.format-image footer.entry-meta a { - color: #444; -} -.indexed.format-image footer.entry-meta a:hover { - color: #fff; -} -#content .indexed.format-image img { - border: none; - max-width: 100%; - padding: 0; -} -.indexed.format-image .wp-caption { - background: #111; - margin-bottom: 0; - max-width: 96%; - padding: 11px; -} -.indexed.format-image .wp-caption .wp-caption-text { - color: #ddd; -} -.indexed.format-image .wp-caption .wp-caption-text:before { - color: #444; -} -.indexed.format-image a:hover img { - opacity: 0.8; -} - - -/* =error404 ------------------------------------------------ */ - -.error404 #main #searchform { - background: #f9f9f9; - border: 1px solid #ddd; - border-width: 1px 0; - margin: 0 -8.9% 1.625em; - overflow: hidden; - padding: 1.625em 8.9%; -} -.error404 #main #s { - width: 95%; -} -.error404 #main .widget { - clear: none; - float: left; - margin-right: 3.7%; - width: 30.85%; -} -.error404 #main .widget_archive { - margin-right: 0; -} -.error404 #main .widget_tag_cloud { - float: none; - margin-right: 0; - width: 100%; -} -.error404 .widgettitle { - font-size: 10px; - letter-spacing: 0.1em; - line-height: 2.6em; - text-transform: uppercase; -} - - -/* =Showcase ------------------------------------------------ */ - -h1.showcase-heading { - color: #666; - font-size: 10px; - font-weight: 500; - letter-spacing: 0.1em; - line-height: 2.6em; - text-transform: uppercase; -} - -/* Intro */ -article.intro { - background: #f9f9f9; - border-bottom: none; - margin: -1.855em -8.9% 1.625em; - padding: 0 8.9%; -} -article.intro .entry-title { - display: none; -} -article.intro .entry-content { - color: #111; - font-size: 16px; - padding: 1.625em 0 0.625em; -} -article.intro .edit-link a { - background: #aaa; - -moz-border-radius: 3px; - border-radius: 3px; - color: #fff; - font-size: 12px; - padding: 0 8px; - position: absolute; - top: 30px; - right: 20px; - text-decoration: none; -} -article.intro .edit-link a:hover, -article.intro .edit-link a:focus, -article.intro .edit-link a:active { - background: #777; -} - -/* Featured post */ -section.featured-post { - float: left; - margin: -1.625em -8.9% 1.625em; - padding: 1.625em 8.9% 0; - position: relative; - width: 100%; -} -section.featured-post .hentry { - border: none; - color: #666; - margin: 0; -} -section.featured-post .entry-meta { - clip: rect(1px 1px 1px 1px); /* IE6, IE7 */ - clip: rect(1px, 1px, 1px, 1px); - position: absolute !important; -} - -/* Small featured post */ -section.featured-post .attachment-small-feature { - float: right; - height: auto; - margin: 0 -8.9% 1.625em 0; - max-width: 59%; - position: relative; - right: -15px; -} -section.featured-post.small { - padding-top: 0; -} -section.featured-post .attachment-small-feature:hover, -section.featured-post .attachment-small-feature:focus, -section.featured-post .attachment-small-feature:active { - opacity: .8; -} -article.feature-image.small { - float: left; - margin: 0 0 1.625em; - width: 45%; -} -article.feature-image.small .entry-title { - line-height: 1.2em; -} -article.feature-image.small .entry-summary { - color: #555; - font-size: 13px; -} -article.feature-image.small .entry-summary p a { - background: #222; - color: #eee; - display: block; - left: -23.8%; - padding: 9px 26px 9px 85px; - position: relative; - text-decoration: none; - top: 20px; - width: 180px; - z-index: 1; -} -article.feature-image.small .entry-summary p a:hover { - background: #1982d1; - color: #eee; - color: rgba(255,255,255,0.8); -} - -/* Large featured post */ -section.feature-image.large { - border: none; - max-height: 288px; - padding: 0; - width: 100%; -} -section.feature-image.large .showcase-heading { - display: none; -} -section.feature-image.large .hentry { - border-bottom: none; - left: 9%; - margin: 1.625em 9% 0 0; - position: absolute; - top: 0; -} -article.feature-image.large .entry-title a { - background: #222; - background: rgba(0,0,0,0.8); - -moz-border-radius: 3px; - border-radius: 3px; - color: #fff; - display: inline-block; - font-weight: 300; - padding: .2em 20px; -} -section.feature-image.large:hover .entry-title a, -section.feature-image.large .entry-title:hover a { - background: #eee; - background: rgba(255,255,255,0.8); - color: #222; -} -article.feature-image.large .entry-summary { - display: none; -} -section.feature-image.large img { - display: block; - height: auto; - max-width: 117.9%; - padding: 0 0 6px; -} - -/* Featured Slider */ -.featured-posts { - border-bottom: 1px solid #ddd; - display: block; - height: 328px; - margin: 1.625em -8.9% 20px; - max-width: 1000px; - padding: 0; - position: relative; - overflow: hidden; -} -.featured-posts .showcase-heading { - padding-left: 8.9%; -} -.featured-posts section.featured-post { - background: #fff; - height: 288px; - left: 0; - margin: 0; - position: absolute; - top: 30px; - width: auto; -} -.featured-posts section.featured-post.large { - max-width: 100%; - overflow: hidden; -} -.featured-posts section.featured-post { - -webkit-transition-duration: 200ms; - -webkit-transition-property: opacity, visibility; - -webkit-transition-timing-function: ease; - -moz-transition-duration: 200ms; - -moz-transition-property: opacity, visibility; - -moz-transition-timing-function: ease; -} -.featured-posts section.featured-post { - opacity: 0; - visibility: hidden; -} -.featured-posts #featured-post-1 { - opacity: 1; - visibility: visible; -} -.featured-post .feature-text:after, -.featured-post .feature-image.small:after { - content: ' '; - background: -moz-linear-gradient(top, rgba(255,255,255,0) 0%, rgba(255,255,255,1) 100%); /* FF3.6+ */ - background: -webkit-gradient(linear, left top, left bottom, color-stop(0%,rgba(255,255,255,0)), color-stop(100%,rgba(255,255,255,1))); /* Chrome,Safari4+ */ - background: -webkit-linear-gradient(top, rgba(255,255,255,0) 0%,rgba(255,255,255,1) 100%); /* Chrome10+,Safari5.1+ */ - background: -o-linear-gradient(top, rgba(255,255,255,0) 0%,rgba(255,255,255,1) 100%); /* Opera11.10+ */ - background: -ms-linear-gradient(top, rgba(255,255,255,0) 0%,rgba(255,255,255,1) 100%); /* IE10+ */ - filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#00ffffff', endColorstr='#ffffff',GradientType=0 ); /* IE6-9 */ - background: linear-gradient(top, rgba(255,255,255,0) 0%,rgba(255,255,255,1) 100%); /* W3C */ - width: 100%; - height: 45px; - position: absolute; - top: 230px; -} -.featured-post .feature-image.small:after { - top: 253px; -} -#content .feature-slider { - top: 5px; - right: 8.9%; - overflow: visible; - position: absolute; -} -.feature-slider ul { - list-style-type: none; - margin: 0; -} -.feature-slider li { - float: left; - margin: 0 6px; -} -.feature-slider a { - background: #3c3c3c; - background: rgba(60,60,60,0.9); - -moz-border-radius: 12px; - border-radius: 12px; - -webkit-box-shadow: inset 1px 1px 5px rgba(0,0,0,0.5), inset 0 0 2px rgba(255,255,255,0.5); - -moz-box-shadow: inset 1px 1px 5px rgba(0,0,0,0.5), inset 0 0 2px rgba(255,255,255,0.5); - box-shadow: inset 1px 1px 5px rgba(0,0,0,0.5), inset 0 0 2px rgba(255,255,255,0.5); - display: block; - width: 14px; - height: 14px; -} -.feature-slider a.active { - background: #1982d1; - -webkit-box-shadow: inset 1px 1px 5px rgba(0,0,0,0.4), inset 0 0 2px rgba(255,255,255,0.8); - -moz-box-shadow: inset 1px 1px 5px rgba(0,0,0,0.4), inset 0 0 2px rgba(255,255,255,0.8); - box-shadow: inset 1px 1px 5px rgba(0,0,0,0.4), inset 0 0 2px rgba(255,255,255,0.8); - cursor: default; - opacity: 0.5; -} - -/* Recent Posts */ -section.recent-posts { - padding: 0 0 1.625em; -} -section.recent-posts .hentry { - border: none; - margin: 0; -} -section.recent-posts .other-recent-posts { - border-bottom: 1px solid #ddd; - list-style: none; - margin: 0; -} -section.recent-posts .other-recent-posts li { - padding: 0.3125em 0; - position: relative; -} -section.recent-posts .other-recent-posts .entry-title { - border-top: 1px solid #ddd; - font-size: 17px; -} -section.recent-posts .other-recent-posts a[rel="bookmark"] { - color: #373737; - float: left; - max-width: 84%; -} -section.recent-posts .other-recent-posts a[rel="bookmark"]:after { - content: '-'; - color: transparent; - font-size: 11px; -} -section.recent-posts .other-recent-posts a[rel="bookmark"]:hover { -} -section.recent-posts .other-recent-posts .comments-link a, -section.recent-posts .other-recent-posts .comments-link > span { - border-bottom: 2px solid #999; - bottom: -2px; - color: #444; - display: block; - font-size: 10px; - font-weight: 500; - line-height: 2.76333em; - padding: 0.3125em 0 0.3125em 1em; - position: absolute; - right: 0; - text-align: right; - text-transform: uppercase; - z-index: 1; -} -section.recent-posts .other-recent-posts .comments-link > span { - border-color: #bbb; - color: #888; -} -section.recent-posts .other-recent-posts .comments-link a:hover { - color: #1982d1; - border-color: #1982d1; -} -section.recent-posts .other-recent-posts li:after { - clear: both; - content: '.'; - display: block; - height: 0; - visibility: hidden; -} - - -/* =Attachments ------------------------------------------------ */ - -.image-attachment div.attachment { - background: #f9f9f9; - border: 1px solid #ddd; - border-width: 1px 0; - margin: 0 -8.9% 1.625em; - overflow: hidden; - padding: 1.625em 1.625em 0; - text-align: center; -} -.image-attachment div.attachment img { - display: block; - height: auto; - margin: 0 auto 1.625em; - max-width: 100%; -} -.image-attachment div.attachment a img { - border-color: #f9f9f9; -} -.image-attachment div.attachment a:focus img, -.image-attachment div.attachment a:hover img, -.image-attachment div.attachment a:active img { - border-color: #ddd; - background: #fff; -} -.image-attachment .entry-caption p { - font-size: 10px; - letter-spacing: 0.1em; - line-height: 2.6em; - margin: 0 0 2.6em; - text-transform: uppercase; -} - - -/* =Navigation --------------------------------------------------------------- */ - -#content nav { - clear: both; - overflow: hidden; - padding: 0 0 1.625em; -} -#content nav a { - font-size: 12px; - font-weight: bold; - line-height: 2.2em; -} -#nav-above { - padding: 0 0 1.625em; -} -#nav-above { - display: none; -} -.paged #nav-above { - display: block; -} -.nav-previous { - float: left; - width: 50%; -} -.nav-next { - float: right; - text-align: right; - width: 50%; -} -#content nav .meta-nav { - font-weight: normal; -} - -/* Singular navigation */ -#nav-single { - float: right; - position: relative; - top: -0.3em; - text-align: right; - z-index: 1; -} -#nav-single .nav-previous, -#nav-single .nav-next { - float: none; - width: auto; -} -#nav-single .nav-next { - padding-left: .5em; -} - - -/* =Widgets ------------------------------------------------ */ - -.widget-area { - font-size: 12px; -} -.widget { - clear: both; - margin: 0 0 2.2em; -} -.widget-title { - color: #666; - font-size: 10px; - font-weight: 500; - letter-spacing: 0.1em; - line-height: 2.6em; - text-transform: uppercase; -} -.widget ul { - font-size: 15px; - margin: 0; -} -.widget ul ul { - margin-left: 1.5em; -} -.widget ul li { - color: #777; - font-size: 13px; -} -.widget a { - font-weight: bold; - text-decoration: none; -} -.widget a:hover, -.widget a:focus, -.widget a:active { - text-decoration: underline; -} - -/* Search Widget */ -.widget_search form { - margin: 0 0 1.625em; -} -.widget_search #s { - width: 77%; -} -.widget_search #searchsubmit { - background: #ddd; - border: 1px solid #ccc; - -webkit-box-shadow: inset 0px -1px 1px rgba(0, 0, 0, 0.09); - -moz-box-shadow: inset 0px -1px 1px rgba(0, 0, 0, 0.09); - box-shadow: inset 0px -1px 1px rgba(0, 0, 0, 0.09); - color: #888; - font-size: 13px; - line-height: 25px; - position: relative; - top: -2px; -} -.widget_search #searchsubmit:active { - background: #1982d1; - border-color: #0861a5; - -webkit-box-shadow: inset 0px 1px 1px rgba(0, 0, 0, 0.1); - -moz-box-shadow: inset 0px 1px 1px rgba(0, 0, 0, 0.1); - box-shadow: inset 0px 1px 1px rgba(0, 0, 0, 0.1); - color: #bfddf3; -} - -/* Ephemera Widget */ -section.ephemera ol, -.widget_twentyeleven_ephemera ol { - list-style: square; - margin: 5px 0 0; -} -.widget_twentyeleven_ephemera .widget-entry-title { - font-size: 15px; - font-weight: bold; - padding: 0; -} -.widget_twentyeleven_ephemera .comments-link a, -.widget_twentyeleven_ephemera .comments-link > span { - color: #666; - display: block; - font-size: 10px; - font-weight: 500; - line-height: 2.76333em; - text-transform: uppercase; -} -section.ephemera .entry-title .comments-link a:hover, -.widget_twentyeleven_ephemera .entry-title .comments-link a:hover { -} -section.ephemera .entry-title a span { - color: #29628d; -} - -/* Twitter */ -.widget_twitter li { - list-style-type: none; - margin-bottom: 14px; -} -.widget_twitter .timesince { - display: block; - font-size: 11px; - margin-right: -10px; - text-align: right; -} - -/* Widget Image */ -.widget_image img { - height: auto; - max-width: 100%; -} - -/* Calendar Widget */ - -.widget_calendar #wp-calendar { - color: #555; - width: 95%; - text-align: center; -} -.widget_calendar #wp-calendar caption, -.widget_calendar #wp-calendar td, -.widget_calendar #wp-calendar th { - text-align: center; -} -.widget_calendar #wp-calendar caption { - font-size: 11px; - font-weight: 500; - padding: 5px 0 3px 0; - text-transform: uppercase; -} -.widget_calendar #wp-calendar th { - background: #f4f4f4; - border-top: 1px solid #ccc; - border-bottom: 1px solid #ccc; - font-weight: bold; -} -.widget_calendar #wp-calendar tfoot td { - background: #f4f4f4; - border-top: 1px solid #ccc; - border-bottom: 1px solid #ccc; -} - - -/* =Comments ------------------------------------------------ */ - -#comments-title { - color: #666; - font-size: 10px; - font-weight: 500; - line-height: 2.6em; - padding: 0 0 2.6em; - text-transform: uppercase; -} -.nopassword, -.nocomments { - color: #aaa; - font-size: 24px; - font-weight: 100; - margin: 26px 0; - text-align: center; -} -.commentlist { - list-style: none; - margin: 0 auto; - width: 68.9%; -} -.content .commentlist, -.page-template-sidebar-page-php .commentlist { - width: 100%; /* reset the width for the one-column and sidebar page layout */ -} -.commentlist > li.comment { - background: #f6f6f6; - border: 1px solid #ddd; - -moz-border-radius: 3px; - border-radius: 3px; - margin: 0 0 1.625em; - padding: 1.625em; - position: relative; -} -.commentlist .pingback { - margin: 0 0 1.625em; - padding: 0 1.625em; -} -.commentlist .children { - list-style: none; - margin: 0; -} -.commentlist .children li.comment { - background: #fff; - border-left: 1px solid #ddd; - -moz-border-radius: 0 3px 3px 0; - border-radius: 0 3px 3px 0; - margin: 1.625em 0 0; - padding: 1.625em; - position: relative; -} -.commentlist .children li.comment .fn { - display: block; -} -.comment-meta .fn { - font-style: normal; -} -.comment-meta { - color: #666; - font-size: 12px; - line-height: 2.2em; -} -.commentlist .children li.comment .comment-meta { - line-height: 1.625em; - margin-left: 50px; -} -.commentlist .children li.comment .comment-content { - margin: 1.625em 0 0; -} -.comment-meta a { - font-weight: bold; -} -.comment-meta a:focus, -.comment-meta a:active, -.comment-meta a:hover { -} -.commentlist .avatar { - -moz-border-radius: 3px; - border-radius: 3px; - -webkit-box-shadow: 0 1px 2px #ccc; - -moz-box-shadow: 0 1px 2px #ccc; - box-shadow: 0 1px 2px #ccc; - left: -102px; - padding: 0; - position: absolute; - top: 0; -} -.commentlist > li:before { - content: url(images/comment-arrow.png); - left: -21px; - position: absolute; -} -.commentlist > li.pingback:before { - content: ''; -} -.commentlist .children .avatar { - background: none; - -webkit-box-shadow: none; - -moz-box-shadow: none; - box-shadow: none; - left: 2.2em; - padding: 0; - top: 2.2em; -} -a.comment-reply-link { - background: #eee; - -moz-border-radius: 3px; - border-radius: 3px; - color: #666; - display: inline-block; - font-size: 12px; - padding: 0 8px; - text-decoration: none; -} -a.comment-reply-link:hover, -a.comment-reply-link:focus, -a.comment-reply-link:active { - background: #888; - color: #fff; -} -a.comment-reply-link > span { - display: inline-block; - position: relative; - top: -1px; -} - -/* Post author highlighting */ -.commentlist > li.bypostauthor { - background: #ddd; - border-color: #d3d3d3; -} -.commentlist > li.bypostauthor .comment-meta { - color: #575757; -} -.commentlist > li.bypostauthor .comment-meta a:focus, -.commentlist > li.bypostauthor .comment-meta a:active, -.commentlist > li.bypostauthor .comment-meta a:hover { -} -.commentlist > li.bypostauthor:before { - content: url(images/comment-arrow-bypostauthor.png); -} - -/* Post Author threaded comments */ -.commentlist .children > li.bypostauthor { - background: #ddd; - border-color: #d3d3d3; -} - -/* sidebar-page.php comments */ -/* Make sure we have room for our comment avatars */ -.page-template-sidebar-page-php .commentlist > li.comment, -.page-template-sidebar-page-php.commentlist .pingback { - margin-left: 102px; - width: auto; -} -/* And a full-width comment form */ -.page-template-sidebar-page-php #respond { - width: auto; -} - -/* Comment Form */ -#respond { - background: #ddd; - border: 1px solid #d3d3d3; - -moz-border-radius: 3px; - border-radius: 3px; - margin: 0 auto 1.625em; - padding: 1.625em; - position: relative; - width: 68.9%; -} -#respond input[type="text"], -#respond textarea { - background: #fff; - border: 4px solid #eee; - -moz-border-radius: 5px; - border-radius: 5px; - -webkit-box-shadow: inset 0 1px 3px rgba(204,204,204,0.95); - -moz-box-shadow: inset 0 1px 3px rgba(204,204,204,0.95); - box-shadow: inset 0 1px 3px rgba(204,204,204,0.95); - position: relative; - padding: 10px; - text-indent: 80px; -} -#respond .comment-form-author, -#respond .comment-form-email, -#respond .comment-form-url, -#respond .comment-form-comment { - position: relative; -} -#respond .comment-form-author label, -#respond .comment-form-email label, -#respond .comment-form-url label, -#respond .comment-form-comment label { - background: #eee; - -webkit-box-shadow: 1px 2px 2px rgba(204,204,204,0.8); - -moz-box-shadow: 1px 2px 2px rgba(204,204,204,0.8); - box-shadow: 1px 2px 2px rgba(204,204,204,0.8); - color: #555; - display: inline-block; - font-size: 13px; - left: 4px; - min-width: 60px; - padding: 4px 10px; - position: relative; - top: 40px; - z-index: 1; -} -#respond input[type="text"]:focus, -#respond textarea:focus { - text-indent: 0; - z-index: 1; -} -#respond textarea { - resize: vertical; - width: 95%; -} -#respond .comment-form-author .required, -#respond .comment-form-email .required { - color: #bd3500; - font-size: 22px; - font-weight: bold; - left: 75%; - position: absolute; - top: 45px; - z-index: 1; -} -#respond .comment-notes, -#respond .logged-in-as { - font-size: 13px; -} -#respond p { - margin: 10px 0; -} -#respond .form-submit { - float: right; - margin: -20px 0 10px; -} -#respond input#submit { - background: #222; - border: none; - -moz-border-radius: 3px; - border-radius: 3px; - -webkit-box-shadow: 0px 1px 2px rgba(0,0,0,0.3); - -moz-box-shadow: 0px 1px 2px rgba(0,0,0,0.3); - box-shadow: 0px 1px 2px rgba(0,0,0,0.3); - color: #eee; - cursor: pointer; - font-size: 15px; - margin: 20px 0; - padding: 5px 42px 5px 22px; - position: relative; - left: 30px; - text-shadow: 0 -1px 0 rgba(0,0,0,0.3); -} -#respond input#submit:active { - background: #1982d1; - color: #bfddf3; -} -#respond #cancel-comment-reply-link { - color: #666; - margin-left: 10px; - text-decoration: none; -} -#respond .logged-in-as a:hover, -#respond #cancel-comment-reply-link:hover { - text-decoration: underline; -} -.commentlist #respond { - margin: 1.625em 0 0; - width: auto; -} -#reply-title { - color: #373737; - font-size: 24px; - font-weight: bold; - line-height: 30px; -} -#cancel-comment-reply-link { - color: #888; - display: block; - font-size: 10px; - font-weight: normal; - line-height: 2.2em; - letter-spacing: 0.05em; - position: absolute; - right: 1.625em; - text-decoration: none; - text-transform: uppercase; - top: 1.1em; -} -#cancel-comment-reply-link:focus, -#cancel-comment-reply-link:active, -#cancel-comment-reply-link:hover { - color: #ff4b33; -} -#respond label { - line-height: 2.2em; -} -#respond input[type=text] { - display: block; - height: 24px; - width: 75%; -} -#respond p { - font-size: 12px; -} -p.comment-form-comment { - margin: 0; -} -.form-allowed-tags { - display: none; -} - - -/* =Footer ------------------------------------------------ */ - -#colophon { - clear: both; -} -#supplementary { - border-top: 1px solid #ddd; - padding: 1.625em 7.6%; - overflow: hidden; -} - -/* Two Footer Widget Areas */ -#supplementary.two .widget-area { - float: left; - margin-right: 3.7%; - width: 48.1%; -} -#supplementary.two .widget-area + .widget-area { - margin-right: 0; -} - -/* Three Footer Widget Areas */ -#supplementary.three .widget-area { - float: left; - margin-right: 3.7%; - width: 30.85%; -} -#supplementary.three .widget-area + .widget-area + .widget-area { - margin-right: 0; -} - -/* Site Generator Line */ -#site-generator { - background: #f9f9f9; - border-top: 1px solid #ddd; - color: #666; - font-size: 12px; - line-height: 2.2em; - padding: 2.2em 0.5em; - text-align: center; -} -#site-generator a { - color: #555; - font-weight: bold; -} -#site-generator .sep { - background: url(images/wordpress.png) center left no-repeat; - color: transparent; - display: inline-block; - height: 16px; - line-height: 16px; - margin: 0 7px; - width: 16px; -} - - -/* =Responsive Structure ------------------------------------------------ */ - -@media (max-width: 800px) { - /* Simplify the basic layout */ - #main #content { - margin: 0 7.6%; - width: auto; - } - #nav-below { - border-bottom: 1px solid #ddd; - margin-bottom: 1.625em; - } - #main #secondary { - float: none; - margin: 0 7.6%; - width: auto; - } - /* Simplify the showcase template */ - .page-template-showcase-php .featured-posts { - min-height: 280px; - } - .featured-posts section.featured-post { - height: auto; - } - .page-template-showcase-php section.recent-posts { - float: none; - margin: 0; - width: 100%; - } - .page-template-showcase-php #main .widget-area { - float: none; - margin: 0; - width: auto; - } - .page-template-showcase-php .other-recent-posts { - border-bottom: 1px solid #ddd; - } - /* Simplify the showcase template when small feature */ - section.featured-post .attachment-small-feature, - .one-column section.featured-post .attachment-small-feature { - border: none; - display: block; - float: left; - height: auto; - margin: 0.625em auto 1.025em; - max-width: 30%; - position: static; - } - article.feature-image.small { - float: right; - margin: 0 0 1.625em; - width: 64%; - } - .one-column article.feature-image.small .entry-summary { - height: auto; - } - article.feature-image.small .entry-summary p a { - left: 0; - padding-left: 20px; - padding-right: 20px; - width: auto; - } - /* Remove the margin on singular articles */ - .singular .entry-header, - .singular .entry-content, - .singular footer.entry-meta, - .singular #comments-title { - width: 100%; - } - /* Simplify the pullquotes and pull styles */ - .singular blockquote.pull { - margin: 0 0 1.625em; - } - .singular .pull.alignleft { - margin: 0 1.625em 0 0; - } - .singular .pull.alignright { - margin: 0 0 0 1.625em; - } - .singular .entry-meta .edit-link a { - left: 0; - position: absolute; - top: 40px; - } - .singular #author-info { - margin: 2.2em -8.8% 0; - padding: 20px 8.8%; - } - /* Make sure we have room for our comment avatars */ - .commentlist { - width: 100%; - } - .commentlist > li.comment, - .commentlist .pingback { - margin-left: 102px; - width: auto; - } - /* And a full-width comment form */ - #respond { - width: auto; - } - /* No need to float footer widgets at this size */ - #colophon #supplementary .widget-area { - float: none; - margin-right: 0; - width: auto; - } - /* No need to float 404 widgets at this size */ - .error404 #main .widget { - float: none; - margin-right: 0; - width: auto; - } - -} -@media (max-width: 650px) { - /* @media (max-width: 650px) Reduce font-sizes for better readability on smaller devices */ - body, input, textarea { - font-size: 13px; - } - #site-title a { - font-size: 24px; - } - #site-description { - font-size: 12px; - } - #access ul { - font-size: 12px; - } - article.intro .entry-content { - font-size: 12px; - } - .entry-title { - font-size: 21px; - } - .featured-post .entry-title { - font-size: 14px; - } - .singular .entry-title { - font-size: 28px; - } - .entry-meta { - font-size: 12px; - } - blockquote { - margin: 0; - } - blockquote.pull { - font-size: 17px; - } - /* Reposition the site title and description slightly */ - #site-title { - padding: 5.30625em 0 0; - } - #site-title, - #site-description { - margin-right: 0; - } - /* Make sure the logo and search form don't collide */ - #branding #searchform { - top: 1.625em !important; - } - /* Floated content doesn't work well at this size */ - .alignleft, - .alignright { - float: none; - margin-left: 0; - margin-right: 0; - } - /* Make sure the post-post navigation doesn't collide with anything */ - #nav-single { - display: block; - position: static; - } - .singular .hentry { - padding: 1.625em 0 0; - } - .singular.page .hentry { - padding: 1.625em 0 0; - } - /* Talking avatars take up too much room at this size */ - .commentlist > li.comment, - .commentlist > li.pingback { - margin-left: 0 !important; - } - .commentlist .avatar { - background: transparent; - display: block; - padding: 0; - position: static; - } - .commentlist .children .avatar { - background: none; - left: 2.2em; - padding: 0; - position: absolute; - top: 2.2em; - } - /* Use the available space in the smaller comment form */ - #respond input[type="text"] { - width: 95%; - } - #respond .comment-form-author .required, - #respond .comment-form-email .required { - left: 95%; - } - #content .gallery-columns-3 .gallery-item { - width: 31%; - padding-right: 2%; - } - #content .gallery-columns-3 .gallery-item img { - width: 100%; - height: auto; - } - -} -@media (max-width: 450px) { - #content .gallery-columns-2 .gallery-item { - width: 45%; - padding-right: 4%; - } - #content .gallery-columns-2 .gallery-item img { - width: 100%; - height: auto; - } - -} -@media only screen and (min-device-width: 320px) and (max-device-width: 480px) { - body { - padding: 0; - } - #page { - margin-top: 0; - } - #branding { - border-top: none; - } - -} - - -/* =Print ------------------------------------------------ */ - -@media print { - body { - background: none !important; - font-size: 10pt; - } - footer.entry-meta a[rel=bookmark]:link:after, - footer.entry-meta a[rel=bookmark]:visited:after { - content: " [" attr(href) "] "; /* Show URLs */ - } - #page { - clear: both !important; - display: block !important; - float: none !important; - max-width: 100%; - position: relative !important; - } - #branding { - border-top: none !important; - padding: 0; - } - #branding hgroup { - margin: 0; - } - #site-title a { - font-size: 21pt; - } - #site-description { - font-size: 10pt; - } - #branding #searchform { - display: none; - } - #branding img { - display: none; - } - #access { - display: none; - } - #main { - border-top: none; - box-shadow: none; - } - #primary { - float: left; - margin: 0; - width: 100%; - } - #content { - margin: 0; - width: auto; - } - .singular #content { - margin: 0; - width: 100%; - } - .singular .entry-header .entry-meta { - position: static; - } - .entry-meta .edit-link a { - display: none; - } - #content nav { - display: none; - } - .singular .entry-header, - .singular .entry-content, - .singular footer.entry-meta, - .singular #comments-title { - margin: 0; - width: 100%; - } - .singular .hentry { - padding: 0; - } - .entry-title, - .singular .entry-title { - font-size: 21pt; - } - .entry-meta { - font-size: 10pt; - } - .entry-header .comments-link { - display: none; - } - .page-link { - display: none; - } - .singular #author-info { - background: none; - border-bottom: none; - border-top: none; - margin: 2.2em 0 0; - padding: 0; - } - #respond { - display: none; - } - .widget-area { - display: none; - } - #colophon { - display: none; - } - - /* Comments */ - .commentlist > li.comment { - background: none; - border: 1px solid #ddd; - -moz-border-radius: 3px 3px 3px 3px; - border-radius: 3px 3px 3px 3px; - margin: 0 auto 1.625em; - padding: 1.625em; - position: relative; - width: auto; - } - .commentlist .avatar { - height: 39px; - left: 2.2em; - top: 2.2em; - width: 39px; - } - .commentlist li.comment .comment-meta { - line-height: 1.625em; - margin-left: 50px; - } - .commentlist li.comment .fn { - display: block; - } - .commentlist li.comment .comment-content { - margin: 1.625em 0 0; - } - .commentlist .comment-edit-link { - display: none; - } - .commentlist > li::before, - .commentlist > li.bypostauthor::before { - content: ''; - } - .commentlist .reply { - display: none; - } - - /* Post author highlighting */ - .commentlist > li.bypostauthor { - color: #444; - } - .commentlist > li.bypostauthor .comment-meta { - color: #666; - } - .commentlist > li.bypostauthor:before { - content: none; - } - - /* Post Author threaded comments */ - .commentlist .children > li.bypostauthor { - background: #fff; - border-color: #ddd; - } - .commentlist .children > li.bypostauthor > article, - .commentlist .children > li.bypostauthor > article .comment-meta { - color: #666; - } - -} - - -/* =IE7 ------------------------------------------------ */ - -#ie7 article.intro { - margin-left: -7.6%; - margin-right: -7.6%; - padding-left: -7.6%; - padding-right: -7.6%; - max-width: 1000px; -} -#ie7 section.featured-post { - margin-left: -7.6%; - margin-right: -7.6%; - max-width: 850px; -} -#ie7 section.recent-posts { - margin-right: 7.6%; +/* +Theme Name: HuskyPress +Theme URI: +Author: the WordPress team +Author URI: http://uconn.edu +Description: Adapted from the Wordpress TwentyEleven theme. +Version: 1.0 +License: GNU General Public License +License URI: license.txt +Tags: dark, light, white, black, gray, one-column, two-columns, left-sidebar, right-sidebar, fixed-width, flexible-width, custom-background, custom-colors, custom-header, custom-menu, editor-style, featured-image-header, featured-images, full-width-template, microformats, post-formats, rtl-language-support, sticky-post, theme-options, translation-ready +*/ + +/* =Reset default browser CSS. Based on work by Eric Meyer: http://meyerweb.com/eric/tools/css/reset/index.html +-------------------------------------------------------------- */ + +html, body, div, span, applet, object, iframe, +h1, h2, h3, h4, h5, h6, p, blockquote, pre, +a, abbr, acronym, address, big, cite, code, +del, dfn, em, font, ins, kbd, q, s, samp, +small, strike, strong, sub, sup, tt, var, +dl, dt, dd, ol, ul, li, +fieldset, form, label, legend, +table, caption, tbody, tfoot, thead, tr, th, td { + border: 0; + font-family: inherit; + font-size: 100%; + font-style: inherit; + font-weight: inherit; + margin: 0; + outline: 0; + padding: 0; + vertical-align: baseline; +} +:focus {/* remember to define focus styles! */ + outline: 0; +} +body { + background: #fff; + line-height: 1; +} +ol, ul { + list-style: none; +} +table {/* tables still need 'cellspacing="0"' in the markup */ + border-collapse: separate; + border-spacing: 0; +} +caption, th, td { + font-weight: normal; + text-align: left; +} +blockquote:before, blockquote:after, +q:before, q:after { + content: ""; +} +blockquote, q { + quotes: "" ""; +} +a img { + border: 0; +} +article, aside, details, figcaption, figure, +footer, header, hgroup, menu, nav, section { + display: block; +} + + +/* =Structure +----------------------------------------------- */ + +body { + padding: 0 2em; +} +#page { + margin: 2em auto; + max-width: 1000px; +} +#branding hgroup { + margin: 0 7.6%; +} +#access div { + margin: 0 7.6%; +} +#primary { + float: left; + margin: 0 -26.4% 0 0; + width: 100%; +} +#content { + margin: 0 34% 0 7.6%; + width: 58.4%; +} +#secondary { + float: right; + margin-right: 7.6%; + width: 18.8%; +} + +/* Singular */ +.singular #primary { + margin: 0; +} +.singular #content, +.left-sidebar.singular #content { + margin: 0 7.6%; + position: relative; + width: auto; +} +.singular .entry-header, +.singular .entry-content, +.singular footer.entry-meta, +.singular #comments-title { + margin: 0 auto; + width: 68.9%; +} + +/* Attachments */ +.singular .image-attachment .entry-content { + margin: 0 auto; + width: auto; +} +.singular .image-attachment .entry-description { + margin: 0 auto; + width: 68.9%; +} + +/* Showcase */ +.page-template-showcase-php #primary, +.left-sidebar.page-template-showcase-php #primary { + margin: 0; +} +.page-template-showcase-php #content, +.left-sidebar.page-template-showcase-php #content { + margin: 0 7.6%; + width: auto; +} +.page-template-showcase-php section.recent-posts { + float: right; + margin: 0 0 0 31%; + width: 69%; +} +.page-template-showcase-php #main .widget-area { + float: left; + margin: 0 -22.15% 0 0; + width: 22.15%; +} + +/* error404 */ +.error404 #primary { + float: none; + margin: 0; +} +.error404 #primary #content { + margin: 0 7.6%; + width: auto; +} + +/* Alignment */ +.alignleft { + display: inline; + float: left; + margin-right: 1.625em; +} +.alignright { + display: inline; + float: right; + margin-left: 1.625em; +} +.aligncenter { + clear: both; + display: block; + margin-left: auto; + margin-right: auto; +} + +/* Right Content */ +.left-sidebar #primary { + float: right; + margin: 0 0 0 -26.4%; + width: 100%; +} +.left-sidebar #content { + margin: 0 7.6% 0 34%; + width: 58.4%; +} +.left-sidebar #secondary { + float: left; + margin-left: 7.6%; + margin-right: 0; + width: 18.8%; +} + +/* One column */ +.one-column #page { + max-width: 690px; +} +.one-column #content { + margin: 0 7.6%; + width: auto; +} +.one-column #nav-below { + border-bottom: 1px solid #ddd; + margin-bottom: 1.625em; +} +.one-column #secondary { + float: none; + margin: 0 7.6%; + width: auto; +} +/* Simplify the showcase template */ +.one-column .page-template-showcase-php section.recent-posts { + float: none; + margin: 0; + width: 100%; +} +.one-column .page-template-showcase-php #main .widget-area { + float: none; + margin: 0; + width: auto; +} +.one-column .page-template-showcase-php .other-recent-posts { + border-bottom: 1px solid #ddd; +} +/* Simplify the showcase template when small feature */ +.one-column section.featured-post .attachment-small-feature { + border: none; + display: block; + height: auto; + max-width: 60%; + position: static; +} +.one-column article.feature-image.small { + margin: 0 0 1.625em; + padding: 0; +} +.one-column article.feature-image.small .entry-title { + font-size: 20px; + line-height: 1.3em; +} +.one-column article.feature-image.small .entry-summary { + height: 150px; + overflow: hidden; + padding: 0; + text-overflow: ellipsis; +} +.one-column article.feature-image.small .entry-summary a { + left: -9%; +} +/* Remove the margin on singular articles */ +.one-column.singular .entry-header, +.one-column.singular .entry-content, +.one-column.singular footer.entry-meta, +.one-column.singular #comments-title { + width: 100%; +} +/* Simplify the pullquotes and pull styles */ +.one-column.singular blockquote.pull { + margin: 0 0 1.625em; +} +.one-column.singular .pull.alignleft { + margin: 0 1.625em 0 0; +} +.one-column.singular .pull.alignright { + margin: 0 0 0 1.625em; +} +.one-column.singular .entry-meta .edit-link a { + position: absolute; + left: 0; + top: 40px; +} +.one-column.singular #author-info { + margin: 2.2em -8.8% 0; + padding: 20px 8.8%; +} +/* Make sure we have room for our comment avatars */ +.one-column .commentlist > li.comment { + margin-left: 102px; + width: auto; +} +/* Make sure the logo and search form don't collide */ +.one-column #branding #searchform { + right: 40px; + top: 4em; +} +/* Talking avatars take up too much room at this size */ +.one-column .commentlist > li.comment { + margin-left: 0; +} +.one-column .commentlist > li.comment .comment-meta, +.one-column .commentlist > li.comment .comment-content { + margin-right: 85px; +} +.one-column .commentlist .avatar { + background: transparent; + display: block; + padding: 0; + top: 1.625em; + left: auto; + right: 1.625em; +} +.one-column .commentlist .children .avatar { + background: none; + padding: 0; + position: absolute; + top: 2.2em; + left: 2.2em; +} +.one-column #respond { + width: auto; +} + + +/* =Global +----------------------------------------------- */ + +body, input, textarea { + color: #373737; + font: 15px "Helvetica Neue", Helvetica, Arial, sans-serif; + font-weight: 300; + line-height: 1.625; +} +body { + background: #e2e2e2; +} +#page { + background: #fff; +} + +/* Headings */ +h1,h2,h3,h4,h5,h6 { + clear: both; +} +hr { + background-color: #ccc; + border: 0; + height: 1px; + margin-bottom: 1.625em; +} + +/* Text elements */ +p { + margin-bottom: 1.625em; +} +ul, ol { + margin: 0 0 1.625em 2.5em; +} +ul { + list-style: square; +} +ol { + list-style-type: decimal; +} +ol ol { + list-style: upper-alpha; +} +ol ol ol { + list-style: lower-roman; +} +ol ol ol ol { + list-style: lower-alpha; +} +ul ul, ol ol, ul ol, ol ul { + margin-bottom: 0; +} +dl { + margin: 0 1.625em; +} +dt { + font-weight: bold; +} +dd { + margin-bottom: 1.625em; +} +strong { + font-weight: bold; +} +cite, em, i { + font-style: italic; +} +blockquote { + font-family: Georgia, "Bitstream Charter", serif; + font-style: italic; + font-weight: normal; + margin: 0 3em; +} +blockquote em, blockquote i, blockquote cite { + font-style: normal; +} +blockquote cite { + color: #666; + font: 12px "Helvetica Neue", Helvetica, Arial, sans-serif; + font-weight: 300; + letter-spacing: 0.05em; + text-transform: uppercase; +} +pre { + background: #f4f4f4; + font: 13px "Courier 10 Pitch", Courier, monospace; + line-height: 1.5; + margin-bottom: 1.625em; + overflow: auto; + padding: 0.75em 1.625em; +} +code, kbd { + font: 13px Monaco, Consolas, "Andale Mono", "DejaVu Sans Mono", monospace; +} +abbr, acronym, dfn { + border-bottom: 1px dotted #666; + cursor: help; +} +address { + display: block; + margin: 0 0 1.625em; +} +ins { + background: #fff9c0; + text-decoration: none; +} +sup, +sub { + font-size: 10px; + height: 0; + line-height: 1; + position: relative; + vertical-align: baseline; +} +sup { + bottom: 1ex; +} +sub { + top: .5ex; +} + +/* Forms */ +input[type=text], +input[type=password], +textarea { + background: #fafafa; + -moz-box-shadow: inset 0 1px 1px rgba(0,0,0,0.1); + -webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,0.1); + box-shadow: inset 0 1px 1px rgba(0,0,0,0.1); + border: 1px solid #ddd; + color: #888; +} +input[type=text]:focus, +textarea:focus { + color: #373737; +} +textarea { + padding-left: 3px; + width: 98%; +} +input[type=text] { + padding: 3px; +} +input#s { + background: url(images/search.png) no-repeat 5px 6px; + -moz-border-radius: 2px; + border-radius: 2px; + font-size: 14px; + height: 22px; + line-height: 1.2em; + padding: 4px 10px 4px 28px; +} +input#searchsubmit { + display: none; +} + +/* Links */ +a { + color: #1982d1; + text-decoration: none; +} +a:focus, +a:active, +a:hover { + text-decoration: underline; +} + +/* Assistive text */ +.assistive-text { + position: absolute !important; + clip: rect(1px 1px 1px 1px); /* IE6, IE7 */ + clip: rect(1px, 1px, 1px, 1px); +} +#access a.assistive-text:active, +#access a.assistive-text:focus { + background: #eee; + border-bottom: 1px solid #ddd; + color: #1982d1; + clip: auto !important; + font-size: 12px; + position: absolute; + text-decoration: underline; + top: 0; + left: 7.6%; +} + + +/* =Header +----------------------------------------------- */ + +#branding { + border-top: 2px solid #bbb; + + position: relative; + z-index: 9999; +} +#site-title { + margin-right: 270px; + padding: 3.65625em 0 0; +} +#site-title a { + color: #111; + font-size: 30px; + font-weight: bold; + line-height: 36px; + text-decoration: none; +} +#site-title a:hover, +#site-title a:focus, +#site-title a:active { + color: #1982d1; +} +#site-description { + color: #7a7a7a; + font-size: 14px; + margin: 0 270px 3.65625em 0; +} +#branding img { + height: auto; + margin-bottom: -7px; + width: 100%; +} + + +/* =Menu +-------------------------------------------------------------- */ + +#access { + background: #222; /* Show a solid color for older browsers */ + background: -moz-linear-gradient(#252525, #0a0a0a); + background: -o-linear-gradient(#252525, #0a0a0a); + background: -webkit-gradient(linear, 0% 0%, 0% 100%, from(#252525), to(#0a0a0a)); /* older webkit syntax */ + background: -webkit-linear-gradient(#252525, #0a0a0a); + -webkit-box-shadow: rgba(0, 0, 0, 0.4) 0px 1px 2px; + -moz-box-shadow: rgba(0, 0, 0, 0.4) 0px 1px 2px; + box-shadow: rgba(0, 0, 0, 0.4) 0px 1px 2px; + clear: both; + display: block; + float: left; + margin: 0 auto 6px; + width: 100%; +} +#access ul { + font-size: 13px; + list-style: none; + margin: 0 0 0 -0.8125em; + padding-left: 0; +} +#access li { + float: left; + position: relative; +} +#access a { + color: #eee; + display: block; + line-height: 3.333em; + padding: 0 1.2125em; + text-decoration: none; +} +#access ul ul { + -moz-box-shadow: 0 3px 3px rgba(0,0,0,0.2); + -webkit-box-shadow: 0 3px 3px rgba(0,0,0,0.2); + box-shadow: 0 3px 3px rgba(0,0,0,0.2); + display: none; + float: left; + margin: 0; + position: absolute; + top: 3.333em; + left: 0; + width: 188px; + z-index: 99999; +} +#access ul ul ul { + left: 100%; + top: 0; +} +#access ul ul a { + background: #f9f9f9; + border-bottom: 1px dotted #ddd; + color: #444; + font-size: 13px; + font-weight: normal; + height: auto; + line-height: 1.4em; + padding: 10px 10px; + width: 168px; +} +#access li:hover > a, +#access ul ul :hover > a, +#access a:focus { + background: #efefef; +} +#access li:hover > a, +#access a:focus { + background: #f9f9f9; /* Show a solid color for older browsers */ + background: -moz-linear-gradient(#f9f9f9, #e5e5e5); + background: -o-linear-gradient(#f9f9f9, #e5e5e5); + background: -webkit-gradient(linear, 0% 0%, 0% 100%, from(#f9f9f9), to(#e5e5e5)); /* Older webkit syntax */ + background: -webkit-linear-gradient(#f9f9f9, #e5e5e5); + color: #373737; +} +#access ul li:hover > ul { + display: block; +} +#access .current-menu-item > a, +#access .current-menu-ancestor > a, +#access .current_page_item > a, +#access .current_page_ancestor > a { + font-weight: bold; +} + +/* Search Form */ +#branding #searchform { + position: absolute; + top: 3.8em; + right: 7.6%; + text-align: right; +} +#branding #searchform div { + margin: 0; +} +#branding #s { + float: right; + -webkit-transition-duration: 400ms; + -webkit-transition-property: width, background; + -webkit-transition-timing-function: ease; + -moz-transition-duration: 400ms; + -moz-transition-property: width, background; + -moz-transition-timing-function: ease; + -o-transition-duration: 400ms; + -o-transition-property: width, background; + -o-transition-timing-function: ease; + width: 72px; +} +#branding #s:focus { + background-color: #f9f9f9; + width: 196px; +} +#branding #searchsubmit { + display: none; +} +#branding .only-search #searchform { + top: 5px; + z-index: 1; +} +#branding .only-search #s { + background-color: #666; + border-color: #000; + color: #222; +} +#branding .only-search #s, +#branding .only-search #s:focus { + width: 85%; +} +#branding .only-search #s:focus { + background-color: #bbb; +} +#branding .with-image #searchform { + top: auto; + bottom: -27px; + max-width: 195px; +} +#branding .only-search + #access div { + padding-right: 205px; +} + + +/* =Content +----------------------------------------------- */ + +#main { + clear: both; + padding: 1.625em 0 0; +} +.page-title { + color: #666; + font-size: 10px; + font-weight: 500; + letter-spacing: 0.1em; + line-height: 2.6em; + margin: 0 0 2.6em; + text-transform: uppercase; +} +.page-title a { + font-size: 12px; + font-weight: bold; + letter-spacing: 0; + text-transform: none; +} +.hentry, +.no-results { + border-bottom: 1px solid #ddd; + margin: 0 0 1.625em; + padding: 0 0 1.625em; + position: relative; +} +.hentry:last-child, +.no-results { + border-bottom: none; +} +.blog .sticky .entry-header .entry-meta { + clip: rect(1px 1px 1px 1px); /* IE6, IE7 */ + clip: rect(1px, 1px, 1px, 1px); + position: absolute !important; +} +.entry-title, +.entry-header .entry-meta { + padding-right: 76px; +} +.entry-title { + clear: both; + color: #222; + font-size: 26px; + font-weight: bold; + line-height: 1.5em; + padding-bottom: .3em; + padding-top: 15px; +} +.entry-title, +.entry-title a { + color: #222; + text-decoration: none; +} +.entry-title a:hover, +.entry-title a:focus, +.entry-title a:active { + color: #1982d1; +} +.entry-meta { + color: #666; + clear: both; + font-size: 12px; + line-height: 18px; +} +.entry-meta a { + font-weight: bold; +} +.single-author .entry-meta .by-author { + display: none; +} +.entry-content, +.entry-summary { + padding: 1.625em 0 0; +} +.entry-content h1, +.entry-content h2, +.comment-content h1, +.comment-content h2 { + color: #000; + font-weight: bold; +} +.entry-content h3, +.comment-content h3 { + font-size: 10px; + letter-spacing: 0.1em; + line-height: 2.6em; + text-transform: uppercase; +} +.entry-content table, +.comment-content table { + border-bottom: 1px solid #ddd; + margin: 0 0 1.625em; + width: 100%; +} +.entry-content th, +.comment-content th { + color: #666; + font-size: 10px; + font-weight: 500; + letter-spacing: 0.1em; + line-height: 2.6em; + text-transform: uppercase; +} +.entry-content td, +.comment-content td { + border-top: 1px solid #ddd; + padding: 6px 10px 6px 0; +} +.entry-content #s { + width: 75%; +} +.comment-content ul, +.comment-content ol { + margin-bottom: 1.625em; +} +.comment-content ul ul, +.comment-content ol ol, +.comment-content ul ol, +.comment-content ol ul { + margin-bottom: 0; +} +dl.gallery-item { + margin: 0; +} +.page-link { + clear: both; + display: block; + margin: 0 0 1.625em; +} +.page-link a { + background: #eee; + color: #373737; + margin: 0; + padding: 2px 3px; + text-decoration: none; +} +.page-link a:hover { + background: #888; + color: #fff; + font-weight: bold; +} +.page-link span { + margin-right: 6px; +} +.entry-meta .edit-link a, +.commentlist .edit-link a { + background: #eee; + -moz-border-radius: 3px; + border-radius: 3px; + color: #666; + float: right; + font-size: 12px; + line-height: 1.5em; + font-weight: 300; + text-decoration: none; + padding: 0 8px; +} +.entry-meta .edit-link a:hover, +.commentlist .edit-link a:hover { + background: #888; + color: #fff; +} +.entry-content .edit-link { + clear: both; + display: block; +} + +/* Images */ +.entry-content img, +.comment-content img, +.widget img { + max-width: 97.5%; /* Fluid images for posts, comments, and widgets */ +} +img[class*="align"], +img[class*="wp-image-"], +img[class*="attachment-"] { + height: auto; /* Make sure images with WordPress-added height and width attributes are scaled correctly */ +} +img.size-full, +img.size-large { + max-width: 97.5%; + width: auto; /* Prevent stretching of full-size and large-size images with height and width attributes in IE8 */ + height: auto; /* Make sure images with WordPress-added height and width attributes are scaled correctly */ +} +.entry-content img.wp-smiley { + border: none; + margin-bottom: 0; + margin-top: 0; + padding: 0; +} +img.alignleft, +img.alignright, +img.aligncenter { + margin-bottom: 1.625em; +} +p img, +.wp-caption { + margin-top: 0.4em; +} +.wp-caption { + background: #eee; + margin-bottom: 1.625em; + max-width: 96%; + padding: 9px; +} +.wp-caption img { + display: block; + margin: 0 auto; + max-width: 98%; +} +.wp-caption .wp-caption-text, +.gallery-caption { + color: #666; + font-family: Georgia, serif; + font-size: 12px; +} +.wp-caption .wp-caption-text { + margin-bottom: 0.6em; + padding: 10px 0 5px 40px; + position: relative; +} +.wp-caption .wp-caption-text:before { + color: #666; + content: '\2014'; + font-size: 14px; + font-style: normal; + font-weight: bold; + margin-right: 5px; + position: absolute; + left: 10px; + top: 7px; +} +#content .gallery { + margin: 0 auto 1.625em; +} +#content .gallery a img { + border: none; +} +img#wpstats { + display: block; + margin: 0 auto 1.625em; +} +#content .gallery-columns-4 .gallery-item { + width: 23%; + padding-right: 2%; +} +#content .gallery-columns-4 .gallery-item img { + width: 100%; + height: auto; +} + +/* Image borders */ +img[class*="align"], +img[class*="wp-image-"], +#content .gallery .gallery-icon img {/* Add fancy borders to all WordPress-added images but not things like badges and icons and the like */ + border: 1px solid #ddd; + padding: 6px; +} +.wp-caption img { + border-color: #eee; +} +a:focus img[class*="align"], +a:hover img[class*="align"], +a:active img[class*="align"], +a:focus img[class*="wp-image-"], +a:hover img[class*="wp-image-"], +a:active img[class*="wp-image-"], +#content .gallery .gallery-icon a:focus img, +#content .gallery .gallery-icon a:hover img, +#content .gallery .gallery-icon a:active img {/* Add some useful style to those fancy borders for linked images ... */ + background: #eee; + border-color: #bbb; +} +.wp-caption a:focus img, +.wp-caption a:active img, +.wp-caption a:hover img {/* ... including captioned images! */ + background: #fff; + border-color: #ddd; +} + +/* Make sure embeds and iframes fit their containers */ +embed, +iframe, +object { + max-width: 100%; +} + +/* Password Protected Posts */ +.post-password-required .entry-header .comments-link { + margin: 1.625em 0 0; +} +.post-password-required input[type=password] { + margin: 0.8125em 0; +} +.post-password-required input[type=password]:focus { + background: #f7f7f7; +} + +/* Author Info */ +#author-info { + font-size: 12px; + overflow: hidden; +} +.singular #author-info { + background: #f9f9f9; + border-top: 1px solid #ddd; + border-bottom: 1px solid #ddd; + margin: 2.2em -35.6% 0 -35.4%; + padding: 20px 35.4%; +} +.archive #author-info { + border-bottom: 1px solid #ddd; + margin: 0 0 2.2em; + padding: 0 0 2.2em; +} +#author-avatar { + float: left; + margin-right: -78px; +} +#author-avatar img { + background: #fff; + -moz-border-radius: 3px; + border-radius: 3px; + -webkit-box-shadow: 0 1px 2px #bbb; + -moz-box-shadow: 0 1px 2px #bbb; + box-shadow: 0 1px 2px #bbb; + padding: 3px; +} +#author-description { + float: left; + margin-left: 108px; +} +#author-description h2 { + color: #000; + font-size: 15px; + font-weight: bold; + margin: 5px 0 10px; +} + +/* Comments link */ +.entry-header .comments-link a { + background: #eee url(images/comment-bubble.png) no-repeat; + color: #666; + font-size: 13px; + font-weight: normal; + line-height: 35px; + overflow: hidden; + padding: 0 0 0; + position: absolute; + top: 1.5em; + right: 0; + text-align: center; + text-decoration: none; + width: 43px; + height: 36px; +} +.entry-header .comments-link a:hover, +.entry-header .comments-link a:focus, +.entry-header .comments-link a:active { + background-color: #1982d1; + color: #fff; + color: rgba(255,255,255,0.8); +} +.entry-header .comments-link .leave-reply { + visibility: hidden; +} + +/* +Post Formats Headings +To hide the headings, display: none the ".entry-header .entry-format" selector, +and remove the padding rules below. +*/ +.entry-header .entry-format { + color: #666; + font-size: 10px; + font-weight: 500; + letter-spacing: 0.1em; + line-height: 2.6em; + position: absolute; + text-transform: uppercase; + top: -5px; +} +.entry-header hgroup .entry-title { + padding-top: 15px; +} +article.format-aside .entry-content, +article.format-link .entry-content, +article.format-status .entry-content { + padding: 20px 0 0; +} +article.format-status .entry-content { + min-height: 65px; +} +.recent-posts .entry-header .entry-format { + display: none; +} +.recent-posts .entry-header hgroup .entry-title { + padding-top: 0; +} + +/* Singular content styles for Posts and Pages */ +.singular .hentry { + border-bottom: none; + padding: 4.875em 0 0; + position: relative; +} +.singular.page .hentry { + padding: 3.5em 0 0; +} +.singular .entry-title { + color: #000; + font-size: 36px; + font-weight: bold; + line-height: 48px; +} +.singular .entry-title, +.singular .entry-header .entry-meta { + padding-right: 0; +} +.singular .entry-header .entry-meta { + position: absolute; + top: 0; + left: 0; +} +blockquote.pull { + font-size: 21px; + font-weight: bold; + line-height: 1.6125em; + margin: 0 0 1.625em; + text-align: center; +} +.singular blockquote.pull { + margin: 0 -22.25% 1.625em; +} +.pull.alignleft { + margin: 0 1.625em 0 0; + text-align: right; + width: 33%; +} +.singular .pull.alignleft { + margin: 0 1.625em 0 -22.25%; +} +.pull.alignright { + margin: 0 0 0 1.625em; + text-align: left; + width: 33%; +} +.singular .pull.alignright { + margin: 0 -22.25% 0 1.625em; +} +.singular blockquote.pull.alignleft, +.singular blockquote.pull.alignright { + width: 33%; +} +.singular .entry-meta .edit-link a { + bottom: auto; + left: 50px; + position: absolute; + right: auto; + top: 80px; +} + + +/* =Aside +----------------------------------------------- */ + +.format-aside .entry-title, +.format-aside .entry-header .comments-link { + display: none; +} +.singular .format-aside .entry-title { + display: block; +} +.format-aside .entry-content { + padding: 0; +} +.singular .format-aside .entry-content { + padding: 1.625em 0 0; +} + + +/* =Link +----------------------------------------------- */ + +.format-link .entry-title, +.format-link .entry-header .comments-link { + display: none; +} +.singular .format-link .entry-title { + display: block; +} +.format-link .entry-content { + padding: 0; +} +.singular .format-link .entry-content { + padding: 1.625em 0 0; +} + + +/* =Gallery +----------------------------------------------- */ + +.format-gallery .gallery-thumb { + float: left; + display: block; + margin: .375em 1.625em 0 0; +} + + +/* =Status +----------------------------------------------- */ + +.format-status .entry-title, +.format-status .entry-header .comments-link { + display: none; +} +.singular .format-status .entry-title { + display: block; +} +.format-status .entry-content { + padding: 0; +} +.singular .format-status .entry-content { + padding: 1.625em 0 0; +} +.format-status img.avatar { + -moz-border-radius: 3px; + border-radius: 3px; + -webkit-box-shadow: 0 1px 2px #ccc; + -moz-box-shadow: 0 1px 2px #ccc; + box-shadow: 0 1px 2px #ccc; + float: left; + margin: 4px 10px 2px 0; + padding: 0; +} + + +/* =Quote +----------------------------------------------- */ + +.format-quote blockquote { + color: #555; + font-size: 17px; + margin: 0; +} + + +/* =Image +----------------------------------------------- */ + +.indexed.format-image .entry-header { + min-height: 61px; /* Prevent the comment icon from colliding with the image when there is no title */ +} +.indexed.format-image .entry-content { + padding-top: 0.5em; +} +.indexed.format-image p, +.indexed.format-image p img { + margin-bottom: 0; +} +.indexed.format-image footer.entry-meta { + background: #ddd; + margin-top: -7px; + padding: 20px 30px; + overflow: hidden; +} +.indexed.format-image div.entry-meta { + display: inline-block; + float: left; + width: 35%; +} +.indexed.format-image div.entry-meta + div.entry-meta { + float: none; + width: 65%; +} +.indexed.format-image .entry-meta span.cat-links, +.indexed.format-image .entry-meta span.tag-links, +.indexed.format-image .entry-meta span.comments-link { + display: block; +} +.indexed.format-image footer.entry-meta a { + color: #444; +} +.indexed.format-image footer.entry-meta a:hover { + color: #fff; +} +#content .indexed.format-image img { + border: none; + max-width: 100%; + padding: 0; +} +.indexed.format-image .wp-caption { + background: #111; + margin-bottom: 0; + max-width: 96%; + padding: 11px; +} +.indexed.format-image .wp-caption .wp-caption-text { + color: #ddd; +} +.indexed.format-image .wp-caption .wp-caption-text:before { + color: #444; +} +.indexed.format-image a:hover img { + opacity: 0.8; +} + + +/* =error404 +----------------------------------------------- */ + +.error404 #main #searchform { + background: #f9f9f9; + border: 1px solid #ddd; + border-width: 1px 0; + margin: 0 -8.9% 1.625em; + overflow: hidden; + padding: 1.625em 8.9%; +} +.error404 #main #s { + width: 95%; +} +.error404 #main .widget { + clear: none; + float: left; + margin-right: 3.7%; + width: 30.85%; +} +.error404 #main .widget_archive { + margin-right: 0; +} +.error404 #main .widget_tag_cloud { + float: none; + margin-right: 0; + width: 100%; +} +.error404 .widgettitle { + font-size: 10px; + letter-spacing: 0.1em; + line-height: 2.6em; + text-transform: uppercase; +} + + +/* =Showcase +----------------------------------------------- */ + +h1.showcase-heading { + color: #666; + font-size: 10px; + font-weight: 500; + letter-spacing: 0.1em; + line-height: 2.6em; + text-transform: uppercase; +} + +/* Intro */ +article.intro { + background: #f9f9f9; + border-bottom: none; + margin: -1.855em -8.9% 1.625em; + padding: 0 8.9%; +} +article.intro .entry-title { + display: none; +} +article.intro .entry-content { + color: #111; + font-size: 16px; + padding: 1.625em 0 0.625em; +} +article.intro .edit-link a { + background: #aaa; + -moz-border-radius: 3px; + border-radius: 3px; + color: #fff; + font-size: 12px; + padding: 0 8px; + position: absolute; + top: 30px; + right: 20px; + text-decoration: none; +} +article.intro .edit-link a:hover, +article.intro .edit-link a:focus, +article.intro .edit-link a:active { + background: #777; +} + +/* Featured post */ +section.featured-post { + float: left; + margin: -1.625em -8.9% 1.625em; + padding: 1.625em 8.9% 0; + position: relative; + width: 100%; +} +section.featured-post .hentry { + border: none; + color: #666; + margin: 0; +} +section.featured-post .entry-meta { + clip: rect(1px 1px 1px 1px); /* IE6, IE7 */ + clip: rect(1px, 1px, 1px, 1px); + position: absolute !important; +} + +/* Small featured post */ +section.featured-post .attachment-small-feature { + float: right; + height: auto; + margin: 0 -8.9% 1.625em 0; + max-width: 59%; + position: relative; + right: -15px; +} +section.featured-post.small { + padding-top: 0; +} +section.featured-post .attachment-small-feature:hover, +section.featured-post .attachment-small-feature:focus, +section.featured-post .attachment-small-feature:active { + opacity: .8; +} +article.feature-image.small { + float: left; + margin: 0 0 1.625em; + width: 45%; +} +article.feature-image.small .entry-title { + line-height: 1.2em; +} +article.feature-image.small .entry-summary { + color: #555; + font-size: 13px; +} +article.feature-image.small .entry-summary p a { + background: #222; + color: #eee; + display: block; + left: -23.8%; + padding: 9px 26px 9px 85px; + position: relative; + text-decoration: none; + top: 20px; + width: 180px; + z-index: 1; +} +article.feature-image.small .entry-summary p a:hover { + background: #1982d1; + color: #eee; + color: rgba(255,255,255,0.8); +} + +/* Large featured post */ +section.feature-image.large { + border: none; + max-height: 288px; + padding: 0; + width: 100%; +} +section.feature-image.large .showcase-heading { + display: none; +} +section.feature-image.large .hentry { + border-bottom: none; + left: 9%; + margin: 1.625em 9% 0 0; + position: absolute; + top: 0; +} +article.feature-image.large .entry-title a { + background: #222; + background: rgba(0,0,0,0.8); + -moz-border-radius: 3px; + border-radius: 3px; + color: #fff; + display: inline-block; + font-weight: 300; + padding: .2em 20px; +} +section.feature-image.large:hover .entry-title a, +section.feature-image.large .entry-title:hover a { + background: #eee; + background: rgba(255,255,255,0.8); + color: #222; +} +article.feature-image.large .entry-summary { + display: none; +} +section.feature-image.large img { + display: block; + height: auto; + max-width: 117.9%; + padding: 0 0 6px; +} + +/* Featured Slider */ +.featured-posts { + border-bottom: 1px solid #ddd; + display: block; + height: 328px; + margin: 1.625em -8.9% 20px; + max-width: 1000px; + padding: 0; + position: relative; + overflow: hidden; +} +.featured-posts .showcase-heading { + padding-left: 8.9%; +} +.featured-posts section.featured-post { + background: #fff; + height: 288px; + left: 0; + margin: 0; + position: absolute; + top: 30px; + width: auto; +} +.featured-posts section.featured-post.large { + max-width: 100%; + overflow: hidden; +} +.featured-posts section.featured-post { + -webkit-transition-duration: 200ms; + -webkit-transition-property: opacity, visibility; + -webkit-transition-timing-function: ease; + -moz-transition-duration: 200ms; + -moz-transition-property: opacity, visibility; + -moz-transition-timing-function: ease; +} +.featured-posts section.featured-post { + opacity: 0; + visibility: hidden; +} +.featured-posts #featured-post-1 { + opacity: 1; + visibility: visible; +} +.featured-post .feature-text:after, +.featured-post .feature-image.small:after { + content: ' '; + background: -moz-linear-gradient(top, rgba(255,255,255,0) 0%, rgba(255,255,255,1) 100%); /* FF3.6+ */ + background: -webkit-gradient(linear, left top, left bottom, color-stop(0%,rgba(255,255,255,0)), color-stop(100%,rgba(255,255,255,1))); /* Chrome,Safari4+ */ + background: -webkit-linear-gradient(top, rgba(255,255,255,0) 0%,rgba(255,255,255,1) 100%); /* Chrome10+,Safari5.1+ */ + background: -o-linear-gradient(top, rgba(255,255,255,0) 0%,rgba(255,255,255,1) 100%); /* Opera11.10+ */ + background: -ms-linear-gradient(top, rgba(255,255,255,0) 0%,rgba(255,255,255,1) 100%); /* IE10+ */ + filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#00ffffff', endColorstr='#ffffff',GradientType=0 ); /* IE6-9 */ + background: linear-gradient(top, rgba(255,255,255,0) 0%,rgba(255,255,255,1) 100%); /* W3C */ + width: 100%; + height: 45px; + position: absolute; + top: 230px; +} +.featured-post .feature-image.small:after { + top: 253px; +} +#content .feature-slider { + top: 5px; + right: 8.9%; + overflow: visible; + position: absolute; +} +.feature-slider ul { + list-style-type: none; + margin: 0; +} +.feature-slider li { + float: left; + margin: 0 6px; +} +.feature-slider a { + background: #3c3c3c; + background: rgba(60,60,60,0.9); + -moz-border-radius: 12px; + border-radius: 12px; + -webkit-box-shadow: inset 1px 1px 5px rgba(0,0,0,0.5), inset 0 0 2px rgba(255,255,255,0.5); + -moz-box-shadow: inset 1px 1px 5px rgba(0,0,0,0.5), inset 0 0 2px rgba(255,255,255,0.5); + box-shadow: inset 1px 1px 5px rgba(0,0,0,0.5), inset 0 0 2px rgba(255,255,255,0.5); + display: block; + width: 14px; + height: 14px; +} +.feature-slider a.active { + background: #1982d1; + -webkit-box-shadow: inset 1px 1px 5px rgba(0,0,0,0.4), inset 0 0 2px rgba(255,255,255,0.8); + -moz-box-shadow: inset 1px 1px 5px rgba(0,0,0,0.4), inset 0 0 2px rgba(255,255,255,0.8); + box-shadow: inset 1px 1px 5px rgba(0,0,0,0.4), inset 0 0 2px rgba(255,255,255,0.8); + cursor: default; + opacity: 0.5; +} + +/* Recent Posts */ +section.recent-posts { + padding: 0 0 1.625em; +} +section.recent-posts .hentry { + border: none; + margin: 0; +} +section.recent-posts .other-recent-posts { + border-bottom: 1px solid #ddd; + list-style: none; + margin: 0; +} +section.recent-posts .other-recent-posts li { + padding: 0.3125em 0; + position: relative; +} +section.recent-posts .other-recent-posts .entry-title { + border-top: 1px solid #ddd; + font-size: 17px; +} +section.recent-posts .other-recent-posts a[rel="bookmark"] { + color: #373737; + float: left; + max-width: 84%; +} +section.recent-posts .other-recent-posts a[rel="bookmark"]:after { + content: '-'; + color: transparent; + font-size: 11px; +} +section.recent-posts .other-recent-posts a[rel="bookmark"]:hover { +} +section.recent-posts .other-recent-posts .comments-link a, +section.recent-posts .other-recent-posts .comments-link > span { + border-bottom: 2px solid #999; + bottom: -2px; + color: #444; + display: block; + font-size: 10px; + font-weight: 500; + line-height: 2.76333em; + padding: 0.3125em 0 0.3125em 1em; + position: absolute; + right: 0; + text-align: right; + text-transform: uppercase; + z-index: 1; +} +section.recent-posts .other-recent-posts .comments-link > span { + border-color: #bbb; + color: #888; +} +section.recent-posts .other-recent-posts .comments-link a:hover { + color: #1982d1; + border-color: #1982d1; +} +section.recent-posts .other-recent-posts li:after { + clear: both; + content: '.'; + display: block; + height: 0; + visibility: hidden; +} + + +/* =Attachments +----------------------------------------------- */ + +.image-attachment div.attachment { + background: #f9f9f9; + border: 1px solid #ddd; + border-width: 1px 0; + margin: 0 -8.9% 1.625em; + overflow: hidden; + padding: 1.625em 1.625em 0; + text-align: center; +} +.image-attachment div.attachment img { + display: block; + height: auto; + margin: 0 auto 1.625em; + max-width: 100%; +} +.image-attachment div.attachment a img { + border-color: #f9f9f9; +} +.image-attachment div.attachment a:focus img, +.image-attachment div.attachment a:hover img, +.image-attachment div.attachment a:active img { + border-color: #ddd; + background: #fff; +} +.image-attachment .entry-caption p { + font-size: 10px; + letter-spacing: 0.1em; + line-height: 2.6em; + margin: 0 0 2.6em; + text-transform: uppercase; +} + + +/* =Navigation +-------------------------------------------------------------- */ + +#content nav { + clear: both; + overflow: hidden; + padding: 0 0 1.625em; +} +#content nav a { + font-size: 12px; + font-weight: bold; + line-height: 2.2em; +} +#nav-above { + padding: 0 0 1.625em; +} +#nav-above { + display: none; +} +.paged #nav-above { + display: block; +} +.nav-previous { + float: left; + width: 50%; +} +.nav-next { + float: right; + text-align: right; + width: 50%; +} +#content nav .meta-nav { + font-weight: normal; +} + +/* Singular navigation */ +#nav-single { + float: right; + position: relative; + top: -0.3em; + text-align: right; + z-index: 1; +} +#nav-single .nav-previous, +#nav-single .nav-next { + float: none; + width: auto; +} +#nav-single .nav-next { + padding-left: .5em; +} + + +/* =Widgets +----------------------------------------------- */ + +.widget-area { + font-size: 12px; +} +.widget { + clear: both; + margin: 0 0 2.2em; +} +.widget-title { + color: #666; + font-size: 10px; + font-weight: 500; + letter-spacing: 0.1em; + line-height: 2.6em; + text-transform: uppercase; +} +.widget ul { + font-size: 15px; + margin: 0; +} +.widget ul ul { + margin-left: 1.5em; +} +.widget ul li { + color: #777; + font-size: 13px; +} +.widget a { + font-weight: bold; + text-decoration: none; +} +.widget a:hover, +.widget a:focus, +.widget a:active { + text-decoration: underline; +} + +/* Search Widget */ +.widget_search form { + margin: 0 0 1.625em; +} +.widget_search #s { + width: 77%; +} +.widget_search #searchsubmit { + background: #ddd; + border: 1px solid #ccc; + -webkit-box-shadow: inset 0px -1px 1px rgba(0, 0, 0, 0.09); + -moz-box-shadow: inset 0px -1px 1px rgba(0, 0, 0, 0.09); + box-shadow: inset 0px -1px 1px rgba(0, 0, 0, 0.09); + color: #888; + font-size: 13px; + line-height: 25px; + position: relative; + top: -2px; +} +.widget_search #searchsubmit:active { + background: #1982d1; + border-color: #0861a5; + -webkit-box-shadow: inset 0px 1px 1px rgba(0, 0, 0, 0.1); + -moz-box-shadow: inset 0px 1px 1px rgba(0, 0, 0, 0.1); + box-shadow: inset 0px 1px 1px rgba(0, 0, 0, 0.1); + color: #bfddf3; +} + +/* Ephemera Widget */ +section.ephemera ol, +.widget_twentyeleven_ephemera ol { + list-style: square; + margin: 5px 0 0; +} +.widget_twentyeleven_ephemera .widget-entry-title { + font-size: 15px; + font-weight: bold; + padding: 0; +} +.widget_twentyeleven_ephemera .comments-link a, +.widget_twentyeleven_ephemera .comments-link > span { + color: #666; + display: block; + font-size: 10px; + font-weight: 500; + line-height: 2.76333em; + text-transform: uppercase; +} +section.ephemera .entry-title .comments-link a:hover, +.widget_twentyeleven_ephemera .entry-title .comments-link a:hover { +} +section.ephemera .entry-title a span { + color: #29628d; +} + +/* Twitter */ +.widget_twitter li { + list-style-type: none; + margin-bottom: 14px; +} +.widget_twitter .timesince { + display: block; + font-size: 11px; + margin-right: -10px; + text-align: right; +} + +/* Widget Image */ +.widget_image img { + height: auto; + max-width: 100%; +} + +/* Calendar Widget */ + +.widget_calendar #wp-calendar { + color: #555; + width: 95%; + text-align: center; +} +.widget_calendar #wp-calendar caption, +.widget_calendar #wp-calendar td, +.widget_calendar #wp-calendar th { + text-align: center; +} +.widget_calendar #wp-calendar caption { + font-size: 11px; + font-weight: 500; + padding: 5px 0 3px 0; + text-transform: uppercase; +} +.widget_calendar #wp-calendar th { + background: #f4f4f4; + border-top: 1px solid #ccc; + border-bottom: 1px solid #ccc; + font-weight: bold; +} +.widget_calendar #wp-calendar tfoot td { + background: #f4f4f4; + border-top: 1px solid #ccc; + border-bottom: 1px solid #ccc; +} + + +/* =Comments +----------------------------------------------- */ + +#comments-title { + color: #666; + font-size: 10px; + font-weight: 500; + line-height: 2.6em; + padding: 0 0 2.6em; + text-transform: uppercase; +} +.nopassword, +.nocomments { + color: #aaa; + font-size: 24px; + font-weight: 100; + margin: 26px 0; + text-align: center; +} +.commentlist { + list-style: none; + margin: 0 auto; + width: 68.9%; +} +.content .commentlist, +.page-template-sidebar-page-php .commentlist { + width: 100%; /* reset the width for the one-column and sidebar page layout */ +} +.commentlist > li.comment { + background: #f6f6f6; + border: 1px solid #ddd; + -moz-border-radius: 3px; + border-radius: 3px; + margin: 0 0 1.625em; + padding: 1.625em; + position: relative; +} +.commentlist .pingback { + margin: 0 0 1.625em; + padding: 0 1.625em; +} +.commentlist .children { + list-style: none; + margin: 0; +} +.commentlist .children li.comment { + background: #fff; + border-left: 1px solid #ddd; + -moz-border-radius: 0 3px 3px 0; + border-radius: 0 3px 3px 0; + margin: 1.625em 0 0; + padding: 1.625em; + position: relative; +} +.commentlist .children li.comment .fn { + display: block; +} +.comment-meta .fn { + font-style: normal; +} +.comment-meta { + color: #666; + font-size: 12px; + line-height: 2.2em; +} +.commentlist .children li.comment .comment-meta { + line-height: 1.625em; + margin-left: 50px; +} +.commentlist .children li.comment .comment-content { + margin: 1.625em 0 0; +} +.comment-meta a { + font-weight: bold; +} +.comment-meta a:focus, +.comment-meta a:active, +.comment-meta a:hover { +} +.commentlist .avatar { + -moz-border-radius: 3px; + border-radius: 3px; + -webkit-box-shadow: 0 1px 2px #ccc; + -moz-box-shadow: 0 1px 2px #ccc; + box-shadow: 0 1px 2px #ccc; + left: -102px; + padding: 0; + position: absolute; + top: 0; +} +.commentlist > li:before { + content: url(images/comment-arrow.png); + left: -21px; + position: absolute; +} +.commentlist > li.pingback:before { + content: ''; +} +.commentlist .children .avatar { + background: none; + -webkit-box-shadow: none; + -moz-box-shadow: none; + box-shadow: none; + left: 2.2em; + padding: 0; + top: 2.2em; +} +a.comment-reply-link { + background: #eee; + -moz-border-radius: 3px; + border-radius: 3px; + color: #666; + display: inline-block; + font-size: 12px; + padding: 0 8px; + text-decoration: none; +} +a.comment-reply-link:hover, +a.comment-reply-link:focus, +a.comment-reply-link:active { + background: #888; + color: #fff; +} +a.comment-reply-link > span { + display: inline-block; + position: relative; + top: -1px; +} + +/* Post author highlighting */ +.commentlist > li.bypostauthor { + background: #ddd; + border-color: #d3d3d3; +} +.commentlist > li.bypostauthor .comment-meta { + color: #575757; +} +.commentlist > li.bypostauthor .comment-meta a:focus, +.commentlist > li.bypostauthor .comment-meta a:active, +.commentlist > li.bypostauthor .comment-meta a:hover { +} +.commentlist > li.bypostauthor:before { + content: url(images/comment-arrow-bypostauthor.png); +} + +/* Post Author threaded comments */ +.commentlist .children > li.bypostauthor { + background: #ddd; + border-color: #d3d3d3; +} + +/* sidebar-page.php comments */ +/* Make sure we have room for our comment avatars */ +.page-template-sidebar-page-php .commentlist > li.comment, +.page-template-sidebar-page-php.commentlist .pingback { + margin-left: 102px; + width: auto; +} +/* And a full-width comment form */ +.page-template-sidebar-page-php #respond { + width: auto; +} + +/* Comment Form */ +#respond { + background: #ddd; + border: 1px solid #d3d3d3; + -moz-border-radius: 3px; + border-radius: 3px; + margin: 0 auto 1.625em; + padding: 1.625em; + position: relative; + width: 68.9%; +} +#respond input[type="text"], +#respond textarea { + background: #fff; + border: 4px solid #eee; + -moz-border-radius: 5px; + border-radius: 5px; + -webkit-box-shadow: inset 0 1px 3px rgba(204,204,204,0.95); + -moz-box-shadow: inset 0 1px 3px rgba(204,204,204,0.95); + box-shadow: inset 0 1px 3px rgba(204,204,204,0.95); + position: relative; + padding: 10px; + text-indent: 80px; +} +#respond .comment-form-author, +#respond .comment-form-email, +#respond .comment-form-url, +#respond .comment-form-comment { + position: relative; +} +#respond .comment-form-author label, +#respond .comment-form-email label, +#respond .comment-form-url label, +#respond .comment-form-comment label { + background: #eee; + -webkit-box-shadow: 1px 2px 2px rgba(204,204,204,0.8); + -moz-box-shadow: 1px 2px 2px rgba(204,204,204,0.8); + box-shadow: 1px 2px 2px rgba(204,204,204,0.8); + color: #555; + display: inline-block; + font-size: 13px; + left: 4px; + min-width: 60px; + padding: 4px 10px; + position: relative; + top: 40px; + z-index: 1; +} +#respond input[type="text"]:focus, +#respond textarea:focus { + text-indent: 0; + z-index: 1; +} +#respond textarea { + resize: vertical; + width: 95%; +} +#respond .comment-form-author .required, +#respond .comment-form-email .required { + color: #bd3500; + font-size: 22px; + font-weight: bold; + left: 75%; + position: absolute; + top: 45px; + z-index: 1; +} +#respond .comment-notes, +#respond .logged-in-as { + font-size: 13px; +} +#respond p { + margin: 10px 0; +} +#respond .form-submit { + float: right; + margin: -20px 0 10px; +} +#respond input#submit { + background: #222; + border: none; + -moz-border-radius: 3px; + border-radius: 3px; + -webkit-box-shadow: 0px 1px 2px rgba(0,0,0,0.3); + -moz-box-shadow: 0px 1px 2px rgba(0,0,0,0.3); + box-shadow: 0px 1px 2px rgba(0,0,0,0.3); + color: #eee; + cursor: pointer; + font-size: 15px; + margin: 20px 0; + padding: 5px 42px 5px 22px; + position: relative; + left: 30px; + text-shadow: 0 -1px 0 rgba(0,0,0,0.3); +} +#respond input#submit:active { + background: #1982d1; + color: #bfddf3; +} +#respond #cancel-comment-reply-link { + color: #666; + margin-left: 10px; + text-decoration: none; +} +#respond .logged-in-as a:hover, +#respond #cancel-comment-reply-link:hover { + text-decoration: underline; +} +.commentlist #respond { + margin: 1.625em 0 0; + width: auto; +} +#reply-title { + color: #373737; + font-size: 24px; + font-weight: bold; + line-height: 30px; +} +#cancel-comment-reply-link { + color: #888; + display: block; + font-size: 10px; + font-weight: normal; + line-height: 2.2em; + letter-spacing: 0.05em; + position: absolute; + right: 1.625em; + text-decoration: none; + text-transform: uppercase; + top: 1.1em; +} +#cancel-comment-reply-link:focus, +#cancel-comment-reply-link:active, +#cancel-comment-reply-link:hover { + color: #ff4b33; +} +#respond label { + line-height: 2.2em; +} +#respond input[type=text] { + display: block; + height: 24px; + width: 75%; +} +#respond p { + font-size: 12px; +} +p.comment-form-comment { + margin: 0; +} +.form-allowed-tags { + display: none; +} + + +/* =Footer +----------------------------------------------- */ + +#colophon { + clear: both; +} +#supplementary { + border-top: 1px solid #ddd; + padding: 1.625em 7.6%; + overflow: hidden; +} + +/* Two Footer Widget Areas */ +#supplementary.two .widget-area { + float: left; + margin-right: 3.7%; + width: 48.1%; +} +#supplementary.two .widget-area + .widget-area { + margin-right: 0; +} + +/* Three Footer Widget Areas */ +#supplementary.three .widget-area { + float: left; + margin-right: 3.7%; + width: 30.85%; +} +#supplementary.three .widget-area + .widget-area + .widget-area { + margin-right: 0; +} + +/* Site Generator Line */ +#site-generator { + background: #f9f9f9; + border-top: 1px solid #ddd; + color: #666; + font-size: 12px; + line-height: 2.2em; + padding: 2.2em 0.5em; + text-align: center; +} +#site-generator a { + color: #555; + font-weight: bold; +} +#site-generator .sep { + background: url(images/wordpress.png) center left no-repeat; + color: transparent; + display: inline-block; + height: 16px; + line-height: 16px; + margin: 0 7px; + width: 16px; +} + + +/* =Responsive Structure +----------------------------------------------- */ + +@media (max-width: 800px) { + /* Simplify the basic layout */ + #main #content { + margin: 0 7.6%; + width: auto; + } + #nav-below { + border-bottom: 1px solid #ddd; + margin-bottom: 1.625em; + } + #main #secondary { + float: none; + margin: 0 7.6%; + width: auto; + } + /* Simplify the showcase template */ + .page-template-showcase-php .featured-posts { + min-height: 280px; + } + .featured-posts section.featured-post { + height: auto; + } + .page-template-showcase-php section.recent-posts { + float: none; + margin: 0; + width: 100%; + } + .page-template-showcase-php #main .widget-area { + float: none; + margin: 0; + width: auto; + } + .page-template-showcase-php .other-recent-posts { + border-bottom: 1px solid #ddd; + } + /* Simplify the showcase template when small feature */ + section.featured-post .attachment-small-feature, + .one-column section.featured-post .attachment-small-feature { + border: none; + display: block; + float: left; + height: auto; + margin: 0.625em auto 1.025em; + max-width: 30%; + position: static; + } + article.feature-image.small { + float: right; + margin: 0 0 1.625em; + width: 64%; + } + .one-column article.feature-image.small .entry-summary { + height: auto; + } + article.feature-image.small .entry-summary p a { + left: 0; + padding-left: 20px; + padding-right: 20px; + width: auto; + } + /* Remove the margin on singular articles */ + .singular .entry-header, + .singular .entry-content, + .singular footer.entry-meta, + .singular #comments-title { + width: 100%; + } + /* Simplify the pullquotes and pull styles */ + .singular blockquote.pull { + margin: 0 0 1.625em; + } + .singular .pull.alignleft { + margin: 0 1.625em 0 0; + } + .singular .pull.alignright { + margin: 0 0 0 1.625em; + } + .singular .entry-meta .edit-link a { + left: 0; + position: absolute; + top: 40px; + } + .singular #author-info { + margin: 2.2em -8.8% 0; + padding: 20px 8.8%; + } + /* Make sure we have room for our comment avatars */ + .commentlist { + width: 100%; + } + .commentlist > li.comment, + .commentlist .pingback { + margin-left: 102px; + width: auto; + } + /* And a full-width comment form */ + #respond { + width: auto; + } + /* No need to float footer widgets at this size */ + #colophon #supplementary .widget-area { + float: none; + margin-right: 0; + width: auto; + } + /* No need to float 404 widgets at this size */ + .error404 #main .widget { + float: none; + margin-right: 0; + width: auto; + } + +} +@media (max-width: 650px) { + /* @media (max-width: 650px) Reduce font-sizes for better readability on smaller devices */ + body, input, textarea { + font-size: 13px; + } + #site-title a { + font-size: 24px; + } + #site-description { + font-size: 12px; + } + #access ul { + font-size: 12px; + } + article.intro .entry-content { + font-size: 12px; + } + .entry-title { + font-size: 21px; + } + .featured-post .entry-title { + font-size: 14px; + } + .singular .entry-title { + font-size: 28px; + } + .entry-meta { + font-size: 12px; + } + blockquote { + margin: 0; + } + blockquote.pull { + font-size: 17px; + } + /* Reposition the site title and description slightly */ + #site-title { + padding: 5.30625em 0 0; + } + #site-title, + #site-description { + margin-right: 0; + } + /* Make sure the logo and search form don't collide */ + #branding #searchform { + top: 1.625em !important; + } + /* Floated content doesn't work well at this size */ + .alignleft, + .alignright { + float: none; + margin-left: 0; + margin-right: 0; + } + /* Make sure the post-post navigation doesn't collide with anything */ + #nav-single { + display: block; + position: static; + } + .singular .hentry { + padding: 1.625em 0 0; + } + .singular.page .hentry { + padding: 1.625em 0 0; + } + /* Talking avatars take up too much room at this size */ + .commentlist > li.comment, + .commentlist > li.pingback { + margin-left: 0 !important; + } + .commentlist .avatar { + background: transparent; + display: block; + padding: 0; + position: static; + } + .commentlist .children .avatar { + background: none; + left: 2.2em; + padding: 0; + position: absolute; + top: 2.2em; + } + /* Use the available space in the smaller comment form */ + #respond input[type="text"] { + width: 95%; + } + #respond .comment-form-author .required, + #respond .comment-form-email .required { + left: 95%; + } + #content .gallery-columns-3 .gallery-item { + width: 31%; + padding-right: 2%; + } + #content .gallery-columns-3 .gallery-item img { + width: 100%; + height: auto; + } + +} +@media (max-width: 450px) { + #content .gallery-columns-2 .gallery-item { + width: 45%; + padding-right: 4%; + } + #content .gallery-columns-2 .gallery-item img { + width: 100%; + height: auto; + } + +} +@media only screen and (min-device-width: 320px) and (max-device-width: 480px) { + body { + padding: 0; + } + #page { + margin-top: 0; + } + #branding { + border-top: none; + } + +} + + +/* =Print +----------------------------------------------- */ + +@media print { + body { + background: none !important; + font-size: 10pt; + } + footer.entry-meta a[rel=bookmark]:link:after, + footer.entry-meta a[rel=bookmark]:visited:after { + content: " [" attr(href) "] "; /* Show URLs */ + } + #page { + clear: both !important; + display: block !important; + float: none !important; + max-width: 100%; + position: relative !important; + } + #branding { + border-top: none !important; + padding: 0; + } + #branding hgroup { + margin: 0; + } + #site-title a { + font-size: 21pt; + } + #site-description { + font-size: 10pt; + } + #branding #searchform { + display: none; + } + #branding img { + display: none; + } + #access { + display: none; + } + #main { + border-top: none; + box-shadow: none; + } + #primary { + float: left; + margin: 0; + width: 100%; + } + #content { + margin: 0; + width: auto; + } + .singular #content { + margin: 0; + width: 100%; + } + .singular .entry-header .entry-meta { + position: static; + } + .entry-meta .edit-link a { + display: none; + } + #content nav { + display: none; + } + .singular .entry-header, + .singular .entry-content, + .singular footer.entry-meta, + .singular #comments-title { + margin: 0; + width: 100%; + } + .singular .hentry { + padding: 0; + } + .entry-title, + .singular .entry-title { + font-size: 21pt; + } + .entry-meta { + font-size: 10pt; + } + .entry-header .comments-link { + display: none; + } + .page-link { + display: none; + } + .singular #author-info { + background: none; + border-bottom: none; + border-top: none; + margin: 2.2em 0 0; + padding: 0; + } + #respond { + display: none; + } + .widget-area { + display: none; + } + #colophon { + display: none; + } + + /* Comments */ + .commentlist > li.comment { + background: none; + border: 1px solid #ddd; + -moz-border-radius: 3px 3px 3px 3px; + border-radius: 3px 3px 3px 3px; + margin: 0 auto 1.625em; + padding: 1.625em; + position: relative; + width: auto; + } + .commentlist .avatar { + height: 39px; + left: 2.2em; + top: 2.2em; + width: 39px; + } + .commentlist li.comment .comment-meta { + line-height: 1.625em; + margin-left: 50px; + } + .commentlist li.comment .fn { + display: block; + } + .commentlist li.comment .comment-content { + margin: 1.625em 0 0; + } + .commentlist .comment-edit-link { + display: none; + } + .commentlist > li::before, + .commentlist > li.bypostauthor::before { + content: ''; + } + .commentlist .reply { + display: none; + } + + /* Post author highlighting */ + .commentlist > li.bypostauthor { + color: #444; + } + .commentlist > li.bypostauthor .comment-meta { + color: #666; + } + .commentlist > li.bypostauthor:before { + content: none; + } + + /* Post Author threaded comments */ + .commentlist .children > li.bypostauthor { + background: #fff; + border-color: #ddd; + } + .commentlist .children > li.bypostauthor > article, + .commentlist .children > li.bypostauthor > article .comment-meta { + color: #666; + } + +} + + +/* =IE7 +----------------------------------------------- */ + +#ie7 article.intro { + margin-left: -7.6%; + margin-right: -7.6%; + padding-left: -7.6%; + padding-right: -7.6%; + max-width: 1000px; +} +#ie7 section.featured-post { + margin-left: -7.6%; + margin-right: -7.6%; + max-width: 850px; +} +#ie7 section.recent-posts { + margin-right: 7.6%; +} +/* +Theme Name: HuskyPress +Theme URI: http://wordpress.org/extend/themes/twentyeleven +Author: the WordPress team +Author URI: http://uconn.edu +Description: +Version: 1.3 +License: GNU General Public License +License URI: license.txt +Tags: dark, light, white, black, gray, one-column, two-columns, left-sidebar, right-sidebar, fixed-width, flexible-width, custom-background, custom-colors, custom-header, custom-menu, editor-style, featured-image-header, featured-images, full-width-template, microformats, post-formats, rtl-language-support, sticky-post, theme-options, translation-ready +*/ + +/* =Reset default browser CSS. Based on work by Eric Meyer: http://meyerweb.com/eric/tools/css/reset/index.html +-------------------------------------------------------------- */ + +html, body, div, span, applet, object, iframe, +h1, h2, h3, h4, h5, h6, p, blockquote, pre, +a, abbr, acronym, address, big, cite, code, +del, dfn, em, font, ins, kbd, q, s, samp, +small, strike, strong, sub, sup, tt, var, +dl, dt, dd, ol, ul, li, +fieldset, form, label, legend, +table, caption, tbody, tfoot, thead, tr, th, td { + border: 0; + font-family: inherit; + font-size: 100%; + font-style: inherit; + font-weight: inherit; + margin: 0; + outline: 0; + padding: 0; + vertical-align: baseline; +} +:focus {/* remember to define focus styles! */ + outline: 0; +} +body { + background: #fff; + line-height: 1; +} +ol, ul { + list-style: none; +} +table {/* tables still need 'cellspacing="0"' in the markup */ + border-collapse: separate; + border-spacing: 0; +} +caption, th, td { + font-weight: normal; + text-align: left; +} +blockquote:before, blockquote:after, +q:before, q:after { + content: ""; +} +blockquote, q { + quotes: "" ""; +} +a img { + border: 0; +} +article, aside, details, figcaption, figure, +footer, header, hgroup, menu, nav, section { + display: block; +} + + +/* =Structure +----------------------------------------------- */ + +body { + padding: 0 2em; +} +#page { + margin: 2em auto; + max-width: 1000px; +} +#branding hgroup { + margin: 0 7.6%; +} +#access div { + margin: 0 7.6%; +} +#primary { + float: left; + margin: 0 -26.4% 0 0; + width: 100%; +} +#content { + margin: 0 34% 0 7.6%; + width: 58.4%; +} +#secondary { + float: right; + margin-right: 7.6%; + width: 18.8%; +} + +/* Singular */ +.singular #primary { + margin: 0; +} +.singular #content, +.left-sidebar.singular #content { + margin: 0 7.6%; + position: relative; + width: auto; +} +.singular .entry-header, +.singular .entry-content, +.singular footer.entry-meta, +.singular #comments-title { + margin: 0 auto; + width: 68.9%; +} + +/* Attachments */ +.singular .image-attachment .entry-content { + margin: 0 auto; + width: auto; +} +.singular .image-attachment .entry-description { + margin: 0 auto; + width: 68.9%; +} + +/* Showcase */ +.page-template-showcase-php #primary, +.left-sidebar.page-template-showcase-php #primary { + margin: 0; +} +.page-template-showcase-php #content, +.left-sidebar.page-template-showcase-php #content { + margin: 0 7.6%; + width: auto; +} +.page-template-showcase-php section.recent-posts { + float: right; + margin: 0 0 0 31%; + width: 69%; +} +.page-template-showcase-php #main .widget-area { + float: left; + margin: 0 -22.15% 0 0; + width: 22.15%; +} + +/* error404 */ +.error404 #primary { + float: none; + margin: 0; +} +.error404 #primary #content { + margin: 0 7.6%; + width: auto; +} + +/* Alignment */ +.alignleft { + display: inline; + float: left; + margin-right: 1.625em; +} +.alignright { + display: inline; + float: right; + margin-left: 1.625em; +} +.aligncenter { + clear: both; + display: block; + margin-left: auto; + margin-right: auto; +} + +/* Right Content */ +.left-sidebar #primary { + float: right; + margin: 0 0 0 -26.4%; + width: 100%; +} +.left-sidebar #content { + margin: 0 7.6% 0 34%; + width: 58.4%; +} +.left-sidebar #secondary { + float: left; + margin-left: 7.6%; + margin-right: 0; + width: 18.8%; +} + +/* One column */ +.one-column #page { + max-width: 690px; +} +.one-column #content { + margin: 0 7.6%; + width: auto; +} +.one-column #nav-below { + border-bottom: 1px solid #ddd; + margin-bottom: 1.625em; +} +.one-column #secondary { + float: none; + margin: 0 7.6%; + width: auto; +} +/* Simplify the showcase template */ +.one-column .page-template-showcase-php section.recent-posts { + float: none; + margin: 0; + width: 100%; +} +.one-column .page-template-showcase-php #main .widget-area { + float: none; + margin: 0; + width: auto; +} +.one-column .page-template-showcase-php .other-recent-posts { + border-bottom: 1px solid #ddd; +} +/* Simplify the showcase template when small feature */ +.one-column section.featured-post .attachment-small-feature { + border: none; + display: block; + height: auto; + max-width: 60%; + position: static; +} +.one-column article.feature-image.small { + margin: 0 0 1.625em; + padding: 0; +} +.one-column article.feature-image.small .entry-title { + font-size: 20px; + line-height: 1.3em; +} +.one-column article.feature-image.small .entry-summary { + height: 150px; + overflow: hidden; + padding: 0; + text-overflow: ellipsis; +} +.one-column article.feature-image.small .entry-summary a { + left: -9%; +} +/* Remove the margin on singular articles */ +.one-column.singular .entry-header, +.one-column.singular .entry-content, +.one-column.singular footer.entry-meta, +.one-column.singular #comments-title { + width: 100%; +} +/* Simplify the pullquotes and pull styles */ +.one-column.singular blockquote.pull { + margin: 0 0 1.625em; +} +.one-column.singular .pull.alignleft { + margin: 0 1.625em 0 0; +} +.one-column.singular .pull.alignright { + margin: 0 0 0 1.625em; +} +.one-column.singular .entry-meta .edit-link a { + position: absolute; + left: 0; + top: 40px; +} +.one-column.singular #author-info { + margin: 2.2em -8.8% 0; + padding: 20px 8.8%; +} +/* Make sure we have room for our comment avatars */ +.one-column .commentlist > li.comment { + margin-left: 102px; + width: auto; +} +/* Make sure the logo and search form don't collide */ +.one-column #branding #searchform { + right: 40px; + top: 4em; +} +/* Talking avatars take up too much room at this size */ +.one-column .commentlist > li.comment { + margin-left: 0; +} +.one-column .commentlist > li.comment .comment-meta, +.one-column .commentlist > li.comment .comment-content { + margin-right: 85px; +} +.one-column .commentlist .avatar { + background: transparent; + display: block; + padding: 0; + top: 1.625em; + left: auto; + right: 1.625em; +} +.one-column .commentlist .children .avatar { + background: none; + padding: 0; + position: absolute; + top: 2.2em; + left: 2.2em; +} +.one-column #respond { + width: auto; +} + + +/* =Global +----------------------------------------------- */ + +body, input, textarea { + color: #373737; + font: 15px "Helvetica Neue", Helvetica, Arial, sans-serif; + font-weight: 300; + line-height: 1.625; +} +body { + background: #e2e2e2; +} +#page { + background: #fff; +} + +/* Headings */ +h1,h2,h3,h4,h5,h6 { + clear: both; +} +hr { + background-color: #ccc; + border: 0; + height: 1px; + margin-bottom: 1.625em; +} + +/* Text elements */ +p { + margin-bottom: 1.625em; +} +ul, ol { + margin: 0 0 1.625em 2.5em; +} +ul { + list-style: square; +} +ol { + list-style-type: decimal; +} +ol ol { + list-style: upper-alpha; +} +ol ol ol { + list-style: lower-roman; +} +ol ol ol ol { + list-style: lower-alpha; +} +ul ul, ol ol, ul ol, ol ul { + margin-bottom: 0; +} +dl { + margin: 0 1.625em; +} +dt { + font-weight: bold; +} +dd { + margin-bottom: 1.625em; +} +strong { + font-weight: bold; +} +cite, em, i { + font-style: italic; +} +blockquote { + font-family: Georgia, "Bitstream Charter", serif; + font-style: italic; + font-weight: normal; + margin: 0 3em; +} +blockquote em, blockquote i, blockquote cite { + font-style: normal; +} +blockquote cite { + color: #666; + font: 12px "Helvetica Neue", Helvetica, Arial, sans-serif; + font-weight: 300; + letter-spacing: 0.05em; + text-transform: uppercase; +} +pre { + background: #f4f4f4; + font: 13px "Courier 10 Pitch", Courier, monospace; + line-height: 1.5; + margin-bottom: 1.625em; + overflow: auto; + padding: 0.75em 1.625em; +} +code, kbd { + font: 13px Monaco, Consolas, "Andale Mono", "DejaVu Sans Mono", monospace; +} +abbr, acronym, dfn { + border-bottom: 1px dotted #666; + cursor: help; +} +address { + display: block; + margin: 0 0 1.625em; +} +ins { + background: #fff9c0; + text-decoration: none; +} +sup, +sub { + font-size: 10px; + height: 0; + line-height: 1; + position: relative; + vertical-align: baseline; +} +sup { + bottom: 1ex; +} +sub { + top: .5ex; +} + +/* Forms */ +input[type=text], +input[type=password], +textarea { + background: #fafafa; + -moz-box-shadow: inset 0 1px 1px rgba(0,0,0,0.1); + -webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,0.1); + box-shadow: inset 0 1px 1px rgba(0,0,0,0.1); + border: 1px solid #ddd; + color: #888; +} +input[type=text]:focus, +textarea:focus { + color: #373737; +} +textarea { + padding-left: 3px; + width: 98%; +} +input[type=text] { + padding: 3px; +} +input#s { + background: url(images/search.png) no-repeat 5px 6px; + -moz-border-radius: 2px; + border-radius: 2px; + font-size: 14px; + height: 22px; + line-height: 1.2em; + padding: 4px 10px 4px 28px; +} +input#searchsubmit { + display: none; +} + +/* Links */ +a { + color: #1982d1; + text-decoration: none; +} +a:focus, +a:active, +a:hover { + text-decoration: underline; +} + +/* Assistive text */ +.assistive-text { + position: absolute !important; + clip: rect(1px 1px 1px 1px); /* IE6, IE7 */ + clip: rect(1px, 1px, 1px, 1px); +} +#access a.assistive-text:active, +#access a.assistive-text:focus { + background: #eee; + border-bottom: 1px solid #ddd; + color: #1982d1; + clip: auto !important; + font-size: 12px; + position: absolute; + text-decoration: underline; + top: 0; + left: 7.6%; +} + + +/* =Header +----------------------------------------------- */ + +#branding { + border-top: 2px solid #bbb; + padding-bottom: 10px; + position: relative; + z-index: 9999; +} +#site-title { + margin-right: 270px; + padding: 3.65625em 0 0; +} +#site-title a { + color: #111; + font-size: 30px; + font-weight: bold; + line-height: 36px; + text-decoration: none; +} +#site-title a:hover, +#site-title a:focus, +#site-title a:active { + color: #1982d1; +} +#site-description { + color: #7a7a7a; + font-size: 14px; + margin: 0 270px 3.65625em 0; +} +#branding img { + height: auto; + margin-bottom: -7px; + width: 100%; +} + + +/* =Menu +-------------------------------------------------------------- */ + +#access { + background: #222; /* Show a solid color for older browsers */ + background: -moz-linear-gradient(#252525, #0a0a0a); + background: -o-linear-gradient(#252525, #0a0a0a); + background: -webkit-gradient(linear, 0% 0%, 0% 100%, from(#252525), to(#0a0a0a)); /* older webkit syntax */ + background: -webkit-linear-gradient(#252525, #0a0a0a); + -webkit-box-shadow: rgba(0, 0, 0, 0.4) 0px 1px 2px; + -moz-box-shadow: rgba(0, 0, 0, 0.4) 0px 1px 2px; + box-shadow: rgba(0, 0, 0, 0.4) 0px 1px 2px; + clear: both; + display: block; + float: left; + margin: 0 auto 6px; + width: 100%; +} +#access ul { + font-size: 13px; + list-style: none; + margin: 0 0 0 -0.8125em; + padding-left: 0; +} +#access li { + float: left; + position: relative; +} +#access a { + color: #eee; + display: block; + line-height: 3.333em; + padding: 0 1.2125em; + text-decoration: none; +} +#access ul ul { + -moz-box-shadow: 0 3px 3px rgba(0,0,0,0.2); + -webkit-box-shadow: 0 3px 3px rgba(0,0,0,0.2); + box-shadow: 0 3px 3px rgba(0,0,0,0.2); + display: none; + float: left; + margin: 0; + position: absolute; + top: 3.333em; + left: 0; + width: 188px; + z-index: 99999; +} +#access ul ul ul { + left: 100%; + top: 0; +} +#access ul ul a { + background: #f9f9f9; + border-bottom: 1px dotted #ddd; + color: #444; + font-size: 13px; + font-weight: normal; + height: auto; + line-height: 1.4em; + padding: 10px 10px; + width: 168px; +} +#access li:hover > a, +#access ul ul :hover > a, +#access a:focus { + background: #efefef; +} +#access li:hover > a, +#access a:focus { + background: #f9f9f9; /* Show a solid color for older browsers */ + background: -moz-linear-gradient(#f9f9f9, #e5e5e5); + background: -o-linear-gradient(#f9f9f9, #e5e5e5); + background: -webkit-gradient(linear, 0% 0%, 0% 100%, from(#f9f9f9), to(#e5e5e5)); /* Older webkit syntax */ + background: -webkit-linear-gradient(#f9f9f9, #e5e5e5); + color: #373737; +} +#access ul li:hover > ul { + display: block; +} +#access .current-menu-item > a, +#access .current-menu-ancestor > a, +#access .current_page_item > a, +#access .current_page_ancestor > a { + font-weight: bold; +} + +/* Search Form */ +#branding #searchform { + position: absolute; + top: 3.8em; + right: 7.6%; + text-align: right; +} +#branding #searchform div { + margin: 0; +} +#branding #s { + float: right; + -webkit-transition-duration: 400ms; + -webkit-transition-property: width, background; + -webkit-transition-timing-function: ease; + -moz-transition-duration: 400ms; + -moz-transition-property: width, background; + -moz-transition-timing-function: ease; + -o-transition-duration: 400ms; + -o-transition-property: width, background; + -o-transition-timing-function: ease; + width: 72px; +} +#branding #s:focus { + background-color: #f9f9f9; + width: 196px; +} +#branding #searchsubmit { + display: none; +} +#branding .only-search #searchform { + top: 5px; + z-index: 1; +} +#branding .only-search #s { + background-color: #666; + border-color: #000; + color: #222; +} +#branding .only-search #s, +#branding .only-search #s:focus { + width: 85%; +} +#branding .only-search #s:focus { + background-color: #bbb; +} +#branding .with-image #searchform { + top: auto; + bottom: -27px; + max-width: 195px; +} +#branding .only-search + #access div { + padding-right: 205px; +} + + +/* =Content +----------------------------------------------- */ + +#main { + clear: both; + padding: 1.625em 0 0; +} +.page-title { + color: #666; + font-size: 10px; + font-weight: 500; + letter-spacing: 0.1em; + line-height: 2.6em; + margin: 0 0 2.6em; + text-transform: uppercase; +} +.page-title a { + font-size: 12px; + font-weight: bold; + letter-spacing: 0; + text-transform: none; +} +.hentry, +.no-results { + border-bottom: 1px solid #ddd; + margin: 0 0 1.625em; + padding: 0 0 1.625em; + position: relative; +} +.hentry:last-child, +.no-results { + border-bottom: none; +} +.blog .sticky .entry-header .entry-meta { + clip: rect(1px 1px 1px 1px); /* IE6, IE7 */ + clip: rect(1px, 1px, 1px, 1px); + position: absolute !important; +} +.entry-title, +.entry-header .entry-meta { + padding-right: 76px; +} +.entry-title { + clear: both; + color: #222; + font-size: 26px; + font-weight: bold; + line-height: 1.5em; + padding-bottom: .3em; + padding-top: 15px; +} +.entry-title, +.entry-title a { + color: #222; + text-decoration: none; +} +.entry-title a:hover, +.entry-title a:focus, +.entry-title a:active { + color: #1982d1; +} +.entry-meta { + color: #666; + clear: both; + font-size: 12px; + line-height: 18px; +} +.entry-meta a { + font-weight: bold; +} +.single-author .entry-meta .by-author { + display: none; +} +.entry-content, +.entry-summary { + padding: 1.625em 0 0; +} +.entry-content h1, +.entry-content h2, +.comment-content h1, +.comment-content h2 { + color: #000; + font-weight: bold; +} +.entry-content h3, +.comment-content h3 { + font-size: 10px; + letter-spacing: 0.1em; + line-height: 2.6em; + text-transform: uppercase; +} +.entry-content table, +.comment-content table { + border-bottom: 1px solid #ddd; + margin: 0 0 1.625em; + width: 100%; +} +.entry-content th, +.comment-content th { + color: #666; + font-size: 10px; + font-weight: 500; + letter-spacing: 0.1em; + line-height: 2.6em; + text-transform: uppercase; +} +.entry-content td, +.comment-content td { + border-top: 1px solid #ddd; + padding: 6px 10px 6px 0; +} +.entry-content #s { + width: 75%; +} +.comment-content ul, +.comment-content ol { + margin-bottom: 1.625em; +} +.comment-content ul ul, +.comment-content ol ol, +.comment-content ul ol, +.comment-content ol ul { + margin-bottom: 0; +} +dl.gallery-item { + margin: 0; +} +.page-link { + clear: both; + display: block; + margin: 0 0 1.625em; +} +.page-link a { + background: #eee; + color: #373737; + margin: 0; + padding: 2px 3px; + text-decoration: none; +} +.page-link a:hover { + background: #888; + color: #fff; + font-weight: bold; +} +.page-link span { + margin-right: 6px; +} +.entry-meta .edit-link a, +.commentlist .edit-link a { + background: #eee; + -moz-border-radius: 3px; + border-radius: 3px; + color: #666; + float: right; + font-size: 12px; + line-height: 1.5em; + font-weight: 300; + text-decoration: none; + padding: 0 8px; +} +.entry-meta .edit-link a:hover, +.commentlist .edit-link a:hover { + background: #888; + color: #fff; +} +.entry-content .edit-link { + clear: both; + display: block; +} + +/* Images */ +.entry-content img, +.comment-content img, +.widget img { + max-width: 97.5%; /* Fluid images for posts, comments, and widgets */ +} +img[class*="align"], +img[class*="wp-image-"], +img[class*="attachment-"] { + height: auto; /* Make sure images with WordPress-added height and width attributes are scaled correctly */ +} +img.size-full, +img.size-large { + max-width: 97.5%; + width: auto; /* Prevent stretching of full-size and large-size images with height and width attributes in IE8 */ + height: auto; /* Make sure images with WordPress-added height and width attributes are scaled correctly */ +} +.entry-content img.wp-smiley { + border: none; + margin-bottom: 0; + margin-top: 0; + padding: 0; +} +img.alignleft, +img.alignright, +img.aligncenter { + margin-bottom: 1.625em; +} +p img, +.wp-caption { + margin-top: 0.4em; +} +.wp-caption { + background: #eee; + margin-bottom: 1.625em; + max-width: 96%; + padding: 9px; +} +.wp-caption img { + display: block; + margin: 0 auto; + max-width: 98%; +} +.wp-caption .wp-caption-text, +.gallery-caption { + color: #666; + font-family: Georgia, serif; + font-size: 12px; +} +.wp-caption .wp-caption-text { + margin-bottom: 0.6em; + padding: 10px 0 5px 40px; + position: relative; +} +.wp-caption .wp-caption-text:before { + color: #666; + content: '\2014'; + font-size: 14px; + font-style: normal; + font-weight: bold; + margin-right: 5px; + position: absolute; + left: 10px; + top: 7px; +} +#content .gallery { + margin: 0 auto 1.625em; +} +#content .gallery a img { + border: none; +} +img#wpstats { + display: block; + margin: 0 auto 1.625em; +} +#content .gallery-columns-4 .gallery-item { + width: 23%; + padding-right: 2%; +} +#content .gallery-columns-4 .gallery-item img { + width: 100%; + height: auto; +} + +/* Image borders */ +img[class*="align"], +img[class*="wp-image-"], +#content .gallery .gallery-icon img {/* Add fancy borders to all WordPress-added images but not things like badges and icons and the like */ + border: 1px solid #ddd; + padding: 6px; +} +.wp-caption img { + border-color: #eee; +} +a:focus img[class*="align"], +a:hover img[class*="align"], +a:active img[class*="align"], +a:focus img[class*="wp-image-"], +a:hover img[class*="wp-image-"], +a:active img[class*="wp-image-"], +#content .gallery .gallery-icon a:focus img, +#content .gallery .gallery-icon a:hover img, +#content .gallery .gallery-icon a:active img {/* Add some useful style to those fancy borders for linked images ... */ + background: #eee; + border-color: #bbb; +} +.wp-caption a:focus img, +.wp-caption a:active img, +.wp-caption a:hover img {/* ... including captioned images! */ + background: #fff; + border-color: #ddd; +} + +/* Make sure embeds and iframes fit their containers */ +embed, +iframe, +object { + max-width: 100%; +} + +/* Password Protected Posts */ +.post-password-required .entry-header .comments-link { + margin: 1.625em 0 0; +} +.post-password-required input[type=password] { + margin: 0.8125em 0; +} +.post-password-required input[type=password]:focus { + background: #f7f7f7; +} + +/* Author Info */ +#author-info { + font-size: 12px; + overflow: hidden; +} +.singular #author-info { + background: #f9f9f9; + border-top: 1px solid #ddd; + border-bottom: 1px solid #ddd; + margin: 2.2em -35.6% 0 -35.4%; + padding: 20px 35.4%; +} +.archive #author-info { + border-bottom: 1px solid #ddd; + margin: 0 0 2.2em; + padding: 0 0 2.2em; +} +#author-avatar { + float: left; + margin-right: -78px; +} +#author-avatar img { + background: #fff; + -moz-border-radius: 3px; + border-radius: 3px; + -webkit-box-shadow: 0 1px 2px #bbb; + -moz-box-shadow: 0 1px 2px #bbb; + box-shadow: 0 1px 2px #bbb; + padding: 3px; +} +#author-description { + float: left; + margin-left: 108px; +} +#author-description h2 { + color: #000; + font-size: 15px; + font-weight: bold; + margin: 5px 0 10px; +} + +/* Comments link */ +.entry-header .comments-link a { + background: #eee url(images/comment-bubble.png) no-repeat; + color: #666; + font-size: 13px; + font-weight: normal; + line-height: 35px; + overflow: hidden; + padding: 0 0 0; + position: absolute; + top: 1.5em; + right: 0; + text-align: center; + text-decoration: none; + width: 43px; + height: 36px; +} +.entry-header .comments-link a:hover, +.entry-header .comments-link a:focus, +.entry-header .comments-link a:active { + background-color: #1982d1; + color: #fff; + color: rgba(255,255,255,0.8); +} +.entry-header .comments-link .leave-reply { + visibility: hidden; +} + +/* +Post Formats Headings +To hide the headings, display: none the ".entry-header .entry-format" selector, +and remove the padding rules below. +*/ +.entry-header .entry-format { + color: #666; + font-size: 10px; + font-weight: 500; + letter-spacing: 0.1em; + line-height: 2.6em; + position: absolute; + text-transform: uppercase; + top: -5px; +} +.entry-header hgroup .entry-title { + padding-top: 15px; +} +article.format-aside .entry-content, +article.format-link .entry-content, +article.format-status .entry-content { + padding: 20px 0 0; +} +article.format-status .entry-content { + min-height: 65px; +} +.recent-posts .entry-header .entry-format { + display: none; +} +.recent-posts .entry-header hgroup .entry-title { + padding-top: 0; +} + +/* Singular content styles for Posts and Pages */ +.singular .hentry { + border-bottom: none; + padding: 4.875em 0 0; + position: relative; +} +.singular.page .hentry { + padding: 3.5em 0 0; +} +.singular .entry-title { + color: #000; + font-size: 36px; + font-weight: bold; + line-height: 48px; +} +.singular .entry-title, +.singular .entry-header .entry-meta { + padding-right: 0; +} +.singular .entry-header .entry-meta { + position: absolute; + top: 0; + left: 0; +} +blockquote.pull { + font-size: 21px; + font-weight: bold; + line-height: 1.6125em; + margin: 0 0 1.625em; + text-align: center; +} +.singular blockquote.pull { + margin: 0 -22.25% 1.625em; +} +.pull.alignleft { + margin: 0 1.625em 0 0; + text-align: right; + width: 33%; +} +.singular .pull.alignleft { + margin: 0 1.625em 0 -22.25%; +} +.pull.alignright { + margin: 0 0 0 1.625em; + text-align: left; + width: 33%; +} +.singular .pull.alignright { + margin: 0 -22.25% 0 1.625em; +} +.singular blockquote.pull.alignleft, +.singular blockquote.pull.alignright { + width: 33%; +} +.singular .entry-meta .edit-link a { + bottom: auto; + left: 50px; + position: absolute; + right: auto; + top: 80px; +} + + +/* =Aside +----------------------------------------------- */ + +.format-aside .entry-title, +.format-aside .entry-header .comments-link { + display: none; +} +.singular .format-aside .entry-title { + display: block; +} +.format-aside .entry-content { + padding: 0; +} +.singular .format-aside .entry-content { + padding: 1.625em 0 0; +} + + +/* =Link +----------------------------------------------- */ + +.format-link .entry-title, +.format-link .entry-header .comments-link { + display: none; +} +.singular .format-link .entry-title { + display: block; +} +.format-link .entry-content { + padding: 0; +} +.singular .format-link .entry-content { + padding: 1.625em 0 0; +} + + +/* =Gallery +----------------------------------------------- */ + +.format-gallery .gallery-thumb { + float: left; + display: block; + margin: .375em 1.625em 0 0; +} + + +/* =Status +----------------------------------------------- */ + +.format-status .entry-title, +.format-status .entry-header .comments-link { + display: none; +} +.singular .format-status .entry-title { + display: block; +} +.format-status .entry-content { + padding: 0; +} +.singular .format-status .entry-content { + padding: 1.625em 0 0; +} +.format-status img.avatar { + -moz-border-radius: 3px; + border-radius: 3px; + -webkit-box-shadow: 0 1px 2px #ccc; + -moz-box-shadow: 0 1px 2px #ccc; + box-shadow: 0 1px 2px #ccc; + float: left; + margin: 4px 10px 2px 0; + padding: 0; +} + + +/* =Quote +----------------------------------------------- */ + +.format-quote blockquote { + color: #555; + font-size: 17px; + margin: 0; +} + + +/* =Image +----------------------------------------------- */ + +.indexed.format-image .entry-header { + min-height: 61px; /* Prevent the comment icon from colliding with the image when there is no title */ +} +.indexed.format-image .entry-content { + padding-top: 0.5em; +} +.indexed.format-image p, +.indexed.format-image p img { + margin-bottom: 0; +} +.indexed.format-image footer.entry-meta { + background: #ddd; + margin-top: -7px; + padding: 20px 30px; + overflow: hidden; +} +.indexed.format-image div.entry-meta { + display: inline-block; + float: left; + width: 35%; +} +.indexed.format-image div.entry-meta + div.entry-meta { + float: none; + width: 65%; +} +.indexed.format-image .entry-meta span.cat-links, +.indexed.format-image .entry-meta span.tag-links, +.indexed.format-image .entry-meta span.comments-link { + display: block; +} +.indexed.format-image footer.entry-meta a { + color: #444; +} +.indexed.format-image footer.entry-meta a:hover { + color: #fff; +} +#content .indexed.format-image img { + border: none; + max-width: 100%; + padding: 0; +} +.indexed.format-image .wp-caption { + background: #111; + margin-bottom: 0; + max-width: 96%; + padding: 11px; +} +.indexed.format-image .wp-caption .wp-caption-text { + color: #ddd; +} +.indexed.format-image .wp-caption .wp-caption-text:before { + color: #444; +} +.indexed.format-image a:hover img { + opacity: 0.8; +} + + +/* =error404 +----------------------------------------------- */ + +.error404 #main #searchform { + background: #f9f9f9; + border: 1px solid #ddd; + border-width: 1px 0; + margin: 0 -8.9% 1.625em; + overflow: hidden; + padding: 1.625em 8.9%; +} +.error404 #main #s { + width: 95%; +} +.error404 #main .widget { + clear: none; + float: left; + margin-right: 3.7%; + width: 30.85%; +} +.error404 #main .widget_archive { + margin-right: 0; +} +.error404 #main .widget_tag_cloud { + float: none; + margin-right: 0; + width: 100%; +} +.error404 .widgettitle { + font-size: 10px; + letter-spacing: 0.1em; + line-height: 2.6em; + text-transform: uppercase; +} + + +/* =Showcase +----------------------------------------------- */ + +h1.showcase-heading { + color: #666; + font-size: 10px; + font-weight: 500; + letter-spacing: 0.1em; + line-height: 2.6em; + text-transform: uppercase; +} + +/* Intro */ +article.intro { + background: #f9f9f9; + border-bottom: none; + margin: -1.855em -8.9% 1.625em; + padding: 0 8.9%; +} +article.intro .entry-title { + display: none; +} +article.intro .entry-content { + color: #111; + font-size: 16px; + padding: 1.625em 0 0.625em; +} +article.intro .edit-link a { + background: #aaa; + -moz-border-radius: 3px; + border-radius: 3px; + color: #fff; + font-size: 12px; + padding: 0 8px; + position: absolute; + top: 30px; + right: 20px; + text-decoration: none; +} +article.intro .edit-link a:hover, +article.intro .edit-link a:focus, +article.intro .edit-link a:active { + background: #777; +} + +/* Featured post */ +section.featured-post { + float: left; + margin: -1.625em -8.9% 1.625em; + padding: 1.625em 8.9% 0; + position: relative; + width: 100%; +} +section.featured-post .hentry { + border: none; + color: #666; + margin: 0; +} +section.featured-post .entry-meta { + clip: rect(1px 1px 1px 1px); /* IE6, IE7 */ + clip: rect(1px, 1px, 1px, 1px); + position: absolute !important; +} + +/* Small featured post */ +section.featured-post .attachment-small-feature { + float: right; + height: auto; + margin: 0 -8.9% 1.625em 0; + max-width: 59%; + position: relative; + right: -15px; +} +section.featured-post.small { + padding-top: 0; +} +section.featured-post .attachment-small-feature:hover, +section.featured-post .attachment-small-feature:focus, +section.featured-post .attachment-small-feature:active { + opacity: .8; +} +article.feature-image.small { + float: left; + margin: 0 0 1.625em; + width: 45%; +} +article.feature-image.small .entry-title { + line-height: 1.2em; +} +article.feature-image.small .entry-summary { + color: #555; + font-size: 13px; +} +article.feature-image.small .entry-summary p a { + background: #222; + color: #eee; + display: block; + left: -23.8%; + padding: 9px 26px 9px 85px; + position: relative; + text-decoration: none; + top: 20px; + width: 180px; + z-index: 1; +} +article.feature-image.small .entry-summary p a:hover { + background: #1982d1; + color: #eee; + color: rgba(255,255,255,0.8); +} + +/* Large featured post */ +section.feature-image.large { + border: none; + max-height: 288px; + padding: 0; + width: 100%; +} +section.feature-image.large .showcase-heading { + display: none; +} +section.feature-image.large .hentry { + border-bottom: none; + left: 9%; + margin: 1.625em 9% 0 0; + position: absolute; + top: 0; +} +article.feature-image.large .entry-title a { + background: #222; + background: rgba(0,0,0,0.8); + -moz-border-radius: 3px; + border-radius: 3px; + color: #fff; + display: inline-block; + font-weight: 300; + padding: .2em 20px; +} +section.feature-image.large:hover .entry-title a, +section.feature-image.large .entry-title:hover a { + background: #eee; + background: rgba(255,255,255,0.8); + color: #222; +} +article.feature-image.large .entry-summary { + display: none; +} +section.feature-image.large img { + display: block; + height: auto; + max-width: 117.9%; + padding: 0 0 6px; +} + +/* Featured Slider */ +.featured-posts { + border-bottom: 1px solid #ddd; + display: block; + height: 328px; + margin: 1.625em -8.9% 20px; + max-width: 1000px; + padding: 0; + position: relative; + overflow: hidden; +} +.featured-posts .showcase-heading { + padding-left: 8.9%; +} +.featured-posts section.featured-post { + background: #fff; + height: 288px; + left: 0; + margin: 0; + position: absolute; + top: 30px; + width: auto; +} +.featured-posts section.featured-post.large { + max-width: 100%; + overflow: hidden; +} +.featured-posts section.featured-post { + -webkit-transition-duration: 200ms; + -webkit-transition-property: opacity, visibility; + -webkit-transition-timing-function: ease; + -moz-transition-duration: 200ms; + -moz-transition-property: opacity, visibility; + -moz-transition-timing-function: ease; +} +.featured-posts section.featured-post { + opacity: 0; + visibility: hidden; +} +.featured-posts #featured-post-1 { + opacity: 1; + visibility: visible; +} +.featured-post .feature-text:after, +.featured-post .feature-image.small:after { + content: ' '; + background: -moz-linear-gradient(top, rgba(255,255,255,0) 0%, rgba(255,255,255,1) 100%); /* FF3.6+ */ + background: -webkit-gradient(linear, left top, left bottom, color-stop(0%,rgba(255,255,255,0)), color-stop(100%,rgba(255,255,255,1))); /* Chrome,Safari4+ */ + background: -webkit-linear-gradient(top, rgba(255,255,255,0) 0%,rgba(255,255,255,1) 100%); /* Chrome10+,Safari5.1+ */ + background: -o-linear-gradient(top, rgba(255,255,255,0) 0%,rgba(255,255,255,1) 100%); /* Opera11.10+ */ + background: -ms-linear-gradient(top, rgba(255,255,255,0) 0%,rgba(255,255,255,1) 100%); /* IE10+ */ + filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#00ffffff', endColorstr='#ffffff',GradientType=0 ); /* IE6-9 */ + background: linear-gradient(top, rgba(255,255,255,0) 0%,rgba(255,255,255,1) 100%); /* W3C */ + width: 100%; + height: 45px; + position: absolute; + top: 230px; +} +.featured-post .feature-image.small:after { + top: 253px; +} +#content .feature-slider { + top: 5px; + right: 8.9%; + overflow: visible; + position: absolute; +} +.feature-slider ul { + list-style-type: none; + margin: 0; +} +.feature-slider li { + float: left; + margin: 0 6px; +} +.feature-slider a { + background: #3c3c3c; + background: rgba(60,60,60,0.9); + -moz-border-radius: 12px; + border-radius: 12px; + -webkit-box-shadow: inset 1px 1px 5px rgba(0,0,0,0.5), inset 0 0 2px rgba(255,255,255,0.5); + -moz-box-shadow: inset 1px 1px 5px rgba(0,0,0,0.5), inset 0 0 2px rgba(255,255,255,0.5); + box-shadow: inset 1px 1px 5px rgba(0,0,0,0.5), inset 0 0 2px rgba(255,255,255,0.5); + display: block; + width: 14px; + height: 14px; +} +.feature-slider a.active { + background: #1982d1; + -webkit-box-shadow: inset 1px 1px 5px rgba(0,0,0,0.4), inset 0 0 2px rgba(255,255,255,0.8); + -moz-box-shadow: inset 1px 1px 5px rgba(0,0,0,0.4), inset 0 0 2px rgba(255,255,255,0.8); + box-shadow: inset 1px 1px 5px rgba(0,0,0,0.4), inset 0 0 2px rgba(255,255,255,0.8); + cursor: default; + opacity: 0.5; +} + +/* Recent Posts */ +section.recent-posts { + padding: 0 0 1.625em; +} +section.recent-posts .hentry { + border: none; + margin: 0; +} +section.recent-posts .other-recent-posts { + border-bottom: 1px solid #ddd; + list-style: none; + margin: 0; +} +section.recent-posts .other-recent-posts li { + padding: 0.3125em 0; + position: relative; +} +section.recent-posts .other-recent-posts .entry-title { + border-top: 1px solid #ddd; + font-size: 17px; +} +section.recent-posts .other-recent-posts a[rel="bookmark"] { + color: #373737; + float: left; + max-width: 84%; +} +section.recent-posts .other-recent-posts a[rel="bookmark"]:after { + content: '-'; + color: transparent; + font-size: 11px; +} +section.recent-posts .other-recent-posts a[rel="bookmark"]:hover { +} +section.recent-posts .other-recent-posts .comments-link a, +section.recent-posts .other-recent-posts .comments-link > span { + border-bottom: 2px solid #999; + bottom: -2px; + color: #444; + display: block; + font-size: 10px; + font-weight: 500; + line-height: 2.76333em; + padding: 0.3125em 0 0.3125em 1em; + position: absolute; + right: 0; + text-align: right; + text-transform: uppercase; + z-index: 1; +} +section.recent-posts .other-recent-posts .comments-link > span { + border-color: #bbb; + color: #888; +} +section.recent-posts .other-recent-posts .comments-link a:hover { + color: #1982d1; + border-color: #1982d1; +} +section.recent-posts .other-recent-posts li:after { + clear: both; + content: '.'; + display: block; + height: 0; + visibility: hidden; +} + + +/* =Attachments +----------------------------------------------- */ + +.image-attachment div.attachment { + background: #f9f9f9; + border: 1px solid #ddd; + border-width: 1px 0; + margin: 0 -8.9% 1.625em; + overflow: hidden; + padding: 1.625em 1.625em 0; + text-align: center; +} +.image-attachment div.attachment img { + display: block; + height: auto; + margin: 0 auto 1.625em; + max-width: 100%; +} +.image-attachment div.attachment a img { + border-color: #f9f9f9; +} +.image-attachment div.attachment a:focus img, +.image-attachment div.attachment a:hover img, +.image-attachment div.attachment a:active img { + border-color: #ddd; + background: #fff; +} +.image-attachment .entry-caption p { + font-size: 10px; + letter-spacing: 0.1em; + line-height: 2.6em; + margin: 0 0 2.6em; + text-transform: uppercase; +} + + +/* =Navigation +-------------------------------------------------------------- */ + +#content nav { + clear: both; + overflow: hidden; + padding: 0 0 1.625em; +} +#content nav a { + font-size: 12px; + font-weight: bold; + line-height: 2.2em; +} +#nav-above { + padding: 0 0 1.625em; +} +#nav-above { + display: none; +} +.paged #nav-above { + display: block; +} +.nav-previous { + float: left; + width: 50%; +} +.nav-next { + float: right; + text-align: right; + width: 50%; +} +#content nav .meta-nav { + font-weight: normal; +} + +/* Singular navigation */ +#nav-single { + float: right; + position: relative; + top: -0.3em; + text-align: right; + z-index: 1; +} +#nav-single .nav-previous, +#nav-single .nav-next { + float: none; + width: auto; +} +#nav-single .nav-next { + padding-left: .5em; +} + + +/* =Widgets +----------------------------------------------- */ + +.widget-area { + font-size: 12px; +} +.widget { + clear: both; + margin: 0 0 2.2em; +} +.widget-title { + color: #666; + font-size: 10px; + font-weight: 500; + letter-spacing: 0.1em; + line-height: 2.6em; + text-transform: uppercase; +} +.widget ul { + font-size: 15px; + margin: 0; +} +.widget ul ul { + margin-left: 1.5em; +} +.widget ul li { + color: #777; + font-size: 13px; +} +.widget a { + font-weight: bold; + text-decoration: none; +} +.widget a:hover, +.widget a:focus, +.widget a:active { + text-decoration: underline; +} + +/* Search Widget */ +.widget_search form { + margin: 0 0 1.625em; +} +.widget_search #s { + width: 77%; +} +.widget_search #searchsubmit { + background: #ddd; + border: 1px solid #ccc; + -webkit-box-shadow: inset 0px -1px 1px rgba(0, 0, 0, 0.09); + -moz-box-shadow: inset 0px -1px 1px rgba(0, 0, 0, 0.09); + box-shadow: inset 0px -1px 1px rgba(0, 0, 0, 0.09); + color: #888; + font-size: 13px; + line-height: 25px; + position: relative; + top: -2px; +} +.widget_search #searchsubmit:active { + background: #1982d1; + border-color: #0861a5; + -webkit-box-shadow: inset 0px 1px 1px rgba(0, 0, 0, 0.1); + -moz-box-shadow: inset 0px 1px 1px rgba(0, 0, 0, 0.1); + box-shadow: inset 0px 1px 1px rgba(0, 0, 0, 0.1); + color: #bfddf3; +} + +/* Ephemera Widget */ +section.ephemera ol, +.widget_twentyeleven_ephemera ol { + list-style: square; + margin: 5px 0 0; +} +.widget_twentyeleven_ephemera .widget-entry-title { + font-size: 15px; + font-weight: bold; + padding: 0; +} +.widget_twentyeleven_ephemera .comments-link a, +.widget_twentyeleven_ephemera .comments-link > span { + color: #666; + display: block; + font-size: 10px; + font-weight: 500; + line-height: 2.76333em; + text-transform: uppercase; +} +section.ephemera .entry-title .comments-link a:hover, +.widget_twentyeleven_ephemera .entry-title .comments-link a:hover { +} +section.ephemera .entry-title a span { + color: #29628d; +} + +/* Twitter */ +.widget_twitter li { + list-style-type: none; + margin-bottom: 14px; +} +.widget_twitter .timesince { + display: block; + font-size: 11px; + margin-right: -10px; + text-align: right; +} + +/* Widget Image */ +.widget_image img { + height: auto; + max-width: 100%; +} + +/* Calendar Widget */ + +.widget_calendar #wp-calendar { + color: #555; + width: 95%; + text-align: center; +} +.widget_calendar #wp-calendar caption, +.widget_calendar #wp-calendar td, +.widget_calendar #wp-calendar th { + text-align: center; +} +.widget_calendar #wp-calendar caption { + font-size: 11px; + font-weight: 500; + padding: 5px 0 3px 0; + text-transform: uppercase; +} +.widget_calendar #wp-calendar th { + background: #f4f4f4; + border-top: 1px solid #ccc; + border-bottom: 1px solid #ccc; + font-weight: bold; +} +.widget_calendar #wp-calendar tfoot td { + background: #f4f4f4; + border-top: 1px solid #ccc; + border-bottom: 1px solid #ccc; +} + + +/* =Comments +----------------------------------------------- */ + +#comments-title { + color: #666; + font-size: 10px; + font-weight: 500; + line-height: 2.6em; + padding: 0 0 2.6em; + text-transform: uppercase; +} +.nopassword, +.nocomments { + color: #aaa; + font-size: 24px; + font-weight: 100; + margin: 26px 0; + text-align: center; +} +.commentlist { + list-style: none; + margin: 0 auto; + width: 68.9%; +} +.content .commentlist, +.page-template-sidebar-page-php .commentlist { + width: 100%; /* reset the width for the one-column and sidebar page layout */ +} +.commentlist > li.comment { + background: #f6f6f6; + border: 1px solid #ddd; + -moz-border-radius: 3px; + border-radius: 3px; + margin: 0 0 1.625em; + padding: 1.625em; + position: relative; +} +.commentlist .pingback { + margin: 0 0 1.625em; + padding: 0 1.625em; +} +.commentlist .children { + list-style: none; + margin: 0; +} +.commentlist .children li.comment { + background: #fff; + border-left: 1px solid #ddd; + -moz-border-radius: 0 3px 3px 0; + border-radius: 0 3px 3px 0; + margin: 1.625em 0 0; + padding: 1.625em; + position: relative; +} +.commentlist .children li.comment .fn { + display: block; +} +.comment-meta .fn { + font-style: normal; +} +.comment-meta { + color: #666; + font-size: 12px; + line-height: 2.2em; +} +.commentlist .children li.comment .comment-meta { + line-height: 1.625em; + margin-left: 50px; +} +.commentlist .children li.comment .comment-content { + margin: 1.625em 0 0; +} +.comment-meta a { + font-weight: bold; +} +.comment-meta a:focus, +.comment-meta a:active, +.comment-meta a:hover { +} +.commentlist .avatar { + -moz-border-radius: 3px; + border-radius: 3px; + -webkit-box-shadow: 0 1px 2px #ccc; + -moz-box-shadow: 0 1px 2px #ccc; + box-shadow: 0 1px 2px #ccc; + left: -102px; + padding: 0; + position: absolute; + top: 0; +} +.commentlist > li:before { + content: url(images/comment-arrow.png); + left: -21px; + position: absolute; +} +.commentlist > li.pingback:before { + content: ''; +} +.commentlist .children .avatar { + background: none; + -webkit-box-shadow: none; + -moz-box-shadow: none; + box-shadow: none; + left: 2.2em; + padding: 0; + top: 2.2em; +} +a.comment-reply-link { + background: #eee; + -moz-border-radius: 3px; + border-radius: 3px; + color: #666; + display: inline-block; + font-size: 12px; + padding: 0 8px; + text-decoration: none; +} +a.comment-reply-link:hover, +a.comment-reply-link:focus, +a.comment-reply-link:active { + background: #888; + color: #fff; +} +a.comment-reply-link > span { + display: inline-block; + position: relative; + top: -1px; +} + +/* Post author highlighting */ +.commentlist > li.bypostauthor { + background: #ddd; + border-color: #d3d3d3; +} +.commentlist > li.bypostauthor .comment-meta { + color: #575757; +} +.commentlist > li.bypostauthor .comment-meta a:focus, +.commentlist > li.bypostauthor .comment-meta a:active, +.commentlist > li.bypostauthor .comment-meta a:hover { +} +.commentlist > li.bypostauthor:before { + content: url(images/comment-arrow-bypostauthor.png); +} + +/* Post Author threaded comments */ +.commentlist .children > li.bypostauthor { + background: #ddd; + border-color: #d3d3d3; +} + +/* sidebar-page.php comments */ +/* Make sure we have room for our comment avatars */ +.page-template-sidebar-page-php .commentlist > li.comment, +.page-template-sidebar-page-php.commentlist .pingback { + margin-left: 102px; + width: auto; +} +/* And a full-width comment form */ +.page-template-sidebar-page-php #respond { + width: auto; +} + +/* Comment Form */ +#respond { + background: #ddd; + border: 1px solid #d3d3d3; + -moz-border-radius: 3px; + border-radius: 3px; + margin: 0 auto 1.625em; + padding: 1.625em; + position: relative; + width: 68.9%; +} +#respond input[type="text"], +#respond textarea { + background: #fff; + border: 4px solid #eee; + -moz-border-radius: 5px; + border-radius: 5px; + -webkit-box-shadow: inset 0 1px 3px rgba(204,204,204,0.95); + -moz-box-shadow: inset 0 1px 3px rgba(204,204,204,0.95); + box-shadow: inset 0 1px 3px rgba(204,204,204,0.95); + position: relative; + padding: 10px; + text-indent: 80px; +} +#respond .comment-form-author, +#respond .comment-form-email, +#respond .comment-form-url, +#respond .comment-form-comment { + position: relative; +} +#respond .comment-form-author label, +#respond .comment-form-email label, +#respond .comment-form-url label, +#respond .comment-form-comment label { + background: #eee; + -webkit-box-shadow: 1px 2px 2px rgba(204,204,204,0.8); + -moz-box-shadow: 1px 2px 2px rgba(204,204,204,0.8); + box-shadow: 1px 2px 2px rgba(204,204,204,0.8); + color: #555; + display: inline-block; + font-size: 13px; + left: 4px; + min-width: 60px; + padding: 4px 10px; + position: relative; + top: 40px; + z-index: 1; +} +#respond input[type="text"]:focus, +#respond textarea:focus { + text-indent: 0; + z-index: 1; +} +#respond textarea { + resize: vertical; + width: 95%; +} +#respond .comment-form-author .required, +#respond .comment-form-email .required { + color: #bd3500; + font-size: 22px; + font-weight: bold; + left: 75%; + position: absolute; + top: 45px; + z-index: 1; +} +#respond .comment-notes, +#respond .logged-in-as { + font-size: 13px; +} +#respond p { + margin: 10px 0; +} +#respond .form-submit { + float: right; + margin: -20px 0 10px; +} +#respond input#submit { + background: #222; + border: none; + -moz-border-radius: 3px; + border-radius: 3px; + -webkit-box-shadow: 0px 1px 2px rgba(0,0,0,0.3); + -moz-box-shadow: 0px 1px 2px rgba(0,0,0,0.3); + box-shadow: 0px 1px 2px rgba(0,0,0,0.3); + color: #eee; + cursor: pointer; + font-size: 15px; + margin: 20px 0; + padding: 5px 42px 5px 22px; + position: relative; + left: 30px; + text-shadow: 0 -1px 0 rgba(0,0,0,0.3); +} +#respond input#submit:active { + background: #1982d1; + color: #bfddf3; +} +#respond #cancel-comment-reply-link { + color: #666; + margin-left: 10px; + text-decoration: none; +} +#respond .logged-in-as a:hover, +#respond #cancel-comment-reply-link:hover { + text-decoration: underline; +} +.commentlist #respond { + margin: 1.625em 0 0; + width: auto; +} +#reply-title { + color: #373737; + font-size: 24px; + font-weight: bold; + line-height: 30px; +} +#cancel-comment-reply-link { + color: #888; + display: block; + font-size: 10px; + font-weight: normal; + line-height: 2.2em; + letter-spacing: 0.05em; + position: absolute; + right: 1.625em; + text-decoration: none; + text-transform: uppercase; + top: 1.1em; +} +#cancel-comment-reply-link:focus, +#cancel-comment-reply-link:active, +#cancel-comment-reply-link:hover { + color: #ff4b33; +} +#respond label { + line-height: 2.2em; +} +#respond input[type=text] { + display: block; + height: 24px; + width: 75%; +} +#respond p { + font-size: 12px; +} +p.comment-form-comment { + margin: 0; +} +.form-allowed-tags { + display: none; +} + + +/* =Footer +----------------------------------------------- */ + +#colophon { + clear: both; +} +#supplementary { + border-top: 1px solid #ddd; + padding: 1.625em 7.6%; + overflow: hidden; +} + +/* Two Footer Widget Areas */ +#supplementary.two .widget-area { + float: left; + margin-right: 3.7%; + width: 48.1%; +} +#supplementary.two .widget-area + .widget-area { + margin-right: 0; +} + +/* Three Footer Widget Areas */ +#supplementary.three .widget-area { + float: left; + margin-right: 3.7%; + width: 30.85%; +} +#supplementary.three .widget-area + .widget-area + .widget-area { + margin-right: 0; +} + +/* Site Generator Line */ +#site-generator { + background: #f9f9f9; + border-top: 1px solid #ddd; + color: #666; + font-size: 12px; + line-height: 2.2em; + padding: 2.2em 0.5em; + text-align: center; +} +#site-generator a { + color: #555; + font-weight: bold; +} +#site-generator .sep { + background: url(images/wordpress.png) center left no-repeat; + color: transparent; + display: inline-block; + height: 16px; + line-height: 16px; + margin: 0 7px; + width: 16px; +} + + +/* =Responsive Structure +----------------------------------------------- */ + +@media (max-width: 800px) { + /* Simplify the basic layout */ + #main #content { + margin: 0 7.6%; + width: auto; + } + #nav-below { + border-bottom: 1px solid #ddd; + margin-bottom: 1.625em; + } + #main #secondary { + float: none; + margin: 0 7.6%; + width: auto; + } + /* Simplify the showcase template */ + .page-template-showcase-php .featured-posts { + min-height: 280px; + } + .featured-posts section.featured-post { + height: auto; + } + .page-template-showcase-php section.recent-posts { + float: none; + margin: 0; + width: 100%; + } + .page-template-showcase-php #main .widget-area { + float: none; + margin: 0; + width: auto; + } + .page-template-showcase-php .other-recent-posts { + border-bottom: 1px solid #ddd; + } + /* Simplify the showcase template when small feature */ + section.featured-post .attachment-small-feature, + .one-column section.featured-post .attachment-small-feature { + border: none; + display: block; + float: left; + height: auto; + margin: 0.625em auto 1.025em; + max-width: 30%; + position: static; + } + article.feature-image.small { + float: right; + margin: 0 0 1.625em; + width: 64%; + } + .one-column article.feature-image.small .entry-summary { + height: auto; + } + article.feature-image.small .entry-summary p a { + left: 0; + padding-left: 20px; + padding-right: 20px; + width: auto; + } + /* Remove the margin on singular articles */ + .singular .entry-header, + .singular .entry-content, + .singular footer.entry-meta, + .singular #comments-title { + width: 100%; + } + /* Simplify the pullquotes and pull styles */ + .singular blockquote.pull { + margin: 0 0 1.625em; + } + .singular .pull.alignleft { + margin: 0 1.625em 0 0; + } + .singular .pull.alignright { + margin: 0 0 0 1.625em; + } + .singular .entry-meta .edit-link a { + left: 0; + position: absolute; + top: 40px; + } + .singular #author-info { + margin: 2.2em -8.8% 0; + padding: 20px 8.8%; + } + /* Make sure we have room for our comment avatars */ + .commentlist { + width: 100%; + } + .commentlist > li.comment, + .commentlist .pingback { + margin-left: 102px; + width: auto; + } + /* And a full-width comment form */ + #respond { + width: auto; + } + /* No need to float footer widgets at this size */ + #colophon #supplementary .widget-area { + float: none; + margin-right: 0; + width: auto; + } + /* No need to float 404 widgets at this size */ + .error404 #main .widget { + float: none; + margin-right: 0; + width: auto; + } + +} +@media (max-width: 650px) { + /* @media (max-width: 650px) Reduce font-sizes for better readability on smaller devices */ + body, input, textarea { + font-size: 13px; + } + #site-title a { + font-size: 24px; + } + #site-description { + font-size: 12px; + } + #access ul { + font-size: 12px; + } + article.intro .entry-content { + font-size: 12px; + } + .entry-title { + font-size: 21px; + } + .featured-post .entry-title { + font-size: 14px; + } + .singular .entry-title { + font-size: 28px; + } + .entry-meta { + font-size: 12px; + } + blockquote { + margin: 0; + } + blockquote.pull { + font-size: 17px; + } + /* Reposition the site title and description slightly */ + #site-title { + padding: 5.30625em 0 0; + } + #site-title, + #site-description { + margin-right: 0; + } + /* Make sure the logo and search form don't collide */ + #branding #searchform { + top: 1.625em !important; + } + /* Floated content doesn't work well at this size */ + .alignleft, + .alignright { + float: none; + margin-left: 0; + margin-right: 0; + } + /* Make sure the post-post navigation doesn't collide with anything */ + #nav-single { + display: block; + position: static; + } + .singular .hentry { + padding: 1.625em 0 0; + } + .singular.page .hentry { + padding: 1.625em 0 0; + } + /* Talking avatars take up too much room at this size */ + .commentlist > li.comment, + .commentlist > li.pingback { + margin-left: 0 !important; + } + .commentlist .avatar { + background: transparent; + display: block; + padding: 0; + position: static; + } + .commentlist .children .avatar { + background: none; + left: 2.2em; + padding: 0; + position: absolute; + top: 2.2em; + } + /* Use the available space in the smaller comment form */ + #respond input[type="text"] { + width: 95%; + } + #respond .comment-form-author .required, + #respond .comment-form-email .required { + left: 95%; + } + #content .gallery-columns-3 .gallery-item { + width: 31%; + padding-right: 2%; + } + #content .gallery-columns-3 .gallery-item img { + width: 100%; + height: auto; + } + +} +@media (max-width: 450px) { + #content .gallery-columns-2 .gallery-item { + width: 45%; + padding-right: 4%; + } + #content .gallery-columns-2 .gallery-item img { + width: 100%; + height: auto; + } + +} +@media only screen and (min-device-width: 320px) and (max-device-width: 480px) { + body { + padding: 0; + } + #page { + margin-top: 0; + } + #branding { + border-top: none; + } + +} + + +/* =Print +----------------------------------------------- */ + +@media print { + body { + background: none !important; + font-size: 10pt; + } + footer.entry-meta a[rel=bookmark]:link:after, + footer.entry-meta a[rel=bookmark]:visited:after { + content: " [" attr(href) "] "; /* Show URLs */ + } + #page { + clear: both !important; + display: block !important; + float: none !important; + max-width: 100%; + position: relative !important; + } + #branding { + border-top: none !important; + padding: 0; + } + #branding hgroup { + margin: 0; + } + #site-title a { + font-size: 21pt; + } + #site-description { + font-size: 10pt; + } + #branding #searchform { + display: none; + } + #branding img { + display: none; + } + #access { + display: none; + } + #main { + border-top: none; + box-shadow: none; + } + #primary { + float: left; + margin: 0; + width: 100%; + } + #content { + margin: 0; + width: auto; + } + .singular #content { + margin: 0; + width: 100%; + } + .singular .entry-header .entry-meta { + position: static; + } + .entry-meta .edit-link a { + display: none; + } + #content nav { + display: none; + } + .singular .entry-header, + .singular .entry-content, + .singular footer.entry-meta, + .singular #comments-title { + margin: 0; + width: 100%; + } + .singular .hentry { + padding: 0; + } + .entry-title, + .singular .entry-title { + font-size: 21pt; + } + .entry-meta { + font-size: 10pt; + } + .entry-header .comments-link { + display: none; + } + .page-link { + display: none; + } + .singular #author-info { + background: none; + border-bottom: none; + border-top: none; + margin: 2.2em 0 0; + padding: 0; + } + #respond { + display: none; + } + .widget-area { + display: none; + } + #colophon { + display: none; + } + + /* Comments */ + .commentlist > li.comment { + background: none; + border: 1px solid #ddd; + -moz-border-radius: 3px 3px 3px 3px; + border-radius: 3px 3px 3px 3px; + margin: 0 auto 1.625em; + padding: 1.625em; + position: relative; + width: auto; + } + .commentlist .avatar { + height: 39px; + left: 2.2em; + top: 2.2em; + width: 39px; + } + .commentlist li.comment .comment-meta { + line-height: 1.625em; + margin-left: 50px; + } + .commentlist li.comment .fn { + display: block; + } + .commentlist li.comment .comment-content { + margin: 1.625em 0 0; + } + .commentlist .comment-edit-link { + display: none; + } + .commentlist > li::before, + .commentlist > li.bypostauthor::before { + content: ''; + } + .commentlist .reply { + display: none; + } + + /* Post author highlighting */ + .commentlist > li.bypostauthor { + color: #444; + } + .commentlist > li.bypostauthor .comment-meta { + color: #666; + } + .commentlist > li.bypostauthor:before { + content: none; + } + + /* Post Author threaded comments */ + .commentlist .children > li.bypostauthor { + background: #fff; + border-color: #ddd; + } + .commentlist .children > li.bypostauthor > article, + .commentlist .children > li.bypostauthor > article .comment-meta { + color: #666; + } + +} + + +/* =IE7 +----------------------------------------------- */ + +#ie7 article.intro { + margin-left: -7.6%; + margin-right: -7.6%; + padding-left: -7.6%; + padding-right: -7.6%; + max-width: 1000px; +} +#ie7 section.featured-post { + margin-left: -7.6%; + margin-right: -7.6%; + max-width: 850px; +} +#ie7 section.recent-posts { + margin-right: 7.6%; } \ No newline at end of file